共查询到20条相似文献,搜索用时 46 毫秒
1.
Green TW Lieberman R Mitchell N Krause Bauer JA Connick WB 《Inorganic chemistry》2005,44(6):1955-1965
Five platinum(II) 1,4,7-trithiacyclononane (ttcn) complexes with bidentate-substituted 2,2'-bipyridine ligands have been prepared and structurally characterized: [Pt(bpy)(ttcn)](PF6)2 (bpy = 2,2'-bipyridine), triclinic, P1, a = 10.2529(3) A, b = 10.7791(3) A, c = 10.7867(3) A, alpha = 83.886(1) degrees, beta = 87.565(1) degrees, gamma = 84.901(1), V = 1179.99(6) A3, Z = 2; [Pt(4,4'-dmbpy)(ttcn)](PF6)2 x CH3CN x H2O (4,4'-dmbpy = 4,4'-dimethyl-2,2'-bipyridine), triclinic, P1, a = 10.1895(3) A, b = 11.8566(4) A, c = 13.1004(4) A, alpha = 77.345(1) degrees, beta = 79.967(1) degrees, gamma = 72.341(1) degrees, V = 1461.56(8) A3, Z = 2; [Pt(5,5'-dmbpy)(ttcn)](PF6)2 (5,5'-dmbpy = 5,5'-dimethyl-2,2'-bipyridine), triclinic, P1, a = 10.6397(4) A, b = 10.8449(4) A, c = 11.2621(4) A, alpha = 90.035(1) degrees, beta = 98.061(1) degrees, gamma = 91.283(1) degrees, V = 1286.32(8) A3, Z = 2; [Pt(dbbpy)(ttcn)](PF6)2 x CH3NO2 (dbbpy = 4,4'-di-tert-butyl-2,2'-bipyridine), triclinic, P1, a = 11.5422(7) A, b = 11.6100(7) A, c = 13.6052(9) A, alpha = 85.902(1) degrees, beta = 89.675(1) degrees, gamma = 74.942(1) degrees, V = 1755.90(19) A3, Z = 2; and [Pt(dtfmbpy)(ttcn)](PF6)2 x CH3CN (dtfmbpy = 5,5'-di-trifluoromethyl-2,2'-bipyridine): monoclinic, P2(1)/c, a = 13.1187(9) A, b = 20.9031(15) A, c = 11.3815(8) A, beta = 105.789(2) degrees, V = 3003.3(4) A3, Z = 4. For each salt, the platinum(II) center of the cation is bonded to two nitrogen atoms of the chelating diimine and two sulfur atoms of the thioether macrocycle. The third sulfur atom of ttcn forms a long apical interaction with the metal center (2.84-2.97 A), resulting in a flattened square pyramid structure. An examination of these and 17 other structures of platinum(II) ttcn complexes reveals a correlation between the apical Pt...S distance and the donor properties of the ancillary ligands, suggesting a means for using variations in ligand electronic properties to tune molecular structure. The room-temperature absorption spectra in acetonitrile solution show a broad and comparatively low-energy MLCT band maximizing near approximately 390 nm for the bpy and dialkyl-substituted bipyridyl derivatives. The maximum is dramatically red-shifted to 460 nm in the spectrum of the dtfmbpy complex as a result of the electron-withdrawing properties of the -CF(3) groups. The 3:1 EtOH/MeOH 77 K glassy solution emission spectra exhibit low-energy emission bands (lambdamax, 570-645 nm), tentatively assigned as originating from a lowest, predominantly spin-forbidden MLCT excited state that is stabilized by apical Pt...S interactions. 相似文献
2.
A new series of square planar Pt(II) complexes with the mer-coordinating tridentate ligand, pip(2)NCN(-) (pip(2)NCNH = 1,3-bis(piperdylmethyl)benzene), has been prepared: Pt(pip(2)NCN)Cl (2), Pt(pip(2)NCN)Br (3), Pt(pip(2)NCN)I (4), and [Pt(pip(2)NCN)(CH(3)N=C(CH(3))(2))][CF(3)SO(3)] (5). The complexes have been fully characterized by (1)H NMR spectroscopy, elemental analysis, and UV-vis spectroscopy. The X-ray crystal structures of pip(2)NCNBr (1), 2, and 5 are reported. Compound 1: triclinic, P, a = 10.081(1) A, b = 10.153(2) A, c = 10.390(1) A, alpha = 66.05(1) degrees, beta = 79.07(1) degrees, gamma = 64.51(1) degrees, V = 877.1(2) A(3), Z = 2. Complex 2: triclinic, P, a = 9.897(2) A, b = 10.191(2) A, c = 19.174(4) A, alpha = 75.09(3) degrees, beta = 76.14(3) degrees, gamma = 71.00(3) degrees, V = 1741.2(6) A(3), Z = 4. Complex 5: triclinic, P, a = 10.709(2) A, b = 11.2321(10) A, c = 12.447(2) A, alpha = 110.509(8) degrees, beta = 112.417(10) degrees, gamma = 91.066(9) degrees, V = 1276.1(3) A(3), Z = 2. In 77 K 3:1 EtOH/MeOH glassy solution, these colorless complexes exhibit weak red-orange to red emissions originating from a lowest spin-forbidden ligand field excited state. 相似文献
3.
