共查询到20条相似文献,搜索用时 46 毫秒
1.
A convenient and one-pot synthetic method of lanthanide thiolate compounds was developed. An excess of metallic samarium, europium, and ytterbium directly reacted with diaryl disulfides in THF to give selectively Ln(II) thiolate complexes, [Ln(SAr)(&mgr;-SAr)(thf)(3)](2) (1, Ln = Sm; 2, Ln = Eu; Ar = 2,4,6-triisopropylphenyl), Yb(SAr)(2)(py)(4) (3, py = pyridine), and [{Ln(hmpa)(3)}(2)(&mgr;-SPh)(3)][SPh] (6, Ln = Sm; 7, Ln = Eu; 8, Ln = Yb; hmpa = hexamethylphosphoric triamide). Reaction of metallic lanthanides with 3 equiv of disulfides afforded Ln(III) thiolate complexes, Ln(SAr)(3)(py)(n)()(thf)(3)(-)(n)() (9a, Ln = Sm, n = 3; 9b, Ln = Sm, n = 2; 10, Ln = Yb, n = 3) and Ln(SPh)(3)(hmpa)(3) (11, Ln = Sm; 12, Ln = Eu; 13, Ln = Yb). Thus, Ln(II) and Ln(III) thiolate complexes were prepared from the same source by controlling the stoichiometry of the reactants. X-ray analysis of 8 revealed that 8 has the first ionic structure composed of triply bridged dinuclear cation and benezenethiolate anion [8, orthorhombic, space group P2(1)2(1)2(1) with a = 21.057(9), b = 25.963(7), c = 16.442(8) ?, V = 8988(5) ?(3), Z = 4, R = 0.040, R(w) = 0.039 for 5848 reflections with I > 3sigma(I) and 865 parameters]. The monomeric structures of 11 and 13 were revealed by X-ray crystallographic studies [11, triclinic, space group P&onemacr; with a = 14.719(3), b = 17.989(2), c = 11.344(2) ?, alpha = 97.91(1), beta = 110.30(2), gamma = 78.40(1) degrees, V = 2751.9(9) ?(3), Z = 2, R = 0.045, R(w) = 0.041 for 7111 reflections with I > 3sigma(I) and 536 parameters; 13, triclinic, space group P&onemacr; with a = 14.565(2), b = 17.961(2), c = 11.302(1) ?, alpha = 97.72(1), beta = 110.49(1), gamma = 78.37(1) degrees, V = 2706.0(7) ?(3), Z = 2, R = 0.031, R(w) = 0.035 for 9837 reflections with I > 3sigma(I) and 536 parameters]. A comparison with the reported mononuclear and dinuclear lanthanide thiolate complexes has been made to indicate that the Ln-S bonds weakened by the coordination of HMPA to lanthanide metals have ionic character. 相似文献
2.
Hou Z Fujita A Yoshimura T Jesorka A Zhang Y Yamazaki H Wakatsuki Y 《Inorganic chemistry》1996,35(25):7190-7195
Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557. 相似文献
3.
The reactions of the unsymmetrical, coordinatively unsaturated dirhenium(II) complexes [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)]Y (XylNC = 2,6-dimethylphenyl isocyanide; Y = O(3)SCF(3) (3a), PF(6) (3b)) with XylNC afford at least three isomeric forms of the complex cation [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+). Two forms have very similar bis(&mgr;-halo)-bridged edge-sharing bioctahedral structures of the type [(CO)BrRe(&mgr;-Br)(2)(&mgr;-dppm)(2)Re(CNXyl)(2)]Y (Y = O(3)SCF(3) (4a/4a'), PF(6) (4b/4b')), while the third is an open bioctahedron [(XylNC)(2)BrRe(&mgr;-dppm)(2)ReBr(2)(CO)]Y (Y = O(3)SCF(3) (5a), PF(6) (5b)). While the analogous chloro complex cation [Re(2)Cl(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+) was previously shown to exist in three isomeric forms, only one of these has been found to be structurally similar to the bromo complexes (i.e. the isomer analogous to 5a and 5b). The reaction of 3a with CO gives the salt [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3) (7), in which the edge-sharing bioctahedral cation [(XylNC)BrRe(&mgr;-Br)(&mgr;-CO)(&mgr;-dppm)(2)ReBr(CO)](+) has an all-cis arrangement of pi-acceptor ligands. The Re-Re distances in the structures of 4b', 5a, and 7 are 3.0456(8), 2.3792(7), and 2.5853(13) ?, respectively, and accord with formal Re-Re bond orders of 1, 3, and 2, respectively. Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](PF(6))(0.78)(ReO(4))(0.22).CH(2)Cl(2) (4b') at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 19.845(4) ?, b = 16.945(5) ?, c = 21.759(3) ?, beta = 105.856(13) degrees, V = 7038(5) ?(3), and Z = 4. The structure was refined to R = 0.060 (R(w) = 0.145) for 14 245 data (F(o)(2) > 2sigma(F(o)(2))). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)]O(3)SCF(3).C(6)H(6) (5a) at 173 K: monoclinic space group P2(1)/n (No. 14) with a = 14.785(3) ?, b = 15.289(4) ?, c = 32.067(5) ?, beta = 100.87(2) degrees, V=7118(5) ?(3), and Z = 4. The structure was refined to R = 0.046 (R(w) = 0.055) for 6962 data (I > 3.0sigma(I)). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3).Me(2)CHC(O)Me (7) at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 14.951(2) ?, b = 12.4180(19) ?, c = 40.600(5) ?, beta = 89.993(11) degrees, V = 7537(3) ?(3), and Z = 4. The structure was refined to R = 0.074 (R(w) = 0.088) for 6595 data (I > 3.0sigma(I)). 相似文献
4.
The synthesis and structural characterization of the compounds MesAlCl(2)(THF) (1), MesAlCl(2) (2), MesAl(H)Cl(THF) (3a), MesAl(H)Cl (4a), and (MesAlH(2))(2) (5) (Mes = 2,4,6-t-Bu(3)C(6)H(2)(-)) are described as well as those for two compounds 3b and 4b that are analogs of 3a and 4a but have H:Cl ratios that are less than 1:1. All compounds were characterized by (1)H, (13)C NMR, and IR spectroscopy, and 1, 2, 3a, and 4b were additionally characterized by X-ray crystallography. Compound 1 is best synthesized by the reaction of [(THF)(2)LiH(3)AlMes](2) (6) with 6 equiv of Me(3)SiCl. A more conventional route involving the addition of (THF)(2)LiMes to 2 equiv of AlCl(3) in toluene usually affords a mixture of 1 and AlCl(3).THF. Recrystallization of 1 from n-hexane results in a species that has less than 1 equiv of THF per MesAlCl(2). The THF free complex 2 may be obtained in quantitative yield by heating 1 for 20 min at 90 degrees C under reduced pressure. Compound 3a may be obtained by treating a 1:1 mixture of MesLi(THF)(2) and LiAlH(4) with 2 equiv of Me(3)SiCl or by the addition of slightly less than 4 equiv of Me(3)SiCl to 6. The THF can be removed from 3a by sublimation to give 4a. The related compounds 3b and 4b, which display an aluminum-bound H:Cl ratio that is deficient in H, can be obtained by reactions with slightly more than 2 equiv of Me(3)SiCl. Crystal data at 130 K with Cu Kalpha (lambda = 1.541 78 ?) radiation: 1, C(22)H(37)AlCl(2)O, a = 11.889(3) ?, b = 9.992(3) ?, c = 19.704(5) ?, orthorhombic, space group Pca2(1), Z = 4, R = 0.068 for 1556 (I > 2sigma(I)) data; 2, C(18)H(29)AlCl(2), a = 12.147(5) ?, b = 18.042(6) ?, c = 17.771(7) ?, beta = 95.77(3) degrees, monoclinic, space group P2(1)/n,Z = 8, R = 0.032 for 4610 (I > 2sigma(I)) data; 3a, C(22)H(38)AlClO, a = 16.887(7) ?, b = 16.333(6) ?, c = 8.739(3) ?, beta = 101.41(3) degrees, monoclinic, space group P2(1)/c, Z = 4, R = 0.073 for 2752 (I > 2sigma(I)) data; 4b, C(18)H(29.64)AlCl(1.36), a = 12.077(3) ?, b = 17.920(3) ?, c = 17.634(5) ?; beta = 95.21(2) ?, monoclinic, space group P2(1)/n,Z = 8, R = 0.070 for 4261 (I > 2sigma(I)) data. 相似文献
5.
