1H NMR, EPR, UV-Vis, and Electrochemical Studies of Imidazole Complexes of Ru(III). Crystal Structures of cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) and [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O

Comparisons of the spectroscopic properties of a number of Ru(III) complexes of imidazole ligands provide methods of distinguishing between various types of bonding that can occur in proteins and nucleic acids. In particular, EPR and (1)H NMR parameters arising from the paramagnetism of Ru(III) should aid in determining binding sites of Ru(III) drugs in macromolecules. Electrochemical studies on several imidazole complexes of ruthenium suggest that imidazole may serve as a significant pi-acceptor ligand in the presence of anionic ligands. Crystal structures are reported on two active immunosuppressant complexes. cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) crystallizes in the triclinic space group P&onemacr; (No. 2) with the cell parameters a = 8.961(2) ?, b = 12.677(3) ?, c = 7.630(2) ?, alpha = 98.03(2) degrees, beta = 100.68(2) degrees, gamma = 81.59(2) degrees, and Z = 2 (R = 0.044). [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O crystallizes in the monoclinic space group P2(1)/n (No. 14) with the cell parameters a = 7.994(2) ?, b = 13.173(4) ?, c = 14.904(2) ?, beta = 97.89(1) degrees, and Z = 2 (R = 0.052). The average Ru(II)-N bond distance is 2.106(8) ?.     

Structural Chemistry of Poly(ethylene glycol) Complexes of Lead(II) Nitrate and Lead(II) Bromide

The reaction of 1:1 stoichiometries (1:1.5 for the nitrate/tetraethylene glycol (EO4) and pentaethylene glycol (EO5) complexes) of PbX(2) (X = NO(3), Br) with five- to eight-donor poly(ethylene glycols) (PEGs) in 3:1 CH(3)CN/CH(3)OH (CH(3)CN only for the nitrate/EO5 complex) followed by solvent evaporation resulted in six crystalline materials upon which X-ray structural analyses were carried out: [Pb(NO(3))(2)(EO4)](n)(), [Pb(NO(3))(2)(EO5)], [Pb(NO(3))(2)(EO6)], [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O, [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2), and [PbBr(EO7)][PbBr(3)]. The nitrates crystallize as tight ion pairs with the PEG ligands coordinating in an equatorial plane around the Pb(2+) ions. Because EO4 has only five oxygen donors, this complex exhibits steric unsaturation which is overcome by a monodentate interaction with a third nitrate anion that is also coordinated to a neighboring Pb(2+) ion. The six donors of EO5 coordinate in an equatorial plane resulting in a 10-coordinate complex with trans, twisted, bidentate nitrate anions. The seven-donor hexaethylene glycol (EO6) only uses six of its oxygen donors to coordinate Pb(2+). [Pb(NO(3))(2)(EO4)](n)() is monoclinic, P2(1)/c, with a = 7.902(3) ?, b = 22.136(6) ?, c = 8.910(2) ?, beta = 90.96(3) degrees, and Z = 4. [Pb(NO(3))(2)(EO5)] is triclinic P&onemacr;, with a = 9.332(3) ?, b = 10.025(3) ?, c = 11.688(4) ?, alpha = 68.41(3) degrees, beta = 68.39(3) degrees, gamma = 68.58(3) degrees, and Z = 2. [Pb(NO(3))(2)(EO6)] is monoclinic P2(1)/c, with a = 16.289(4) ?, b = 10.773(4) ?, c = 12.329(4) ?, beta = 106.77(2) degrees, and Z = 4. Lead(II) bromide complexes with PEGs tend to crystallize as PEG complexed cations with polymeric lead(II) bromide anions. In the EO5 complex, bromide anions in the polymer also coordinate to the PEG-wrapped Pb(2+) cations. The hexa- and heptaethylene glycol (EO6 and EO7, respectively) complexes contain discreet ions. In these halide complexes, EO7 is the only PEG to expand the Pb(2+) coordination number from eight to nine. [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O is triclinic P&onemacr;, with a = 7.922(6) ?,b = 15.802(9) ?, c = 19.001(9) ?, alpha = 73.19(8) degrees, beta = 88.91(9) degrees, gamma = 87.22(9) degrees, and Z = 4. [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2) is monoclinic P2(1)/c, with a = 14.389(4) ?, b = 31.931(9) ?, c = 8.029(2) ?, beta = 97.76(3) degrees, and Z = 2. [PbBr(EO7)][PbBr(3)] is monoclinic Cc, with a = 13.165(3) ?, b = 24.732(5) ?, c = 8.007(1) ?, beta = 94.58(2) degrees, and Z = 4.     