A series of one-dimensional arrays of lanthanide-transition metal complexes has been prepared and characterized. These complexes, [(DMF)(10)Ln(2)[Ni(CN)(4)](3)](infinity), crystallize as linear single-strand arrays (structural type A) (Ln = Sm, 1a; Eu, 2a) or double-strand arrays (structural type B) (Ln = Sm, 1b; Eu, 2b) depending upon the conditions chosen, and they are interconvertible. The single-strand type A structure can be converted to the double-strand type B structure. When the 1b and 2b type B crystals are completely dissolved in DMF, their infrared spectra are identical to the infrared spectra of 1a and 2a type A crystals dissolved in DMF. These solutions produce type A crystals initially. It is believed that formation of the type A structure is kinetically favored while the type B structure is thermodynamically favored for lanthanide-nickel complexes 1 and 2. On the other hand the complex [(DMF)(10)Y(2)[Pd(CN)(4)](3)](infinity), 3, appears to crystallize only as the double-strand array (type B). The complexes [(DMF)(12)Ce(2)[Ni(CN)(4)](3)](infinity), 4, and [(DMF)(12)Ce(2)[Pd(CN)(4)](3)](infinity), 5, crystallize as a new type of single-strand array (structural type C). This structural type is a zigzag chain array. Crystal data for 1a: triclinic space group P1, a = 10.442(5) A, b = 10.923(2) A, c = 15.168(3) A, alpha = 74.02(2) degrees, beta = 83.81(3) degrees, gamma = 82.91(4) degrees, Z = 2. Crystal data for 1b: triclinic space group P1, a = 9.129(2) A, b = 11.286(6) A, c = 16.276(7) A, alpha = 81.40(4) degrees, beta = 77.41(3) degrees, gamma = 83.02(3) degrees, Z = 2. Crystal data for 2a: triclinic space group P1, a = 10.467(1) A, b = 10.923(1) A, c = 15.123(1) A, alpha = 74.24(1) degrees, beta = 83.61(1) degrees, gamma = 83.13(1) degrees, Z = 2. Crystal data for 2b: triclinic space group P1, a = 9.128(1) A, b = 11.271(1) A, c = 16.227(6) A, alpha = 81.36(2) degrees, beta = 77.43(2) degrees, gamma = 82.99(1) degrees, Z = 2. Crystal data for 3: triclinic space group P1, a = 9.251(3) A, b = 11.193(4) A, c = 16.388(4) A, alpha = 81.46(2) degrees, beta = 77.18(2) degrees, gamma = 83.24(3) degrees, Z = 2. Crystal data for 4: triclinic space group P1, a = 11.279(1) A, b = 12.504(1) A, c = 13.887(1) A, alpha = 98.68(1) degrees, beta = 108.85(1) degrees, gamma = 101.75(1) degrees, Z = 2. Crystal data for 5: triclinic space group P1, a = 11.388(3) A, b = 12.614(5) A, c = 13.965(4) A, alpha = 97.67(3) degrees, beta = 109.01(2) degrees, gamma = 101.93(2) degrees, Z = 2. 相似文献
4.
Sheet- and column-like cyanide bridged lanthanide-transition metal arrays were synthesized through metathesis reactions between anhydrous LnCl(3) (Ln = Eu, Yb) and A(2)[M(CN)(4)] (A = K(+), NH(4)(+); M = Ni, Pt) in a 1:2 molar ratio in DMF (DMF = N,N-dimethylformamide) solution. Single-crystal X-ray analysis revealed that complexes of formula [K(DMF)(7)Ln[M(CN)(4)](2)](infinity) (Ln = Eu, M = Ni, 1; Ln = Yb, M = Pt, 2) consist of infinite layers of neutral, puckered sheets that contain hexagonal rings of composition [(DMF)(10)Ln(2)[M(CN)(4)](3)](6) with interstitial (DMF)(4)K(2)[M(CN)(4)] units located between the layers. The sheet structure is generated through the repeating (DMF)(10)Ln(2)[M(CN)(4)](3) unit with trans cyanide ligands in [M(CN)(4)](2)(-) serving as bridges. The column-like complex [(NH(4))(DMF)(4)Yb[Pt(CN)(4)](2)](infinity), 3, is formed when NH(4)(+) replaces K(+). It consists of infinite, negatively charged, square, parallel columns bundled through N-H...NC hydrogen bonds between NH(4)(+) and terminal CN from the columns. Cis cyanide ligands in [Pt(CN)(4)](2)(-) units serve as bridges. Complex 3 is the first known example where Ln(III) centers are coordinated to four [M(CN)(4)](2)(-) units. Bicapped (square face) trigonal prismatic coordination geometries were observed for Ln(III) centers in 1 and 2. Square antiprismatic geometry for Yb(III) centers are observed in 3. Crystal data for 1: triclinic space group P1, a = 8.797(2) A, b = 15.621(3) A, c = 17.973(6) A, alpha = 105.48(2) degrees, beta = 98.60(2) degrees, gamma = 98.15(2) degrees, Z = 2. Crystal data for 2: triclinic space group P1, a = 8.825(1) A, b = 15.673(1) A, c = 17.946(1) A, alpha = 105.46(2) degrees, beta = 99.10(1) degrees, gamma = 98.59(1) degrees, Z = 2. Crystal data for 3: monoclinic space group P2(1)/c, a = 9.032(1) A, b = 29.062(1) A, c = 15.316(1) A, beta = 94.51(1) degrees, Z = 2. 相似文献
5.