(C(5)Me(5))(2)Sm (2 equiv) reacts with Ph(2)EEPh(2) to give (C(5)Me(5))(2)SmEPh(2) (E: P, 1; As, 2), while (C(5)Me(5))(2)Sm(THF)(2) (2 equiv) reacts with Ph(2)EEPh(2) to give (C(5)Me(5))(2)Sm(EPh(2))(THF) (E: P, 3; As, 4). 3 and 4 are also available from the reactions of 1 and 2 with THF. 3 and 4 undergo further reaction to produce the THF ring-opened products (C(5)Me(5))(2)Sm[O(CH(2))(4)EPh(2)](THF) (E: P, 5; As, 6).(C(5)Me(5))(2)Sm (4 equiv) reacts with Ph(2)EEPh(2) to give the mixed-valent (C(5)Me(5))(2)Sm(&mgr;-EPh(2))Sm(C(5)Me(5))(2) (E: P, 7; As, 8). These compounds are also available from the reaction of 1 and 2 with (C(5)Me(5))(2)Sm. The X-ray crystal structure of 2, crystallized from hexanes (P2(1)/n; a = 26.188(24) ?, b = 9.911(10) ?, c = 23.280(23) ?, beta = 97.150(12) degrees, V = 5995(2) ?(3), D(calcd) = 1.488 Mg/m(3); Z = 8; T = 156 K), revealed, in addition to a conventional seven-coordinate bent metallocene geometry with 2.698 ? Sm-C(C(5)Me(5)) and 2.970 ? Sm-As average distances, two very different Sm-As-C(Ph) angles, 74.2 and 118.7 degrees. As a result, one phenyl group is closer to the metal (2.901 ? minimum Sm-C distance). 4, crystallized from toluene (P2(1)/n; a = 10.713(9) ?, b = 14.143(11) ?, c = 21.620(16) ?, beta = 101.08(6) degrees, V = 3215(4) ?(3), D(calcd) = 1.492 Mg/m(3); Z = 4; T = 163 K), and 6, crystallized from hexanes (P2(1)/n; a = 9.3958(16) ?, b = 22.245(3) ?, c = 17.931(3) ?, beta = 96.497(11) degrees, V = 3724(1) ?(3), D(calcd) = 1.416 Mg/m(3); Z = 4; T = 163 K), have conventional eight-coordinate, bent metallocene structures. 相似文献
6.
Anilido phosphinimino ancillary ligand H(2)L(1) reacted with one equivalent of rare earth metal trialkyl [Ln{CH(2)Si(CH(3))(3)}(3)(thf)(2)] (Ln=Y, Lu) to afford rare earth metal monoalkyl complexes [L(1)LnCH(2)Si(CH(3))(3)(THF)] (1 a: Ln=Y; 1 b: Ln=Lu). In this process, deprotonation of H(2)L(1) by one metal alkyl species was followed by intramolecular C--H activation of the phenyl group of the phosphine moiety to generate dianionic species L(1) with release of two equivalnts of tetramethylsilane. Ligand L(1) coordinates to Ln(3+) ions in a rare C,N,N tridentate mode. Complex l a reacted readily with two equivalents of 2,6-diisopropylaniline to give the corresponding bis-amido complex [(HL(1))LnY(NHC(6)H(3)iPr(2)-2,6)(2)] (2) selectively, that is, the C--H activation of the phenyl group is reversible. When 1 a was exposed to moisture, the hydrolyzed dimeric complex [{(HL(1))Y(OH)}(2)](OH)(2) (3) was isolated. Treatment of [Ln{CH(2)Si(CH(3))(3)}(3)(thf)(2)] with amino phosphine ligands HL(2-R) gave stable rare earth metal bis-alkyl complexes [(L(2-R))Ln{CH(2)Si(CH(3))(3)}(2)(thf)] (4 a: Ln=Y, R=Me; 4 b: Ln=Lu, R=Me; 4 c: Ln=Y, R=iPr; 4 d: Ln=Y, R=iPr) in high yields. No proton abstraction from the ligand was observed. Amination of 4 a and 4 c with 2,6-diisopropylaniline afforded the bis-amido counterparts [(L(2-R))Y(NHC(6)H(3)iPr(2)-2,6)(2)(thf)] (5 a: R=Me; 5 b: R=iPr). Complexes 1 a,b and 4 a-d initiated the ring-opening polymerization of d,l-lactide with high activity to give atactic polylactides. 相似文献
7.
