共查询到20条相似文献,搜索用时 31 毫秒
1.
Hou Z Fujita A Yoshimura T Jesorka A Zhang Y Yamazaki H Wakatsuki Y 《Inorganic chemistry》1996,35(25):7190-7195
Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557. 相似文献
2.
The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam). 相似文献
3.
Jüstel T Bendix J Metzler-Nolte N Weyhermüller T Nuber B Wieghardt K 《Inorganic chemistry》1998,37(1):35-43
Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible. 相似文献
4.
Two bis(amido)ruthenium(IV) complexes, [Ru(IV)(bpy)(L-H)(2)](2+) and [Ru(IV)(L)(L-H)(2)](2+) (bpy = 2,2'-bipyridine, L = 2,3-diamino-2,3-dimethylbutane, L-H = (H(2)NCMe(2)CMe(2)NH)(-)), were prepared by chemical oxidation of [Ru(II)(bpy)(L)(2)](2+) and the reaction of [(n-Bu)(4)N][Ru(VI)NCl(4)] with L, respectively. The structures of [Ru(bpy)(L-H)(2)][ZnBr(4)].CH(3)CN and [Ru(L)(L-H)(2)]Cl(2).2H(2)O were determined by X-ray crystal analysis. [Ru(bpy)(L-H)(2)][ZnBr(4)].CH(3)CN crystallizes in the monoclinic space group P2(1)/n with a = 12.597(2) ?, b = 15.909(2) ?, c = 16.785(2) ?, beta = 91.74(1) degrees, and Z = 4. [Ru(L)(L-H)(2)]Cl(2).2H(2)O crystallizes in the tetragonal space group I4(1)/a with a = 31.892(6) ?, c = 10.819(3) ?, and Z = 16. In both complexes, the two Ru-N(amide) bonds are cis to each other with bond distances ranging from 1.835(7) to 1.856(7) ?. The N(amide)-Ru-N(amide) angles are about 110 degrees. The two Ru(IV) complexes are diamagnetic, and the chemical shifts of the amide protons occur at around 13 ppm. Both complexes display reversible metal-amide/metal-amine redox couples in aqueous solution with a pyrolytic graphite electrode. Depending on the pH of the media, reversible/quasireversible 1e(-)-2H(+) Ru(IV)-amide/Ru(III)-amine and 2e(-)-2H(+) Ru(IV)-amide/Ru(II)-amine redox couples have been observed. At pH = 1.0, the E degrees is 0.46 V for [Ru(IV)(bpy)(L-H)(2)](2+)/[Ru(III)(bpy)(L)(2)](3+) and 0.29 V vs SCE for [Ru(IV)(L)(L-H)(2)](2+)/[Ru(III)(L)(3)](3+). The difference in the E degrees values for the two Ru(IV)-amide complexes has been attributed to the fact that the chelating saturated diamine ligand is a better sigma-donor than 2,2'-bipyridine. 相似文献
5.
Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4. 相似文献
6.
The fluorinated tris(pyrazolyl)borate ligands [HB(3,5-(CF(3))(2)Pz)(3)](-) and [HB(3-(CF(3))Pz)(3)](-) (where Pz = pyrazolyl) have been synthesized as their sodium salts from the corresponding pyrazoles and NaBH(4) in high yield. These sodium complexes and the related [HB(3,5-(CF(3))(2)Pz)(3)]K(DMAC) were used as ligand transfer agents in the preparation of the copper and silver complexes [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3), and [HB(3-(CF(3))Pz)(3)]AgPPh(3). Metal complexes of the fluorinated [HB(3,5-(CF(3))(2)Pz)(3)](-) ligand have highly electrophilic metal sites relative to their hydrocarbon analogs. This is evident from the formation of stable adducts with neutral oxygen donors such as H(2)O, dimethylacetamide, or thf. Furthermore, the metal compounds derived from fluorinated ligands show fairly long-range coupling between fluorines of the trifluoromethyl groups and the hydrogen, silver, or phosphorus. The solid state structures show that the fluorines are in close proximity to these nuclei, thus suggesting a possible through-space coupling mechanism. Crystal structures of the sodium adducts exhibit significant metal-fluorine interactions. The treatment of [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O) with Et(4)NBr led to [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], which contains a well-separated [Et(4)N](+) cation and the [HB(3,5-(CF(3))(2)Pz)(3)](-) anion in the solid state. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 193 K: [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O), C(15)H(6)BF(18)N(6)NaO, a = 7.992(2) ?, b = 15.049(2) ?, c = 9.934(2) ?, beta = 101.16(2) degrees, monoclinic, P2(1)/m, Z = 2; [{HB(3-(CF(3))Pz)(3)}Na(thf)](2), C(32)H(30)B(2)F(18)N(12)Na(2)O(2), a = 9.063(3) ?, b = 10.183(2) ?, c = 12.129(2) ?, alpha = 94.61(1) degrees, beta = 101.16(2) degrees, gamma = 95.66(2) degrees, triclinic, &Pmacr;1, Z = 1; [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), C(19)H(13)BCuF(18)N(7)O, a = 15.124(4) ?, b = 8.833(2) ?, c = 21.637(6) ?, beta = 105.291(14) degrees, monoclinic, P2(1)/n, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), C(33)H(19)BCuF(18)N(6)P, a = 9.1671(8) ?, b = 14.908(2) ?, c = 26.764(3) ?, beta = 94.891(1) degrees, monoclinic, P2(1)/c, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3).0.5C(6)H(14), C(36)H(26)AgBF(18)N(6)P, a = 13.929(2) ?, b = 16.498(2) ?, c = 18.752(2) ?, beta = 111.439(6) degrees, monoclinic, P2(1)/c, Z = 4; [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], C(23)H(24)BF(18)N(7), a = 10.155(2) ?, b = 18.580(4) ?, c = 16.875(5) ?, beta = 99.01(2) degrees, monoclinic, P2(1)/n, Z = 4. 相似文献
7.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions. 相似文献
8.
The first integrally oxidized metal-free phthalocyanine compounds have been synthesized by chemical oxidation. Phthalocyanine (H(2)(pc), pc = phthalocyaninato) was oxidized with IBr to afford the compounds [H(2)(pc)][IBr(2)] (1) and [H(2)(pc)](2)[IBr(2)]BrAC(10)H(7)Br (2), whose structures were determined by means of single-crystal X-ray diffraction methods: [H(2)(pc)][IBr(2)], P2(1)/c, a = 8.0272(9) A, b = 21.258(2) A, c = 18.1439(2) A, beta = 113.975(2) degrees, V = 2828.8(5) A(3), T = 153 K, Z = 4; [H(2)(pc)](2)[IBr(2)]Br.C(10)H(7)Br, P, a = 8.4724(6) A, b = 13.5794(10) A, c = 13.8403(10) A, alpha = 90.854(1) degrees, beta = 103.417(1) degrees, gamma = 97.049(1)E degrees, V = 1535.61(19) A(3), T = 153 K, Z = 1. The extended structure of [H(2)(pc)][IBr(2)] comprises slipped columns of pc rings stacked along the a axis in adjacent columns at approximately 70 degrees to one another. IBr(2-) ions occupy the interstitial columns. The extended structure of [H(2)(pc)](2)[IBr(2)]Br.C(10)H(7)Br comprises slant stacks of pc rings along the crystallographic a axis with IBr(2-) ions, Br(-) ions, and disordered 1-bromonaphthalene molecules in the adjacent, parallel columns. The overall reaction for the formation of 1 is 2H(2)(pc) + 4IBr --> 2[H(2)(pc)][IBr(2)] + I(2), and the overall reaction for the formation of 2 (not including solvent) is 2H(2)(pc) + 3IBr --> [H(2)(pc)](2)Br[IBr(2)] + I(2). 相似文献
9.
Sanz JL Ruiz R Gleizes A Lloret F Faus J Julve M Borrás-Almenar JJ Journaux Y 《Inorganic chemistry》1996,35(25):7384-7393
The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data. 相似文献
10.
