Coordination Compounds of Schiff-Base Ligands Derived from Diaminomaleonitrile (DMN): Mononuclear, Dinuclear, and Macrocyclic Derivatives

Copper(II) and V(IV)O complexes of an open chain (1:2) Schiff-base ligand (H(2)L1), derived by the template condensation of diaminomaleonitrile (DMN) and salicylaldehyde, and dicopper(II) complexes of (2:2) macrocyclic Schiff-base ligands derived by template condensation of diformylphenols and diaminomaleonitrile, have been synthesized and studied. Structures have been established for the first time for mononuclear Cu(II) and V(IV)O derivatives of the open chain ligand H(2)L1 (1:2), a dinuclear macrocyclic Cu(II) complex derived from a 2:2 macrocyclic ligand (H(2)M1), and the half-condensed 1:1 salicylaldehyde ligand (H(2)L2). [Cu(L1)] (1) (L1 = C(18)H(10)N(4)O(2)) crystallized in the monoclinic system, space group P2(1)/n (No. 14), with a = 11.753(6) ?, b = 7.708(5) ?, c = 16.820(1) ?, and Z = 4. [VO(L1)(DMSO] (2) crystallized in the orthorhombic system, space group Pbca (No. 61), with a = 22.534(9) ?, b = 23.31(1) ?, c = 7.694(5) ?, and Z = 8. H(2)L2 (C(18)H(8)N(4)O) (3) crystallized in the monoclinic system, space group P2(1)/c (No. 14), with a = 13.004(6) ?, b = 11.441(7) ?, c = 7.030(4) ?, and Z = 4. [Cu(2)(M3)](CH(3)COCH(3)) (4) (M3 = C(32)H(24)N(8)O(4)) crystallized in the monoclinic system, space group C2/c (No. 15), with a = 38.33(2) ?, b = 8.059(4) ?, c = 22.67(2) ?, and Z = 8. [Cu(L3)(DMSO)] (5) (L3 = C(20)H(14)N(2)O(4)) crystallized in the triclinic system, space group P&onemacr; (No. 2), with a = 10.236(4) ?, b = 13.514(4) ?, c = 9.655(4) ?, and Z = 2. 4 results from the unique addition of two acetone molecules to two imine sites in [Cu(2)(M1)](ClO(4))(2) (M1 = 2:2 macrocyclic ligand derived from template condensation of DMN and 2,6-diformyl-4-methylphenol). 4 has extremely small Cu-OPh-Cu bridge angles (92.0, 92.8 degrees ), well below the expected lower limit for antiferromagnetic behavior, but is still antiferromagnetically coupled (-2J = 25.2 cm(-)(1)). This behavior is associated with a possible antiferromagnetic exchange term that involves the conjugated framework of the macrocyclic ligand itself. The ligand L3 in 5 results from hydrolysis of M1 on recrystallization of [Cu(2)(M1)](ClO(4))(2) from undried dimethyl sulfoxide.     

Crystal Structures and Magnetic Properties of Novel [Ln(III)Cu(II)(4)] (Ln = Gd, Dy, Ho) Pentanuclear Complexes. Topology and Ferromagnetic Interaction in the Ln(III)-Cu(II) Pair

The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data.     

Manganese(II/II/II) and Manganese(III/II/III) Trinuclear Compounds. Structure and Solid and Solution Behavior

Two mixed-valence Mn(III)Mn(II) complexes and a homo-valence Mn(II) trinuclear manganese complex of stoichiometry Mn(III)Mn(II)Mn(III)(5-Cl-Hsaladhp)(2)(AcO)(4)(MeOH)(2).4CH(3)OH (1a), Mn(III)Mn(II)Mn(III) (Hsaladhp)(2)(AcO)(2)(5-Cl-Sal)(2)(thf)(2) (3a) and Mn(II)Mn(II)Mn(II) (AcO)(6)(pybim)(2) (1b) where H(3)saladhp is a tridentate Schiff base ligand and pybim a neutral bidentate donor ligand, have been structurally characterized by using X-ray crystallography. The structurally characterized mixed-valence complexes have strictly 180 degrees Mn(III)-Mn(II)-Mn(III) angles as required by crystallographic inversion symmetry. The complexes are valence trapped with two terminal Mn(III) ions showing Jahn-Teller distortion along the acetate or salicylate-Mn(III)-X axis. The Mn.Mn separation is 3.511 ? and 3.507 ? respectively. The mixed-valence complexes have S = (3)/(2) ground state and the homovalence complex S = (5)/(2), with small antiferromagnetic exchange J couplings, -5.6 and -1.8 cm(-1), respectively, while the powder ESR spectra at 4 K show a broad low field signal with g approximately 4.3 for Mn(III)Mn(II)Mn(III) and a broad temperature-dependent signal at g = 2 for Mn(II)Mn(II)Mn(II). Crystal data for 1a: [C(36)H(60)O(20)N(2)Cl(2)Mn(3)], triclinic, space group P&onemacr;, a = 9.272(7) ?, b = 11.046(8) ?, c = 12.635(9) ?, alpha = 76.78(2) degrees, beta = 81.84(2) degrees, gamma = 85.90(2) degrees, Z = 1. Crystal data for 3a: [C(48)H(56)O(18)N(2)Cl(2)Mn(3)], monoclinic, space group P2(1)/n, a = 8.776(3) ?, b = 22.182(7) ?, c = 13.575(4) ?, beta = 94.44(1) degrees, Z = 2. Crystal data for 1b: [C(36)H(36)O(12)N(6)Mn(3)], triclinic, space group P&onemacr;, a = 13.345(6) ?, b = 8.514(4) ?, c = 9.494(4) ?, alpha = 75.48(1) degrees, beta = 75.83(1) degrees, gamma = 76.42(1) degrees, Z = 1.     