An EPR and 1H NMR active mixed-valence manganese (III/II/III) trinuclear compound

A mixed-valence Mn(III)-Mn(II)-Mn(III) trinuclear complex of stoichiometry MnIIIMnIIMnIII(Hsaladhp)2(Sal)4.2CH3CN (1), where H3saladhp is a tridentate Schiff-base ligand, has been structurally characterized with X-ray crystallography. The Mn(III)Mn(II)Mn(III) angles are strictly 180 degrees as required by crystallographic inversion symmetry. The complex is valence-trapped with two terminal Mn(III) ions in a distorted square pyramidal geometry. The Mn(III)...Mn(II) separation is 3.495 A. The trinuclear complex shows small antiferromagnetic exchange J coupling. The magnetic parameters obtained from the fitting procedure in the temperature range 10-300 K are J1 = -5.7 cm-1, g = 2.02, zJ = -0.19 cm-1, and R = 0.004. The EPR spectrum was obtained at 4 K in CHCl3 and in tetrahydrofuran glasses. The low-field EPR signal is a superposition of two signals, one centered around g = 3.6 and the other, for which hyperfine structure is observed, centered around g = 4.1 indicating an S = 3/2 state. In addition, there is a 19-line signal at g = 2.0. The multiline signal compares well with that observed for the S2 or S0* states of the oxygen-evolving complex. 1H NMR data reveal that the trinuclear compound keeps its integrity into the CHCl3 solution. Crystal data for complex 1: [C54H52N4O18Mn3], M = 1209.82, triclinic, space group P1, a = 10.367(6) A, b = 11.369(6) A, c = 13.967(8) A; alpha = 112.56(1) degree, beta = 93.42(2) degrees, gamma = 115.43(1) degree, Z = 1.     

Stereochemical Consequences of the Bismuth Atom Electron Lone Pair, a Comparison between MX(6)E and MX(6) Systems. Crystal and Molecular Structures of Tris[N-(P,P-diphenylphosphinoyl)-P,P-diphenylphosphinimidato]bismuth(III), [Bi{(OPPh(2))(2)N}(3)], -indium(III), [In{(OPPh(2))(2)N}(3)].C(6)H(6), and -gallium(III), [Ga{(OPPh(2))(2)N}(3)].CH(2)Cl(2)

The tetraphenylimidodiphosphinate [N-(P,P-diphenylphosphinoyl)-P,P-diphenylphosphinimidate] ion forms stable tris-chelates with the Bi(III), In(III), and Ga(III) cations. The crystal and molecular structures of [M{(OPPh(2))(2)N}(3)] (M = Ga, In, Bi) were determined by X-ray diffractometry. The geometry around the bismuth atom in compound 3 displays an approximately C(3)(v)() symmetry. This arrangement suggests the presence of a stereoactive lone pair of electrons, which is located in one of the triangular octahedral faces. Derivative 3 crystallizes in the triclinic space group P&onemacr; with Z = 2, a = 14.006(6) ?, b = 14.185(4) ?, c = 17.609(8) ?, alpha = 88.45(2) degrees, beta = 79.34(2) degrees, and gamma = 78.23(2) degrees. The structures of the gallium(III) and indium(III) tris-chelate oxygen-based complexes (1 and 2, respectively) were compared with the bismuth analogue in order to determine the ligand steric bulk influence on the coordination sphere in the absence of the electron lone pair. Complex 1 crystallizes as the [Ga{(OPPh(2))(2)N}(3)].CH(2)Cl(2) solvate in the triclinic space group P&onemacr;; Z = 2, a = 13.534(4) ?, b = 13.855(4) ?, c = 18.732(7) ?, alpha = 95.48(2) degrees, beta = 98.26(2) degrees, and gamma = 97.84(2) degrees. Crystal data for the benzene solvate of 2, [In{(OPPh(2))(2)N}(3)].C(6)H(6): triclinic space group P&onemacr;, Z = 2, a = 13.542(9) ?, b = 15.622(3) ?, c = 18.063(5) ?, alpha = 98.21(1) degrees, beta = 104.77(0) degrees, and gamma = 92.260(0) degrees.     

Preparation, Structure, and Properties of Bis(&mgr;-oxo)dirhenium(III,IV) and -dirhenium(IV) Complexes of Tris(2-pyridylmethyl)amine and Its (6-Methyl-2-pyridyl)methyl Derivatives