The first examples of high-dimensional mixed-valence homometallic cyano-bridged copper complexes were synthesized and characterized: net-structured [Cu(CN)(4){Cu(cyclam)}(1.5)](2)(n)()(H(2)O)(5)(n) (1), ladder-type double-chain-structured [Cu(CN)(2){Cu(CN)(2)Cu(cyclam)}](n)()(H(2)O)(n) (2), layer-structured [{Cu(CN)(2)}(2)Cu(cycalm)](n) (3), and hydrogen-bond-based 2-D [Cu(CN)(3)Cu(cyclam)](n)()(CH(3)OH)(n) (4) (cyclam = 1,4,8,11-tetraazacyclotetradecane). (1) Crystallizes in triclinic space group P with a = 8.3589(11) A, b = 13.478(2) A, c = 14.828(2) A, alpha = 66.895(2) degrees , beta = 77.916(3) degrees , gamma = 85.939(3) degrees , and Z = 1; (2) crystallizes in triclinic space group P with a = 8.2305(12) A, b = 9.8861(15) A, c = 13.219(2) A, alpha = 84.863(3) degrees , beta = 75.744(3) degrees , gamma = 89.818(3) degrees , and Z = 2; 3 crystallizes in monoclinic space group P2(1)/c with a = 6.830(2) A, b = 8.482(2) A, c = 17.306(4) A, beta = 98.144(4) degrees , and Z = 2; 4 crystallizes in triclinic space group P with a = 9.470(1) A, b = 10.034(1) A, c = 12.064(1) A, alpha = 67.325(2), beta = 75.593(2), gamma = 70.672(2), and Z = 2. The coordination sphere of Cu(I) sites in the complexes shows diverse structures: tetrahedral [CuC(4)] for (1), tetrahedral [CuC(3)N] and triangular [CuC(2)N] for (2), triangular [CuC(2)N] for (3), and triangular [CuC(3)] for 4. In particular, (1) constitutes the first example of a structurally characterized system containing a bridging tetrahedral [Cu(CN)(4)](3)(-) unit. The diverse structural nature of these complexes is governed by the capping amines and the content of water in the reaction media. The magnetic interactions are negligible in these mixed-valence complexes. 相似文献
6.
Fronczek FR Delord TJ Watkins SF Gueorguieva P Stanley GG Zizza AS Cornelius JB Mantz YA Musselman RL 《Inorganic chemistry》2003,42(22):7026-7036
Crystal structures of three Ni(CN)(4)(2)(-) salts all with eclipsed ligands and varying axial stacking arrangements are presented. The absorption spectra of all three salts show a slight red shift in the x,y-polarizations and a large red shift in their z-polarizations upon crystallization from solution. Semiempirical ZINDO calculations provide a good model of the solid state, even with only a three-molecule segment, allowing reproduction of the red-shifting and intensity increase upon crystallization found experimentally. The modified nickel beta(s,p) bonding parameter of -5 found appropriate for Ni coordination in our previous studies of single Ni(CN)(4)(2-) planes and a helically stacked Cs(2)[Ni(CN)(4)].H(2)O crystal was changed to -3 for the more parallel-stacked Ni(CN)(4)(2-) planes in this case, while beta(d) was retained at -41. Crystal data are as follows: Na(2)[Ni(CN)(4)].3H(2)O, triclinic space group P1, a = 7.2980(10) A, b = 8.8620(10) A, c = 15.132(2) A, alpha = 89.311(5) degrees, beta = 87.326(5) degrees, gamma = 83.772(6) degrees, V = 971.8(2) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.064; Sr[Ni(CN)(4)].5H(2)O, monoclinic space group C2/m, a = 10.356(2) A, b = 15.272(3) A, c = 7.1331(10) A, beta = 98.548(12) degrees, V = 1115.6(3) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.059; Rb(2)[Ni(CN)(4)].1.05H(2)O, triclinic space group P1, a = 8.6020(10) A, b = 9.6930(10) A, c = 12.006(2) A, alpha = 92.621(6) degrees, beta = 94.263(6) degrees, gamma = 111.795(10) degrees, V = 924.0(2) A(3), T = 100 K, Z = 4, R = 0.034, R(w) = 0.067. 相似文献
7.
