Rb(4)Hg(5)(Te(2))(2)(Te(3))(2)Te(3), [Zn(en)3](4)In(16)(Te2)4(Te3)Te22, and K2Cu2(Te2)(Te3): novel metal polytellurides with unusual metal-tellurium coordination

Three novel metal polytellurides Rb(4)Hg(5)(Te(2))(2)(Te(3))(2)Te(3) (I), [Zn(en)(3)](4)In(16)(Te(2))(4)(Te(3))Te(22) (II), and K(2)Cu(2)(Te(2))(Te(3)) (III) have been prepared by solvothermal reactions in superheated ethylenediamine at 160 degrees C. Their crystal structures have been determined by single-crystal X-ray diffraction techniques. Crystal data for I: space group Pnma, a = 9.803(2) A, b = 9.124(2) A, c = 34.714(7) A, Z = 4. Crystal data for II: space group C2/c, a = 36.814(7) A, b = 16.908(3) A, c = 25.302(5) A, beta = 128.46(3) degrees, Z = 4. Crystal data for III: space group Cmcm, a = 11.386(2) A, b = 7.756(2) A, c = 11.985(2) A, Z = 4. The crystal structure of I consists of 1D infinite ribbons of [Hg(5)(Te(2))(2)(Te(3))(2)Te(3)](4-), which are composed of tetrahedral HgTe(4) and trigonal HgTe(3) units connected through the bridging Te(2-), (Te(2))(2-), and (Te(3))(2-) ligands. II is a layered compound containing InTe(4) tetrahedra that share corners and edges via Te, Te(2), and Te(3) units to form a 2D slab that contains relatively large voids. The [Zn(en)(3)](2+) template cations are filled in these voids and between the slabs. The primary building blocks of III are CuTe(4) tetrahedra that are linked by intralayer (Te(3))(2-) and interlayer (Te(2))(2-) units to form a 3D network with open channels that are occupied by the K(+) cations. All three compounds are rare polytelluride products of solvothermal reactions that contain both Te(2) and Te(3) fragments with unusual metal-tellurium coordination.     

Cyano-bridged bimetallic assemblies from hexacyanometalate, [M(CN)6](3-) (M = Mn(III) and Fe(III)), and [M(N4-macrocycle)]2+ (M=Fe(III), Ni(II) and Zn(II)) building blocks. Syntheses, multidimensional structures, and magnetic properties

Reactions between [M(N(4)-macrocycle)](2+) (M = Zn(II) and Ni(II); macrocycle ligands are either CTH = d,l-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradecane or cyclam = 1,4, 8, 11-tetrazaazaciclotetradecane) and [M(CN)(6)](3-) (M = Fe(III) and Mn(III)) give rise to cyano-bridged assemblies with 1D linear chain and 2D honeycomblike structures. The magnetic measurements on the 1D linear chain complex [Fe(cyclam)][Fe(CN)(6)].6H(2)O 1 points out its metamagnetic behavior, where the ferromagnetic interaction operates within the chain and the antiferromagnetic one between chains. The Neel temperature, T(N), is 5.5 K and the critical field at 2 K is 1 T. The unexpected ferromagnetic intrachain interaction can be rationalized on the basis of the axially elongated octahedral geometry of the low spin Fe(III) ion of the [Fe(cyclam)](3+) unit. The isostructural substitution of [Fe(CN)(6)](3-) by [Mn(CN)(6)](3-) in the previously reported complex [Ni(cyclam)](3)[Fe(CN)(6)](2).12H(2)O 2 leads to [Ni(cyclam)](3)[Mn(CN)(6)](2).16 H(2)O 3, which exhibits a corrugated 2D honeycomblike structure and a metamagnetic behavior with T(N) = 16 K and a critical field of 1 T. In the ferromagnetic phase (H > 1 T) this compound shows a very important coercitive field of 2900 G at 2 K. Compound [Ni(CTH)](3)[Fe(CN)(6)](2).13H(2)O 4, C(60)H(116)Fe(2)N(24)Ni(3)O(13), monoclinic, A 2/n, a = 20.462(7), b = 16.292(4), c = 27.262(7) A, beta = 101.29(4) degrees, Z = 4, also has a corrugated 2D honeycomblike structure and a ferromagnetic intralayer interaction, but, in contrast to 2 and 3, does not exhibit any magnetic ordering. This fact is likely due to the increase of the interlayer separation in this compound. ([Zn(cyclam)Fe(CN)(6)Zn(cyclam)] [Zn(cyclam)Fe(CN)(6)].22H(2)O.EtOH) 5, C(44)H(122)Fe(2)N(24)O(23)Zn(3), monoclinic, A 2/n, a = 14.5474(11), b = 37.056(2), c = 14.7173(13) A, beta = 93.94(1) degrees, Z = 4, presents an unique structure made of anionic linear chains containing alternating [Zn(cyclam)](2+) and [Fe(CN)(6)](3)(-) units and cationic trinuclear units [Zn(cyclam)Fe(CN)(6)Zn(cyclam)](+). Their magnetic properties agree well with those expected for two [Fe(CN)(6)](3-) units with spin-orbit coupling effect of the low spin iron(III) ions.     

