Utility of Arylamido Ligands in Yttrium and Lanthanide Chemistry(1)

The reactivity of KNHAr reagents (Ar = C(6)H(5), C(6)H(3)Me(2)-2,6, C(6)H(3)(i)Pr(2)-2,6) with lanthanide and yttrium trichlorides has been investigated. With the larger metals Nd and Sm and the smaller 2,6-dimethyl-substituted ligand, the bimetallic dianionic complexes [K(THF)(6)](2)[Ln(&mgr;-NHC(6)H(3)Me(2)-2,6)(NHC(6)H(3)Me(2)-2,6)(3)](2) (Ln: Sm, 1a; Nd, 1b) are isolated as the potassium salts. Under the same reaction conditions YCl(3) forms a bimetallic anion which retains chloride: [K(DME)(2)(THF)(3)][Y(2)(&mgr;-NHC(6)H(3)Me(2)-2,6)(2)(&mgr;-Cl)(NHC(6)H(3)Me(2)-2,6)(4)(THF)(2)], 2. With the larger 2,6-diisopropyl ligands, neutral complexes are isolated in both solvated monometallic and unsolvated bimetallic forms. With Nd, a distorted octahedral trisolvate, Nd(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(3), 3, was obtained, whereas with Yb and Y the trigonal bipyramidal disolvates, Ln(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(2) (Ln: Yb, 4a; Y, 4b), were isolated. THF-free complexes of the NHC(6)H(3)(i)Pr(2)-2,6 ligand are available by reacting the amine NH(2)C(6)H(3)(i)Pr(2)-2,6 with Ln[N(SiMe(3))(2)](3) complexes. By this route, the dimers [Ln(&mgr;-NHC(6)H(3)(i)Pr(2)-2,6)(NHC(6)H(3)(i)Pr(2)-2,6)(2)](2) (Ln: Yb, 5a; Y, 5b) were isolated. The reaction of the unsubstituted arylamido salt KNHC(6)H(5) with NdCl(3) produced an insoluble material which was characterized as [Nd(NHC(6)H(5))(3)(KCl)(3)], 6. 6 reacted with Al(2)Me(6) in hexanes and produced a heteroleptic mixed-metal complex {[Me(2)Al(&mgr;-Me(2))](2)Nd(&mgr;(3)-NC(6)H(5))(&mgr;-Me)AlMe}(2), 7, and the trimeric aluminum arylamido complex [Me(2)Al(&mgr;-NHC(6)H(5))](3), 8. The solvent of crystallization and relevant crystallographic data for the compounds identified by X-ray analysis follow: 1a,THF, 156 K, P2(1)/n, a = 12.985(2) ?, b = 27.122(5) ?, c = 17.935(3) ?, beta = 100.19(1) degrees, V = 6216(1) ?(3), Z = 2, 6148 reflections (I > 3sigma(I)), R(F)() = 7.1%; 1b,THF, 156 K, P2(1)/n, a = 12.998(2) ?, b = 27.058(3) ?, c = 17.962(2) ?, beta = 99.74(1) degrees, V = 6225(1) ?(3), Z = 2; 2,DME/hexanes, P2(1)/n, a = 23.335(2) ?, b = 12.649(1) ?, c = 27.175(3) ?, beta = 96.36(1) degrees, V = 7971(1) ?(3), Z = 4, 2788 reflections (I > 3sigma(I)), R(F)() = 9.5%; 3, THF, P2(1), a = 12.898(1) ?, b = 16.945(1) ?, c = 13.290(1) ?, beta = 118.64(2) degrees, V = 2549.3(3) ?(3), Z = 2, 3414 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4a, hexanes, P2(1), a = 9.718(2) ?, b = 19.119(3) ?, c = 12.640(2) ?, beta = 112.08(1) degrees, V = 2176.3(6) ?(3), Z = 2, 2933 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4b, hexanes, 158 K, a = 9.729(2) ?, b = 19.095(5) ?, c = 12.744(1) ?, beta = 112.11(1) degrees, V = 2193.4(6) ?(3); 5b, hot toluene, 158 K, P2(1), a =19.218(9) ?, b = 9.375(3) ?, c = 19.820(5) ?, beta = 110.25(2) degrees, V = 3350(2)?(3), Z = 2, 1718 reflections (I > 2sigma (I)), R1 = 9.7%; 7, hexanes, 156 K, P&onemacr;, a = 9.618(3) ?, b = 12.738(4) ?, c = 9.608(3) ?, alpha = 99.32(1) degrees, beta = 108.87(1) degrees, gamma = 94.23(1) degrees, V = 1089.1(6) ?(3), Z = 2, 2976 reflections (I > 3sigma(I)), R(F)() = 3.9%; 8, hexanes, 156 K, Pcab, a = 23.510(5) ?, b = 25.462(5) ?, c = 8.668(2) ?, V = 5188(1) ?(3), Z = 8, 1386 reflections (I > 3sigma(I)), R(F)() = 5.7%.     

