共查询到20条相似文献,搜索用时 546 毫秒
1.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev S. A. Kozyukhin 《Russian Journal of Inorganic Chemistry》2013,58(10):1187-1192
The coordination compounds [CoL2Cl2] (I) and [CdL2(H2O)2(NO3)2] (II) have been synthesized by the reaction of CoCl2 · 6H2O and Cd(NO3)2 · 4H2O with L = 2-amino-4-methylpyrimidine (Ampym, C5H7N3), and their structures have been solved. The crystals of complex I are triclinic, space group $P\bar 1$ , a = 5.627(1) Å, b = 11.191(1) Å, c = 12.445(1) Å, α = 81.00(1)°, β = 77.21(1)°, γ = 76.18(1)°, V = 737.7(2) Å3, ρcalcd = 1.567 g/cm3, Z = 2. The crystals of complex II are monoclinic, space group P21/c, a = 10.390(1) Å, b = 11.982(1) Å, c = 7.624(1) Å, β = 102.61(1)°, V = 926.1(2) Å3, ρcalcd = 1.760 g/cm3, Z = 2. Discrete [CoL2Cl2] moieties are realized in the structure of complex I. The cobalt atom is tetrahedrally coordinated to the two nitrogen atoms of crystallographically nonequivalent ligands L and two chlorine atoms (Co(1)-Navg, 2.051(4)Å; Co(1)-Cl(1), 2.241(1) Å; Co(1)-Cl(2), 2.263 Å; bond angles at the cobalt atom lie within a range of 102.1°–118.6°). The complexes are linked into supramolecular zigzag chains by N-H...N(Cl) hydrogen bonds. In the structure of complex II, the Cd2+ ion (at the inversion center) is coordinated in pairs to the nitrogen atoms of ligand L and the O(NO3) and O(H2O) oxygen atoms. The coordination of the Cd2+ ion is distorted octahedral (Cd(1)-N(1), 2.341Å; Cd(1)-O(1), 2.340(4) Å; Cd(1)-O(4), 2.327(3) Å; bond angles at the cadmium atom lie within a range of 79.1°–100.9°). N-H...N hydrogen bonds link the complexes into supramolecular chains. These chains are linked into a supramolecular framework by the O-H...O hydrogen bonds between water molecules and NO3 groups. 相似文献
2.
V. V. Gorincioy Yu. A. Simonov S. G. Shova V. N. Shofranskii C. I. Turta 《Journal of Structural Chemistry》2009,50(6):1143-1148
Heterometallic complexes [CuSr(SalH)4(DMAA)4(H2O)] (II) and [CuBa(SalH)4(DMAA)4 (H2O)] (III) were synthesized by interaction of salicylates of s elements with copper nitrate. A mixture of III and vanadyl sulfate yielded the crystals of a homonuclear complex [CuCu(SalH)4(H2O)2]·2DMAA (I). According to single crystal X-ray data, all of the products are of lantern type and belong to two space groups: I is triclinic, space group P-1, unit cell parameters a = 9.9083(2) Å, b = 10.5077(3) Å, c = 10.9512(3) Å, α = 112.736(2)°, β = 114.0800(10)°, γ = 93.131°; II and III are tetragonal, space group P4/n, lattice parameters a = b = 16.3180(3) Å, c = 8.7838(2) Å for II and a = b = 16.362(3) Å, c = 8.920(1) Å III. The copper atoms have a square-pyramidal environment. The coordination number of Sr and Ba is 8, and the coordination polyhedron can be represented as a Thomson cube in both cases. The carboxylic groups are coordinated in a syn-syn bridging mode. The oxygen atom of the hydroxyl group of salicylic acid is not involved in coordination, but forms intramolecular hydrogen bonds to the carboxylic groups. The hydrogen bonds between water and DMAA solvate molecules, as well as — interactions between the aromatic fragments of the dimers, play a particularly important role in the molecular packing in crystal. 相似文献
3.