Structural and Electrochemical Comparison of Copper(II) Complexes with Tripodal Ligands

A series of copper(II) complexes with tripodal polypyridylmethylamine ligands, such as tris(2-pyridylmethyl)amine (tpa), ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Me(1)tpa), bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), and tris((6-methyl-2-pyridyl)methyl)amine (Me(3)tpa), have been synthesized and characterized by X-ray crystallography. [Cu(H(2)O)(tpa)](ClO(4))(2) (1) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.029(7) ?, b = 9.268(2) ?, c = 17.948(5) ?, beta = 113.80(3) degrees, and Z = 4 (R = 0.061, R(w) = 0.059). [CuCl(Me(1)tpa)]ClO(4) (2) crystallized in the triclinic system, space group P&onemacr;, with a = 13.617(4) ?, b = 14.532(4) ?, c = 12.357(4) ?, alpha = 106.01(3) degrees, beta = 111.96(2) degrees, gamma = 71.61(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.037). [CuCl(Me(2)tpa)]ClO(4) (3) crystallized in the monoclinic system, space group P2(1)/n, with a = 19.650(4) ?, b = 13.528(4) ?, c = 8.55(1) ?, beta = 101.51(5) degrees, and Z = 4 (R = 0.071, R(w) = 0.050). [CuCl(Me(3)tpa)][CuCl(2)(Me(3)tpa)]ClO(4) (4) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.698(6) ?, b = 14.687(7) ?, c = 19.475(4) ?, beta = 97.13(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.038). All the Cu atoms of 1-4 have pentacoordinate geometries with three pyridyl and one tertiary amino nitrogen atoms, and a chloride or aqua oxygen atom. Nitrite ion coordinated to the Cu(II) center of Me(1)tpa, Me(2)tpa, and Me(3)tpa complexes with only oxygen atom to form nitrito adducts. The cyclic voltammograms of [Cu(H(2)O)(Me(n)()tpa)](2+) (n = 0, 1, 2, and 3) in the presence of NO(2)(-) in H(2)O (pH 7.0) revealed that the catalytic activity for the reduction of NO(2)(-) increases in the order Me(3)tpa < Me(2)tpa < Me(1)tpa < tpa complexes.     

Dinuclear Copper(II) Complexes Incorporating a New Septadentate Polyimidazole Ligand

The dinuclear copper(II) complexes [Cu(2)(tmihpn)(prz)](ClO(4))(2).2CH(3)CN (6) and [Cu(2)(tmihpn)(O(2)CCH(3))](ClO(4))(2).CH(3)CN (7) were prepared, where tmihpn is the deprotonated form of N,N,N',N'-tetrakis[(1-methylimidazol-2-yl)methyl]-1,3-diaminopropan-2-ol and prz is the pyrazolate anion. The crystal structures of 6 and 7 were determined and revealed that both complexes contain bridging alkoxide ligands as well as bridging pyrazolate and acetate ions, respectively. Crystal data: compound 6, triclinic, P&onemacr;, a = 18.089(2) ?, b = 22.948(3) ?, c = 9.597(2) ?, alpha = 93.37(2) degrees, beta = 94.49(2) degrees, gamma = 81.69(2) degrees, V = 3925.1 ?(3), Z = 4; compound 7, triclinic, P&onemacr;, a = 12.417(2) ?, b = 15.012(3) ?, c = 10.699(2) ?, alpha = 104.76(2) degrees, beta = 102.63(2) degrees, gamma = 99.44(2) degrees, V = 1830.1 ?(3), Z = 2. In compound 6, the coordination geometry around both copper centers resembles a distorted square pyramid, while the stereochemistry around the copper centers in 7 is best described as trigonal bipyramidal. Both complexes display well-resolved isotropically shifted (1)H NMR spectra. Selective substitution studies and integration data have been used to definitively assign several signals to specific ligand protons. Results from the solution (1)H NMR studies suggest that the basal and apical imidazole groups do not exchange rapidly on the NMR time scale and the solid state structures of the complexes are retained in solution. In addition, the magnetochemical characteristics of 6 and 7 were determined and provide evidence for "magnetic orbital switching". Antiferromagnetic coupling in 6 (J = -130 cm(-)(1)) is strong, while the copper centers in compound 7 are ferromagnetically coupled (J = +16.4 cm(-1)). Differences in the magnetic behavior of the two copper centers have been rationalized using the "ligand orbital complementary" concept. The ground state magnetic orbitals involved in spin coupling in 6 (d(x)()()2(-)(y)()()2) are different from those in 7 (d(z)()()2).     