Synthesis, Structure, and Reactivity of Model Complexes of Copper Nitrite Reductase

The copper(I) and copper(II) complexes with the nitrogen donor ligands bis[(1-methylbenzimidazol-2-yl)methyl]amine (1-BB), bis[2-(1-methylbenzimidazol-2-yl)ethyl]amine (2-BB), N-acetyl-2-BB (AcBB), and tris[2-(1-methylbenzimidazol-2-yl)ethyl]nitromethane (TB) have been studied as models for copper nitrite reductase. The copper(II) complexes form adducts with nitrite and azide that have been isolated and characterized. The Cu(II)-(1-BB) and Cu(II)-AcBB complexes are basically four-coordinated with weak axial interaction by solvent or counterion molecules, whereas the Cu(II)-(2-BB) and Cu(II)-TB complexes prefer to assume five-coordinate structures. A series of solid state structures of Cu(II)-(1-BB) and -(2-BB) complexes have been determined. [Cu(1-BB)(DMSO-O)(2)](ClO(4))(2): triclinic, P&onemacr; (No. 2), a = 9.400(1) ?, b = 10.494(2) ?, c = 16.760(2) ?, alpha = 96.67(1) degrees, beta = 97.10(1) degrees, gamma = 108.45(1) degrees, V = 1534.8(5) ?(3), Z = 2, number of unique data [I >/= 3sigma(I)] = 4438, number of refined parameters = 388, R = 0.058. [Cu(1-BB)(DMSO-O)(2)](BF(4))(2): triclinic, P&onemacr; (No. 2), a = 9.304(5) ?, b = 10.428(4) ?, c = 16.834(8) ?, alpha = 96.85(3) degrees, beta = 97.25(3) degrees, gamma = 108.21(2) degrees, V = 1517(1) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3388, number of refined parameters = 397, R = 0.075. [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 7.533(2) ?, b = 8.936(1) ?, c = 19.168(2) ?, alpha = 97.66(1) degrees, beta = 98.62(1) degrees, gamma = 101.06(1) degrees, V = 1234.4(7) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3426, number of refined parameters = 325, R = 0.081. [Cu(2-BB)(MeOH)(ClO(4))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 8.493(3) ?, b = 10.846(7) ?, c = 14.484(5) ?, alpha = 93.71(4) degrees, beta = 103.13(3) degrees, gamma = 100.61(4) degrees, V = 1270(1) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2612, number of refined parameters = 352, R = 0.073. [Cu(2-BB)(N(3))](ClO(4)): monoclinic, P2(1)/n (No. 14), a = 12.024(3) ?, b = 12.588(5) ?, c = 15.408(2) ?, beta = 101,90(2) degrees, V = 2282(1) ?(3), Z = 4, number of unique data [I >/= 2sigma(I)] = 2620, number of refined parameters = 311, R = 0.075. [Cu(2-BB)(NO(2))](ClO(4))(MeCN): triclinic, P&onemacr; (No. 2), a = 7.402(2) ?, b = 12.500(1) ?, c = 14.660(2) ?, alpha = 68.14(1) degrees, beta = 88.02(2) degrees, gamma = 78.61(1) degrees, V = 1233.0(4) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2088, number of refined parameters = 319, R = 0.070. In all the complexes the 1-BB or 2-BB ligands coordinate the Cu(II) cations through their three donor atoms. The complexes with 2-BB appear to be more flexible than those with 1-BB. The nitrito ligand is bidentate in [Cu(2-BB)(NO(2))](ClO(4))(MeCN) and essentially monodentate in [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)). The copper(I) complexes exhibit nitrite reductase activity and react rapidly with NO(2)(-) in the presence of stoichiometric amounts of acid to give NO and the corresponding copper(II) complexes. Under the same conditions the reactions between the copper(I) complexes and NO(+) yield the same amount of NO, indicating that protonation and dehydration of bound nitrite are faster than its reduction. The NO evolved from the solution was detected and quantitated as the [Fe(EDTA)(NO)] complex. The order of reactivity of the Cu(I) complexes in the nitrite reduction process is [Cu(2-BB)](+) > [Cu(1-BB)](+) > [Cu(TB)](+) > [Cu(AcBB)](+).     

Halide Effects in the Formation of Four-Coordinate, Cationic Aluminum

This work was conducted as part of a broad-based effort to determine the factors that affect cation formation for organometallic aluminum complexes. In this study the adduct species R(2)AlX.NH(2)(t)Bu (R, X: Me, F (1); Me, Cl (2); Et, Cl (3); Me, Br (4)) and cationic complexes [R(2)Al(NH(2)(t)Bu)(2)]X (R, X: Me, Br (5); Et, Br (6); Me, I (7)) were examined. These complexes demonstrate that the reaction of R(2)AlX with excess NH(2)(t)Bu produces cationic complexes only when X = Br or I. All of the compounds were characterized by melting points, (1)H NMR, IR, elemental analyses, and, in some cases, X-ray crystallography. X-ray data: 2, triclinic, P&onemacr;, a = 6.277(3) ?, b = 8.990(3) ?, c = 10.393(3) ?, alpha = 71.97(1) degrees, beta = 80.25(3) degrees, gamma = 81.97(3) degrees, V = 547.0(4) ?(3), Z = 2, 1032 reflections with F > 4.0 sigma(F), R = 0.0520; 5, monoclinic, P2(1)/c, a = 9.099(1) ?, b = 10.292(1) ?, c = 17.255(2) ?, beta = 104.81(1) degrees, V = 1562.1(3) ?(3), Z = 4, 1464 reflections with F > 4.0 sigmaF, R = 0.0387; 6, monoclinic, P2(1)/c, a = 14.122(2) ?, b = 13.539(2) ?, c = 21.089(2) ?, beta = 107.73(1) degrees, V = 3841.2(9) ?(3), Z = 4, 781 reflections with F > 5.0 sigmaF, R = 0.0873; 7, monoclinic, P2(1)/n, a = 9.071(1) ?, b = 10.529(1) ?, c = 17.714(2) ?, beta = 103.67(1) degrees, V = 1644.0(3) ?(3), Z = 4, 1723 reflections with F > 4.0 sigmaF, R = 0.0451.     