Treatment of the hydrosulfido-bridged titanium-ruthenium heterobimetallic complex [Cp2Ti(mu2-SH)2RuCl(eta5-C5Me5)] (1; Cp = eta5-C5H5) with an excess of triethylamine followed by addition of [RuCl2(PPh3)3] and [[(cod)M]2(mu2-Cl)2] (M = Rh, Ir; cod = 1,5-cyclooctadiene) led to the formation of the TiRu2 and TiRuM mixed-metal sulfido clusters [(CpTi)[(eta5-C5Me5)Ru][Ru(PPh3)2](mu3-S)2(mu2-Cl)2] (3) and [(CpTi)[(eta5-C5Me5)Ru][M(cod)](mu3-S)2(mu2-Cl)] (M = Rh (4a), Ir (4b)), respectively. On the other hand, the reactions of 1 with [M(PPh3)4] (M = Pd, Pt) afforded the TiRuM trinuclear clusters [(CpTiCl)[(eta5-C5Me5)Ru][M(PPh3)2](mu3-S)(mu2-S)(mu2-H)] (M = Pd (5a), Pt (5b)) with an unprecedented M3(mu3-S)(mu2-S) core. The detailed structures of these triangular clusters 3-5 have been determined by X-ray crystallography. Crystal data: 3, triclinic, P1, a = 12.448(4) A, b = 12.773(4) A, c = 17.270(4) A, alpha = 100.16(2) degrees, beta = 99.93(2) degrees, gamma = 114.11(3) degrees, V = 2373(1) A(3), Z = 2; 4a, triclinic, P1, a = 7.714(2) A, b = 11.598(3) A, c = 14.802(4) A, alpha = 80.46(2) degrees, beta = 82.53(2) degrees, gamma = 71.47(2) degrees, V = 1234.0(6) A3, Z = 2; 4b, triclinic, P1, a = 7.729(1) A, b = 11.577(2) A, c = 14.766(3) A, alpha = 80.14(1) degrees, beta = 82.71(1) degrees, gamma = 71.55(1) degrees, V = 1231.1(4) A3, Z = 2; 5a, monoclinic, P2(1)/c, a = 11.259(4) A, b = 16.438(4) A, c = 26.092(5) A, beta = 102.23(3) degrees, V = 4719(2) A(3), Z = 4; 5b, monoclinic, P2(1)/n, a = 11.369(2) A, b = 16.207(3) A, c = 26.116(2) A, beta = 102.29(1) degrees, V = 4701(1) A3, Z = 4. 相似文献
8.
Clemente-León M Coronado E Galán-Mascarós JR Gómez-García CJ Woike T Clemente-Juan JM 《Inorganic chemistry》2001,40(1):87-94
The synthesis, crystal structure, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O (1), [Ni(en)2][Fe(CN)5NO]x3H2O (2), [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO] (3), and [Mn(5-Brsalen)]2[Fe(CN)5NO] (4) are presented. 1 crystallizes in the monoclinic space group P2(1)/n (a = 7.407(4) A, b = 28.963(6) A, c = 14.744(5) A, alpha = 90 degrees, beta = 103.26(4) degrees, gamma = 90 degrees, Z = 2). Its structure consists of branched linear chains formed by cis-[Ni(en)2]2+ cations and ferrocyanide and nitroprusside anions. The presence of two kinds of iron(II) sites has been demonstrated by M?ssbauer spectroscopy. 2 crystallizes in the monoclinic space group P2(1)/c (a = 11.076(3) A, b = 10.983(2) A, c = 17.018(5) A, alpha = 90 degrees, beta = 107.25(2) degrees, gamma = 90 degrees, Z = 4). Its structure consists of zigzag chains formed by an alternated array of cis-[Ni(en)2]2+ cations and nitroprusside anions. 3 crystallizes in the triclinic space group P1 (a = 8.896(5) A, b = 10.430(5) A, c = 12.699(5) A, alpha = 71.110(5) degrees, beta = 79.990(5) degrees, gamma = 89.470(5) degrees, Z = 1). Its structure comprises neutral trinuclear bimetallic complexes in which a central [Fe(CN)5NO]2- anion is linked to two [Mn(3-MeOsalen)]+ cations. 4 crystallizes in the tetragonal space group P4/ncc (a = 13.630(5) A, c = 21.420(8) A, Z = 4). Its structure shows an extended 2D neutral network formed by cyclic octameric [-Mn-NC-Fe-CN-]4 units. The magnetic properties of these compounds indicate the presence of quasi-isolated paramagnetic Ni2+ and Mn3+. Irradiated samples of the four compounds have been studied by differential scanning calorimetry to detect the existence of the long-lived metastable states of nitroprusside. 相似文献
9.
We have synthesized two forms of erbium tetracyanoplatinates, Er2[Pt(CN)4]3.21H2O (red form) and Er2[Pt(CN)4]2.SO4.11.5H2O (yellow form), and determined their crystal structures by X-ray diffraction. While the red form crystallizes in the orthorhombic space group Pbcn, with a = 15.4848(3) A, b = 13.8186(2) A, c = 19.07820(10) A, alpha = beta = gamma = 90 degrees, and Z = 4, the yellow form precipitates in the tetragonal space group I4cm, with a = b = 14.321(2) A, c = 13.338(3) A, alpha = beta = gamma = 90 degrees, and Z = 4. Both forms show [Pt(CN)4]2- chains but differ markedly in color and morphology. This is due to the incorporation of sulfate ions in the latter modification, leading to an increased Pt-Pt distance. The observed optical absorption and emission behavior of the title compounds is correlated with the Pt-Pt distances. 相似文献
10.