Mn2(AsS4)4]8- and [Cd2(AsS4)2(AsS5)2]8-: discrete clusters with high negative charge from alkali metal polythioarsenate fluxes

The reaction of Mn and Cd in alkali metal polythioarsenate fluxes afforded four new compounds featuring molecular anions. K(8)[Mn(2)(AsS(4))(4)] (I) crystallizes in the monoclinic space group P2/n with a = 9.1818(8) A, b = 8.5867(8) A, c = 20.3802(19) A, and beta = 95.095(2) degrees. Rb(8)[Mn(2)(AsS(4))(4)] (II) and Cs(8)[Mn(2)(AsS(4))(4)] (III) both crystallize in the triclinic space group P1 with a = 9.079(3) A, b = 9.197(3) A, c = 11.219(4) A, alpha = 105.958(7) degrees, beta = 103.950(5) degrees, and gamma = 92.612(6) degrees for II and a = 9.420(5) A, b = 9.559(5) A, c = 11.496(7) A, alpha = 105.606(14) degrees, beta = 102.999(12) degrees, and gamma = 92.423(14) degrees for III. The discrete dimeric [Mn(2)(AsS(4))(4)](8-) clusters in these compounds are composed of two octahedral Mn(2+) ions bridged by two [AsS(4)](3-) units and chelated each by a [AsS(4)](3-) unit. Rb(8)[Cd(2)(AsS(4))(2)(AsS(5))(2)] (IV) crystallizes in P1 with a = 9.122(2) A, b = 9.285(2) A, c = 12.400(3) A, alpha = 111.700(6) degrees, beta = 108.744 degrees, and gamma = 90.163(5) degrees. Owing to the greater size of Cd compared to Mn, the Cd centers in this compound are bridged by [AsS(5)](3-) units. The [Cd(2)(AsS(4))(4)](8-) cluster is a minor component cocrystallized in the lattice. These compounds are yellow in color and soluble in water.     

Anion-directed crystallization of coordination polymers: syntheses and characterization of Cu(4)(2-pzc)(4)(H(2)O)(8)(Mo(8)O(26)).2H(2)O and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2-pzc = 2-pyrazinecarboxylate)

Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described.     

Homologous series of redox-active, dinuclear cations [M(2)(O(2)CCH(3))(2)(pynp)(2)](2+) (M = Mo, Ru, Rh) with the bridging ligand 2-(2-pyridyl)-1,8-naphthyridine (pynp)

A homologous series of dinuclear compounds with the bridging ligand 2-(2-pyridyl)-1,8-naphthyridine (pynp) has been prepared and characterized by X-ray crystallographic and spectroscopic methods. [Mo(2)(O(2)CCH(3))(2)(pynp)(2)][BF(4)](2) x 3CH(3)CN (1) crystallizes in the monoclinic space group P2(1)/c with a = 15.134(5) A, b = 14.301(6) A, c = 19.990(6) A, beta = 108.06(2) degrees, V = 4113(3) A(3), and Z = 4. [Ru(2)(O(2)CCH(3))(2)(pynp)(2)][PF(6)](2) x 2CH(3)OH (2) crystallizes in the monoclinic space group C2/c with a = 14.2228(7) A, b = 20.3204(9) A, c = 14.1022(7) A, beta = 95.144(1) degrees, V = 4059.3(3) A(3), and Z = 4. [Rh(2)(O(2)CCH(3))(2)(pynp)(2)][BF(4)](2) x C(7)H(8) (3) crystallizes in the monoclinic space group C2/c with a = 13.409(2) A, b = 21.670(3) A, c = 13.726(2) A, beta = 94.865(2) degrees, V = 3973.9(8) A(3), and Z = 4. A minor product, [Rh(2)(O(2)CCH(3))(2)(pynp)(2)(CH(3)CN)(2)][BF(4)][PF(6)] x 2CH(3)CN (4), was isolated from the mother liquor after crystals of 3 had been harvested; this compound crystallizes in the triclinic space group, P1 with a = 12.535(3) A, b = 13.116(3) A, c = 13.785(3) A, alpha = 82.52(3) degrees, beta = 77.70(3) degrees, gamma = 85.76(3) degrees, V = 2193.0(8) A(3), and Z = 2. Compounds 1-3 constitute a convenient series for probing the influence of the electronic configuration on the extent of mixing of the M-M orbitals with the pi system of the pynp ligand. Single point energy calculations performed on 1-3 at the B3LYP level of theory lend insight into the bonding in these compounds and allow for correlations to be made with electronic spectral data. Although purely qualitative in nature, the values for normalized change in orbital energies (NCOE) of the frontier orbitals before and after reduction are in agreement with the observed differences in reduction potentials as determined by cyclic voltammetry.     

Synthesis, Structure, and Reactivity of [Zr(6)Cl(18)H(5)](2)(-), the First Paramagnetic Species of Its Class

Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4.     