Linear Trinuclear Pt.Mo-Mo Complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CR)(2)](2) (X = Cl, Br, I; R = CH(3), C(CH(3))(3); pyphos = 6-(Diphenylphosphino)-2-pyridonate) with an Axial Interaction between the Quadruply Bonded Mo(2) Moiety and the Platinum Atom

An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters.     

Hydrocarbon-Soluble Mercuracarborands: Syntheses, Halide Complexes, and Supramolecular Chemistry

The syntheses of macrocyclic species composed of carborane derivatives joined via their carbon vertices by electrophilic mercury atoms are described. The reaction of closo-1,2-Li(2)[C(2)B(10)H(10)(-)(x)()R(x)()] with HgI(2) gives Li(2)[(1,2-C(2)B(10)H(10)(-)(x)()R(x)()Hg)(4)I(2)] [R = Et, x = 2 (5.I(2)Li(2)); R = Me, x = 2 (6.I(2)Li(2)); R = Me, x = 4 (7.I(2)Li(2))]. 6.I(2)(K.[18]dibenzocrown-6)(2) crystallizes in the monoclinic space group C2/m [a = 28.99(2) ?, b = 18.19(1) ?, c = 13.61(1) ?, beta = 113.74(2) degrees, V = 6568 ?(3), Z = 4, R = 0.060, R(w) = 0.070]; 7.I(2)(NBu(4))(2) crystallizes in the monoclinic space group P2(1)/c [a = 12.77(1) ?, b = 21.12(2) ?, c = 20.96(2) ?, beta = 97.87(2) degrees, V = 5600 ?(3), Z = 2, R = 0.072, R(w) = 0.082]. The precursor to 7, closo-8,9,10,12-Me(4)-1,2-C(2)B(10)H(8) (4), is made in a single step by reaction of closo-1,2-C(2)B(10)H(12) with MeI in trifluoromethanesulfonic acid. The free hosts 5, 6, and 7 are obtained by reaction of the iodide complexes with stoichiometric quantities of AgOAc. A (199)Hg NMR study indicates that sequential removal of iodide from 5.I(2)Li(2) and 6.I(2)Li(2) with aliquots of AgOAc solution leads to formation of two intermediate host-guest complexes in solution, presumed to be 5(6)ILi and 5(2)(6)(2).ILi. Crystals grown from a solution of 6.I(2)Li(2) to which 1 equiv of AgOAc solution had been added proved to be an unusual stack structure with the formula 6(3).I(4)Li(4) [tetragonal, I4/m, a = 21.589(2) ?, c = 21.666(2) ?, V = 10098 ?(3), Z = 2, R = 0.058, R(w) = 0.084]. Addition of 2 equiv of NBu(4)Br ion to 5 or 6 gives 5.Br(2)(NBu(4))(2) and 6.Br(2)(NBu(4))(2), respectively, while addition of 1 equiv of KBr to 6 forms 6.BrK. 5.Br(2)(NBu(4))(2) crystallizes in the triclinic space group P&onemacr;, [a = 10.433(1) ?, b = 13.013(1) ?, c = 15.867(2) ?, alpha = 91.638(2) degrees, beta = 97.186(3) degrees, gamma = 114.202(2) degrees, V = 1492 ?(3), Z = 1, R = 0.078, R(w) = 0.104]. The hosts 5 and 6 form 1:1 supramolecular adducts with the polyhedral anions B(10)I(10)(2)(-) and B(12)I(12)(2)(-) in solution.     

X-ray Crystallographic Study of the Ruthenium Blue Complexes [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2): Steric Interactions and the Ru-Ru "Bond Length"

X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions.     

Structural Aspects of Lithium Arenethiolate Complexes with Intramolecular Coordinating Amine Donors