A series of bis(&mgr;-oxo)dirhenium complexes, [Re(2)(&mgr;-O)(2)(L)(2)](PF(6))(n)() (L = tris(2-pyridylmethyl)amine (tpa), n = 3 (1), n = 4 (1a); L = ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Metpa), n = 3 (2), n = 4 (2a); bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), n = 3 (3), n = 4 (3a)), have been prepared and characterized by several physical methods. X-ray crystallographic studies for 2, 2a.2CH(3)CN.2H(2)O (2a'), and 3a' (ReO(4)(-) salt), include the first structural determinations of (i) the bis(&mgr;-oxo)-Re(III)Re(IV) complex (2) and (ii) the pair of Re(III)Re(IV) and Re(IV)(2) complexes (2 and 2a'). All the complexes have a centrosymmetric structure, suggesting that the mixed-valence state 2 is of structurally delocalized type. The Re-Re distances for 2, 2a.2CH(3)CN.2H(2)O, and 3a' are 2.426(1), 2.368(1), and 2.383(1) ?, respectively, being consistent with the bond order of 2.5 (sigma(2)pi(2)delta(2)delta) for 2 and 3 (sigma(2)pi(2)delta(2)) for the others. Methyl substitution on the pyridyl moiety of the ligands has no significant influence to the overall structure. Cyclic voltammetry of 1 shows two reversible redox waves at -0.77 ((III,III)/(III,IV)) and 0.09 V ((III,IV)/(IV,IV)) vs Ag/AgCl in acetonitrile. The potentials are slightly more positive for 2 (-0.66 and 0.14 V) and 3(-0.64 and 0.20 V). No proton-coupled redox behavior was observed on addition of p-toluenesulfonic acid. Complexes, 1a, 2a, and 3a show a strong visible absorption band at 477 nm (epsilon, 9200 dm(3) mol(-)(1) cm(-)(1)), 482 (11200), and 485 (8700), respectively, which is assigned to the pi-pi transition within the Re(2)(&mgr;-O)(2) core. For the mixed-valence complexes 1, 2, and 3, a strong band is observed in the longer wavelength region (556-572 nm). Crystal data: 2, monoclinic, space group C2/c (No.15), a = 11.799(2) ?, b = 19.457(3) ?, c = 21.742(4) ?, beta = 98.97(1) degrees, Z = 4; 2a', triclinic, space group P&onemacr; (No. 2), a = 13.151(3) ?, b = 13.535(2) ?, c = 10.243(3) ?, alpha = 104.37(2) degrees, beta = 109.02(2) degrees, gamma = 106.87(1) degrees, Z = 1; 3a', monoclinic, space group P2(1)/n (No. 14), a = 13.384(3) ?, b = 14.243(2) ?, c = 13.215(6) ?, beta = 106.88(2) degrees, Z = 2.     

An Approach to Heterometallic Complexes with Selenolate and Tellurolate Ligands: Crystal Structures of cis-[Mn(CO)(4)(SePh)(2)](-), [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-), (CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3), and (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3)

Oxidative addition of diorganyl diselenides to the coordinatively unsaturated, low-valent transition-metal-carbonyl fragment [Mn(CO)(5)](-) produced cis-[Mn(CO)(4)(SeR)(2)](-). The complex cis-[PPN][Mn(CO)(4)(SePh)(2)] crystallized in triclinic space group P&onemacr; with a = 10.892(8) ?, b = 10.992(7) ?, c = 27.021(4) ?, alpha = 101.93(4) degrees, beta = 89.79(5) degrees, gamma = 116.94(5) degrees, V = 2807(3) ?(3), and Z = 2; final R = 0.085 and R(w) = 0.094. Thermolytic transformation of cis-[Mn(CO)(4)(SeMe)(2)](-) to [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-) was accomplished in high yield in THF at room temperature. Crystal data for [Na-18-crown-6-ether][(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)]: trigonal space group R&thremacr;, a = 13.533(3) ?, c = 32.292(8) ?, V = 5122(2) ?(3), Z = 6, R = 0.042, R(w) = 0.041. Oxidation of Co(2+) to Co(3+) by diphenyl diselenide in the presence of chelating metallo ligands cis-[Mn(CO)(4)(SePh)(2)](-) and cis-[Mn(CO)(4)(TePh)(2)](-), followed by a bezenselenolate ligand rearranging to bridge two metals and a labile carbonyl shift from Mn to Co, led directly to [(CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3)]. Crystal data: triclinic space group P&onemacr;, a = 11.712(3) ?, b = 12.197(3) ?, c = 15.754(3) ?, alpha = 83.56(2) degrees, beta = 76.13(2) degrees, gamma = 72.69(2) degrees, V = 2083.8(7) ?(3), Z = 2, R = 0.040, R(w) = 0.040. Addition of fac-[Fe(CO)(3)(SePh)(3)](-) to fac-[Mn(CO)(3)(CH(3)CN)(3)](+) resulted in formation of (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3). This neutral heterometallic complex crystallized in monoclinic space group P2(1)/n with a = 8.707(2) ?, b = 17.413(4) ?, c = 17.541(4) ?, beta = 99.72(2) degrees, V = 2621(1) ?(3), and Z = 4; final R = 0.033 and R(w) = 0.030.     