E. E. Martsinko L. Kh. Minacheva I. I. Seifullina E. A. Chebanenko V. S. Sergienko A. V. Churakov 《Russian Journal of Inorganic Chemistry》2013,58(2):152-159
A synthetic procedure was developed, and heteropolynuclear coordination compounds—the products of the interaction of germanium tetrachloride with xylaric (trihydroxyglutaric) acid HOOC-CH(OH)-CH(OH)-CH(OH)-COOH (H5L) and the acetates of the 3d metals Mn(II) and Co(II)—were prepared. The compounds were characterized by elemental analysis, thermogravimetry, and IR spectroscopy. The X-ray diffraction analysis of the [M(H2O)6][Ge(μ3-L)2{M(H2O)2}2] · 4H2O · nCH3CN complexes, where M = Co, n = 0 (I) and M = Mn, n = 1 (II), was performed. The crystals of I are monoclinic, a = 10.752(2) Å, b = 11.830(2) Å, and c = 10.772(2) Å, β = 94.741(3)°, V = 1365.4(5) Å3, Z = 2, space group P21/n, R1 = 0.0309 for 3200 reflections with I > 2σ(I). The crystals of II are triclinic, a = 9.5330(17) Å, b = 9.7415(17) Å, and c = 10.3935(18) Å, α = 115.024(2)°, β = 97.580(3)°, γ = 111.535(3)°, V = 764.9(2)Å3, Z = 1, space group $P\bar 1$ , R1 = 0.0621 for 3028 reflections with I > 2σ(I). The bimetallic anions [Ge(μ3-L)2{M(H2O)2}2]2?, the cations [M(H2O)6]2+, and crystal water molecules form the basis of compounds I and II (the acetonitrile molecule is also a constituent of compound II). In the centrally symmetrical trinuclear complex anion, the Ge(1) atom is bound to two M(1) atoms through two completely deprotonated bridging ligands. The Ge(1) atom is coordinated to the six alcohol oxygen atoms of two ligands L5? at the apexes of a distorted octahedron (the average Ge(1)-O distances in I and II are 1.8858(14) and 1.892(3)Å, respectively). The coordination polyhedron of the M(1) atom in the complex anion is a strongly distorted octahedron. The base of the coordination polyhedron is formed by the two bridging alcohol oxygen atoms (the average M(1)-O distances in I and II are 2.1756(14) and 2.255(3) Å, respectively) of two L5? ligands and by the oxygen atoms of two water molecules (the average M(1)-O distances in I and II are 2.0693(17) and 2.175(4) Å, respectively). In the centrally symmetrical complex cation, the coordination polyhedron of the M(2) atom is a somewhat distorted octahedron. The M(2)-O(H2O) bond lengths in I and II vary in the ranges of 2.0137(17)-2.1555(17) and 2.140(5)-2.172(4) Å, respectively (the average lengths are 2.0375(17) and 2.166(4) Å, respectively). The cations and anions are joined by a branched system of hydrogen bonds. 相似文献
4.
The crystal structures of cesium 2-thiobarbiturate C4H3CsN2O2S (I) and rubidium 2-thiobarbiturate C4H3N2O2RbS (II) (C4H4N2O2S is 2-thiobarbituric acid, H2TBA) have been determined. Isostructural crystals are monoclinic; a = 7.9609(3) Å,b = 11.8474(3) Å, c = 7.7317(2) Å, β = 101.285(3)°, V = 715.13(4) Å3, space group C2/m, Z = 4 for I and a = 7.6369(2) Å, b = 11.7690(3) Å, c = 7.5568(2) Å, β = 100.212(1)°, V = 668.44(3) Å3, space group C2/m, Z = 4 for II. Each metal ion in complexes I and II is bonded to four oxygen atoms and two sulfur atoms at the vertices of a six-vertex polyhedron. N-H…O hydrogen bonds link HTBA-ions into chains. The structure is also stabilized by the “head-to-tail” π-π interaction of HTBA-ions. 相似文献
5.