Reaction of aryllithium reagents LiR (R = C(6)H(4)((R)-CH(Me)NMe(2))-2 (1a), C(6)H(3)(CH(2)NMe(2))(2)-2,6 (1b), C(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2 (1c)) with 1 equiv of sulfur (1/8 S(8)) results in the quantitative formation of the corresponding lithium arenethiolates [Li{SC(6)H(4)((R)-CH(Me)NMe(2))-2}](6) (3), [Li{SC(6)H(3)(CH(2)NMe(2))(2)-2,6}](6) (4), and [Li{SC(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2}](2) (5). Alternatively, 3 can be prepared by reacting the corresponding arenethiol HSC(6)H(4)((R)-CH(Me)NMe(2))-2 (2) with (n)BuLi. X-ray crystal structures of lithium arenethiolates 3 and 4, reported in abbreviated form, show them to have hexanuclear prismatic and hexanuclear planar structures, respectively, that are unprecedented in lithium thiolate chemistry. The lithium arenethiolate [Li{SC(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2}](2) (5) is dimeric in the solid state and in solution, and crystals of 5 are monoclinic, space group P2(1)/c, with a = 17.7963(9) ?, b = 8.1281(7) ?, c = 17.1340(10) ?, beta = 108.288(5) degrees, Z = 4, and final R = 0.047 for 4051 reflections with F > 4sigma(F). Hexameric 4 reacts with 1 equiv of lithium iodide and 2 equiv of tetrahydrofuran to form the dinuclear adduct [Li(2)(SAr)(I)(THF)(2)] (6). Crystals of 6 are monoclinic, space group P2(1)/c, with a = 13.0346(10) ?, b = 11.523(3) ?, c = 16.127(3) ?, beta = 94.682(10) degrees, Z = 4, and final R = 0.059 for 3190 reflections with F > 4sigma(F).     

Heteroleptic Lanthanide Complexes with Aryloxide Ligands. Synthesis and Structural Characterization of Divalent and Trivalent Samarium Aryloxide/Halide and Aryloxide/Cyclopentadienide Complexes

Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557.     

Reactivity of trans-[PtX(2)(ketoxime)(2)] Complexes toward m-Chloroperoxybenzoic Acid: An Efficient Route to Coordinated Nitrosoalkanes and Solvent Dependence of the Reaction

The platinum(II) compounds trans-[PtX(2)(RR'C=NOH)(2)] [X = Cl, R = R' = Me, RR' = (CH(2))(4), (CH(2))(5); X = Br, R = R' = Me] react with m-chloroperoxybenzoic acid (MCPBA) in dimethylformamide to give the platinum(II) complexes [PtX(2){N(=O)CRR'ONCRR'}] containing coordinated nitrosoalkane ligands. The complexes [PtX(2){N(=O)CRR'ONCRR'}] were characterized by elemental analysis, EI-MS, IR, electronic absorption, and (1)H NMR spectroscopy; X-ray structure analysis was performed for [PtCl(2){N(=O)CC(5)H(10)ONCC(5)H(10)}]. The latter compound crystallizes in the triclinic P&onemacr; space group with a = 9.214(2) ?, b = 9.577(2) ?, c = 10.367(2) ?, alpha = 109.14(2) degrees, beta = 91.87(2) degrees, gamma = 115.62(2) degrees, V = 762.8(3) ?(3), Z = 2, and rho(calcd) = 2.135 g cm(-)(3). The reaction between trans-[PtX(2)(RR'C=NOH)(2)] and MCPBA displays a solvent dependence: interaction of these reagents in ketones, R(1)R(2)C=O, yields the platinum(IV) chelates [PtX(2)(OCR(1)R(2)ON=CRR')(2)], while the oxidation state of the oxime N atom remains unchanged. Heating [PtCl(2)(OCR(1)R(2)ON=CRR')(2)] in DMF or in DMF-d(7) at 100 degrees C leads to the extrusion of R(1)R(2)C=O and the formation of [PtCl(2){N(=O)CRR'ONCRR'}].     

Structural and Electrochemical Comparison of Copper(II) Complexes with Tripodal Ligands

A series of copper(II) complexes with tripodal polypyridylmethylamine ligands, such as tris(2-pyridylmethyl)amine (tpa), ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Me(1)tpa), bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), and tris((6-methyl-2-pyridyl)methyl)amine (Me(3)tpa), have been synthesized and characterized by X-ray crystallography. [Cu(H(2)O)(tpa)](ClO(4))(2) (1) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.029(7) ?, b = 9.268(2) ?, c = 17.948(5) ?, beta = 113.80(3) degrees, and Z = 4 (R = 0.061, R(w) = 0.059). [CuCl(Me(1)tpa)]ClO(4) (2) crystallized in the triclinic system, space group P&onemacr;, with a = 13.617(4) ?, b = 14.532(4) ?, c = 12.357(4) ?, alpha = 106.01(3) degrees, beta = 111.96(2) degrees, gamma = 71.61(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.037). [CuCl(Me(2)tpa)]ClO(4) (3) crystallized in the monoclinic system, space group P2(1)/n, with a = 19.650(4) ?, b = 13.528(4) ?, c = 8.55(1) ?, beta = 101.51(5) degrees, and Z = 4 (R = 0.071, R(w) = 0.050). [CuCl(Me(3)tpa)][CuCl(2)(Me(3)tpa)]ClO(4) (4) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.698(6) ?, b = 14.687(7) ?, c = 19.475(4) ?, beta = 97.13(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.038). All the Cu atoms of 1-4 have pentacoordinate geometries with three pyridyl and one tertiary amino nitrogen atoms, and a chloride or aqua oxygen atom. Nitrite ion coordinated to the Cu(II) center of Me(1)tpa, Me(2)tpa, and Me(3)tpa complexes with only oxygen atom to form nitrito adducts. The cyclic voltammograms of [Cu(H(2)O)(Me(n)()tpa)](2+) (n = 0, 1, 2, and 3) in the presence of NO(2)(-) in H(2)O (pH 7.0) revealed that the catalytic activity for the reduction of NO(2)(-) increases in the order Me(3)tpa < Me(2)tpa < Me(1)tpa < tpa complexes.     