The N-methyl-2-(methylamino)troponimine [(Me)(2)ATI]H reacts with bis[bis(trimethylsilyl)amido]tin(II) to yield [(Me)(2)ATI](2)Sn in excellent yield. The treatment of [(Me)(2)ATI](2)Sn with GaI and InCl led to the bis(ligand)gallium(III) and -indium(III) compounds [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl. These metal complexes were characterized by elemental analysis, (1)H and (13)C NMR spectroscopy, and X-ray crystallography. All three metal adducts show fluxional behavior in solution at room temperature. [(Me)(2)ATI](2)Sn exhibits a pseudo trigonal bipyramidal structure in the solid state. The gallium and indium atoms in [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl adopt trigonal bipyramidal geometry around the metal center with the halide occupying an equatorial site. A convenient, high-yield route to [(Me)(2)ATI]H is also reported. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 183 K: [(Me)(2)ATI](2)Sn, C(18)H(22)N(4)Sn, a = 8.4347(11) ?, b = 10.5564(13) ?, c = 11.5527(11) ?, alpha = 66.931(8) degrees, beta = 73.579(9) degrees, gamma = 67.437(7) degrees, V = 863.3(2) ?(3), triclinic, space group P&onemacr;, Z = 2, R = 0.0224; [(Me)(2)ATI](2)GaI, C(18)H(22)GaIN(4), a = 12.947(2) ?, b = 9.5834(9) ?, c = 16.0132(12) ?, beta = 107.418(8) degrees, V = 1895.8(3) ?(3), monoclinic, space group P2(1)/c, Z = 4, R = 0.0214; [(Me)(2)ATI](2)InCl, C(18)H(22)ClInN(4), a = 24.337(3) ?, b = 8.004(2) ?, c = 19.339(3) ?, beta = 101.537(13) degrees, V = 3691.1(11) ?(3), monoclinic, space group C2/c, Z = 8, R = 0.0224. 相似文献
11.
Faulmann C Errami A Donnadieu B Malfant I Legros JP Cassoux P Rovira C Canadell E 《Inorganic chemistry》1996,35(13):3856-3873
New precursors to potentially conductive noninteger oxidation state (NIOS) compounds based on metal complexes [ML(2)](n)()(-) [M = Ni, Pd, Pt; L = 5,6-dihydro-1,4-dithiin-2,3-dithiolato (dddt(2)(-)), 5,7-dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2)(-)), and 2-thioxo-1,3-dithiole-4,5-dithiolato (dmit(2)(-)); n = 2, 1, 0] have been investigated. Complexes of the series (NR(4))[ML(2)] (R = Me, Et, Bu; L = dddt(2)(-), dtdt(2)(-)) have been isolated and characterized, and the crystal structure of (NBu(4))[Pt(dtdt)(2)] (1) has been determined {1 = C(24)H(44)NPtS(10), a = 12.064(2) ?, b = 17.201(3) ?, c = 16.878(2) ?, beta = 102.22(2) degrees, V = 3423(1) ?(3), monoclinic, P2(1)/n, Z = 4}. Oxidation of these complexes affords the corresponding neutral species [ML(2)](0). Another series of general formula (cation)(n)()[M(dmit)(2)] [cation = PPN(+), BTP(+), and (SMe(y)()Et(3)(-)(y)())(+) with y = 0, 1, 2, and 3, n = 2, 1, M = Ni, Pd] has also been studied. All of these (cation)(n)()[M(dmit)(2)] complexes have been isolated and characterized [with the exception of (cation)[Pd(dmit)(2)] for cation = (SMe(y)()Et(3)(-)(y)())(+)]. The crystal structures of (PPN)[Ni(dmit)(2)].(CH(3))(2)CO (2) and (SMeEt(2))[Ni(dmit)(2)] (3) have been determined {2 = C(45)H(36)NNiS(10)P(2)O, a = 12.310(2) ?, b = 13.328(3) ?, c = 15.850(3) ?, alpha = 108.19(3) degrees, beta = 96.64(2) degrees, gamma = 99.67(2) degrees, V = 2373(1) ?(3), triclinic, P&onemacr;, Z = 2; 3 = C(11)H(13)NiS(11), a = 7.171(9) ?, b = 17.802(3) ?, c = 16.251(3) ?, beta = 94.39(4) degrees, V = 2068(2) ?(3), monoclinic, P2(1)/n, Z = 4} NIOS salts derived from the preceding precursors were obtained by electrochemical oxidation. Electrochemical studies of the [M(dddt)(2)] complexes show that they may be used for the preparation of NIOS radical cation salts and [M(dddt)(2)][M'(dmit)(2)](x)() compounds, but not for the preparation of (cation)[M(dddt)(2)](z)() NIOS radical anion salts. The electrochemical oxidation of the [M(dtdt)(2)](-) complexes always yields the neutral [M(dtdt)(2)](0) species. The crystal structure of [Pt(dddt)(2)][Ni(dmit)(2)](2) (4) has been determined and is consistent with the low compaction powder conductivity (5 x 10(-)(5) S cm(-)(1) at room temperature) {4 = C(20)H(8)Ni(2)PtS(28), a = 20.336(4) ?, b = 7.189(2) ?, c = 14.181(2) ?, beta = 97.16(2) degrees, V = 2057(1) ?