Rational Design of a Novel Intercalation System. Layer-Gap Control of Crystalline Coordination Polymers, {[Cu(CA)(H(2)O)(m)()](G)}(n)() (m = 2, G = 2,5-Dimethylpyrazine and Phenazine; m = 1, G = 1,2,3,4,6,7,8,9-Octahydrophenazine)

New copper(II) intercalation compounds, {[Cu(CA)(H(2)O)(2)](G)}(n)() (H(2)CA = chloranilic acid; G = 2,5-dimethylpyrazine (dmpyz) (1a and 1b) and phenazine (phz) (2)) have been synthesized and characterized. 1acrystallizes in the triclinic space group P&onemacr;, with a = 8.028(2) ?, b = 10.269(1) ?, c = 4.780(2) ?, alpha = 93.85(3) degrees, beta = 101.01(2) degrees, gamma = 90.04(3) degrees, and Z = 1. 1b crystallizes in the triclinic space group P&onemacr;, with a = 8.010(1) ?, b = 10.117(1) ?, c = 5.162(1) ?, alpha = 94.40(1) degrees, beta = 97.49(1) degrees, gamma = 112.64(1) degrees, and Z = 1. 2crystallizes in the triclinic space group P&onemacr;, with a = 8.071(1) ?, b = 11.266(1) ?, c = 4.991(1) ?, alpha = 97.80(1) degrees, beta = 99.58(1) degrees, gamma = 83.02(1) degrees, and Z = 1. For all the compounds, the crystal structures consist of one dimensional [Cu(CA)(H(2)O)(2)](m)() chains and uncoordinated guest molecules (G). Each copper atom for 1a, 1b, and 2 displays a six-coordinate geometry with the two bis-chelating CA(2)(-) anions and water molecules, providing an infinite, nearly coplanar linear chains running along the a-direction. Theses chains are linked by hydrogen bonds between the coordinated water and the oxygen atoms of CA(2)(-) on the adjacent chain, forming extended layers, which spread out along the ac-plane. The guest molecules are intercalated in between the {[Cu(CA)(H(2)O)(2)](k)()}(l)() layers, just like pillars, which are supported with N.H(2)O hydrogen bonding. The guest molecules are stacked each other with an interplanar distance of ca. 3.2 ? along the c-axis perpendicular to the [Cu(CA)(H(2)O)(2)](m)() chain. The EHMO band calculations of intercalated dmpyz and phz columns show an appreciable band dispersion of phz pi (b(2g) and b(3g)) and dmpyz pi (b(g)), indicative of the importance of planar pi structure for the formation of the intercalated structure. The distances of O-H---N (guest molecules) fall within the range 2.74-2.80 ?, insensitive to the guest, whereas the interlayer distances increase in the order 9.25 ? (1b), 10.24 ? (1a), and 11.03 ? (2). The degree in lengthening the distance correlates well with the size of a molecule, indicative of the stability of the 2-D sheet structure and the flexibility of the sheet packing. The magnetic susceptibilities were measured from 2 to 300 K and analyzed by a one-dimensional Heisenberg-exchange model to yield J = -1.83 cm(-)(1), g = 2.18 (1a), J = -0.39 cm(-)(1), g = 2.14 (1b), and J = -1.84 cm(-)(1), g = 2.18 (2). The absolute value of J is smaller than that value for [Cu(CA)](n)(), which has a planar ribbon structure suggesting that the magnetic orbital d(x)()()2(-)(y)()()2 is not parallel to the chloranilate plane. For comparison with phz another type of copper(II) coordination compound, {[Cu(CA)(H(2)O)](ohphz)}(n)() (ohphz = 1,2,3,4,6,7,8,9-octahydrophenazine (7)) has also been obtained. 7 crystallizes in the orthorhombic space group Cmcm with a = 7.601(2) ?, b = 13.884(2) ?, c = 17.676(4) ?, and Z = 4. Nonplanar ohphz molecules are in between [Cu(CA)(H(2)O)(2)](m)() chains with the N.H(2)O hydrogen bonding in a fashion parallel to the chain direction. The copper atom shows a five-coordinate square-pyramidal configuration with two CA and one water molecule, thus affording no hydrogen bonding links between chains, dissimilar to 1a, 1b, and 2. The magnetic susceptibilities yield J = -10.93 cm(-)(1) and g = 2.00, comparable to that of the four-coordinate [Cu(CA)](n)(). On this basis both hydrogen bonding and stack capability of a guest molecule is responsible for building the unique intercalated structure such as is seen in 1a, 1b, and 2.     