Synthesis and Molecular Structures of Hydrotris(dimethylpyrazolyl)borate Complexes of the Lanthanides

The reaction of lanthanide triflates with 2 equiv of potassium hydrotris(dimethylpyrazolyl)borate (Tp(Me)()2) gives good yields of complexes of composition Ln(Tp(Me)()2)(2)OTf. For La (2), Ce (3), Pr (4), and Nd (5) the complexes are seven-coordinate in the solid state with the triflate group coordinated to the metal in unidentate fashion. Complex 5 crystallizes in the monoclinic space group P2(1)/c with a = 17.629(3) ?, b = 12.740(2) ?, c = 18.163(3) ?, beta = 107.35(1) degrees, V = 3893(1) ?(3), Z = 4, and R(w) = 0.0458. For the complexes of Y (1), Sm (6), Eu (7), Gd (8), Dy (9), Ho (10), and Yb (11), the smaller size of the metal ion leads to ejection of the triflate from the coordination sphere and the complexes are ionic in the solid state with a six-coordinate metal center. Complex 11 crystallizes in the monoclinic space group C2/m with a = 16.593(7) ?, b = 13.671(5) ?, c = 8.746(2) ?, beta = 91.66(3) degrees, V = 1983(1) ?(3), Z = 2, and R(w) = 0.0416. In solution, however, complex 6 adopts a seven-coordinate molecular structure with the triflate ion within the first coordination sphere.     

Organometallic Fluorides of Zirconium and Hafnium in the Synthesis of Carboxylate Complexes: Molecular Structures of [{(eta(5)-C(5)Me(5))ZrF(OCOCF(3))(2)}(2)] and [(eta(5)-C(5)Me(5))(2)Zr(OCOCF(3))(2)

The reaction of [(eta(5)-C(5)Me(5))ZrF(3)] and [(eta(5)-C(5)Me(5))HfF(3)] with Me(3)SiOCOCF(3) yields the dinuclear complexes [{(eta(5)-C(5)Me(5))ZrF(OCOCF(3))(2)}(2)] (1) and [{(eta(5)-C(5)Me(5))HfF(OCOCF(3))(2)}(2)] (2), regardless of the molar ratio employed. [(eta(5)-C(5)Me(5))(2)ZrF(2)] reacts with 1 and 2 equiv of Me(3)SiOCOCF(3) to form the mononuclear compounds [(eta(5)-C(5)Me(5))(2)Zr(OCOCF(3))(2)] (3) and [(eta(5)-C(5)Me(5))(2)ZrF(OCOCF(3))] (4), respectively. The molecular structures of 1 and 3 have been determined by single-crystal X-ray analysis: 1, triclinic, P&onemacr;, a = 9.508(3) ?, b = 11.002(4) ?, c = 17.528(3) ?, alpha = 78.55(4), beta = 76.80(2), gamma = 87.51(2) degrees, V = 1750(1) ?(3), Z = 2, R = 0.0378; 3, monoclinic, C2/c, a = 18.553(4) ?, b = 9.110(2) ?, c = 16.323(3) ?, beta = 114.88(3) degrees, V = 2503(1) ?(3), Z = 4, R = 0.0457. Compound 1 shows bridging bidentate and chelating carboxylate ligands as well as bridging fluorine atoms. The zirconium atoms are seven coordinated and have an 18-electron configuration. X-ray studies of 3 reveal two structural components where the carboxylate ligands coordinate in a monodentate (major component) and a chelating manner (minor component).     

Reactions of the Dirhenium(II) Complexes Re(2)X(4)(dppm)(2) (X = Cl, Br; dppm = Ph(2)PCH(2)PPh(2)) with Isocyanides. 10.(1) Synthesis and Characterization of the Complex [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3) and Several Isomeric Forms of [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)]Y (Y = PF(6), O(3)SCF(3))

The reactions of the unsymmetrical, coordinatively unsaturated dirhenium(II) complexes [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)]Y (XylNC = 2,6-dimethylphenyl isocyanide; Y = O(3)SCF(3) (3a), PF(6) (3b)) with XylNC afford at least three isomeric forms of the complex cation [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+). Two forms have very similar bis(&mgr;-halo)-bridged edge-sharing bioctahedral structures of the type [(CO)BrRe(&mgr;-Br)(2)(&mgr;-dppm)(2)Re(CNXyl)(2)]Y (Y = O(3)SCF(3) (4a/4a'), PF(6) (4b/4b')), while the third is an open bioctahedron [(XylNC)(2)BrRe(&mgr;-dppm)(2)ReBr(2)(CO)]Y (Y = O(3)SCF(3) (5a), PF(6) (5b)). While the analogous chloro complex cation [Re(2)Cl(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+) was previously shown to exist in three isomeric forms, only one of these has been found to be structurally similar to the bromo complexes (i.e. the isomer analogous to 5a and 5b). The reaction of 3a with CO gives the salt [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3) (7), in which the edge-sharing bioctahedral cation [(XylNC)BrRe(&mgr;-Br)(&mgr;-CO)(&mgr;-dppm)(2)ReBr(CO)](+) has an all-cis arrangement of pi-acceptor ligands. The Re-Re distances in the structures of 4b', 5a, and 7 are 3.0456(8), 2.3792(7), and 2.5853(13) ?, respectively, and accord with formal Re-Re bond orders of 1, 3, and 2, respectively. Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](PF(6))(0.78)(ReO(4))(0.22).CH(2)Cl(2) (4b') at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 19.845(4) ?, b = 16.945(5) ?, c = 21.759(3) ?, beta = 105.856(13) degrees, V = 7038(5) ?(3), and Z = 4. The structure was refined to R = 0.060 (R(w) = 0.145) for 14 245 data (F(o)(2) > 2sigma(F(o)(2))). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)]O(3)SCF(3).C(6)H(6) (5a) at 173 K: monoclinic space group P2(1)/n (No. 14) with a = 14.785(3) ?, b = 15.289(4) ?, c = 32.067(5) ?, beta = 100.87(2) degrees, V=7118(5) ?(3), and Z = 4. The structure was refined to R = 0.046 (R(w) = 0.055) for 6962 data (I > 3.0sigma(I)). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3).Me(2)CHC(O)Me (7) at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 14.951(2) ?, b = 12.4180(19) ?, c = 40.600(5) ?, beta = 89.993(11) degrees, V = 7537(3) ?(3), and Z = 4. The structure was refined to R = 0.074 (R(w) = 0.088) for 6595 data (I > 3.0sigma(I)).     