(3), monoclinic, C2/m, Z = 2}. The crystal structures of the semiconducting NIOS compounds (BTP)[Ni(dmit)(2)](3) (5) and (SMe(3))[Ni(dmit)(2)](2) (6) have been determined {5 = C(43)H(22)PNi(3)S(30), a = 11.927(2) ?, b = 24.919(2) ?, c = 11.829(3) ?, alpha = 93.11(1) degrees, beta = 110.22(1) degrees, gamma = 83.94(1) degrees, V = 3284(1) ?(3), triclinic, P&onemacr;, Z = 2; 6 = C(15)H(9)Ni(2)S(21), a = 7.882(1) ?, b = 11.603(2) ?, c = 17.731(2) ?, alpha = 77.44(1) degrees, beta = 94.39(1) degrees, gamma = 81.27(1) degrees, V = 1563(1) ?(3), triclinic, P&onemacr;, Z = 2}. The parent compound (SEt(3))[Ni(dmit)(2)](z) (unknown stoichiometry) is also a semiconductor with a single-crystal conductivity at room temperature of 10 S cm(-)(1). By contrast, the single-crystal conductivity at room temperature of (SMeEt(2))[Pd(dmit)(2)](2) (7) is rather high (100 S cm(-)(1)). 7 behaves as a pseudometal down to 150 K and undergoes an irreversible metal-insulator transition below this temperature. The crystal structure of 7 has been determined {7 = C(17)H(13)NPd(2)S(21), a = 7.804(4) ?, b = 36.171(18) ?, c = 6.284(2) ?, alpha = 91.68(4) degrees, beta = 112.08(4) degrees, gamma = 88.79(5) degrees, V = 1643(1) ?(3), triclinic, P&onemacr;, Z = 2}. The electronic structure of (SMeEt(2))[Pd(dmit)(2)](2) (7) and the possible origin of the metal-insulator transition at 150 K are discussed on the basis of tight-binding band structure calculations. 相似文献
12.
Photolysis of a series of octahedral monoazido complexes of the type [LM(III)(didentate ligand)(N(3))](n)(+)X(n) of vanadium(III), chromium(III), and manganese(III) in the solid state or in solution yields quantitatively the corresponding six-coordinate nitrido complexes [LM(V)(didentate ligand)(N)](n)(+)X(n) and 1 equiv of dinitrogen. L represents the macrocycle 1,4,7-triazacyclononane or its N-methylated derivative (L'), the didentate ligands are pentane-2,4-dionate (acac), 2,2,6,6-tetramethylheptane-3,5-dionate (tacac), picolinate (pic), phenanthroline (phen), and oxalate (ox), and X(-) represents perchlorate or hexafluorophosphate. The following nitrido complexes were prepared: [LV(V)(N)(acac)](ClO(4)) (6), [LCr(V)(N)(acac)](ClO(4)) (13), [LCr(V)(N)(tacac)](ClO(4)) (14), [LCr(V)(N)(pic)](ClO(4)) (15), [LCr(V)(N)(phen)](ClO(4))(2) (16), [LCr(V)(N)(ox)] (19), [L'Mn(V)(N)(acac)]PF(6) (21). Photolysis of [LCr(III)(N(3))(ox)] (17) in the solid state produces the &mgr;-nitrido-bridged mixed-valent species [L(2)Cr(2)(ox)(2)(&mgr;-N)](N(3)) (18). The structures of the precursor complex [L'Mn(acac)(N(3))]BPh(4) (20), of 13, and of [L'Mn(V)(N)(acac)]BPh(4) (21) have been determined by X-ray crystallography. Complex 13 crystallizes in the orthorhombic space group Pnma, with cell constants a = 27.187(5) ?, b = 9.228(2) ?, c = 7.070(1) ?, V = 1773.7(6) ?(3), and Z = 4; complex 20 crystallizes in the triclinic space group P&onemacr; with a = 14.769(5) ?, b = 16.83(1) ?, c = 16.96(1) ?, alpha = 108.19(5) degrees, beta = 105.06(4) degrees, gamma = 99.78(4) degrees, V = 3719(2) ?(3), and Z = 4; and complex 21 crystallizes in the monoclinic space group P2(1)/n with a = 10.443(3) ?, b = 16.035(4) ?, c = 21.463(5) ?, beta = 95.76(1) degrees, V = 3575.9(14) ?(3), and Z = 4. The Cr(V)&tbd1;N and Mn(V)&tbd1;N distances are short at 1.575(9) and 1.518(4) ?, respectively, and indicate a metal-to-nitrogen triple bond. 相似文献
13.