The reaction of lanthanide triflates with 2 equiv of potassium hydrotris(dimethylpyrazolyl)borate (Tp(Me)()2) gives good yields of complexes of composition Ln(Tp(Me)()2)(2)OTf. For La (2), Ce (3), Pr (4), and Nd (5) the complexes are seven-coordinate in the solid state with the triflate group coordinated to the metal in unidentate fashion. Complex 5 crystallizes in the monoclinic space group P2(1)/c with a = 17.629(3) ?, b = 12.740(2) ?, c = 18.163(3) ?, beta = 107.35(1) degrees, V = 3893(1) ?(3), Z = 4, and R(w) = 0.0458. For the complexes of Y (1), Sm (6), Eu (7), Gd (8), Dy (9), Ho (10), and Yb (11), the smaller size of the metal ion leads to ejection of the triflate from the coordination sphere and the complexes are ionic in the solid state with a six-coordinate metal center. Complex 11 crystallizes in the monoclinic space group C2/m with a = 16.593(7) ?, b = 13.671(5) ?, c = 8.746(2) ?, beta = 91.66(3) degrees, V = 1983(1) ?(3), Z = 2, and R(w) = 0.0416. In solution, however, complex 6 adopts a seven-coordinate molecular structure with the triflate ion within the first coordination sphere. 相似文献
8.
Janssen MD Rijnberg E de Wolf CA Hogerheide MP Kruis D Kooijman H Spek AL Grove DM van Koten G 《Inorganic chemistry》1996,35(23):6735-6741
Reaction of aryllithium reagents LiR (R = C(6)H(4)((R)-CH(Me)NMe(2))-2 (1a), C(6)H(3)(CH(2)NMe(2))(2)-2,6 (1b), C(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2 (1c)) with 1 equiv of sulfur (1/8 S(8)) results in the quantitative formation of the corresponding lithium arenethiolates [Li{SC(6)H(4)((R)-CH(Me)NMe(2))-2}](6) (3), [Li{SC(6)H(3)(CH(2)NMe(2))(2)-2,6}](6) (4), and [Li{SC(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2}](2) (5). Alternatively, 3 can be prepared by reacting the corresponding arenethiol HSC(6)H(4)((R)-CH(Me)NMe(2))-2 (2) with (n)BuLi. X-ray crystal structures of lithium arenethiolates 3 and 4, reported in abbreviated form, show them to have hexanuclear prismatic and hexanuclear planar structures, respectively, that are unprecedented in lithium thiolate chemistry. The lithium arenethiolate [Li{SC(6)H(4)(CH(2)N(Me)CH(2)CH(2)OMe)-2}](2) (5) is dimeric in the solid state and in solution, and crystals of 5 are monoclinic, space group P2(1)/c, with a = 17.7963(9) ?, b = 8.1281(7) ?, c = 17.1340(10) ?, beta = 108.288(5) degrees, Z = 4, and final R = 0.047 for 4051 reflections with F > 4sigma(F). Hexameric 4 reacts with 1 equiv of lithium iodide and 2 equiv of tetrahydrofuran to form the dinuclear adduct [Li(2)(SAr)(I)(THF)(2)] (6). Crystals of 6 are monoclinic, space group P2(1)/c, with a = 13.0346(10) ?, b = 11.523(3) ?, c = 16.127(3) ?, beta = 94.682(10) degrees, Z = 4, and final R = 0.059 for 3190 reflections with F > 4sigma(F). 相似文献
9.