New complexes of zirconium(IV) and hafnium(IV) with heteroscorpionate ligands and the hydrolysis of such complexes to give a zirconium cluster

A series of zirconium and hafnium heteroscorpionate complexes have been prepared by the reaction of MCl4 (M = Zr, Hf) with the compounds [[Li(bdmpza)(H2O)](4)] [bdmpza = bis(3,5-dimethylpyrazol-1-yl)acetate], [[Li(bdmpzdta)(H2O)](4)] [bdmpzdta = bis(3,5-dimethylpyrazol-1-yl)dithioacetate], and (Hbdmpze) [bdmpze = 2,2-bis(3,5-dimethylpyrazol-1-yl)ethoxide] (the latter with the prior addition of Bu(n)Li). Under the appropriate experimental conditions, mononuclear complexes, namely, [MCl3(kappa3-bdmpzx)] [x = a, M = Zr (1), Hf (2); x = dta, M = Zr (3), Hf (4); x = e, M = Zr (5), Hf (6)], and dinuclear complexes, namely, [[MCl2(mu-OH)(kappa3-bdmpzx)]2] [x = a, M = Zr (7), Hf (8); x = dta, M = Zr (9); x = e, M = Zr (10)], were isolated. A family of alkoxide-containing complexes of the general formula [ZrCl2(kappa3-bdmpzx)(OR)] [x = a, R = Me (11), Et (12), iPr (13), tBu (14); x = dta, R = Me (15), Et (16), iPr (17), tBu (18); x = e, R = Me (19), Et (20), (i)Pr (21), (t)Bu (22)] was also prepared. Complexes 11-14 underwent an interesting hydrolysis process to give the cluster complex [Zr6(mu3-OH)8(OH)8(kappa2-bdmpza)8] (23). The structures of these complexes have been determined by spectroscopic methods, and the X-ray crystal structures of 7, 8, and 23 were also established.     

Synthesis, Structure, and Magnetic Properties of Transition Metal Complexes of the Nitroxide 2,5-Dihydro-4,5,5-trimethyl-2,2-bis(2-pyridyl)imidazole-1-oxyl

With the radical 2,5-dihydro-4,5,5-trimethyl-2,2-bis(2-pyridyl)imidazole-1-oxyl (L) a series of transition metal complexes have been prepared: [ML(2)](SbF(6))(2) with M(2+) = Mn(2+) (1), Fe(2+) (2), Co(2+) (3), Ni(2+) (4), Cu(2+) (5), and Zn(2+) (6), Cu(L)(Cl)(2)(MeOH) (7), and Cu(L)SO(4).H(2)O (8). The structures of 1, 3, and 6 were determined by X-ray structural analyses. In these compounds the tridendate L is coordinated to the metal ion by the two pyridine nitrogen donors and by the oxygen atom of the nitroxide group. The N-O bond distances are 1.25(2) ? (1), 1.267(13) ? (3), and 1.260(11) ? (6). The M-O-N angles are 117.0(10) degrees (1), 114.5(8) degrees (3), and 114.2(7) degrees (6). Crystal data: space group P2(1)/n, for 1, 3, and 6; compound 1, a = 10.806(3) ?, b = 14.101(6) ?, c = 14.253(4) ?, beta = 108.82(2) degrees, V = 2055.7(12) ?(3), Z = 2, R(1) = 0.0677, wR(2) = 0.1512. Compound 3, a = 10.761(4) ?, b = 14.253(6) ?, c = 14.108(5) ?, beta = 111.16(3) degrees, V = 2017.9(13) ?(3), Z = 2, R(1) = 0.0702, wR(2) = 0.1460; compound 6, a = 10.788(2) ?, b = 14.147(3) ?, c = 14.196(3) ?, beta = 109.93(3) degrees, V = 2036.8(7) ?(3), Z = 2, R(1) = 0.0573, wR(2) = 0.1194. Magnetic measurements of 1, 2, 5, and 8 show strong antiferromagnetic interaction between the spin of the metal ion and the spin of the radical which increases at lower temperatures. For 6 the magnetic moment corresponds to two noninteracting spins in the temperature range 60-300 K.     