The new complexes trans-[a2Pt(Hpymo-N1)2]X2 (a = NH3, X = NO3 (1a); a = CH3NH2, X = NO3 (1b); a = CH3NH2, X = ClO4 (1c); Hpymo = 2-hydroxypyrimidine) have been prepared by reaction of trans-[a2Pt(H2O)2]-X2 with 2-hydroxypyrimidine at 80 degrees C in water. Complex 1c cocrystallizes in water with 2-aminopyrimidine (ampym) through formation of complementary pairs of hydrogen bonds to give the supramolecular hexagon [trans-[(CH3NH2)2Pt(pymo-N1)(Hpymo-N1)].Hampym[2(ClO4)4 (2). Molecular recognition of ampym by 1c is responsible for a conformational change of the two hydroxypyrimidine ligands in 1c from anti (1c) to syn and in addition for a proton transfer from a Hpymo residue to ampym against 1.5 units of pKa gradient. 1H NMR concentration-dependent studies as well as NOE experiments in dmso-d6 and dmf-d7 show that 2 dissociates in solution. Compound 1a reacts in NH3:H2O (1:3) with AgI to give the polymeric species [trans-[(NH3)2Pt(mu-pymo-N1,N3)2Ag(H2O)]-NO3]n (3). In contrast to 2, in the polymeric structure the trans-[NH3)2Pt(pymo)2] entities adopt an anti conformation. Nevertheless, the [(H2O)Ag(pymo)2] residues present a syn conformation that leads to a meander-like global structure. Compounds 1b, 1c, 2, and 3 have been studied by X-ray crystallography: (1b) triclinic space group, P1, a = 9.300(2) A, b = 10.483(2) A, c = 11.050(2) A, alpha = 68.21(3) degrees, beta = 75.47(3) degrees, gamma = 73.83(3) degrees, Z = 2, R1 = 0.025, and wR2 = 0.062; (1c) triclinic space group, P1, a = 5.692(1) A, b = 7.758(2) A, c = 11.236(2) A, alpha = 93.12(3) degrees, beta = 92.86(3) degrees, gamma = 102.58(3) degrees, Z = 2, R1 = 0.048, and wR2 = 0.119; (2) triclinic space group, P1, a = 8.355(2) A, b = 11.221(2) A, c = 13.004(3) A, alpha = 86.76(3) degrees, beta = 78.62(3) degrees, gamma = 77.96(3) degrees, Z = 2, R1 = 0.033, and wR2 = 0.080; (3) monoclinic space group, C2/c, a = 5.345(1) A, b = 23.998(5) A, c = 12.474(2) A, beta = 102.27(3) degrees, Z = 8, R1 = 0.041, and wR2 = 0.093. 相似文献
11.
The compounds Cp2Ln[N(QPPh2)2] (Ln = La (1), Gd (2), Er (3), or Yb (4) for Q = Se, Ln = Yb (5) for Q = S) have been synthesized from the corresponding rare-earth tris(cyclopentadienyl) compound and H[N(QPPh2)2]. The structures of compounds 1, 2, 3, and 5, as determined by X-ray crystallography, consist of a Cp2Ln fragment, coordinated eta 3 through two chalcogen atoms and an N atom of the imidodiphosphinochalcogenido ligand [N(QPPh2)2]-. In compound 4, the Cp2Yb moiety is coordinated eta 2 through the two Se atoms of the [N(SePPh2)2]-ligand. 31P and 77Se (for 1) NMR spectroscopies lend insight into the solution nature of these species. Crystal data: 1, C34H30LaNP2Se2, triclinic, P1, a = 9.7959(10) A, b = 12.4134(13) A, c = 13.9077(14) A, alpha = 88.106(2) degrees, beta = 88.327(2) degrees, gamma = 68.481(2) degrees, V = 1572.2(3) A3, T = 153 K, Z = 2, and R1(F) = 0.0257 for the 5947 reflections with I > .2 sigma(I); 2, C34H30GdNP2Se2, triclinic, P1, a = 9.7130(14) A, b = 12.2659(17) A, c = 13.953(2) A, alpha = 88.062(2) degrees, beta = 87.613(2) degrees, gamma = 69.041(2) degrees, V = 1550.7(4) A3, T = 153 K, Z = 2, and R1(F) = 0.0323 for the 5064 reflections with I > 2 sigma(I); 3, C34H30ErNP2Se2, triclinic, P1, a = 9.704(2) A, b = 12.222(3) A, c = 13.980(4) A, alpha = 88.230(4) degrees, beta = 87.487(4) degees, gamma = 69.107(4) degrees, V = 1547.4(7) A3, T = 153 K, Z = 2, and R1(F) = 0.0278 for the 6377 reflections with I > 2 sigma(I); 4, C34H30NP2Se2Yb.C4H8O, triclinic, P1, a = 12.087(4) A, b = 12.429(4) A, c = 23.990(7) A, alpha = 89.406(5) degrees, beta = 86.368(5) degrees, gamma = 81.664(5) degrees, V = 3558.8(18) A3, T = 153 K, Z = 4, and R1(F) = 0.0321 for the 11,883 reflections with I > 2 sigma(I); and 5, C34H30NP2S2Yb, monoclinic, P21/n, a = 13.8799(18) A, b = 12.6747(16) A, c = 17.180(2) A, beta = 91.102(3) degrees, V = 3021.8(7) A3, T = 153 K, Z = 4, and R1(F) = 0.0218 for the 6698 reflections with I > 2 sigma(I). 相似文献
12.
C(4)N(3)OH(7).Zn(H(2)O)HPO(4), built up from 4-rings of ZnO(2)(H(2)O)N and HPO(4) tetrahedra, is the first neutral, molecular, zincophosphate cluster. The unit-cell packing involves numerous O-H...O and N-H...O hydrogen bonds and pi...pi stacking interactions. Crystal data: C(4)N(3)OH(7).Zn(H(2)O)HPO(4), M(r) = 292.49, triclinic, P1 (No. 2), a = 9.2956(5) A, b = 11.2077(6) A, c = 19.8319(12) A, alpha = 80.314(1) degrees, beta = 78.829(1) degrees, gamma = 89.241(1) degrees, V = 1997.7(2) A(3), Z = 4. 相似文献
13.