Metal Complexes of Dithiolate Ligands: 5,6-Dihydro-1,4-dithiin-2,3-dithiolato (dddt(2-)), 5,7-Dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2-)), and 2-Thioxo-1,3-dithiole-4,5-dithiolato (dmit(2-)). Synthesis, Electrochemical Studies, Crystal and Electronic Structures, and Conducting Properties

New precursors to potentially conductive noninteger oxidation state (NIOS) compounds based on metal complexes [ML(2)](n)()(-) [M = Ni, Pd, Pt; L = 5,6-dihydro-1,4-dithiin-2,3-dithiolato (dddt(2)(-)), 5,7-dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2)(-)), and 2-thioxo-1,3-dithiole-4,5-dithiolato (dmit(2)(-)); n = 2, 1, 0] have been investigated. Complexes of the series (NR(4))[ML(2)] (R = Me, Et, Bu; L = dddt(2)(-), dtdt(2)(-)) have been isolated and characterized, and the crystal structure of (NBu(4))[Pt(dtdt)(2)] (1) has been determined {1 = C(24)H(44)NPtS(10), a = 12.064(2) ?, b = 17.201(3) ?, c = 16.878(2) ?, beta = 102.22(2) degrees, V = 3423(1) ?(3), monoclinic, P2(1)/n, Z = 4}. Oxidation of these complexes affords the corresponding neutral species [ML(2)](0). Another series of general formula (cation)(n)()[M(dmit)(2)] [cation = PPN(+), BTP(+), and (SMe(y)()Et(3)(-)(y)())(+) with y = 0, 1, 2, and 3, n = 2, 1, M = Ni, Pd] has also been studied. All of these (cation)(n)()[M(dmit)(2)] complexes have been isolated and characterized [with the exception of (cation)[Pd(dmit)(2)] for cation = (SMe(y)()Et(3)(-)(y)())(+)]. The crystal structures of (PPN)[Ni(dmit)(2)].(CH(3))(2)CO (2) and (SMeEt(2))[Ni(dmit)(2)] (3) have been determined {2 = C(45)H(36)NNiS(10)P(2)O, a = 12.310(2) ?, b = 13.328(3) ?, c = 15.850(3) ?, alpha = 108.19(3) degrees, beta = 96.64(2) degrees, gamma = 99.67(2) degrees, V = 2373(1) ?(3), triclinic, P&onemacr;, Z = 2; 3 = C(11)H(13)NiS(11), a = 7.171(9) ?, b = 17.802(3) ?, c = 16.251(3) ?, beta = 94.39(4) degrees, V = 2068(2) ?(3), monoclinic, P2(1)/n, Z = 4} NIOS salts derived from the preceding precursors were obtained by electrochemical oxidation. Electrochemical studies of the [M(dddt)(2)] complexes show that they may be used for the preparation of NIOS radical cation salts and [M(dddt)(2)][M'(dmit)(2)](x)() compounds, but not for the preparation of (cation)[M(dddt)(2)](z)() NIOS radical anion salts. The electrochemical oxidation of the [M(dtdt)(2)](-) complexes always yields the neutral [M(dtdt)(2)](0) species. The crystal structure of [Pt(dddt)(2)][Ni(dmit)(2)](2) (4) has been determined and is consistent with the low compaction powder conductivity (5 x 10(-)(5) S cm(-)(1) at room temperature) {4 = C(20)H(8)Ni(2)PtS(28), a = 20.336(4) ?, b = 7.189(2) ?, c = 14.181(2) ?, beta = 97.16(2) degrees, V = 2057(1) ?(3), monoclinic, C2/m, Z = 2}. The crystal structures of the semiconducting NIOS compounds (BTP)[Ni(dmit)(2)](3) (5) and (SMe(3))[Ni(dmit)(2)](2) (6) have been determined {5 = C(43)H(22)PNi(3)S(30), a = 11.927(2) ?, b = 24.919(2) ?, c = 11.829(3) ?, alpha = 93.11(1) degrees, beta = 110.22(1) degrees, gamma = 83.94(1) degrees, V = 3284(1) ?(3), triclinic, P&onemacr;, Z = 2; 6 = C(15)H(9)Ni(2)S(21), a = 7.882(1) ?, b = 11.603(2) ?, c = 17.731(2) ?, alpha = 77.44(1) degrees, beta = 94.39(1) degrees, gamma = 81.27(1) degrees, V = 1563(1) ?(3), triclinic, P&onemacr;, Z = 2}. The parent compound (SEt(3))[Ni(dmit)(2)](z) (unknown stoichiometry) is also a semiconductor with a single-crystal conductivity at room temperature of 10 S cm(-)(1). By contrast, the single-crystal conductivity at room temperature of (SMeEt(2))[Pd(dmit)(2)](2) (7) is rather high (100 S cm(-)(1)). 7 behaves as a pseudometal down to 150 K and undergoes an irreversible metal-insulator transition below this temperature. The crystal structure of 7 has been determined {7 = C(17)H(13)NPd(2)S(21), a = 7.804(4) ?, b = 36.171(18) ?, c = 6.284(2) ?, alpha = 91.68(4) degrees, beta = 112.08(4) degrees, gamma = 88.79(5) degrees, V = 1643(1) ?(3), triclinic, P&onemacr;, Z = 2}. The electronic structure of (SMeEt(2))[Pd(dmit)(2)](2) (7) and the possible origin of the metal-insulator transition at 150 K are discussed on the basis of tight-binding band structure calculations.     