The syntheses of macrocyclic species composed of carborane derivatives joined via their carbon vertices by electrophilic mercury atoms are described. The reaction of closo-1,2-Li(2)[C(2)B(10)H(10)(-)(x)()R(x)()] with HgI(2) gives Li(2)[(1,2-C(2)B(10)H(10)(-)(x)()R(x)()Hg)(4)I(2)] [R = Et, x = 2 (5.I(2)Li(2)); R = Me, x = 2 (6.I(2)Li(2)); R = Me, x = 4 (7.I(2)Li(2))]. 6.I(2)(K.[18]dibenzocrown-6)(2) crystallizes in the monoclinic space group C2/m [a = 28.99(2) ?, b = 18.19(1) ?, c = 13.61(1) ?, beta = 113.74(2) degrees, V = 6568 ?(3), Z = 4, R = 0.060, R(w) = 0.070]; 7.I(2)(NBu(4))(2) crystallizes in the monoclinic space group P2(1)/c [a = 12.77(1) ?, b = 21.12(2) ?, c = 20.96(2) ?, beta = 97.87(2) degrees, V = 5600 ?(3), Z = 2, R = 0.072, R(w) = 0.082]. The precursor to 7, closo-8,9,10,12-Me(4)-1,2-C(2)B(10)H(8) (4), is made in a single step by reaction of closo-1,2-C(2)B(10)H(12) with MeI in trifluoromethanesulfonic acid. The free hosts 5, 6, and 7 are obtained by reaction of the iodide complexes with stoichiometric quantities of AgOAc. A (199)Hg NMR study indicates that sequential removal of iodide from 5.I(2)Li(2) and 6.I(2)Li(2) with aliquots of AgOAc solution leads to formation of two intermediate host-guest complexes in solution, presumed to be 5(6)ILi and 5(2)(6)(2).ILi. Crystals grown from a solution of 6.I(2)Li(2) to which 1 equiv of AgOAc solution had been added proved to be an unusual stack structure with the formula 6(3).I(4)Li(4) [tetragonal, I4/m, a = 21.589(2) ?, c = 21.666(2) ?, V = 10098 ?(3), Z = 2, R = 0.058, R(w) = 0.084]. Addition of 2 equiv of NBu(4)Br ion to 5 or 6 gives 5.Br(2)(NBu(4))(2) and 6.Br(2)(NBu(4))(2), respectively, while addition of 1 equiv of KBr to 6 forms 6.BrK. 5.Br(2)(NBu(4))(2) crystallizes in the triclinic space group P&onemacr;, [a = 10.433(1) ?, b = 13.013(1) ?, c = 15.867(2) ?, alpha = 91.638(2) degrees, beta = 97.186(3) degrees, gamma = 114.202(2) degrees, V = 1492 ?(3), Z = 1, R = 0.078, R(w) = 0.104]. The hosts 5 and 6 form 1:1 supramolecular adducts with the polyhedral anions B(10)I(10)(2)(-) and B(12)I(12)(2)(-) in solution. 相似文献
10.
Imide transfer properties of ((THF)MgNPh)(6) (1) and the synthesis of the related species {(THF)MgN(1-naphthyl)}(6).2.25THF (2), via the reaction of dibutylmagnesium with H(2)N(1-naphthyl), in a THF/heptane mixture are described. Treatment of 1 with Ph(2)CO, 4-Me(2)NC(6)H(4)NO, t-BuNBr(2) (3), PCl(3), or MesPCl(2) (Mes = 2,4,6-Me(3)C(6)H(2)-) leads to the isolation of Ph(2)CNPh (4), 4-Me(2)NC(6)H(4)NNPh (5), t-BuNNPh (6), (PhNPCl)(2) (7), or (MesPNPh)(2) (8) in moderate yield. Reaction between 1 and GeCl(2).dioxane, SnCl(2), or PbCl(2) affords the M(4)N(4) (M = Ge, Sn, Pb) cubane imide derivative (GeNPh)(4) (9), [(SnNPh)(4).{MgCl(2)(THF)(4)}](infinity) (10), (SnNPh)(4).0.5PhMe (11), or (PbNPh)(4).0.5PhMe (12). Interaction of 1 with Ph(3)PO, (Me(2)N)(3)PO, or Ph(2)SO furnishes the complex (Ph(3)POMgNPh)(6) (13), {(Me(2)N)(3)POMgNPh}(6).2PhMe (14), or (Ph(2)SOMgNPh)(6) (15). The addition of 3 equiv of MgBr(2) to 1 gives 1.5 equiv of ((THF)Mg)(6)(NPh)(4)Br(4) (16) in quantitative yield, whereas treatment of 16 with 4 equiv of 1,4-dioxane is an alternative synthetic route to 1. Compounds 2, 3, 9, 10, and 14 were characterized by X-ray crystallography. The reactions demonstrate that 1 is a versatile and useful reagent for the synthesis of a variety of main group imides. Crystal data at 130 K with Mo Kalpha (lambda = 0.710 73 ?) radiation for 3 or Cu Kalpha (lambda = 1.541 78 ?) radiation for 2, 9, 10, and 14: 2, C(93)H(108)Mg(6)N(6)O(7.25), a = 28.101(7) ?, b = 35.851(7) ?, c = 