Crystal Structures and Magnetic Properties of Novel [Ln(III)Cu(II)(4)] (Ln = Gd, Dy, Ho) Pentanuclear Complexes. Topology and Ferromagnetic Interaction in the Ln(III)-Cu(II) Pair

The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data.     

Copper and Bismuth Complexes Containing Dipyridyl gem-Diolato Ligands: Bi(III)(2)[(2-Py)(2)CO(OH)](2)(O(2)CCF(3))(4)(THF)(2), Cu(II)[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), and Cu(II)(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), a Ferromagnetically Coupled Tetranuclear Copper(II) Chain

The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1.     

N-Methyl-2-(methylamino)troponiminate Complexes of Tin(II), Gallium(III), and Indium(III). Syntheses of [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl Using the Tin(II) Reagent [(Me)(2)ATI](2)Sn

The N-methyl-2-(methylamino)troponimine [(Me)(2)ATI]H reacts with bis[bis(trimethylsilyl)amido]tin(II) to yield [(Me)(2)ATI](2)Sn in excellent yield. The treatment of [(Me)(2)ATI](2)Sn with GaI and InCl led to the bis(ligand)gallium(III) and -indium(III) compounds [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl. These metal complexes were characterized by elemental analysis, (1)H and (13)C NMR spectroscopy, and X-ray crystallography. All three metal adducts show fluxional behavior in solution at room temperature. [(Me)(2)ATI](2)Sn exhibits a pseudo trigonal bipyramidal structure in the solid state. The gallium and indium atoms in [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl adopt trigonal bipyramidal geometry around the metal center with the halide occupying an equatorial site. A convenient, high-yield route to [(Me)(2)ATI]H is also reported. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 183 K: [(Me)(2)ATI](2)Sn, C(18)H(22)N(4)Sn, a = 8.4347(11) ?, b = 10.5564(13) ?, c = 11.5527(11) ?, alpha = 66.931(8) degrees, beta = 73.579(9) degrees, gamma = 67.437(7) degrees, V = 863.3(2) ?(3), triclinic, space group P&onemacr;, Z = 2, R = 0.0224; [(Me)(2)ATI](2)GaI, C(18)H(22)GaIN(4), a = 12.947(2) ?, b = 9.5834(9) ?, c = 16.0132(12) ?, beta = 107.418(8) degrees, V = 1895.8(3) ?(3), monoclinic, space group P2(1)/c, Z = 4, R = 0.0214; [(Me)(2)ATI](2)InCl, C(18)H(22)ClInN(4), a = 24.337(3) ?, b = 8.004(2) ?, c = 19.339(3) ?, beta = 101.537(13) degrees, V = 3691.1(11) ?(3), monoclinic, space group C2/c, Z = 8, R = 0.0224.     

Synthesis and Characterization of Six-Coordinate Nitrido Complexes of Vanadium(V), Chromium(V), and Manganese(V). Isolation of a Dinuclear, Mixed-Valent &mgr;-Nitrido Chromium(III)/Chromium(V) Species

Photolysis of a series of octahedral monoazido complexes of the type [LM(III)(didentate ligand)(N(3))](n)(+)X(n) of vanadium(III), chromium(III), and manganese(III) in the solid state or in solution yields quantitatively the corresponding six-coordinate nitrido complexes [LM(V)(didentate ligand)(N)](n)(+)X(n) and 1 equiv of dinitrogen. L represents the macrocycle 1,4,7-triazacyclononane or its N-methylated derivative (L'), the didentate ligands are pentane-2,4-dionate (acac), 2,2,6,6-tetramethylheptane-3,5-dionate (tacac), picolinate (pic), phenanthroline (phen), and oxalate (ox), and X(-) represents perchlorate or hexafluorophosphate. The following nitrido complexes were prepared: [LV(V)(N)(acac)](ClO(4)) (6), [LCr(V)(N)(acac)](ClO(4)) (13), [LCr(V)(N)(tacac)](ClO(4)) (14), [LCr(V)(N)(pic)](ClO(4)) (15), [LCr(V)(N)(phen)](ClO(4))(2) (16), [LCr(V)(N)(ox)] (19), [L'Mn(V)(N)(acac)]PF(6) (21). Photolysis of [LCr(III)(N(3))(ox)] (17) in the solid state produces the &mgr;-nitrido-bridged mixed-valent species [L(2)Cr(2)(ox)(2)(&mgr;-N)](N(3)) (18). The structures of the precursor complex [L'Mn(acac)(N(3))]BPh(4) (20), of 13, and of [L'Mn(V)(N)(acac)]BPh(4) (21) have been determined by X-ray crystallography. Complex 13 crystallizes in the orthorhombic space group Pnma, with cell constants a = 27.187(5) ?, b = 9.228(2) ?, c = 7.070(1) ?, V = 1773.7(6) ?(3), and Z = 4; complex 20 crystallizes in the triclinic space group P&onemacr; with a = 14.769(5) ?, b = 16.83(1) ?, c = 16.96(1) ?, alpha = 108.19(5) degrees, beta = 105.06(4) degrees, gamma = 99.78(4) degrees, V = 3719(2) ?(3), and Z = 4; and complex 21 crystallizes in the monoclinic space group P2(1)/n with a = 10.443(3) ?, b = 16.035(4) ?, c = 21.463(5) ?, beta = 95.76(1) degrees, V = 3575.9(14) ?(3), and Z = 4. The Cr(V)&tbd1;N and Mn(V)&tbd1;N distances are short at 1.575(9) and 1.518(4) ?, respectively, and indicate a metal-to-nitrogen triple bond.     