Stabilizing Heterobimetallic Complexes Containing Unsupported Ti-M Bonds (M = Fe, Ru, Co): The Nature of Ti-M Donor-Acceptor Bonds

The stabilization of unsupported Ti-M (M = Fe, Ru, Co) heterodinuclear complexes has been achieved by use of amidotitanium building blocks containing tripodal amido ligands. Salt metathesis of H(3)CC(CH(2)NSiMe(3))(3)TiX (1) and C(6)H(5)C(CH(2)NSiMe(3))(3)TiX (2) as well as HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)TiX (3) (X = Cl, a; Br, b) with K[M(CO)(2)Cp] (M = Fe, Ru) and Na[Co(CO)(3)(PR(3))] (R = Ph, Tol) gave the corresponding stable heterobimetallic complexes of which H(3)CC(CH(2)NSiMe(3))(3)Ti-M(CO)(2)Cp (M = Fe, 6; Ru, 7) and HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)Ti-M(CO)(2)Cp (M = Fe, 12; Ru, 13) have been characterized by X-ray crystallography. 6: monoclinic, P2(1)/n, a = 15.496(3) ?, b = 12.983(3) ?, c = 29.219(3) ?, beta = 104.52(2) degrees, Z = 8, V = 5690.71 ?(3), R = 0.070. 7: monoclinic, P2(1)/c, a = 12.977(3) ?, b = 12.084(3) ?, c = 18.217(3) ?, beta = 91.33(2) degrees, Z = 4, V = 2855.91 ?(3), R = 0.048. 12: monoclinic, I2/c, a = 24.660(4) ?, b = 15.452(3) ?, c = 20.631(4) ?, beta = 103.64(3) degrees, Z = 8, V = 7639.65 ?(3), R = 0.079. 13: monoclinic, I2/c, a = 24.473(3) ?, b = 15.417(3) ?, c = 20.783(4) ?, beta = 104.20(2) degrees, Z = 8, V = 7601.84 ?(3), R = 0.066. (1)H- and (13)C-NMR studies in solution indicate free internal rotation of the molecular fragments around the Ti-M bonds. Fenske-Hall calculations performed on the idealized system HC(CH(2)NH)(3)Ti-Fe(CO)(2)Cp (6x) have revealed a significant degree of pi-donor-acceptor interaction between the two metal fragments reinforcing the Ti-Fe sigma-bond. Due to the availability of energetically low-lying pi-acceptor orbitals at the Ti center this partial multiple bonding is more pronounced that in the tin analogue HC(CH(2)NH)(3)Sn-Fe(CO)(2)Cp (15x) in which an N-Sn sigma-orbital may act as pi-acceptor orbital.     

Synthesis and Crystal Structure of Organocobalt(III) Complexes with Secondary Alkyls or Bulky Schiff Base Equatorial Ligands

Alkylcobalt(III) Schiff base B(12) model complexes with secondary alkyls or a bulky diamine in the equatorial position were synthesized and characterized. Structures have been first determined by X-ray diffraction analysis for i-C(4)H(9)Co(salen)(gamma-pic) (I), n-C(3)H(7)Co(salen)(gamma-pic) (II) and C(2)H(5)Co(SB) (III), where salen = N,N'-ethylenebis(salicylideneamine) dianion; SB = 1,1,2,2-tetramethyl-N,N'-ethylenebis(salicylideneamine) dianion, gamma-pic = gamma-picoline. Crystal data for I (CoC(26)N(3)O(2)H(30)): space group P2(1)/c with a = 6.661(5) ?, b = 18.612(2) ?, c = 19.533(3) ?, beta = 98.93(1) degrees, V = 2392.10 ?(3), D(calcd) = 1.320 g.cm(-3), Z = 4, and R = 0.048 for 4469 measured reflections. Crystal data for II (CoC(25)N(3)O(2)H(28)): space group P2(1)/c, a = 9.609(6) ?, b = 19.169(8) ?, c = 12.995(9) ?, beta = 106.9(7) degrees, V = 2290.4 ?(3), D(calcd) = 1.332 g.cm(-1), Z = 4, and R = 0.048 for 4358 measured reflections. Crystal data for III (CoC(22)N(2)O(2)H(27)): space group P2(1)/c, a = 8.318(3) ?, b = 21.579(2) ?, c = 11.572(2) ?, beta = 93.35(1) degrees, V = 2073.7 ?(3), D(calcd) = 1.314 g.cm(-1), Z = 4, and R = 0.060 for 3954 measured reflections. The crystal structure data reveal that complexes I and II display six-coordinate octahedral geometry; their Co-C, Co-N bond lengths, as well as the Co-C-C angles, are very close to those in 5'-deoxyadenosylcobalamin. Complex III is one of the very few compounds having five-coordinate square pyramidal geometry and observed instability of the Co-C bond.     