36.816(7) ?, Z = 2, space group Fddd, R = 0.068 for 3500 (I > 2sigma(I)) data; 3, C(4)H(9)Br(2)N, a = 6.682(2) ?, b = 10.834(3) ?, c = 11.080(3) ?, alpha = 66.25(2) degrees, beta = 89.88(2) degrees, gamma = 82.53(2) degrees, Z = 4, space group P&onemacr;, R = 0.038 for 2043 (I > 2sigma(I)) data; 9, C(24)H(20)Ge(4)N(4), a = 10.749(2) ?, b = 12.358(3) ?, c = 35.818(7) ?, Z = 8, space group Pbca, R = 0.040 for 2981 (I > 2sigma(I)) data; 10, C(40)H(52)Cl(2)MgN(4)O(4)Sn(4), a = 12.770(3) ?, b = 13.554(3) ?, c = 25.839(5) ?, Z = 4, space group P2(1)2(1)2(1), R = 0.040 for (I > 2sigma(I)) data; 14, C(86)H(154)Mg(6)N(4)O(6)P(6), a = 22.478(4) ?, b = 16.339(3) ?, c = 29.387(6) ?, Z = 4, space group Pbcn, R = 0.081 for 4696 (I >2sigma(I)) data. 相似文献
11.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions. 相似文献
12.
The reaction of [UI(3)(THF)(4)] with 1 equiv of KTp()i(Pr)()2 in toluene in the presence of several neutral coligands allowed the synthesis of a novel family of mono-Tp()i(Pr)()2 complexes, [UI(2)Tp()i(Pr)()2(L)(x)()] [L = OPPh(3), x = 1 (3); L = C(5)H(5)N, x = 2 (4); L = Hpz()t(Bu,Me), x = 2 (5); and L = bipy, x = 1 (6)]. The adduct with THF, [UI(2)Tp()i(Pr)()2(THF)(2)(-)(3)] (1), could also be isolated by reacting [UI(3)(THF)(4)] with 1 equiv of KTp()i(Pr)()2 in tetrahydrofuran. However, complex 1 is not a good starting material to enter into the mono-Tp()i(Pr)()2 U(III) complexes as it decomposes in solution, leading to mixtures of U(III) species coordinated with Hpz()i(Pr)()2. The solid-state structures of 3, 4, and 6 were determined by single-crystal X-ray diffraction and revealed that this family of mono-Tp()i(Pr)()2 complexes can be six- (3) or seven-coordinated (4 and 6), depending on the nature of the neutral coligand. Complex 3 displays distorted octahedral coordination geometry, while 4 and 6 display distorted pentagonal bipyramid and capped octahedral geometries, respectively. Complexes 3 and 6 are static in solution, and the patterns of the (1)H NMR spectra are consistent with the C(s)() symmetry found in the solid state. The other complexes (1, 4, and 5) are fluxional, but the dynamic processes involved can be slowed by decreasing the temperature. 相似文献
13.
This work was conducted as part of a broad-based effort to determine the factors that affect cation formation for organometallic aluminum complexes. In this study the adduct species R(2)AlX.NH(2)(t)Bu (R, X: Me, F (1); Me, Cl (2); Et, Cl (3); Me, Br (4)) and cationic complexes [R(2)Al(NH(2)(t)Bu)(2)]X (R, X: Me, Br (5); Et, Br (6); Me, I (7)) were examined. These complexes demonstrate that the reaction of R(2)AlX with excess NH(2)(t)Bu produces cationic complexes only when X = Br or I. All of the compounds were characterized by melting points, (1)H NMR, IR, elemental analyses, and, in some cases, X-ray crystallography. X-ray data: 2, triclinic, P&onemacr;, a = 6.277(3) ?, b = 8.990(3) ?, c = 10.393(3) ?, alpha = 71.97(1) degrees, beta = 80.25(3) degrees, gamma = 81.97(3) degrees, V = 547.0(4) ?(3), Z = 2, 1032 reflections with F > 4.0 sigma(F), R = 0.0520; 5, monoclinic, P2(1)/c, a = 9.099(1) ?, b = 10.292(1) ?, c = 17.255(2) ?, beta = 104.81(1) degrees, V = 1562.1(3) ?(3), Z = 4, 1464 reflections with F > 4.0 sigmaF, R = 0.0387; 6, monoclinic, P2(1)/c, a = 14.122(2) ?, b = 13.539(2) ?, c = 21.089(2) ?, beta = 107.73(1) degrees, V = 3841.2(9) ?(3), Z = 4, 781 reflections with F > 5.0 sigmaF, R = 0.0873; 7, monoclinic, P2(1)/n, a = 9.071(1) ?, b = 10.529(1) ?, c = 17.714(2) ?, beta = 103.67(1) degrees, V = 1644.0(3) ?(3), Z = 4, 1723 reflections with F > 4.0 sigmaF, R = 0.0451. 相似文献
14.