Coordination Chemistry of 2,2'-Dipyridyl Diselenide: X-ray Crystal Structures of PySeSePy, [Zn(PySeSePy)Cl(2)], [(PySeSePy)Hg(C(6)F(5))(2)], [Mo(SePy)(2)(CO)(3)], [W(SePy)(2)(CO)(3)], and [Fe(SePy)(2)(CO)(2)] (PySeSePy = C(5)H(4)NSeSeC(5)H(4)N; SePy = [C(5)H(4)N(2-Se)-N,Se])

The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4).     

Copper and Bismuth Complexes Containing Dipyridyl gem-Diolato Ligands: Bi(III)(2)[(2-Py)(2)CO(OH)](2)(O(2)CCF(3))(4)(THF)(2), Cu(II)[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), and Cu(II)(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), a Ferromagnetically Coupled Tetranuclear Copper(II) Chain

The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1.     

Model for the Reduced Schiff Base Intermediate between Amino Acids and Pyridoxal: Copper(II) Complexes of N-(2-Hydroxybenzyl)amino Acids with Nonpolar Side Chains and the Crystal Structures of [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(phen)].H(2)O and [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)

Copper(II) complexes with reduced Schiff base ligands of amino acids possessing nonpolar side chains with salicylaldehyde have been synthesized. Ternary complexes with imidazole, 1,10-phenanthroline, and pyridine have been prepared and characterized for N-(2-hydroxybenzyl)-D,L-alanine. The crystal structures of [(N-(2-hydroxybenzyl)-D,L-alanine)(1,10-phenanthroline)Cu(II)] monohydrate ([Cu(SAla)phen].H(2)O) and [(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)Cu(II)] ([Cu(SAla)Him]), have been determined. [Cu(SAla)phen].H(2)O crystallized in space group P&onemacr;, with a = 8.718(2) ?, b = 10.886(3) ?, c = 11.693(2) ?, alpha = 71.32(2) degrees, beta = 85.27(2) degrees, gamma = 70.21(2) degrees, and Z = 2. The copper atom is five coordinate, with SAla acting as a tridentate ONO chelator through the carboxylato and phenolato oxygens and the amine nitrogen. The remaining donors are provided by the phen nitrogens. [Cu(SAla)Him] crystallized in space group P2(1)/n, with a = 10.353(1) ?, b = 6.714(1) ?, c = 18.769(2) ?, beta = 91.71(1) degrees, and Z = 4. The copper atom is four coordinate, with SAla acting as a tridentate ONO chelator with the neutral imidazole moiety coordinated through nitrogen. In both complexes the ligand has two chiral centers due to the coordination of the N. Molecular mechanics calculations show that unfavorable steric interactions would occur in the nonobserved R,R and S,S diastereomers. Compounds prepared have been characterized by a range of physicochemical techniques. The complexes may serve as stable models for the intermediates in enzymatic amino acid transformations.     

Synthesis and Characterization of Copper(II), Zinc(II), and Potassium Complexes of a Highly Fluorinated Bis(pyrazolyl)borate Ligand

Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4.     

Structure of Dicopper Complexes of N,N,N',N'-Tetrakis[(2-benzimidazolyl)methyl]-2-hydroxy-1,3-diaminopropane with Coordinated Thiocyanate Counterions