Heteroleptic Lanthanide Complexes with Aryloxide Ligands. Synthesis and Structural Characterization of Divalent and Trivalent Samarium Aryloxide/Halide and Aryloxide/Cyclopentadienide Complexes

Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557.     

Molecular Assemblies Containing Unsupported [Fe(III)-(&mgr;(2):eta(2)-RCO(2))-Cu(II)] Bridges

Formate is an inhibitor of cytochrome oxidases and also effects conversion of the bovine heart enzyme from the "fast" to the "slow" cyanide-binding form. The molecular basis of these effects is unknown; one possibility is that formate inserts as a bridge into the binuclear heme a(3)-Cu(B) site, impeding the binding of dioxygen or cyanide. Consequently, Fe-Cu-carboxylate interactions are a matter of current interest. We have initiated an examination of such interactions by the synthesis of the first examples of [Fe(III)-(&mgr;(2):eta(2)-RCO(2))-Cu(II)] bridges, minimally represented by Fe(III)-L + Cu(II)-O(2)CR --> [Fe(III)-(RCO(2))-Cu(II)] + L. A series of Cu(II) precursor complexes and solvate forms have been prepared and their structures determined, including [Cu(Me(5)dien)(O(2)CH)](+) (3), [Cu(Me(5)dien)(O(2)CH)(MeOH)](+) (4), [Cu(Me(6)tren)(O(2)CH)](+) (5), and [Cu(Me(5)dien)(OAc)](+) (6). [4](ClO(4)) was obtained in monoclinic space group P2(1)/n with a = 8.166(3) ?, b = 15.119(5) ?, c = 15.070(4) ?, beta = 104.65(2) degrees, and Z = 4. [5](ClO(4))/[6](ClO(4)) crystallize in orthorhombic space groups Pnma/Pna2(1) with a = 16.788(2)/14.928(5) ?, b = 9.542(1)/9.341(4) ?, c = 12.911(1)/12.554(4) ?, and Z = 4/4. In all cases, the carboxylate ligand is terminal and is bound in a syn orientation. Also prepared for the purpose of structural comparison was [Fe(OEP)(O(2)CH)], which occurred in monoclinic space group P2(1)/c with a = 13.342(2) ?, b = 13.621(2) ?, c = 19.333(2) ?, beta = 106.12(2) degrees, and Z = 4. The desired bridges were stabilized in the assemblies [(OEP)Fe(O(2)CH)Cu(Me(5)dien)(OClO(3))](+) (9), [(OEP)Fe(OAc)Cu(Me(5)dien)](2+) (10), and {(OEP)Fe[(O(2)CH)Cu(Me(6)tren)](2)}(3+) (11), which were prepared by the reaction of 3, 6, and 5, respectively, with [Fe(OEP)(OClO(3))] in acetone or dichloromethane. [9](ClO(4))/[10](ClO(4))(2).CH(2)Cl(2) crystallize in triclinic space group P&onemacr; with a = 9.016(3)/13.777(3) ?, b = 15.377(5)/13.847(3) ?, c = 19.253(5)/17.608(4) ?, alpha = 78.12(3)/96.82(3) degrees, beta = 86.30(4)/108.06(3) degrees, gamma = 76.23(3)/114.32(3) degrees, and Z = 2/2. Each assembly contains a [Fe(III)-(RCO(2))-Cu(II)] bridge but with the differing orientations anti-anti (9) and syn-anti (10, 11). The compound [11](ClO(4))(2)(SbF(6)) occurs in orthorhombic space group Pbcn with a = 12.517(6) ?, b = 29.45(1) ?, c = 21.569(8) ?, and Z = 4. Complex 11 is trinuclear; the Fe(III) site has two axial formate ligands with bond distances indicative of a high-spin configuration. Structural features of 9-11 are discussed and are considered in relation to the possible insertion of formate into the binuclear sites of two oxidases whose structures were recently determined. The present results contribute to the series of molecular assemblies with the bridge groups [Fe(III)-X-Cu(II)], X = O(2)(-), OH(-), and RCO(2)(-), all with a common high-spin heme, thereby allowing an examination of electronic structure as dependent on the bridging atom or group and bridge structure. (Me(5)dien = 1,1,4,7,7-pentamethyldiethylenetriamine; Me(6)tren = tris(2-(dimethylamino)ethyl)amine; OEP = octaethylporphyrinate(2-).)     