Willison SA Jude H Antonelli RM Rennekamp JM Eckert NA Krause Bauer JA Connick WB 《Inorganic chemistry》2004,43(8):2548-2555
Four platinum(II) cationic complexes were prepared with the mer-coordinating tridentate ligands 2,6-bis(N-pyrazolyl)pyridine (bpp) and 2,6-bis(3,5-dimethyl-N-pyrazolyl)pyridine (bdmpp): [Pt(bpp)Cl]Cl.H(2)O; [Pt(bdmpp)Cl]Cl.H(2)O; [Pt(bpp)(Ph)](PF(6)); [Pt(bdmpp)(Ph)](PF(6)). The complexes were characterized by (1)H NMR spectroscopy, elemental analysis, and mass spectrometry, and the structures of the bpp derivatives were determined by X-ray crystallography. [Pt(bpp)Cl]Cl.2H(2)O: monoclinic, P2(1)/n, a = 11.3218(5) A, b = 6.7716(3) A, c = 20.6501(6) A, beta = 105.883(2) degrees, V = 1522.73(11) A(3), Z = 4. The square planar cations stack in a head-to-tail fashion to form a linear chain structure with alternating Pt...Pt distances of 3.39 and 3.41 A. [Pt(bpp)(Ph)](PF(6)).CH(3)CN: triclinic, P, a = 8.3620(3) A, b = 10.7185(4) A, c = 13.4273(5) A, alpha = 96.057(1) degrees, beta = 104.175(1) degrees, gamma = 110.046(1) degrees, V = 1072.16(7) A(3), Z = 2. Cyclic voltammograms indicate all four complexes undergo irreversible reductions between -1.0 and -1.3 V vs Ag/AgCl (0.1 M TBAPF(6)/CH(3)CN), attributable to ligand- and/or metal-centered processes. By comparison to related 2,2':6',2' '-terpyridine complexes, the electrochemical and UV-visible absorption data are consistent with bpp being both a weaker sigma-donor and pi-acceptor than terpyridine. Solid samples of [Pt(bpp)(Ph)](PF(6)) at 77 K exhibit a remarkably intense, narrow emission centered at 655 nm, whereas the other three complexes exhibit only very weak emission. 相似文献
14.
Schatz M Becker M Thaler F Hampel F Schindler S Jacobson RR Tyeklár Z Murthy NN Ghosh P Chen Q Zubieta J Karlin KD 《Inorganic chemistry》2001,40(10):2312-2322
Copper(I) and copper(II) complexes possessing a series of related ligands with pyridyl-containing donors have been investigated. The ligands are tris(2-pyridylmethyl)amine (tmpa), bis[(2-pyridyl)methyl]-2-(2-pyridyl)ethylamine (pmea), bis[2-(2-pyridyl)ethyl]-(2-pyridyl)methylamine (pmap), and tris[2-(2-pyridyl)ethyl]amine (tepa). The crystal structures of the protonated ligand H(tepa)ClO(4), the copper(I) complexes [Cu(pmea)]PF(6) (1b-PF(6)), [Cu(pmap)]PF(6) (1c-PF(6)), and copper(II) complexes [Cu(pmea)Cl]ClO(4).H(2)O (2b-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4).H(2)O (2c-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4) (2c-ClO(4)), and [Cu(pmea)F](2)(PF(6))(2) (3b-PF(6)) were determined. Crystal data: H(tepa)ClO(4), formula C(21)H(25)ClN(4)O(4), triclinic space group P1, Z = 2, a = 10.386(2) A, b = 10.723(2) A, c = 11.663(2) A, alpha = 108.77(3) degrees, beta = 113.81(3) degrees, gamma = 90.39(3) degrees; 1b-PF(6), formula C(19)H(20)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 14.413(3) A, b = 16.043(3) A, c = 18.288(4) A, alpha = beta = gamma = 90 degrees; (1c-PF(6)), formula C(20)H(22)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 13.306(3) A, b = 16.936(3) A, c = 19.163(4) A, alpha = beta = gamma = 90 degrees; 2b-ClO(4).H(2)O, formula C(19)H(22)Cl(2)CuN(4)O(5), triclinic space group P1, Z = 4, a = 11.967(2) A, b = 12.445(3) A, c = 15.668(3) A, alpha = 84.65(3) degrees, beta = 68.57(3) degrees, gamma = 87.33(3) degrees; 2c-ClO(4).H(2)O, formula C(20)H(24)Cl(2)CuN(4)O(5), monoclinic space group P2(1)/c, Z = 4, a = 11.2927(5) A, b = 13.2389(4) A, c = 15.0939(8) A, alpha = gamma = 90 degrees, beta = 97.397(2) degrees; 2c-ClO(4), formula C(20)H(22)Cl(2)CuN(4)O(4), monoclinic space group P2(1)/c, Z = 4, a = 8.7682(4) A, b = 18.4968(10) A, c = 13.2575(8) A, alpha = gamma = 90 degrees, beta = 94.219(4) degrees; 3b-PF(6), formula [C(19)H(20)CuF(7)N(4)P](2), monoclinic space group P2(1)/n, Z = 2, a = 11.620(5) A, b = 12.752(5) A, c = 15.424(6) A, alpha = gamma = 90 degrees, beta = 109.56(3) degrees. The oxidation of the copper(I) complexes with dioxygen was studied. [Cu(tmpa)(CH(3)CN)](+) (1a) reacts with dioxygen to form a dinuclear peroxo complex that is stable at low temperatures. In contrast, only a very labile peroxo complex was observed spectroscopically when 1b was reacted with dioxygen at low temperatures using stopped-flow kinetic techniques. No dioxygen adduct was detected spectroscopically during the oxidation of 1c, and 1d was found to be unreactive toward dioxygen. Reaction of dioxygen with 1a-PF(6), 1b-PF(6), and 1c-PF(6) at ambient temperatures leads to fluoride-bridged dinuclear copper(II) complexes as products. All copper(II) complexes were characterized by UV-vis, EPR, and electrochemical measurements. The results manifest the dramatic effects of ligand variations and particularly chelate ring size on structure and reactivity. 相似文献
15.