The structures of five dicopper complexes of binucleating ligand HL-H (N,N,N',N'-tetrakis[(2-benzimidazolyl)methyl]-2-hydroxy-1,3-diaminopropane) with thiocyanate and some other counterions were investigated by the X-ray diffraction method. In Cu(2)(HL-H)(NCS)(2)Cl(2).6H(2)O.CH(3)OH, 1 (a = 12.524(5) ?, b = 14.429(4) ?, c = 16.343(3) ?, alpha = 109.01(2) degrees, beta = 92.62(2) degrees, gamma = 115.27(3) degrees, Z = 2, triclinic, P&onemacr;), one chloride is not coordinated. Distorted square pyramidal (SP) geometry is found for both CuN(3)ClN and CuN(3)ON coordination sites in which the N(3) tripodal coordination sites come from the two symmetric halves of HL-H and the other nitrogen atoms come from thiocyanate ions. In Cu(2)(HL-H)(NCS)(2)(ClO(4))(2).6H(2)O.2EtOH, 2 (a = 10.955(2) ?, b = 15.366(5) ?, c = 18.465(9) ?, alpha = 65.57(4) degrees, beta = 89.73(3) degrees, gamma = 79.81(2) degrees, Z = 2, triclinic, P&onemacr;), the coordination environments for the two copper ions are both CuN(3)ON. However, their geometries are different: one is distorted SP and the other is distorted trigonal bipyramid (TBP). In Cu(2)(HL-H)(NCS)(2)(ClO(4))(2)Cl.H(3)O.3.5H(2)O, 3 (a = 11.986(6) ?, b = 12.778(5) ?, c = 17.81(1) ?, alpha = 82.41(4) degrees, beta = 75.44(5) degrees, gamma = 78.46(4) degrees, Z = 2, triclinic, P&onemacr;), the chloride ion does not coordinate to copper ion, but it is hydrogen bonded to the hydroxy hydrogen. The coordination environments for the two copper ions are both CuN(3)ON with distorted SP geometries. In Cu(2)(HL-H)(NCS)Cl(3).6H(2)O, 4 (a = 12.026(5) ?, b = 14.369(6) ?, c = 16.430(6) ?, alpha = 111.64(3) degrees, beta = 90.51(4) degrees, gamma = 113.90(3) degrees, Z = 2, triclinic, P&onemacr;), one chloride does not coordinate. The coordination environments for the two copper ions are CuN(3)ON in severely distorted TBP geometry and CuN(3)Cl(2) in SP geometry. In Cu(2)(HL-H)(NCS)(3)OH.2H(2)O.3CH(3)OH.Et(2)O, 5 (a = 18.322(5) ?, b = 15.543(6) ?, c = 19.428(7) ?, beta = 102.78(3) degrees, Z = 4, monoclinic, P2(1)/c), the hydroxide ion does not coordinate. The coordination environments for the two copper ions are CuN(3)N(2) with a geometry inbetween SP and TBP but slightly closer to SP and CuN(3)ON in distorted SP geometry. The distances between the copper ions are in the range 4.45-7.99 ?, indicating negligible interaction between the copper ions. The hydroxy groups of HL-H in 1-5all coordinate to copper ions either in a terminal mode (in complexes 1, 4, and 5, denoted as OHR(t)) or in a bridging mode (in complexes 2 and 3, denoted as OHR(b)). These hydroxy groups do not lose their protons in all cases. All thiocyanate anions coordinate to copper ions through nitrogen atoms. All copper ions in 1-5 are pentacoordinated. The fact that the CuN(3) geometries of the tripodal coordination sites in HL-H do not allow the formation of a square planar complex, may be the driving force for the formation of pentacoordinated complexes. From the structurally known dicopper complexes of the HL-H type ligands, the relative coordinating abilities of ligands to CuN(3) are OHR(t) > NCS(-) > Cl(-)(t) > OHR(b) approximately Cl(-)(b), where the letters b and t in parentheses denote bridging and terminal coordination modes respectively.     

Molecule-Based Magnets: Ferro- and Antiferromagnetic Interactions in Copper(II)-Polyorganosiloxanolate Clusters

The magnetic behavior of the clusters [(PhSiO(2))(6)Cu(6)(O(2)SiPh)(6)].6EtOH (1), Na(4)[(PhSiO(2))(12)Cu(4)].8(n)()BuOH (2), and K(4)[(C(2)H(3)SiO(2))(12)Cu(4)].6(n)()BuOH (3) has been investigated by combined magnetic susceptibility measurements and variable-temperature EPR techniques (9.25 and 245 GHz). The six copper(II) ions in the core of 1, which approaches 6/mmm symmetry, are ferromagnetically coupled as a result of the geometry at the bridging siloxanolate oxygen atoms (Cu-O-Cu = 91.5-94.6 degrees; J = -42 cm(-)(1) with H = J S(i)().S(i)()(+1), S(7) = S(1)). The ground S = 3 spin state is split in zero field mainly due to anisotropic exchange contributions (D = 0.30 cm(-)(1)). Notably, both the magnitude and the sign of the zero-field splitting parameter have been determined from HF-EPR spectra. Large antiferromagnetic Cu-Cu interactions (J approximately 200 cm(-)(1)) and an S = 0 ground state have been detected in the tetranuclear clusters 2 and 3 as a consequence of the larger Cu-O-Cu angles. The results presented in the paper are relevant to the search for new molecule-based magnetic materials.     