Hydrothermal Syntheses and Structural Characterization of Layered Vanadium Oxides Incorporating Organic Cations: alpha-, beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] and alpha-, beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)

Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space.     

High-Valent Manganese in Polyoxotungstates. 3. Dimanganese Complexes of gamma-Keggin Anions

Dimanganese-substituted gamma-Keggin heteropoly tungstates have been synthesized by reaction of the lacunary species gamma-[(SiO(4))W(10)O(32)](8)(-) with appropriate mixtures of Mn(II) and MnO(4)(-). The crystal structure of [(CH(3))(3)(C(6)H(5))N](4)[(SiO(4))W(10)Mn(III)(2)O(36)H(6)].2CH(3)CN.H(2)O (anion 1) was determined by X-ray diffraction. Crystallographic data: space group P&onemacr;, a = 12.951(3) ?, b = 14.429(3) ?, c = 20.347(4) ?, alpha = 81.95(3) degrees, beta = 88.92(3) degrees, gamma = 67.48(3) degrees, V = 3475.2(13) ?(3), and Z = 2. The final R value is 7.29% for 15861 reflections with I > 2sigma(I). The anion has the anticipated gamma-Keggin structure with virtual C(2)(v)() symmetry. The two Mn cations occupy adjacent, edge-shared octahedra with bridging hydroxo and terminal aqua ligands. Anion 1 can be oxidized and reduced to the corresponding Mn(III)Mn(IV) (2) and Mn(II)(2) (3) species respectively. The magnetic susceptibility of 1 between 2 and 300 K indicates that the Mn(III) cations are antiferromagnetically coupled, with J = -17.0 cm(-)(1) and g = 1.965. No simple magnetic behavior was observed for 2 or 3.     

Dinuclear Copper(II) Complexes Incorporating a New Septadentate Polyimidazole Ligand

The dinuclear copper(II) complexes [Cu(2)(tmihpn)(prz)](ClO(4))(2).2CH(3)CN (6) and [Cu(2)(tmihpn)(O(2)CCH(3))](ClO(4))(2).CH(3)CN (7) were prepared, where tmihpn is the deprotonated form of N,N,N',N'-tetrakis[(1-methylimidazol-2-yl)methyl]-1,3-diaminopropan-2-ol and prz is the pyrazolate anion. The crystal structures of 6 and 7 were determined and revealed that both complexes contain bridging alkoxide ligands as well as bridging pyrazolate and acetate ions, respectively. Crystal data: compound 6, triclinic, P&onemacr;, a = 18.089(2) ?, b = 22.948(3) ?, c = 9.597(2) ?, alpha = 93.37(2) degrees, beta = 94.49(2) degrees, gamma = 81.69(2) degrees, V = 3925.1 ?(3), Z = 4; compound 7, triclinic, P&onemacr;, a = 12.417(2) ?, b = 15.012(3) ?, c = 10.699(2) ?, alpha = 104.76(2) degrees, beta = 102.63(2) degrees, gamma = 99.44(2) degrees, V = 1830.1 ?(3), Z = 2. In compound 6, the coordination geometry around both copper centers resembles a distorted square pyramid, while the stereochemistry around the copper centers in 7 is best described as trigonal bipyramidal. Both complexes display well-resolved isotropically shifted (1)H NMR spectra. Selective substitution studies and integration data have been used to definitively assign several signals to specific ligand protons. Results from the solution (1)H NMR studies suggest that the basal and apical imidazole groups do not exchange rapidly on the NMR time scale and the solid state structures of the complexes are retained in solution. In addition, the magnetochemical characteristics of 6 and 7 were determined and provide evidence for "magnetic orbital switching". Antiferromagnetic coupling in 6 (J = -130 cm(-)(1)) is strong, while the copper centers in compound 7 are ferromagnetically coupled (J = +16.4 cm(-1)). Differences in the magnetic behavior of the two copper centers have been rationalized using the "ligand orbital complementary" concept. The ground state magnetic orbitals involved in spin coupling in 6 (d(x)()()2(-)(y)()()2) are different from those in 7 (d(z)()()2).     