A. V. Noshchenko Yu. I. Slyvka A. V. Pavlyuk M. G. Mys’kiv 《Russian Journal of Coordination Chemistry》2010,36(8):585-590
Reactions of a solution of AgNO3 in aqueous methanol with solutions of 1,4-diallylpiperazine (acidified with HNO3 to pH = 4) and 1-allyloxybenzotriazole in ethanol gave the crystalline silver(I) π-complexes [Ag2(C4H8N2(C3H5)2(H+)2)(H2O)2(NO3)2](NO3)2 (I) and [Ag(C6H4N3(OC3H5)(NO3))] (II). Their crystal structures were determined by X-ray diffraction. Crystals of complexes I and II are monoclinic, space group P21/c; for I: a = 7.053(3)Å, b = 9.389(3)Å, c = 15.488(4)Å, β = 91.60°, V = 1025.3(6)Å3, Z = 4; for II: a = 10.650(4)Å, b = 15.062(5)Å, c = 7.412(4)Å, β = 104.20(3)°, V = 1152.6(8)Å3, Z = 4. In both structures, the organic components act as bidentate ligands forming with AgNO3 34- and 14-membered topological rings, respectively. In complex I, the nearly tetrahedral environment of the Ag(I) atom is made up of the olefinic C=C bond, the O atoms of the nitrate anions, and the water molecule. 1-Allyloxybenzotriazole in structure II causes the deformation of the coordination polyhedron of Ag into a trigonal pyramid via inclusion of the ligand N atom in its coordination sphere. The topological units of the complexes form infinite polymer layers linked by anionic NO 3 ? bridges. In structure I, these layers are united through a system of hydrogen bonds into a three-dimensional framework. 相似文献
6.
G. V. Noshchenko N. F. Salivon B. Zarychta V. V. Olijnyk 《Journal of Structural Chemistry》2013,54(1):129-133
Alternating-current electrochemical synthesis is used to obtain for the first time halogenocuprates of an allyl derivative of phosphonium of the composition (CH2=CHCH2(C6H5)3P)CuX2 (X = Br (I), Cl (II)). Compound I crystallizes in the space group P21, a = 9.6341(3) Å, b = 12.4167(4) Å, c = 9.9618(4) Å, β = 117.484(5)°, Z = 2. Compound II crystallizes in the space group P21/n, a = 9.9725(5) Å, b = 15.4586(8) Å, c = 13.7557(5) Å, β = 90.429(4)°, Z = 4. In the structures of I and II quasilinear CuX 2 ? anions are held by C-H…X hydrogen bonds inside a framework formed by the stacking of phenyl groups from CH2=CHCH2(C6P5)3P+ cations. Allyl groups are not involved in coordination with copper(I) atoms. 相似文献
7.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev S. A. Kozyukhin 《Russian Journal of Coordination Chemistry》2013,39(8):565-570
Reactions of AgReO4 and AgCH3SO3 with L = 2-amino-4-methylpyrimidine (Ampym, C5H7N3) in a ratio of 1: 2 in acetonitrile gave the complexes [AgL2(ReO4)] (I) and [AgL2(CH3SO3)] (II). Their structures were determined. The crystals of complex I are monoclinic, space group C2/c, a = 5.985(1), b = 3.465(1), c = 19.071(1) Å, β = 96.52(1)°, V = 1527.0(3) Å3, ρcalcd = 2.507 g/cm3, Z = 4. The crystals of complex II are orthorhombic, space group Pbca, a = 14.784(1), b = 11.991(1), c = 17.711(1) Å, V = 3139.7(4) Å3, ρcalcd= 1.782 g/cm3, Z = 8. Structure I shows discrete cationic complexes [AgL2]+. The silver atom is virtually linearly coordinated to two N atoms of crystallographically equivalent ligands L (Ag-N, 2.156(4) Å; the angle NAgN, 174.7(4)°). The complex cations are united into zigzag chains through the hydrogen bonds N-H...N. The resulting chains are linked by the hydrogen bonds N-H...O to uncoordinated perrhenate anions to form 2D supramolecular layers. In structure II, the Ag+ ion is coordinated by two crystallographically non-equivalent ligands L in a distorted linear fashion: Ag(1)-N(1), 2.166(7) Å;Ag(1)-N(4), 2.181(6) Å; the angle NAgN, 157.2(2)°. The anions CH3SO3 ? are weakly linked to the Ag+ ions (Ag...O 2.72 Å) and are hydrogen-bonded to the complex cations [AgL2]+, uniting them into supramolecular ribbons. 相似文献
8.