Copper(II) complexes of a series of alkoxy diazine ligands: mononuclear, dinuclear, and tetranuclear examples with structural, magnetic, and DFT studies

Picolyl hydrazide ligands have two potentially bridging functional groups (micro-O, micro-N-N) and consequently can exist in different coordination conformers, both of which form spin-coupled polynuclear coordination complexes, with quite different magnetic properties. The complex [Cu(2)(POAP-H)Br(3)(H(2)O)] (1) involves a micro-N-N bridge (Cu-N-N-Cu 150.6 degrees ) and exhibits quite strong antiferromagnetic coupling (-2J = 246(1) cm(-)(1)). [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2) has two Cu(II) centers bridged by an alkoxide group with a very large Cu-O-Cu angle of 141.7 degrees but unexpectedly exhibits quite weak antiferromagnetic exchange (-2J = 91.5 cm(-)(1)). This is much weaker than anticipated, despite direct overlap of the copper magnetic orbitals. Density functional calculations have been carried out on compound 2, yielding a similar singlet-triplet splitting energy. Structural details are reported for [Cu(2)(POAP-H)Br(3)(H(2)O)] (1), [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2), [Cu(2)(PAOPF-2H)Br(2)(DMSO)(H(2)O)].H(2)O (3), [Cu(4)(POMP-H))(4)](NO(3))(4).2H(2)O (4), and PPOCCO (5) (a picolyl hydrazide ligand with a terminal oxime group) and its mononuclear complexes [Cu(PPOCCO-H)(NO(3))] (6) and [Cu(PPOCCO-H)Cl] (7). Compound 1 (C(12)H(13)Br(3)Cu(2)N(5)O(4)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 15.1465(3) A, b = 18.1848(12) A, c = 6.8557(5) A, beta = 92.751(4) degrees, and Z = 4. Compound 2 (C(10)H(13)Br(3)Cu(2)N(7)O(4)) crystallizes in the triclinic system, space group P, with a = 9.14130(1) A, b = 10.4723(1) A, c = 10.9411(1) A, alpha = 100.769(1), beta = 106.271(1) degrees, gamma = 103.447(1) degrees, and Z = 2. Compound 3 (C(23)H(22)Br(2)Cu(2)N(7)O(5.5)S) crystallizes in the monoclinic system, space group P2(1)/c, with a = 12.406(2) A, b = 22.157(3) A, c = 10.704(2) A, beta = 106.21(1) degrees, and Z = 4. Compound 4(C(52)H(48)Cu(4)N(20)O(18)) crystallizes in the monoclinic system, space group P2(1)/n, with a = 14.4439(6) A, b = 12.8079(5) A, c = 16.4240(7) A, beta = 105.199(1) degrees, and Z = 4. Compound 5 (C(15)H(14)N(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.834(3) A, b = 11.797(4) A, c = 15.281(3) A, and Z = 4. Compound 6(C(15)H(13)CuN(5)O(5)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 8.2818(9) A, b = 17.886(2) A, c = 10.828(1) A, beta = 92.734(2) degrees, and Z = 4. Compound 7 (C(15)H(13)CuClN(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.9487(6) A, b = 14.3336(10) A, c = 13.0014(9) A, and Z = 4. Density functional calculations on PPOCCO are examined in relation to the anti-eclipsed conformational change that occurs on coordination to copper(II).     

Hydrothermal Syntheses and Structural Characterization of Layered Vanadium Oxides Incorporating Organic Cations: alpha-, beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] and alpha-, beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)

Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space.     

A Ferromagnetic Interaction between Cu(2+) Centers through a [CrO(4)](2-) Bridge: Crystal Structures and Magnetic Properties of [{Cu(acpa)}(2)(&mgr;-MO(4))] (M = Cr, Mo) (Hacpa = N-(1-Acetyl-2-propyridene)(2-pyridylmethyl)amine)