Synthesis and Crystal Structure of Organocobalt(III) Complexes with Secondary Alkyls or Bulky Schiff Base Equatorial Ligands

Alkylcobalt(III) Schiff base B(12) model complexes with secondary alkyls or a bulky diamine in the equatorial position were synthesized and characterized. Structures have been first determined by X-ray diffraction analysis for i-C(4)H(9)Co(salen)(gamma-pic) (I), n-C(3)H(7)Co(salen)(gamma-pic) (II) and C(2)H(5)Co(SB) (III), where salen = N,N'-ethylenebis(salicylideneamine) dianion; SB = 1,1,2,2-tetramethyl-N,N'-ethylenebis(salicylideneamine) dianion, gamma-pic = gamma-picoline. Crystal data for I (CoC(26)N(3)O(2)H(30)): space group P2(1)/c with a = 6.661(5) ?, b = 18.612(2) ?, c = 19.533(3) ?, beta = 98.93(1) degrees, V = 2392.10 ?(3), D(calcd) = 1.320 g.cm(-3), Z = 4, and R = 0.048 for 4469 measured reflections. Crystal data for II (CoC(25)N(3)O(2)H(28)): space group P2(1)/c, a = 9.609(6) ?, b = 19.169(8) ?, c = 12.995(9) ?, beta = 106.9(7) degrees, V = 2290.4 ?(3), D(calcd) = 1.332 g.cm(-1), Z = 4, and R = 0.048 for 4358 measured reflections. Crystal data for III (CoC(22)N(2)O(2)H(27)): space group P2(1)/c, a = 8.318(3) ?, b = 21.579(2) ?, c = 11.572(2) ?, beta = 93.35(1) degrees, V = 2073.7 ?(3), D(calcd) = 1.314 g.cm(-1), Z = 4, and R = 0.060 for 3954 measured reflections. The crystal structure data reveal that complexes I and II display six-coordinate octahedral geometry; their Co-C, Co-N bond lengths, as well as the Co-C-C angles, are very close to those in 5'-deoxyadenosylcobalamin. Complex III is one of the very few compounds having five-coordinate square pyramidal geometry and observed instability of the Co-C bond.     

Magnetostructural Correlations in Bis(&mgr;(2)-phenoxide)-Bridged Macrocyclic Dinuclear Copper(II) Complexes. Influence of Electron-Withdrawing Substituents on Exchange Coupling

Macrocyclic dicopper(II) complexes derived from 2,6-di(R)formylphenols and various linking diamines are surveyed and their magnetic and structural properties assessed. For those systems with "flat" dinuclear centers and no electronic perturbations associated with electron-withdrawing ligands or ligand groups, the complexes exhibit a "straight-line" relationship between exchange integral and phenoxide bridge angle. Within the angle range 98.8-104.7 degrees, 11 complexes are included with -2J in the range 689-902 cm(-)(1). When electron-withdrawing species are present, either as ligands or as groups bound to the macrocycle itself, considerable suppression of the antiferromagnetic exchange component is observed. Single-crystal X-ray diffraction studies are reported for three complexes. [Cu(2)(L1)(H(2)O)(2)]F(2)(CH(3)OH)(2) (1) crystallized in the triclinic system, space group P&onemacr;, with a = 8.1878(5) ?, b = 9.0346(7) ?, c = 10.4048(7) ?, alpha = 103.672(6) degrees, beta = 101.163(5) degrees, gamma = 104.017(5) degrees, and Z = 1. [Cu(2)(L2)Cl(2)] [Cu(2)(L2) (H(2)O)(2)]Cl(ClO(4)).5.5H(2)O (2) crystallized in the monoclinic system, space group P2(1)/n, with a = 14.4305(5) ?, b = 24.3149(8) ?, c = 18.6584(8) ?, beta = 111.282(3) degrees, and Z = 4. [Cu(2)(L3)(H(2)O)(2)](BF(4))(2) (3) crystallized in the triclinic system, space group P&onemacr;, with a = 8.6127(4) ?, b = 8.6321(7) ?, c = 10.8430(10) ?, a = 74.390(10) degrees, beta = 86.050(10) degrees, gamma = 76.350(10) degrees, and Z = 2. Square pyramidal copper ion stereochemistries are observed in all cases, with axially coordinated halogens or water molecules. Strong antiferromagnetic exchange is observed for all complexes (-2J = 784(8) cm(-)(1), Cu-O-Cu 103.65(10) degrees (1); -2J = 801(11) cm(-)(1), Cu-O-Cu 102.4(3), 107.5(3), 102.9(3), 106.1(3) degrees (2); -2J = 689(3) cm(-)(1), Cu-O-Cu 98.8(4) degrees (3)). The presence of electron-withdrawing CN groups on the periphery of the macrocyclic ligand leads to substantially reduced antiferromagnetic exchange.     