Ge(7)O(13)(OH)(2)F(3)](3)(-).Cl(-).2[Ni(dien)(2)](2+): the first chainlike germanate templated by a transition metal complex

The first chainlike germanate, [Ge(7)O(13)(OH)(2)F(3)](3)(-).Cl(-).2[Ni(dien)(2)](2+), has been solvothermally synthesized by using Ni(dien)(2)(2+) cations as the template and characterized by IR, SEM, TGA, powder X-ray diffraction (PXRD), energy-dispersive X-ray analysis (EDXA), elemental analysis, and single-crystal X-ray diffraction, respectively. This compound crystallized in the monoclinic space group P2/nwith a = 8.8904(2) A, b = 17.4374(3) A, c = 13.2110(3) A, beta = 101.352(1) degrees, V = 2007.97(7) A(3), and Z = 2. Interestingly, the structure contains two types of chiral mer-[Ni(dien)(2)](2+) cations and two types of chiral chains, one left-handed and the other right-handed, which lead to a racemic compound. The orderly separation of achiral s-fac-[Ni(dien)(2)](2+) and chiral mer-[Ni(dien)(2)](2+) isomers was found in the structure. The structure is stabilized by N-H.O(F, Cl) hydrogen bonds.     

Syntheses and structural characterizations of sheet- and column-like lanthanide-transition metal arrays: the effect of hydrogen bonding on the structure when K(+) is replaced by [NH4]+

Sheet- and column-like cyanide bridged lanthanide-transition metal arrays were synthesized through metathesis reactions between anhydrous LnCl(3) (Ln = Eu, Yb) and A(2)[M(CN)(4)] (A = K(+), NH(4)(+); M = Ni, Pt) in a 1:2 molar ratio in DMF (DMF = N,N-dimethylformamide) solution. Single-crystal X-ray analysis revealed that complexes of formula [K(DMF)(7)Ln[M(CN)(4)](2)](infinity) (Ln = Eu, M = Ni, 1; Ln = Yb, M = Pt, 2) consist of infinite layers of neutral, puckered sheets that contain hexagonal rings of composition [(DMF)(10)Ln(2)[M(CN)(4)](3)](6) with interstitial (DMF)(4)K(2)[M(CN)(4)] units located between the layers. The sheet structure is generated through the repeating (DMF)(10)Ln(2)[M(CN)(4)](3) unit with trans cyanide ligands in [M(CN)(4)](2)(-) serving as bridges. The column-like complex [(NH(4))(DMF)(4)Yb[Pt(CN)(4)](2)](infinity), 3, is formed when NH(4)(+) replaces K(+). It consists of infinite, negatively charged, square, parallel columns bundled through N-H...NC hydrogen bonds between NH(4)(+) and terminal CN from the columns. Cis cyanide ligands in [Pt(CN)(4)](2)(-) units serve as bridges. Complex 3 is the first known example where Ln(III) centers are coordinated to four [M(CN)(4)](2)(-) units. Bicapped (square face) trigonal prismatic coordination geometries were observed for Ln(III) centers in 1 and 2. Square antiprismatic geometry for Yb(III) centers are observed in 3. Crystal data for 1: triclinic space group P1, a = 8.797(2) A, b = 15.621(3) A, c = 17.973(6) A, alpha = 105.48(2) degrees, beta = 98.60(2) degrees, gamma = 98.15(2) degrees, Z = 2. Crystal data for 2: triclinic space group P1, a = 8.825(1) A, b = 15.673(1) A, c = 17.946(1) A, alpha = 105.46(2) degrees, beta = 99.10(1) degrees, gamma = 98.59(1) degrees, Z = 2. Crystal data for 3: monoclinic space group P2(1)/c, a = 9.032(1) A, b = 29.062(1) A, c = 15.316(1) A, beta = 94.51(1) degrees, Z = 2.     

Modified polyoxometalates: Hydrothermal syntheses and crystal structures of three novel reduced and capped Keggin derivatives decorated by transition metal complexes