The reaction of [Cu(acpa)](+) with [MO(4)](2)(-) (Hacpa = N-(1-acetyl-2-propyridene)(2-pyridylmethyl)amine and M = Cr and Mo) in water-methanol or water-acetonitrile solution affords dinuclear copper(II) complexes with metalate bridges, [{Cu(acpa)}(2)(&mgr;-CrO(4))].4CH(3)OH.4H(2)O (1) and [{Cu(acpa)}(2)(&mgr;-MoO(4))].4H(2)O (2), respectively. The crystal structures and the magnetic properties have been studied. Complexes 1 and 2 are isomorphous and the structures are made up of discrete dimers in which two copper(II) ions are bridged by the [MO(4)](2)(-) anion. The coordination geometry about the copper(II) ions is square planar with a N(2)O chelate group from acpa and an oxygen atom from [MO(4)](2)(-). Magnetic susceptibility measurements for 1 revealed that a ferromagnetic interaction between copper(II) ions is propagated through the [CrO(4)](2)(-) bridge and the coupling constant (2J) was evaluated to be 14.6(1) cm(-)(1) (H = -2JS(1).S(2)). In 2, two copper(II) ions bridged by [MoO(4)](2)(-) anion are antiferromagnetically coupled with the 2J value of -5.1(4) cm(-)(1). The ferromagnetic interaction in 1 is explained by means of the orbital topology of frontier orbitals. Crystal data: 1, monoclinic, space group P2(1)/m, a = 8.349(2) ?, b = 17.616(3) ?, c = 10.473 ?, beta = 107.40(2) degrees, Z= 2; 2, monoclinic, space group P2(1)/m, a = 8.486(2) ?, b = 18.043(3) ?, c = 9.753(2) ?, beta = 95.82(2) degrees, Z = 2.     

Chemistry of Thiobenzoates: Syntheses, Structures, and NMR Spectra of Salts of [M(SOCPh)(3)](-) (M = Zn, Cd, Hg)

The salts (Ph(4)E)[M(SOCPh)(3)] (M = Zn, Cd, or Hg; E = P or As) are produced by the reaction of Zn(NO(3))(2).6 H(2)O, Cd(NO(3))(2).4H(2)O or HgCl(2) with Et(3)NH(+)PhCOS(-) and (Ph(4)E)X (E = P, X = Br; E = As, X = Cl) in aqueous MeOH in the ratios M(II):PhCOS(-):Ph(4)E(+) = 1:>/=3:>/=1. The crystal structures of (Ph(4)P)[Zn(SOCPh)(3)] (1), (Ph(4)As)[Cd(SOCPh)(3)] (2) and (Ph(4)P)[Hg(SOCPh)(3)] (3) have been determined by single-crystal X-ray diffraction experiments. Crystal data for 1: triclinic; space group P&onemacr;; Z = 2; a = 10.819(2) ?, b = 13.219(3) ?, c = 15.951(3) ?; alpha = 101.75(2) degrees, beta = 97.92(1) degrees, gamma = 109.18(2) degrees. Crystal data for 2: triclinic; space group P&onemacr;; Z= 2; a = 10.741(2) ?, b = 13.168(2) ?, c = 15.809(2) ?; alpha = 101.00(1) degrees, beta = 97.65(1) degrees, gamma = 109.88(1) degrees. Crystal data for 3: monoclinic; space group P2(1)/n; Z = 4; a = 13.302(2) ?, b = 14.276(2) ?, c = 21.108(2) ?; beta = 90.92(1) degrees. The compounds 1 and 2 are isomorphous and isostructural. In the anions [M(SOCPh)(3)](-) the metal atoms have trigonal planar coordination by three sulfur atoms. The metal atoms are further more weakly coordinated intramolecularly to one (M = Hg) or two (M = Zn, Cd) thiobenzoate oxygen atom(s). Using the Bond Valence approach it is found that the contribution of M.O bonding to the total bonding is in the order Cd > Zn > Hg. The metal ((113)Cd, (199)Hg) NMR signals of [M(SOCPh)(3)](-) (M = Cd, Hg) are more shielded than those found for MS(3) kernels in thiolate complexes, a difference attributed to the M(.)O bonding in the thiobenzoate complexes. The (113)Cd resonance of [Cd(SOCPh)(3)](-) in dilute solution is in the region anticipated from dilution data for [Na(Cd{SOCPh}(3))(2)](-).     

Synthesis, Structure, and Reactivity of [Zr(6)Cl(18)H(5)](2)(-), the First Paramagnetic Species of Its Class

Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4.     

Metal Binding of Polyalcohols. 4. Structure and Magnetism of the Hexanuclear, &mgr;(6)-Oxo-Centered [OFe(6)(H(-)(3)thme)(3)(OCH(3))(3)Cl(6)](2)(-) (thme = 1,1,1-Tris(hydroxymethyl)ethane)