The verdazyl radical 1,5-dimethyl-3-(2,2'-bipyridin-6-yl)-6-oxoverdazyl (3) was prepared, and its homoleptic metal complexes M(3)(2)(2+).2X(-) (5, M = Mn(II); 6, M = Ni(II); 7, M = Cu(II); 8, M = Zn(II); X = ClO(4), PF(6)) were characterized by single-crystal X-ray diffraction and variable-temperature magnetic susceptibility measurements. Relevant crystallographic parameters are as follows: 5, monoclinic space group Pna2(1), a = 18.755(4) A, b = 11.154(3) A, c = 16.594(4) A, alpha = 90.00 degrees, beta = 90.00 degrees, gamma = 90.00 degrees, V = 3471.4(13) A(3), and Z = 4; 7, triclinic space group Ponedblac;, a = 9.4638(18) A, b = 9.8442(19) A, c = 18.769(4) A, alpha = 103.746(3) degrees, beta = 92.925(3) degrees, gamma = 94.869(3) degrees, V = 1687.8(6) A(3), and Z = 2; 8, triclinic space group Ponedblac;, a = 9.4858(14) A, b = 9.7919(14) A, c = 18.889(3) A, alpha = 104.196(3) degrees, beta = 92.855(3) degrees, gamma = 94.216(3) degrees, V = 1692.1(4) A(3), and Z = 2. In all cases, the two verdazyl-based ligands bind almost perpendicular to each other in meridional positions, yielding pseudooctahedral metal complexes whose general structural features are strongly reminiscent of metal bis(terpyridine) complexes. The intramolecular metal-verdazyl magnetic exchange coupling is strongly ferromagnetic in 6 (J(Ni-vd) = +240 cm(-1)), and strongly antiferromagnetic in 5 (J(Mn-vd) = -93 cm(-1)). Complex 7 exhibits weak ferromagnetic coupling (J(Cu-vd) = -4.5 cm(-1)). Intramolecular radical-radical coupling in the zinc complex 8 was found to be weakly antiferromagnetic (J(vd-vd) = -8 cm(-1)). Intramolecular radical-radical exchange was generally weak in the four metal complexes, ranging from -10 cm(-1) (for 5) to +2 cm(-1) (for 7). The low-temperature magnetic behavior of 7 and 8 is complex, possibly arising from a combination of intra- and intermolecular interactions. 相似文献
16.
Stoicescu L Jeanson A Duhayon C Tesouro-Vallina A Boudalis AK Costes JP Tuchagues JP 《Inorganic chemistry》2007,46(17):6902-6910
Doubly bridged mu-alkoxo-mu-X (X = pyrazolato or acetato) dinuclear MnIII complexes of 2-hydroxy-N-{2-hydroxy-3-[(2-hydroxybenzoyl)amino]propyl}benzamide) (H5L1) and 2-hydroxy-N-{2-hydroxy-4-[(2-hydroxybenzoyl)amino]butyl}benzamide (H5L2), [Mn2(L)(pz)(MeOH)4].xMeOH (1, L = L1, x = 0.5; 2, L = L2, x = 0; Hpz = pyrazole) and [Mn2(L1)(OAc)(MeOH)4] (3), have been prepared, and their structure and magnetic properties have been studied. The X-ray diffraction analysis of 1 (C24.5H34Mn2N4O9.5, triclinic, P, a = 12.2050(7) A, b = 12.7360(8) A, c = 19.2780(10) A, alpha = 99.735(5) degrees , beta = 96.003(4) degrees , gamma = 101.221(5) degrees , V = 2867.6(3) A3, Z = 4), 2 (C25H34Mn2N4O9, triclinic, P, a = 9.4560(5) A, b = 11.0112(5) A, c = 13.8831(6) A, alpha = 90.821(4) degrees , beta = 92.597(4) degrees , gamma = 93.403(4) degrees , V = 1441.29(12) A3, Z = 2), and 3 (C23H32Mn2N2O11, triclinic, P, a = 10.511(5) A, b = 11.713(5) A, c = 13.135(5) A, alpha = 64.401(5) degrees , beta = 74.000(5) degrees , gamma = 66.774(5) degrees , V = 1329.3(10) A3, Z = 2) revealed that all complexes consist of dinuclear units which are further extended into 1D (1 and 3) and 2D (2) supramolecular networks via hydrogen-bonding interactions. Magnetic susceptibility data evidence antiferromagnetic interactions for all three complexes: J = -3.6 cm-1, D approximately 0 cm-1, g = 1.93 (1); J = -2.7 cm-1, D = 0.8 cm-1, g = 1.93 (2); J = -4.9 cm-1, D = 3.8 cm-1, g = 1.95 (3). 相似文献
17.