Three novel polyoxometalate derivatives decorated by transition metal complexes have been hydrothermally synthesized. Compound 1 consists of [PMo(VI)(6)Mo(V)(2)V(IV)(8)O(44)[Co (2,2'-bipy)(2)(H(2)O)](4)](3+) polyoxocations and [PMo(VI)(4-)Mo(V)(4)V(IV)(8)O(44)[Co(2,2'-bipy)(2)(H(2)O)](2)](3-) polyoxoanions, which are both built on mixed-metal tetracapped [PMo(8)V(8)O(44)] subunits covalently bonded to four or two [Co(2,2'-bpy)(2)(H(2)O)](2+) clusters via terminal oxo groups of the capping V atoms. Compound 2 is built on [PMo(VI)(8)V(IV)(6)O(42)[Cu(I)(phen)](2)](5-) clusters constructed from mixed-metal bicapped [PMo(VI)(8)V(IV)(6)O(42)](7-) subunits covalently bonded to two [Cu(phen)](+) fragments in the similar way to 1. The structure of 3 is composed of [PMo(VI)(9)Mo(V)(3)O(40)](6-) units capped by two divalent Ni atoms via four bridging oxo groups. The crystal data for these are the following: C(120)H(126)Co(6)Mo(16)N(24)O(103)P(2)V(16) (1), triclinic P1, a = 15.6727(2) A, b = 17.3155(3) A, c = 19.5445(2) A, alpha = 86.1520(1) degrees, beta = 81.2010(1) degrees, gamma = 63.5970(1) degrees, Z = 1; C(120)H(85)Cu(6-)Mo(8)N(20)O(44)PV(6) (2), triclinic P1, a = 14.565(4) A, b = 15.899(3) A, c = 16.246(4) A, alpha = 116.289(2) degrees, beta = 103.084(2) degrees, gamma = 94.796(2) degrees, Z = 1; C(60)H(40)Mo(12)N(10)Ni(3)O(40)P (3), monoclinic P2(1)/c, a = 14.804(3) A, b = 22.137(4) A, c = 25.162(5) A, alpha = 90 degrees, beta = 98.59(3) degrees, gamma = 90 degrees, Z = 4.     

Crystal Structures and Magnetic Properties of Novel [Ln(III)Cu(II)(4)] (Ln = Gd, Dy, Ho) Pentanuclear Complexes. Topology and Ferromagnetic Interaction in the Ln(III)-Cu(II) Pair

The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data.     

Synthesis, Structure, and Reactivities of [eta(2)-P(7)M(CO)(4)](3)(-), [eta(2)-HP(7)M(CO)(4)](2)(-), and [eta(2)-RP(7)M(CO)(4)](2)(-) Zintl Ion Complexes Where M = Mo, W

Ethylenediamine (en) solutions of [eta(4)-P(7)M(CO)(3)](3)(-) ions [M = W (1a), Mo (1b)] react under one atmosphere of CO to form microcrystalline yellow powders of [eta(2)-P(7)M(CO)(4)](3)(-) complexes [M = W (4a), Mo (4b)]. Compounds 4 are unstable, losing CO to re-form 1, but are highly nucleophilic and basic. They are protonated with methanol in en solvent giving [eta(2)-HP(7)M(CO)(4)](2)(-) ions (5) and are alkylated with R(4)N(+) salts in en solutions to give [eta(2)-RP(7)M(CO)(4)](2)(-) complexes (6) in good yields (R = alkyl). Compounds 5 and 6 can also be prepared by carbonylations of the [eta(4)-HP(7)M(CO)(3)](2)(-) (3) and [eta(4)-RP(7)M(CO)(3)](2)(-) (2) precursors, respectively. The carbonylations of 1-3 to form 4-6 require a change from eta(4)- to eta(2)-coordination of the P(7) cages in order to maintain 18-electron configurations at the metal centers. Comparative protonation/deprotonation studies show 4 to be more basic than 1. The compounds were characterized by IR and (1)H, (13)C, and (31)P NMR spectroscopic studies and microanalysis where appropriate. The [K(2,2,2-crypt)](+) salts of 5 were characterized by single crystal X-ray diffraction. For 5, the M-P bonds are very long (2.71(1) ?, average). The P(7)(3)(-) cages of 5 are not displaced by dppe. The P(7) cages in 4-6 have nortricyclane-like structures in contrast to the norbornadiene-type geometries observed for 1-3. (31)P NMR spectroscopic studies for 5-6 show C(1) symmetry in solution (seven inequivalent phosphorus nuclei), consistent with the structural studies for 5, and C(s)() symmetry for 4 (five phosphorus nuclei in a 2:2:1:1:1 ratio). Crystallographic data for [K(2,2,2-crypt)](2)[eta(2)-HP(7)W(CO)(4)].en: monoclinic, space group C2/c, a = 23.067(20) ?, b = 12.6931(13) ?, c = 21.433(2) ?, beta = 90.758(7) degrees, V = 6274.9(10) ?(3), Z = 4, R(F) = 0.0573, R(w)(F(2)) = 0.1409. For [K(2,2,2-crypt)](2)[eta(2)-HP(7)Mo(CO)(4)].en: monoclinic, space group C2/c, a = 22.848(2) ?, b = 12.528(2) ?, c = 21.460(2) ?, beta = 91.412(12) degrees, V = 6140.9(12) ?(3), Z = 4, R(F) = 0.0681, R(w)(F(2)) = 0.1399.     