The addition of [N(CH(3))(4)]OH to a methanolic solution of FeCl(3) and thme (thme = 1,1,1-tris(hydroxymethyl)ethane) yielded [N(CH(3))(4)](2)[OFe(6)(H(-)(3)thme)(3)(OCH(3))(3)Cl(6)].2H(2)O (1). Crystal data: C(26)H(64)Cl(6)Fe(6)N(2)O(15), trigonal space group P31c, a = 12.459(2) ?, c = 18.077(4) ?, Z = 2. The complex anion exhibits the well-known &mgr;(6)-O-Fe(6)-(&mgr;(2)-OR)(12) structure with three &mgr;(2)-methoxo bridges, three triply deprotonated H(-)(3)thme ligands, where each alkoxo group bridges two Fe(III) centers, and six terminally coordinating Cl(-) ligands. In contrast to two previously described ferric complexes with an analogous structure of the complex core, compound 1 is stable in air. Variable-temperature magnetic susceptibility measurements established antiferromagnetic exchange coupling interactions with J(trans)(Fe-&mgr;(6)-O-Fe) = 24.5 cm(-)(1), J(cis)(Fe-&mgr;(2)-O(thme)-Fe) = 11.5 cm(-)(1), and J(cis)'(Fe-&mgr;(2)-OCH(3)-Fe) = 19.5 cm(-)(1). The unexpectedly high value for J(trans) is explained by means of a superexchange pathway and is discussed for a simplified model by using MO calculations at the extended Hückel level.     

Magnetic Susceptibility Trends in Oxo-Bridged, Dinuclear Chromium(III) Complexes. Crystal Structure of [(tmpa)Cr(&mgr;-O)(&mgr;-CO(3))Cr(tmpa)](ClO(4))(2).2H(2)O

The synthesis and physical characterization of oxo-bridged [Cr(2)(tmpa)(2)(&mgr;-O)(X)](n)()(+) complexes (tmpa = tris(2-pyridylmethyl)amine) containing a variety of complementary ligands (X = CO(3)(2)(-), PhPO(4)(2)(-), HS(-)) are described, with the objective of understanding factors underlying variations in the antiferromagnetic coupling constant J. We also present the crystal structure of [(tmpa)Cr(&mgr;-O)(&mgr;-CO(3))Cr(tmpa)](ClO(4))(2).2H(2)O, for comparison with previous findings on [(tmpa)Cr(&mgr;-O)(&mgr;-CH(3)CO(2))Cr(tmpa)](ClO(4))(3). The carbonate-bridged complex crystallizes in the monoclinic space group P2(1)/c with a = 11.286(10) ?, b = 18.12(2) ?, c = 20.592(12) ?, beta = 95.99(5) degrees, and V = 4190 ?(3) and Z = 4. Asymmetric tmpa ligation pertains, with apical N atoms situated trans to bridging oxo and acido O atoms. Key structural parameters include Cr-O(b) bond lengths of 1.818(6) and 1.838(6) ?, Cr-OCO(2) distances of 1.924(7) and 1.934(7) ?, and a bridging bond angle of 128.3(3) degrees. Several attempts to prepare oxo, amido-bridged dimers were unsuccessful, but the nearlinear [Cr(tmpa)(N(CN)(2))](2)O(ClO(4))(2).3H(2)O complex was isolated from the reaction of dicyanamide ion with [Cr(tmpa)(OH)](2)(4+). In contrast to the behavior of analogous diiron(III) complexes, antiferromagnetic coupling constants of [Cr(2)(tmpa)(2)(&mgr;-O)(X)](n)()(+) dinuclear species are highly responsive to the X group. Considering the complexes with X = CO(3)(2)(-), PhPO(4)(2)(-), HS(-), SO(4)(2)(-), and RCO(2)(-) (10 R substituents), we find a reasonably linear, empirical relationship between J and oxo bridge basicity, as measured by pK(a) (Cr(OH)Cr) values in aqueous solution. While there is no theoretical basis for such a correlation between solid-state and solution-phase properties, this relationship demonstrates that CrOCr pi-bonding contributes significantly to antiferromagnetic exchange. Thus, J tends to become less negative with increasing &mgr;-O(2)(-) basicity, showing that greater availability of a bridging oxo group lone pair toward the proton, with decreasing CrOCr pi-interaction, reduces the singlet-triplet gap.     

Triangular,ferromagnetically-coupled CuII 3-pyrazolato complexes as possible models of particulate methane monooxygenase (pMMO)

Magnetic susceptibility and EPR studies show that trinuclear Cu(II)-pyrazolato complexes with a Cu(3)(mu3-X)2 core (X = Cl, Br) are ferromagnetically coupled: J(Cu-Cu) = +28.6 cm(-1) (X = Cl), +3.1 cm(-1) (X = Br). The orderly transition from an antiferromagnetic to a ferromagnetic exchange among the Cu centers of Cu(3)(mu3-X) complexes, X = O, OH, Cl, Br, follows the change of the Cu-X-Cu angle from 120 degrees to approximately 80 degrees. The crystal structures of [Bu4N]2"[Cu3(mu3-Br)2(mu-pz*)3Br3] (pz* = pz (1a) or 4-O2N-pz (1b), pz = pyrazolato anion, C(3)H(3)N(2)(1-)) are presented.