The reaction of 1:1 stoichiometries (1:1.5 for the nitrate/tetraethylene glycol (EO4) and pentaethylene glycol (EO5) complexes) of PbX(2) (X = NO(3), Br) with five- to eight-donor poly(ethylene glycols) (PEGs) in 3:1 CH(3)CN/CH(3)OH (CH(3)CN only for the nitrate/EO5 complex) followed by solvent evaporation resulted in six crystalline materials upon which X-ray structural analyses were carried out: [Pb(NO(3))(2)(EO4)](n)(), [Pb(NO(3))(2)(EO5)], [Pb(NO(3))(2)(EO6)], [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O, [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2), and [PbBr(EO7)][PbBr(3)]. The nitrates crystallize as tight ion pairs with the PEG ligands coordinating in an equatorial plane around the Pb(2+) ions. Because EO4 has only five oxygen donors, this complex exhibits steric unsaturation which is overcome by a monodentate interaction with a third nitrate anion that is also coordinated to a neighboring Pb(2+) ion. The six donors of EO5 coordinate in an equatorial plane resulting in a 10-coordinate complex with trans, twisted, bidentate nitrate anions. The seven-donor hexaethylene glycol (EO6) only uses six of its oxygen donors to coordinate Pb(2+). [Pb(NO(3))(2)(EO4)](n)() is monoclinic, P2(1)/c, with a = 7.902(3) ?, b = 22.136(6) ?, c = 8.910(2) ?, beta = 90.96(3) degrees, and Z = 4. [Pb(NO(3))(2)(EO5)] is triclinic P&onemacr;, with a = 9.332(3) ?, b = 10.025(3) ?, c = 11.688(4) ?, alpha = 68.41(3) degrees, beta = 68.39(3) degrees, gamma = 68.58(3) degrees, and Z = 2. [Pb(NO(3))(2)(EO6)] is monoclinic P2(1)/c, with a = 16.289(4) ?, b = 10.773(4) ?, c = 12.329(4) ?, beta = 106.77(2) degrees, and Z = 4. Lead(II) bromide complexes with PEGs tend to crystallize as PEG complexed cations with polymeric lead(II) bromide anions. In the EO5 complex, bromide anions in the polymer also coordinate to the PEG-wrapped Pb(2+) cations. The hexa- and heptaethylene glycol (EO6 and EO7, respectively) complexes contain discreet ions. In these halide complexes, EO7 is the only PEG to expand the Pb(2+) coordination number from eight to nine. [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O is triclinic P&onemacr;, with a = 7.922(6) ?,b = 15.802(9) ?, c = 19.001(9) ?, alpha = 73.19(8) degrees, beta = 88.91(9) degrees, gamma = 87.22(9) degrees, and Z = 4. [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2) is monoclinic P2(1)/c, with a = 14.389(4) ?, b = 31.931(9) ?, c = 8.029(2) ?, beta = 97.76(3) degrees, and Z = 2. [PbBr(EO7)][PbBr(3)] is monoclinic Cc, with a = 13.165(3) ?, b = 24.732(5) ?, c = 8.007(1) ?, beta = 94.58(2) degrees, and Z = 4. 相似文献
14.
The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1. 相似文献
15.
Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4. 相似文献
16.
Dimanganese-substituted gamma-Keggin heteropoly tungstates have been synthesized by reaction of the lacunary species gamma-[(SiO(4))W(10)O(32)](8)(-) with appropriate mixtures of Mn(II) and MnO(4)(-). The crystal structure of [(CH(3))(3)(C(6)H(5))N](4)[(SiO(4))W(10)Mn(III)(2)O(36)H(6)].2CH(3)CN.H(2)O (anion 1) was determined by X-ray diffraction. Crystallographic data: space group P&onemacr;, a = 12.951(3) ?, b = 14.429(3) ?, c = 20.347(4) ?, alpha = 81.95(3) degrees, beta = 88.92(3) degrees, gamma = 67.48(3) degrees, V = 3475.2(13) ?(3), and Z = 2. The final R value is 7.29% for 15861 reflections with I > 2sigma(I). The anion has the anticipated gamma-Keggin structure with virtual C(2)(v)() symmetry. The two Mn cations occupy adjacent, edge-shared octahedra with bridging hydroxo and terminal aqua ligands. Anion 1 can be oxidized and reduced to the corresponding Mn(III)Mn(IV) (2) and Mn(II)(2) (3) species respectively. The magnetic susceptibility of 1 between 2 and 300 K indicates that the Mn(III) cations are antiferromagnetically coupled, with J = -17.0 cm(-)(1) and g = 1.965. No simple magnetic behavior was observed for 2 or 3. 相似文献
17.