Coordination polymers assembled from angular dipyridyl ligands and CuII, CdII, CoII salts: crystal structures and properties

Six new metal-organic coordination networks based on linking unit 2,5-bis(4-pyridyl)-1,3,4-thiadiazole (L(1)) or 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L(3)) and inorganic Cu(II), Cd(II), and Co(II) salts have been prepared and structurally characterized by single-crystal X-ray analysis. Using L(1) to react with three different Cu(II) salts, Cu(OAc)(2).H(2)O, Cu(NO(3))(2).3H(2)O, and CuSO(4).5H(2)O, respectively, two different one-dimensional (1-D) coordination polymers, [[Cu(2)L(1)(mu-OAc)(4)](CHCl(3))(2)](n) (1) [triclinic, space group P1, a = 7.416(3) A, b = 8.207(3) A, c = 14.137(5) A, alpha = 100.333(7) degrees, beta = 105.013(6) degrees, gamma = 94.547(6) degrees, Z = 1] and [[CuL(1)(NO(3))(2)](CHCl(3))(0.5)](n) (2) [monoclinic, space group C2/c, a = 28.070(8) A, b = 9.289(3) A, c = 15.235(4) A, beta = 113.537(5) degrees, Z = 8], and a chiral 3-D open framework, [[CuL(1)(H(2)O)(SO(4))](H(2)O)(2)](n) (3) [orthorhombic, space group P2(1)2(1)2(1), a = 5.509(2) A, b = 10.545(4) A, c = 29.399(11) A, Z = 4], were obtained. Reaction of L(1) and Cd(ClO(4))(2).6H(2)O or Co(ClO(4))(2).6H(2)O, in the presence of NH(4)SCN, yielded another 3-D open framework, [[CdL(1)(NCS)(2)](CH(3)OH)(1.5)](n) (4) [monoclinic, space group C2/c, a = 28.408(10) A, b = 9.997(5) A, c = 7.358(4) A, beta = 99.013(8) degrees, Z = 4], or a 2-D network, [[Co(L(1)())(2)(NCS)(2)](H(2)O)(2.5)](n) (5) [orthorhombic, space group Pnna, a = 22.210(5) A, b = 12.899(3) A, c = 20.232(4) A, Z = 4]. When L(1) was replaced by L(3) to react with Co(ClO(4))(2).6H(2)O and NH(4)SCN, another 2-D coordination polymer, [Co(L(3))(2)(NCS)(2)](n) (6) [monoclinic, space group P2(1)/c, a = 8.120(3) A, b = 9.829(4) A, c = 17.453(6) A, beta = 103.307(6) degrees, Z = 2], was constructed. These results indicate that the nature of the ligands, metal centers, or counteranions plays the critical role in construction of these novel coordination polymers. The interesting porous natures of two 3-D open frameworks 3 and 4 were investigated by TGA and XPRD techniques, and the magnetic properties of the Cu(II) and Co(II) complexes were studied by variable-temperature magnetic susceptibility and magnetization measurements.     

Composition Space of the (CuO, (1)/(2)Nb(2)O(5))/(HF)(x)().pyridine/H(2)O System. Structure and Synthesis of [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2-) and CuNb(py)(4)OF(5)

Single crystals of [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-) and CuNb(py)(4)OF(5) were synthesized in a (HF)(x)().pyridine/pyridine/water solution (150 degrees C, 24 h, autogeneous pressure) using CuO and Nb(2)O(5) as reagents. The compound [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-) contains clusters of [CuNb(2)(py)(4)O(2)F(10)](2)(-) anions linked through N-H(+).F hydrogen bonds to the [pyH(+)] cations. In contrast CuNb(py)(4)OF(5) is a unidimensional compound consisting only of chains, perpendicular to the c axis, of alternating [Cu(py)(4)(O/F)(2/2)](0.5+) and [NbF(4)(O/F)(2/)(2)](0.5)(-) octahedra. The chains change direction between the [110] and [1&onemacr;0] every c/2. Crystal data for [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-): tetragonal, space group I4(1)22 (No. 98),with a = 11.408(3) ?, c = 30.36(1) ?, and Z = 4. Crystal data for CuNb(py)(4)OF(5): monoclinic, space group C2/c (No. 15), with a = 10.561(3) ?, b = 13.546(6) ?, c = 16.103(4) ?, beta = 97.77(2) degrees, and Z = 4.     

N,N,N ',N '-Tetrakis(2-pyridylmethyl)ethylenediamine and its analogues as hypodentate ligands. Synthesis and characterization of the rhodium(III), ruthenium(II), and palladium(II) complexes