Chemistry of Thiobenzoates: Syntheses, Structures, and NMR Spectra of Salts of [M(SOCPh)(3)](-) (M = Zn, Cd, Hg)

The salts (Ph(4)E)[M(SOCPh)(3)] (M = Zn, Cd, or Hg; E = P or As) are produced by the reaction of Zn(NO(3))(2).6 H(2)O, Cd(NO(3))(2).4H(2)O or HgCl(2) with Et(3)NH(+)PhCOS(-) and (Ph(4)E)X (E = P, X = Br; E = As, X = Cl) in aqueous MeOH in the ratios M(II):PhCOS(-):Ph(4)E(+) = 1:>/=3:>/=1. The crystal structures of (Ph(4)P)[Zn(SOCPh)(3)] (1), (Ph(4)As)[Cd(SOCPh)(3)] (2) and (Ph(4)P)[Hg(SOCPh)(3)] (3) have been determined by single-crystal X-ray diffraction experiments. Crystal data for 1: triclinic; space group P&onemacr;; Z = 2; a = 10.819(2) ?, b = 13.219(3) ?, c = 15.951(3) ?; alpha = 101.75(2) degrees, beta = 97.92(1) degrees, gamma = 109.18(2) degrees. Crystal data for 2: triclinic; space group P&onemacr;; Z= 2; a = 10.741(2) ?, b = 13.168(2) ?, c = 15.809(2) ?; alpha = 101.00(1) degrees, beta = 97.65(1) degrees, gamma = 109.88(1) degrees. Crystal data for 3: monoclinic; space group P2(1)/n; Z = 4; a = 13.302(2) ?, b = 14.276(2) ?, c = 21.108(2) ?; beta = 90.92(1) degrees. The compounds 1 and 2 are isomorphous and isostructural. In the anions [M(SOCPh)(3)](-) the metal atoms have trigonal planar coordination by three sulfur atoms. The metal atoms are further more weakly coordinated intramolecularly to one (M = Hg) or two (M = Zn, Cd) thiobenzoate oxygen atom(s). Using the Bond Valence approach it is found that the contribution of M.O bonding to the total bonding is in the order Cd > Zn > Hg. The metal ((113)Cd, (199)Hg) NMR signals of [M(SOCPh)(3)](-) (M = Cd, Hg) are more shielded than those found for MS(3) kernels in thiolate complexes, a difference attributed to the M(.)O bonding in the thiobenzoate complexes. The (113)Cd resonance of [Cd(SOCPh)(3)](-) in dilute solution is in the region anticipated from dilution data for [Na(Cd{SOCPh}(3))(2)](-).     

Synthesis and Characterization of Water-Soluble 1,2-Bis(bis(hydroxyalkyl)phosphino)ethane Ligands and Their Nickel(II), Ruthenium(III), and Rhodium(I) Complexes

The syntheses of the water-soluble, chelating phosphines 1,2-bis(bis(hydroxybutyl)phosphino)ethane (1, n = 3; DHBuPE) and 1,2-bis(bis(hydroxypentyl)phosphino)ethane (1, n = 4; DHPePE) are reported. These ligands (and, in general, other 1,2-bis(bis(hydroxyalkyl)phosphino)ethane ligands) can be used to impart water solubility to metal complexes. As examples of this, the [Ni(DHPrPE)(2)Cl]Cl (2), [Rh(DHPrPE)(2)][Cl] (3), and [Ru(DHBuPE)(2)Cl(2)][Cl] (4) complexes were synthesized; they are indeed soluble in water (>0.5 M). Crystals of DHPrPE (1, n = 2) are monoclinic, space group P2(1)/c, with a = 9.5935(8) ?, b = 9.353(2) ?, c = 10.655(2) ?, alpha = 90 degrees, beta = 100.03(1) degrees, gamma = 90, V = 941.5(5) ?(3), R = 0.051, and Z = 2. Crystals of [Ni(DHPrPE)(2)Cl]Cl (2) are monoclinic, space group I2, with a = 15.951(3) ?, b = 11.454(2) ?, c = 20.843(3) ?, alpha = 90 degrees, beta = 91.24(2) degrees, gamma = 90 degrees, V = 3807(2) ?(3), R = 0.062, and Z = 4. Crystals of [Rh(DHPrPE)(2)][Cl] (3) are triclinic, space group P&onemacr;, with a = 13.900(2) ?, b = 15.378(2) ?, c = 18.058(2) ?, alpha = 87.71(1) degrees, beta = 75.03(1) degrees, gamma = 85.24(1), V = 3715(2) ?(3), R = 0.044, and Z = 4. Crystals of [Ru(DHBuPE)(2)Cl(2)][Cl] (4) are monoclinic, space group C2/c, with a = 14.310(2) ?, b = 21.630(2) ?, c = 15.459(3) ?, alpha = 90 degrees, beta = 99.83(1) degrees, gamma = 90, V = 4715(1) ?(3), R = 0.056, and Z = 4.     

Synthesis and Characterization of Copper(II), Zinc(II), and Potassium Complexes of a Highly Fluorinated Bis(pyrazolyl)borate Ligand

Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4.