Unusual Reactivity Mode of Coordinated Oximes: Platinum(IV)-Assisted Ring Closure by Reaction with Acetone

The platinum(II) complexes trans-[PtCl(2)(RR'C=NOH)(2)], where R = R' = Me, RR' = (CH(2))(4) and (CH(2))(5), react with m-chloroperoxybenzoic acid in Me(2)CO to give the platinum(IV) complexes [PtCl(2)(OCMe(2)ON=CRR')(2)] in 50-60% yields. The complexes [PtCl(2)(OCMe(2)ON=CRR')(2)] were characterized by elemental analysis, EI-MS, and IR and Raman spectroscopies; X-ray structure analyses were performed for both trans-[PtCl(2)(OCMe(2)ON=CC(4)H(8))(2)] and trans-[PtCl(2)(OCMe(2)ON=CC(5)H(10))(2)]. The former compound crystallizes in the triclinic space group P&onemacr; with a = 8.088(2) ?, b = 8.327(2) ?, c = 8.475(2) ?, alpha = 103.54(3) degrees, beta = 102.15(3) degrees, gamma = 108.37(3) degrees, V = 501.0(2) ?(3), Z = 1, and rho(calcd) = 1.917 g cm(-)(3). The latter complex crystallizes in the monoclinic space group C2/c with a = 12.5260(10) ?, b = 9.3360(10) ?, c = 18.699(2) ?, beta = 98.320(10) degrees, V = 2163.7(4) ?(3), Z = 4, and rho(calcd) = 1.862 g cm(-)(3). The structures of [PtCl(2)(OCMe(2)ON=CC(4)H(8))(2)] and [PtCl(2)(OCMe(2)ON=CC(5)H(10))(2)] show an octahedron of Pt where two Cl atoms and two chelate ligands are mutually trans, respectively.     

Novel Organo-Substituted Cyclophosphazenes via Reaction of a Monohydro Cyclophosphazene and Acetyl Chloride

A new olefin-substituted tetrachlorocyclotri-lambda(5)-phosphazene (NPCl(2))(2)NP(i)Pr{C[OC(O)Me]=CH(2)} (4) and an unique bicyclo-lambda(5)-triphosphazene [(NPCl(2))(2)NP(i)Pr](2)C(OH)Me (5) have been prepared from the reaction of MeC(O)Cl and (NPCl(2))(2)NP(i)PrH in the presence of Et(3)N. Exclusive formation of 4 could be achieved by using an excess of both Et(3)N and MeC(O)Cl. The phosphazene rings in 5 are bridged by one carbon atom. The presence of this C(OH)Me bridge induces an asymmetric environment which renders the isopropyl ligands no longer equivalent under NMR conditions. Crystals of 4 are monoclinic, space group P2(1)/n, with a = 13.158(1) ?, b = 9.555(1) ?, c = 14.859(1) ?, beta = 115.502(6) degrees, V = 1686.1(3) ?(3), and Z = 4. Crystals of 5 are monoclinic, space group P2(1)/c, with a = 13.255(2) ?, b = 12.050(2) ?, c = 16.280(2) ?, beta = 98.91(1) degrees, V = 2568.8(7) ?(3), and Z = 4.     

Synthesis and Characterization of Water-Soluble 1,2-Bis(bis(hydroxyalkyl)phosphino)ethane Ligands and Their Nickel(II), Ruthenium(III), and Rhodium(I) Complexes

The syntheses of the water-soluble, chelating phosphines 1,2-bis(bis(hydroxybutyl)phosphino)ethane (1, n = 3; DHBuPE) and 1,2-bis(bis(hydroxypentyl)phosphino)ethane (1, n = 4; DHPePE) are reported. These ligands (and, in general, other 1,2-bis(bis(hydroxyalkyl)phosphino)ethane ligands) can be used to impart water solubility to metal complexes. As examples of this, the [Ni(DHPrPE)(2)Cl]Cl (2), [Rh(DHPrPE)(2)][Cl] (3), and [Ru(DHBuPE)(2)Cl(2)][Cl] (4) complexes were synthesized; they are indeed soluble in water (>0.5 M). Crystals of DHPrPE (1, n = 2) are monoclinic, space group P2(1)/c, with a = 9.5935(8) ?, b = 9.353(2) ?, c = 10.655(2) ?, alpha = 90 degrees, beta = 100.03(1) degrees, gamma = 90, V = 941.5(5) ?(3), R = 0.051, and Z = 2. Crystals of [Ni(DHPrPE)(2)Cl]Cl (2) are monoclinic, space group I2, with a = 15.951(3) ?, b = 11.454(2) ?, c = 20.843(3) ?, alpha = 90 degrees, beta = 91.24(2) degrees, gamma = 90 degrees, V = 3807(2) ?(3), R = 0.062, and Z = 4. Crystals of [Rh(DHPrPE)(2)][Cl] (3) are triclinic, space group P&onemacr;, with a = 13.900(2) ?, b = 15.378(2) ?, c = 18.058(2) ?, alpha = 87.71(1) degrees, beta = 75.03(1) degrees, gamma = 85.24(1), V = 3715(2) ?(3), R = 0.044, and Z = 4. Crystals of [Ru(DHBuPE)(2)Cl(2)][Cl] (4) are monoclinic, space group C2/c, with a = 14.310(2) ?, b = 21.630(2) ?, c = 15.459(3) ?, alpha = 90 degrees, beta = 99.83(1) degrees, gamma = 90, V = 4715(1) ?(3), R = 0.056, and Z = 4.