New complexes of Rh(III), Ru(II), and Pd(II) with N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (tpen) and its analogues have been prepared. The reaction of RhCl(3).nH(2)O with tpen is slow and allows one to isolate the products of three consecutive substitution steps: Rh(2)Cl(6)(tpen) (1), cis-[RhCl(2)(eta(4)-tpen)](+) (2), and [RhCl(eta(5)-tpen)](2+) (3). In acetonitrile the reaction stops at the step of the formation of cis-[RhCl(2)(eta(4)-tpen)](+), whereas [RhCl(eta(5)-tpen)](2+) is the final product of the further reaction in ethanol. Fully chelated [Rh(tpen)](3+) could not be obtained. Bis(acetylacetonato)palladium(II), Pd(acac)(2), reacts with tpen and its analogues, N,N,N',N'-tetrakis(2-pyridylmethyl)-1,3-propanediamine (tptn) and N,N,N',N'-tetrakis(2-pyridylmethyl)-(R)-1,2-propylenediamine (R-tppn), to give [Pd(eta(4)-tpen)](2+) (4), [Pd(eta(4)-tppn)](2+) (5), and [Pd(eta(4)-tptn)](2+) (6), respectively. Two pyridyl arms remain uncoordinated in these cases. The formation of unstable Pd(III) complexes from these Pd(II) complexes in solution was suggested on the basis of electrochemical measurements. Ruthenium(III) trichloride, RuCl(3).nH(2)O, is reduced to give a Ru(II) complex with fully coordinated tpen, [Ru(tpen)](2+) (7). The same product was obtained in a more straightforward reaction of Ru(II)Cl(2)(dimethyl sulfoxide)(4) with tpen. Electrochemical studies showed a quasi-reversible [Ru(tpen)](2+/3+) couple for [7](ClO(4))(2) (E(1/2) = 1.05 V vs Ag/AgCl). Crystal structures of [2](PF(6)).2CH(3)CN, [3](PF(6))(2).CH(3)CN, [6](ClO(4))(2), and [7](ClO(4))(2).0.5H(2)O were determined. Crystal data: [2](PF(6)).2CH(3)CN, monoclinic, C2, a = 16.974(4) A, b = 8.064(3) A, c = 13.247(3) A, beta = 106.37(2) degrees, V = 1739.9(8) A(3), Z = 2; [3](PF(6))(2).CH(3)CN, triclinic, P1, a = 11.430(1) A, b = 19.234(3) A, c = 8.101(1) A, alpha = 99.43(1) degrees, beta = 93.89(1) degrees, gamma = 80.10(1) degrees, V = 1729.3(4) A(3), Z = 2; [6](ClO(4))(2), orthorhombic, Pnna, a = 8.147(1) A, b = 25.57(1) A, c = 14.770(4) A, V = 3076(3) A(3), Z = 4; [7](ClO(4))(2).0.5H(2)O, monoclinic, P2(1)/c, a = 10.046(7) A, b = 19.049(2) A, c = 15.696(3) A, beta = 101.46(3) degrees, V = 2943(2) A(3), Z = 4.     

Novel metal-organic frameworks with specific topology from new tripodal ligands: 1,3,5-tris(1-imidazolyl)benzene and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene

Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks.     

Multi-iron silicotungstates: synthesis, characterization, and stability studies of polyoxometalate dimers

The reaction of Fe(III) with Na(+) and K(+) salts of the trivacant [alpha-SiW(9)O(34)](10)(-) ligand have been investigated at pH 6 and pH 1. A new dimer, [(alpha-SiFe(3)W(9)(OH)(3)O(34))(2)(OH)(3)](11-) (1), is synthesized by reacting Na(7)H(3)[alpha-SiW(9)O(34)] or K(10)[alpha-SiW(9)O(34)] with exactly 3 equiv of Fe(III) in a 0.5 M sodium acetate solution (pH 6). The structure of 1, determined by single-crystal X-ray diffraction (a = 22.454(2) A, b = 12.387(2) A, c = 37.421(2), beta = 100.107(8) degrees , monoclinic, C2/c, Z = 4, R(1) = 5.11% based on 12739 independent reflections), consists of two [alpha-SiFe(3)W(9)(OH)(3)O(34)](4-) units linked by three Fe-mu-OH-Fe bonds. Reaction of K(10)[alpha-SiW(9)O(34)] with 3 equiv of Fe(III) in water (pH 1) yields [(alpha-Si(FeOH(2))(2)FeW(9)(OH)(3)O(34))(2)](8)(-2). The structure of 2 was also determined by single-crystal X-ray diffraction (a = 36.903(2) A, b = 13.9868(9) A, c = 21.7839(13) A, beta = 122.709(1) degrees , monoclinic, C2/c, Z = 4, R(1) = 4.57% based on 11787 independent reflections). It consists of two [alpha-Si(FeOH(2))(2)FeW(9)(OH)(3)O(34)](4-) Keggin units linked by a single edge. The terminal ligand on Fe1 in each trisubstituted Keggin unit becomes a mu(2) oxo ligand bridging to a [WO(6)](2-) moiety. The UV-vis spectra of both complexes show the characteristic oxygen-to-metal-charge-transfer bands of polyoxometalates as well as an Fe(III)-centered band at 436 nm (epsilon = 146 M(-1) cm(-1)) and 456 nm (epsilon = 104 M(-1) cm(-1)) for complexes 1 and 2, respectively. Differential scanning calorimetry data show that complex 1 decomposes between 575 and 600 degrees C whereas no decomposition is observed for complex 2 up to temperatures of 600 degrees C.     

Synthesis and characterization of six new quaternary actinide thiophosphate compounds: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6)(,) K(10)Th(3)(P(2)S(7))(4)(PS(4))(2), and A(5)An(PS(4))(3), (A = K, Rb, Cs; An = U, Th)

Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6).     