A. V. Oreshkina G. Z. Kaziev A. V. Steblevskii 《Russian Journal of Inorganic Chemistry》2009,54(7):1018-1022
Tetraamminecobalt hydrogen hexamolybdoferrate [Co(NH3)4] · H[FeMo6O18(OH)6] · 6H2O (I) and tetraamminecobalt hydrogen hexamolybdogallate(III) [Co(NH3)4] · H[GaMo6O18(OH)6] · 6H2O (II) were synthesized and studied by mass spectrometry, thermogravimetry, IR spectroscopy, and X-ray diffraction. Crystals of I and II are monoclinic; a = 16.21 Å, b = 5.43 Å, c = 12.32 Å, β = 119.63°, V = 1092.11 Å3, ρcalcd = 2.21 g/cm3, and Z = 1 for I; a = 16.24 Å, b = 5.59 Å, c = 12.29 Å, β = 119.79°, V = 1064.05 Å3, ρcalcd = 2.15 g/cm3, and Z = 1 for II. Compounds I and II were used as catalysts for soft oxidation of natural gas. 相似文献
9.
K. K. Palkina A. N. Kochetov E. V. Savinkina L. Yu. Alikberova 《Russian Journal of Inorganic Chemistry》2006,51(11):1743-1749
An Ag(I) complex with HL (I), AgL (AgC23H15O3, II), has been synthesized. Compounds I and II have been studied by X-ray diffraction. The crystals are monoclinic, I: space group P21/n, a = 10.459(2) Å, b = 12.354(2) Å, c = 13.390(3) Å, β = 96.67(3)°, Z = 4; II: space group P21/c, a = 10.764(2) Å, b = 10.683(2) Å, c = 15.939(3) Å, β = 101.57(3)°, Z = 4. The structural units of the crystal of I are neutral molecules with intramolecular hydrogen bonds. In structure II, the Ag2O6 dimeric groups and the ligands form infinite openwork layers perpendicular to the x axis and containing cavities. The layers are penetrated by channels with an oblong cross section. In the crystal of II, all intermolecular distances exceed the sums of the van der Waals radii of the corresponding atoms. 相似文献
10.
Yu. M. Chumakov N. M. Samus’ G. Bocelli K. Yu. Suponitskii V. I. Tsapkov A. P. Gulya 《Russian Journal of Coordination Chemistry》2006,32(1):14-20
3-Phenylpropenal thiosemicarbazone hydrate C6H5-HC=CH-CH=N-NH-C(S)-NH2 · H2O (HL · H2O, I) and two chelates [Ni(L)2] · nCH3OH (II) and [Zn(L)2] (III) are studied by X-ray diffraction. The crystals of I are orthorhombic: a = 6.227(1) Å, b = 7.763(2) Å, c = 25.585(5) Å, β = 90°, space group P212121, Z = 4, R = 0.0426. A nonplanar molecule of I has an E conformation. The crystals of II are triclinic: a = 6.551(2) Å, b = 10.752(3) Å, c = 10.885(3) Å, α = 64.751(5)°, β = 82.753(5)°, γ = 89.857(5)°, space group, Z = 1, R = 0.0661. In a centrosymmetric molecule of II, the central atom coordinates two deprotonated ligands L through the immine nitrogen atom and thioamide sulfur atom at the vertices of a distorted square. The crystals of III are monoclinic: a = 25.342(2) Å, b = 9.150(2) Å, c = 21.340(3) Å, α = 90°, β = 111.84(2)°, γ = 90°, space group C2/c, Z = 8, R = 0.0556. In a molecule of complex III, two deprotonated bidentate ligands L are coordinated by the zinc ion through the immine nitrogen atoms and thioamide sulfur atoms to form a distorted tetrahedron at the central atom. In both II and III, ligand L after coordination by the metal ion changes the E conformation with respect to the N(1)-C(2) bond for the Z conformation. In crystals I-III, molecules are packed to form infinite layers parallel to the planes (001) and (010). 相似文献
11.