Three new platinum complexes containing 3,3'-biisoquinoline (i-biq), [Pt(CN)(2)(i-biq)] (1), [PtCl(2)(i-biq)] (2), and [Pt(i-biq)(2)](PF(6))(2) (3), have been synthesized as orange-red, yellow, and colorless crystals, respectively. Their crystal structures and luminescence properties are reported. Crystal data: for 1.0.5H(2)O, PtO(0.5)N(4)C(20)H(13), orthorhombic, Pbcm, a = 13.989(2) ?, b = 18.304(1) ?, c = 6.682(3) ?, V = 1710.9(6) ?(3), Z = 4, and final R = 0.039 (R(w) = 0.033) for 970 independent reflections; for 2.DMF.H(2)O, PtCl(2)O(2)N(3)C(21)H(21), triclinic, P&onemacr;, a = 11.047(1) ?, b = 12.397(3) ?, c = 8.000(2) ?, alpha = 106.56(1) degrees, beta = 100.15(1) degrees, gamma = 76.15(1) degrees, V = 1012.8(3) ?(3), Z = 2, and final R = 0.058 (R(w) = 0.077) for 4219 independent reflections; for 3.2DMF, PtP(2)F(12)O(2)N(6)C(42)H(38), triclinic, P&onemacr;, a = 10.795(2) ?, b = 13.511(2) ?, c = 8.281(1) ?, alpha = 105.22(1) degrees, beta = 112.17(1) degrees, gamma = 85.02(1) degrees, V = 1079.2(3) ?(3), Z = 1, and final R = 0.038 (R(w) = 0.042) for 3606 independent reflections. Square-planar complexes of 1 are stacked in the crystal to form a columnar structure with the Pt-Pt distance of 3.34 ?. The crystal emits strongly, even at room temperature, and the emission spectrum is similar to that for the [Pt(CN)(2)(bpy)] crystal (bpy = 2,2'-bipyridine), which is due to a (3)dpi[dsigma(Pt) --> pi(i-biq)] transition. The single crystal emission spectrum at 77 K is, however, observed as a superposition of broad (3)dpi and sharp (3)pipi(i-biq) emissions. The crystal structure of 2 has a completely different stacking structure from that of 1. The stacking occurs on the i-biq ligands, and the Pt atoms are separated more than 6 ?. The complex exhibits only a structured emission component assigned to the (3)pipi(i-biq) transition in the crystal at 77 K, in agreement with the crystal structure with no Pt-Pt interaction. In the crystal of 3, the [Pt(i-biq)(2)](2+) complexes are stacked but offset, being in close contact between parts of adjacent i-biq ligands. There is no Pt-Pt interaction also in this case. Two i-biq ligands in the complex are distorted to adopt the bowed conformation due to the steric crowding of the alpha-hydrogens on opposite ligands. Nevertheless, 3 provides almost the same (3)pipi emission spectrum as 1 and 2 in dilute glassy solution at 77 K. The (3)pipi emission spectra observed in the crystals of these Pt(II) complexes are red-shifted compared with those in dilute glassy solution. The fact is attributable to the pi-pi intermolecular interactions between the ligands in the crystals. The factors controlling the crystal structures for these complexes are also discussed. 相似文献
18.
Bigoli F Deplano P Mercuri ML Pellinghelli MA Pilia L Pintus G Serpe A Trogu EF 《Inorganic chemistry》2002,41(20):5241-5248
New [M(R(2)pipdt)(2)](BF(4))(2) salts [R(2)pipdt = N,N'-dialkyl-piperazine-2,3-dithione; M = Pd(II), R = Me and M = Pt(II), R = Me, Et, Pr(i)] bearing redox-active cationic dithiolene complexes have been prepared and characterized. These cations react with the redox-active [M(mnt)(2)](2-) [M = Pd(II), Pt(II); mnt = maleonitrile-2,3-dithiolate] anionic dithiolenes to form salts describable as ion pair charge-transfer complexes. X-ray crystallographic studies have shown that [M(Me(2)pipdt)(2)][M(mnt)(2)] complexes, with M = Pd(II) and Pt(II), are isomorphous. Crystal data of the Pt salt (3a): triclinic, Ponemacr; (No. 2); Z = 1; T = 293(2) K; a = 6.784(7) A, b = 8.460(6) A, c = 13.510(5) A, alpha = 100.63(2) degrees, beta = 104.04(2) degrees, gamma = 96.90(2) degrees; R1 = 0.0691 [wR2 = 0.2187 (all data)]. Structural data show that approximately square-planar [Pt(Me(2)pipdt)(2)] dications and regular square-planar [Pt(mnt)(2)] dianions form an infinite anion-cation one-dimensional stack along axis a with a Pt...Pt a/2 distance of 3.392 A and a Pt...Pt...Pt angle of 180 degrees. Anions and cations arrange themselves face-to-face so as to take on a staggered arrangement. These salts exhibit strong absorptions in the visible-near-infrared region assigned to ion pair charge-transfer transitions. A relation between the optical and thermal electron transfer in the solid state is obtained using a "Marcus-Hush model", and a solid-state electrical conductivity in agreement with expectations is observed. Vibrational spectroscopy is in agreement with the existence of charge-transfer interactions between the cationic and anionic components of the salts. 相似文献
19.
Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated. 相似文献
20.
Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space. 相似文献