The reactions of Ga(CH(2)CH(3))(3) with variable amounts of elemental sulfur, S(8), in toluene or benzene at different temperatures result in the insertion of sulfur into the Ga-C bonds to form the compounds Ga[(S-S)CH(2)CH(3)](3) (I) and Ga[(S-S-S)CH(2)CH(3)](3) (II). Compound I was isolated from the reaction at low temperature while at room temperature; compound II was the major product. Compound II exhibited the maximum extent of sulfur insertion even when the reactions were carried out with more than 9.0 equiv of sulfur. The reactions of Ga(CH(3))(3) with various amounts of sulfur in toluene or benzene only result in the formation of compound III, Ga[(S-S)CH(3)](3). In pyridine at -30 degrees C, deinsertion of the sulfur atoms from Ga-S-S-C bonds was observed for the first time from compounds I and III resulting in formation of the six-membered Ga-S ring compounds IV, [PyEtGaS](3), and V, [PyMeGaS](3), respectively. Compounds IV and V were characterized by (1)H NMR, (13)C NMR, elemental analyses, thermogravimetric analysis, and single-crystal X-ray diffraction. Compound IV crystallized in the monoclinic space group P2(1)/n, with a = 9.288(2) ?, b = 14.966(2) ?, c = 19.588(3) ?, beta = 90.690(10) degrees, and Z = 4. Compound V crystallized in the monoclinic space group P2(1)/c, with a = 10.385(1) ?, b = 15.300(2) ?, c = 15.949(2) ?, beta = 107.01(1) degrees, Z = 4, unit cell volume = 2423.5(5) ?(3), R = 0.030, and R(w) = 0.026. The sulfur insertion reaction pathway was investigated by time-dependent and variable-temperature (1)H NMR spectroscopy. 相似文献
18.
The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4). 相似文献
19.
The pyridineselenolate (2-Se-NC(5)H(4), (SePy)) and the 3-(trimethylsilyl)pyridineselenolate (3-Me(3)Si-2-Se-NC(5)H(4) (SePy)) ligands form air-stable homoleptic coordination compounds of Cu(I) { [Cu(SePy)](4) (1) and [Cu(SePy)](4) (2)} and In(III) {In(SePy)(3) (3) and In(SePy)(3) (4)}. Mass spectroscopic characterization of the Cu(I) compounds indicated a tetrametallic core, and this was confirmed with a single-crystal X-ray structural characterization of crystalline 1 and 2, which both contain a tetrametallic cluster of Cu(I) ions bound to two doubly bridging Se atoms and a pyridine nitrogen. The Cu coordination sphere is completed with two strong Cu-Cu bonds and one weaker Cu-Cu interaction. The indium compounds 3 and 4 are each distorted fac-octahedral molecules with chelating SePy ligands. These compounds are useful low-temperature precursors to the binary selenides. Both 3 and 4 sublime intact; 3 thermally decomposes to give In(2)Se(3). The Cu clusters do not sublime intact but still decompose to give metal selenide phases: 2 decomposes to give pure alpha-CuSe at low temperatures and increasing amounts of Cu(2)(-)(x)()Se at elevated temperatures, while 3 decomposes to give a mixture of CuSe phases at all temperatures. Crystal data (Mo Kalpha: 1, 153(5) K; 2-4, 293(2) K) are as follows: 1, monoclinic space group C2/c, a = 20.643(5) ?, b = 16.967(2) ?, c = 16.025(2) ?, beta = 114.16(2) degrees, Z = 8; 2, tetragonal space group I4(1)/a, a = 14.756(3) ?, c = 19.925(3) ?, Z = 4; 3, trigonal space group P&thremacr;c1, a = 13.352(2) ?, c = 13.526(2) ?, Z = 4; 4, monoclinic space group P2(1)/c, a = 9.793(1) ?, b = 20.828(6) ?, c = 16.505(1) ?, beta = 96.69(1) degrees, Z = 4. 相似文献
20.
An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters. 相似文献