S. I. Gutnikov E. V. Karpova M. A. Zakharov A. I. Boltalin 《Russian Journal of Inorganic Chemistry》2006,51(4):541-548
Thulium trifluoroacetate compounds have been synthesized, Tm(CF3COO)3 · 3H2O (I) and Tm2(CF3COO)6 · 2CF3COOH · 3H2O (II). The structure of I has been refined by the Rietveld method on the basis of the structural data for Cd(CF3COO)3 · 3H2O. The structure of II has been solved in a single-crystal X-ray diffraction study. Compound I has been studied by thermal analysis. Crystals of I and II are monoclinic: for I a = 9.062(2) Å, b = 18.678(3) Å, c = 9.687(2) Å, β = 113.93(1)°, Z = 2, space group P21/c, R 1 = 0.062; for II a = 8.560(4) Å, b = 19.866(5) Å, c = 20.813(7) Å, β = 101.69(4)°, Z = 8, space group C2/c, R 1 = 0.0392. In the molecular structure of I, thulium atoms are bonded in pairs through four bridging trifluoroacetate anions to form dimers. The coordination polyhedron of the thulium atom also includes the three O atoms of the water molecules and the O atom of the monodentate trifluoroacetate group; the coordination number of the thulium atom is eight. In the chain structure of II, there are two crystallographically independent thulium atoms with coordination numbers 8 and 9. The coordination polyhedra of the Tm(1) and Tm(2) atoms are a distorted monocapped tetragonal antiprism and a distorted tetragonal antiprism, respectively. The Tm-O bond lengths are in the range 2.28(1)–2.85(2) Å. The thulium atoms are bound into chains through carboxylate groups. These chains are linked into layers through hydrogen bonds. 相似文献
12.
J. M. Ashurov B. T. Ibragimov N. S. Mukhamedov 《Russian Journal of Coordination Chemistry》2014,40(4):246-250
The results of syntheses and X-ray diffraction analyses of mononuclear complexes [ML2(H2O)4] (M = Co2+(I), Cu2+(II), and Zn2+(III)) containing water molecules and anions of acetic acid α-(N-benzoxazolin-2-one) (L = C9H6O4) are presented. The crystals of complexes I–III are isostructural (space group P21/n, Z = 2) and are built of discrete neutral complex molecules. The crystallographic data are as follows: for complex I, a = 6.1470(5), b = 5.3310(3), c = 30.5894(17) Å, β = 95.056(6)°, V = 998.50(11) Å3; for complex II, a = 5.9661(6) Å, b = 5.1414(4) Å, c = 32.672(2) Å, β = 92.395(6)°, V = 1001.33(14) Å3; and for complex III, a = 6.1404(3) Å, b = 5.3476(2) Å, c = 30.5865(12) Å, β = 94.708(4)°, V = 1000.96(7) Å3. The metal atoms (M) of the complexing agents are localized in the crystallographic symmetry centers and have a distorted octahedral environment due to two oxygen atoms of the carboxy groups of two monodentate ligands (L) and four water molecules. The M-O(1w)(H2O) and M-O(2w)(H2O) bond lengths for the indicated complexes are 2.088(3) and 2.118(3), 2.446(3) and 1.971(3), and 2.113(4) and 2.093(3) Å for M = Co2+, Cu2+, and Zn2+, respectively. The crystal structures are formed due to packing of chains built of inter-molecular hydrogen bonds O-H…O. 相似文献
13.
A. N. Chekhlov 《Russian Journal of Coordination Chemistry》2006,32(1):5-9
(2.2.2-Cryptand)potassium nitrate hydrate, [K(Crypt-222)](NO3) · 1.5H2O (I) was synthesized and studied by X-ray diffraction method. Crystals I are triclinic (space group P ī, a = 11.262 Å, b = 12.033 Å, c = 12.181 Å, α = 60.48°, β = 86.17°, γ = 66.20°, Z = 2). The structure was solved by the direct method and refined by the full-matrix least-squares method in anisotropic approximation to R = 0.065 from 3377 independent reflections (CAD-4 automated diffractometer, λMoK α). In complex I, the host-guest complex cation [K(Crypt-222)]+ has approximate D 3 symmetry. The coordination polyhedron of the K+ cation is a two-base-centered trigonal prism, which is slightly distorted toward antiprism. The disordered NO 3 ? anions and water molecules are united by hydrogen bonds into infinite chains along the x-axis. 相似文献
14.