Synthesis, Reactivity, and Structural Characterization of the Nonclassical [MTe(7)](n)()(-) Anions (M = Ag, Au, n = 3; M = Hg, n = 2)

Several tellurometalates of the general formula [MTe(7)](n)()(-) (n = 2, 3) have been isolated as salts of organic cations by reaction of suitable metal sources with polytelluride solutions in DMF. The [HgTe(7)](2)(-) anion has the same structure in both the NEt(4)(+) and the PPh(4)(+) salts except for a minor change in the ligand conformation. The [AgTe(7)](3)(-) and [HgTe(7)](2)(-) anions contain metal atoms coordinated in trigonal-planar fashion to eta(3)-Te(7)(4)(-) ligands. The central Te atom of an eta(3)-Te(7)(4)(-) ligand is coordinated to the metal atom and to two Te atoms in a "T"-shaped geometry consistent with a hypervalent 10 e(-) center. The planar [AuTe(7)](3)(-) anion may best be described as possessing a square-planar Au(III) atom coordinated to an eta(3)-Te(5)(4)(-) ligand and to an eta(1)-Te(2)(2)(-) ligand. The reaction of [NEt(4)](n)()[MTe(7)] (M = Hg, n = 2; M = Au, n = 3) with the activated acetylene dimethyl acetylenedicarboxylate (DMAD) has yielded the products [NEt(4)](n)()[M(Te(2)C(2)(COOCH(3))(2))(2)] (M = Hg, n = 2; M = Au, n = 1). The metal atoms are coordinated to two Te(COOCH(3))C=C(COOCH(3))Te(2)(-) ligands, for M = Hg in a distorted tetrahedral fashion and for M = Au in a square-planar fashion.     

Self-assembled supramolecular M9 (Mn(II), Fe(III), Zn(II)), M5 (Fe(III)), and [M3]2 (Pb(II)) complexes: structural,magnetic, and Mössbauer properties

The tritopic ligand 2poap self-assembles in the presence of Zn(NO(3))(2) and Fe(NO(3))(3) to form homoleptic [3 x 3] nonanuclear M(9) (M = Zn(II), Fe(III)) square grid structures and with Pb(ClO(4))(2) to form a dimerized linear trinuclear [Pb(3)](2) structure. Cl2poap and Cl2poapz form self-assembled homoleptic [3 x 3] Mn(II)(9) square grids with Mn(ClO(4))(2) and Mn(NO(3))(2), respectively, but an unusual incompletely metalated Fe(III)(5) square grid is formed on reaction of Cl2poap with Fe(ClO(4))(3). X-ray structures are reported for [Mn(9)(Cl2poap-2H)(6)](ClO(4))(6).10H(2)O (3), [Mn(9)(Cl2poapz-2H)(6)] (NO(3))(6).22H(2)O (4), [Zn(9)(2poap-2H)(3)(2poap-H)(3)](NO(3))(9).24H(2)O (5), [Pb(3)(2poap-2H) (ClO(4))(4)](2).8H(2)O (6), and [Fe(5)(Cl2poap-H)(6)](ClO(4))(9).34.5H(2)O (7). Compound 3 crystallized in the monoclinic system, space group P(-)1, with a = 18.179(1) A, b = 18.857(1) A, c = 25.871(2) A, alpha = 70.506(2) degrees, beta = 86.440(1) degrees, gamma = 75.175(2) degrees, and z = 2. Compound 4 crystallized in the monoclinic system, space group P(-)1, with a = 16.900(2) A, b = 20.02393) A, c = 25.663() A, alpha = 84.743(3) degrees, beta = 84.885(2) degrees, gamma = 67.081(2) degrees, and z = 2. Compound 5 crystallized in the monoclinic system, space group P(-)1, with a = 18.482(1) A, b = 18.774(1) A, c = 28.112(2) A, alpha = 104.020(1) degrees, beta = 97.791(1) degrees, gamma = 117.036(1) degrees, and z = 2. Compound 6 crystallized in the monoclinic system, space group P(-)1, with a = 10.0513(6) A, b = 11.0958(6) A, c = 17.334(1) A, alpha = 100.932(1) degrees, beta = 100.387(1) degrees, gamma = 94.565(1) degrees, and z = 2. Compound 7 crystallized in the monoclinic system, space group P(-)1, with a = 19.164(1) A, b = 19.587(2) A, c = 26.673(2) A, alpha = 76.430(2) degrees, beta = 78.834(2) degrees, gamma = 64.973(1) degrees, and z = 2. Compound 3 exhibits intramolecular antiferromagnetic exchange within the nonanuclear [Mn(9)(mu-O)(12)] grid structure (J = -4.6 cm(-1)), while the analogous nonanuclear complex [Fe(9)(2poap-2H)(6)](NO(3))(15).18H(2)O (8) is dominated by intramolecular antiferromagnetic coupling at high temperatures but exhibits a low-temperature feature indicative of additional ferromagnetic interactions. The isolated pentanuclear Fe(5) [4 + 1] square grid in 7, with distant Fe-Fe bridging, exhibits very weak antiferromagnetic coupling (J = -0.2 cm(-1)). M?ssbauer spectroscopy data are consistent with high-spin Fe(III)(9) and Fe(III)(5) structures.