L. B. Serezhkina E. V. Peresypkina M. O. Karasev A. V. Virovets V. N. Serezhkin 《Russian Journal of Inorganic Chemistry》2013,58(2):160-165
Cs3[UO2(CH3COO)3]2[UO2(CH3COO)(NCS)2(H2O)] (I) and Cs5[UO2(CH3COO)3]3[UO2 (NCS)4(H2O)] · 2H2O (II) have been synthesized via the reaction between uranyl acetate and cesium thiocyanate in aqueous solution. According to single-crystal X-ray diffraction data, both compounds crystallize in monoclinic system with the unit cell parameters a = 18.7036(5) Å, b = 16.7787(3) Å, c = 12.9636(3) Å, β = 92.532(1)°, space group C2/c, Z = 4, R = 0.0434 (I); and a = 21.7843(3) Å, b = 24.6436(5) Å, c = 13.1942(2) Å, β = 126.482(1)°, space group Cc, Z = 4, R = 0.0273 (II). Uranium-containing structural units of compound (I) are mononuclear [UO2(CH3COO)3]? and [UO2(CH3COO)(NCS)2(H2O)]? moieties, which correspond to the AB 3 01 and AB01M 3 1 crystallochemical groups (A = UO 2 2+ , B01 = CH3COO?, M1 = NCS? and H2O). The structure of compound II is built of [UO2(CH3COO)3]? and [UO2(NCS)4(H2O)]2? complexes, which belong to the AB 3 01 and AM 5 1 crystallochemical groups, respectively. Uranium-containing complexes in both structures are linked into a framework by hydrogen bonds and electrostatic interactions with cesium cations. The IR spectra of compounds I and II agree well with X-ray diffraction data. 相似文献
15.
Two 4-phenylbenzophenones (I) and (II) are synthesized via Friedel-Crafts reactions. There are four crystallographically independent molecules with different conformations in the crystal structure of [1,1′-biphenyl]-4-yl(2-chlorophenyl)methanone (I). Crystals are orthorhombic, Pca21, C19H13ClO, a = 13.699(3) Å, b = 8.9385(17) Å, c = 46.836(9) Å; V = 5735(2) Å3, Z = 16, d x = 1.356 g/cm3. Torsion angles between the biphenyl rings are between 28.5° and 30.8°. Several C-H…O and C-H…Cl hydrogen bonds and weak π-π stacking contacts consolidate the crystal. Crystals of [1,1′-biphenyl]-4-yl(3-methoxyphenyl)methanone (II) are orthorhombic, Pbca, C20H16O2, a = 7.8179(15) Å, b = 16.003(3) Å, c = 23.345(5) Å; V = 2920.7(10) Å3, Z = 8, d x = 1.311 g/cm3. The torsion angle between the biphenyl rings is 28.1° and C-H…O hydrogen bonds are observed in compound (II). 相似文献
16.
Two new coordination polymers, [Pb(IDPT)2(NO3)2] (I) and [Mn(IDPT)(SO4)(H2O)2] (II) (IDPT = imidazo[4,5-f][1,10]phenanthroline), were synthesized by hydrothermal method and characterized by elemental analysis and single-crystal X-ray diffraction technique. The results reveal that the complex I belongs to monoclinic crystal system, space group C2/c and complex II belongs to monoclinic crystal system, P21/c space group. The cell parameters are: a = 19.1970(13), b = 7.3875(5), c = 17.3825(12) Å, β = 100.47(10)°, V = 2424.0(3) Å3, Z = 4, F(000) = 1488 for I; a = 10.9135(6), b = 7.0230(4), c = 19.7034(10) Å, β = 99.32(10)°, V = 1490.25(14) Å3, Z = 4, F(000) = 828 for II. In the structure of complex I, the metal center Pb(II) is six-coordinated, displays an octahedral geometry. Each molecule is further connected with neighboring one via π-π interactions into 1D chain. In complex II, Mn(II) is six-coordinated to form a distorted octahedral geometry. Compound II displays 1D supramolecular chain formed through hydrogen bonds. Additionally, the fluorescent properties for the complexes were investigated. Complexes I and II exhibit strong photoluminescence with emission maximum at 583 and 529 nm at room temperature. 相似文献
17.
I. I. Seifullina A. G. Pesaroglo L. Kh. Minacheva E. E. Martsinko V. S. Sergienko 《Russian Journal of Inorganic Chemistry》2006,51(12):1892-1899
Bis(citrato)germanate complexes with organic cations—protonated nicotinic acid ((HNic)2[Ge(HCit)2]·3H2O (I)), protonated nicotinamide ((HNad)2[Ge(HCit)2]·3H2O (II)), and protonated isonicotinic acid hydrazide ((HInd)2[Ge(HCit)2] (III)) (H4Cit is citric acid)—have been synthesized for the first time. Complexes I–III were studied by chemical and X-ray powder diffraction methods, thermal analysis, and IR spectroscopy. The X-ray diffraction study of complex I was carried out. The crystals are monoclinic, a = 10.931(7) Å, b = 11.420(1) Å, c = 23.188(6) Å, β = 101.54(4)°, V = 2836(2) Å3, z = 4, space group P21/n, R = 0.0334 for 1959 reflections with I > 2σ(I). In the complex anion [Ge(HCit)2]2? of the molecule of I, the coordination polyhedron of the Ge atom is a distorted octahedron formed by six O atoms of two tridentate chelating ligands HCit3? (Ge-O, 1.806–1.957 Å). In the structure of I, anions, cations, and water molecules are linked together by an intricate system of hydrogen bonds. 相似文献
18.
New (C17H20FN3O3)2[CoCl4]2·3H2O (I) and C17H20FN3O3[CoCl4]·H2O (II) compounds, where C17H18FN3O3 is ciprofloxacin (CfH), are synthesized and their crystal structures are determined. Crystallographic data for I: a = 18.441(5) Å, b = 9.030(3) Å, c = 27.551(8) Å, V = 4588(4) Å3, space group Pca21, Z = 4; for II: a = 9.305(3) Å, b = 9.885(3) Å, c = 12.999(4) Å, α = 82.782(4)°, β = 72.954(4)°, γ = 89.736(4)°, V = 1133(1) Å3, P-1 space group, Z = 2. Both structures contain CfH 3 2+ ion pairs bonded by the π-π interaction. Additionally, in the crystal of I there is a stacking interaction between the π clouds of aromatic rings and hydrogen atoms of the cyclopropyl group linking the pairs of molecules with each other. The structure of the centrosymmetric crystal of triclinic phase II is also formed from CfH 3 2+ ion pairs bonded by the π-π interaction, which, in this case, are not independent because they are related by the symmetry center. Hydrogen bonds form a branched three-dimensional network linking the CfH 3 2+ and CoCl 4 2? ions and water molecules. 相似文献
19.
A. V. Oreshkina G. Z. Kaziev A. V. Steblevskii T. Yu. Glazunova 《Russian Journal of Inorganic Chemistry》2013,58(8):906-909
[Co(NH3)6] · H2[NiMo6O18(OH)6] · 6H2O (I) and [Co(NH3)6] · H2[ZnMo6O18(OH)6] · 6H2O (II) have been synthesized and studied by mass spectroscopy, thermogravimetry, and X-ray powder diffraction. The crystals of compounds I and II are monoclinic, Z = 1; for compound I: a = 16.10 Å, b = 5.58 Å, c = 12.22 Å, β = 117.86°, V = 1045.14 Å3, and ρcalcd = 2.26 g/cm3; for compound II: a = 16.12 Å, b = 5.52 Å, c = 12.12 Å, β = 117.90°, V = 1043.21 Å3, and ρcalcd = 2.21 g/cm3. 相似文献
20.
A. N. Chekhlov 《Journal of Structural Chemistry》2006,47(3):513-518
The crystal structure of 4,7,13,16,21,24-hexaoxa-1-aza-10-azoniabicyclo[8.8.8]hexacosane monohydrate picrate, [H(Crypt-222) H2O]+·Pic? (I), has been studied by X-ray crystallography. The structure of I (space group P21/c, a = 9.336 Å, b = 19.497 Å, c = 16.420 Å; β = 94,84°, Z = 4) was solved by direct methods and refined by full-matrix least squares in an anisotropic approximation to R = 0.056 for all 3877 independent reflections collected (CAD-4 automatic diffractometer, λMoK α). This compound is one of the few representatives of the class of crystal salts containing a 2.2.2-cryptand cation with a protonated nitrogen atom that have been synthesized and studied by X-ray crystallography. The void of the cation contains a water molecule held by three H bonds. Crystal I also has unusual H bonds of C-H…O type that link the neighboring 2.2.2-cryptand cation and the picrate anion. 相似文献