Reaction of Ln(OAr(1))(3)(THF)(2) (Ar(1)= [2,6-((t)Bu)(2)-4-MeC(6)H(2)] with carbodiimides (RNCNR) in toluene afforded the RNCNR coordinated complexes (Ar(1)O)(3)Ln(NCNR) (R = (i)Pr (isopropyl), Ln = Y (1) and Yb (2); R = Cy (cyclohexyl), Ln = Y (3)) in high yields. Treatment of 1 and 2 with 4-chloroaniline, respectively, at a molar ratio of 1:1 yielded the corresponding monoguanidinate complex (Ar(1)O)(2)Y[(4-Cl-C(6)H(4)N)C(NH(i)Pr)N(i)Pr](THF) (4) and (Ar(1)O)(2)Yb[(4-Cl-C(6)H(4)N)C(NH(i)Pr)N(i)Pr](THF) (5). Complexes 4 and 5 can be prepared by the reaction of Ln(OAr(1))(3)(THF)(2) with RNCNR and amine in toluene at a 1:1:1 molar ratio in high yield directly. A remarkable influence of the aryloxide ligand on this transformation was observed. The similar transformation using the less bulky yttrium complexes Y(OAr(2))(3)(THF)(2) (Ar(2) = [2,6-((i)Pr)(2)C(6)H(3)]) or Y(OAr(3))(3)(THF)(2) (Ar(3) = [2,6-Me(2)C(6)H(3)]) did not occur. Complexes Ln(OAr(1))(3)(THF)(2) were found to be the novel precatalysts for addition of RNCNR with amines, which represents the first example of catalytic guanylation by the lanthanide complexes with the Ln-O active group. The catalytic activity of Y(OAr(1))(3)(THF)(2) was found to be the same as that of monoguanidinate complex 4, indicating 4 is one of the active intermediates in the present process. The other intermediate, amide complex (Ar(1)O)(2)Ln[(2-OCH(3)-C(6)H(4)NH)(2-OCH(3)-C(6)H(4)NH(2))] (6), was isolated by protonolysis of 4 with 2-OCH(3)-C(6)H(4)NH(2). All the complexes were structurally characterized by X-ray single crystal determination. 相似文献
15.
Reactions of niobium and tantalum pentachlorides with tert-butylamine (>/=6 equiv) in benzene afford the dimeric imido complexes [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (90%) and [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (79%). The niobium complex exists as two isomers in solution, while the tantalum complex is composed of three major isomers and at least two minor isomers. Analogous treatments with isopropylamine (>/=7 equiv) give the monomeric complexes NbCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%) and TaCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%). The monomeric complexes are unaffected by treatment with excess isopropylamine, while the dimeric complexes are cleaved to the monomers MCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)(2) upon addition of excess tert-butylamine in chloroform solution. Treatment of niobium and tantalum pentachlorides with 2,6-diisopropylaniline affords insoluble precipitates of [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%) and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%), which react with 4-tert-butylpyridine to afford the soluble complexes [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (45%) and [4-t-C(4)H(9)C(5)H(4)NH](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (44%). Sublimation of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), MCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2), and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[MCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] leads to decomposition to give [MCl(3)(NR)(NH(2)R)](2) as sublimates (32-49%), leaving complexes of the proposed formulation MCl(NR)(2) as nonvolatile residues. By contrast, [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) sublimes without chemical reaction. Analysis of the organic products obtained from thermal decomposition of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) showed isobutylene and tert-butylamine in a 2.2:1 ratio. Mass spectra of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), and [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) showed the presence of dimeric imido complexes, monomeric imido complexes, and nitrido complexes, implying that such species are important gas phase species in CVD processes utilizing these molecular precursors. The crystal structures of [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))], [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2), [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2), and [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) were determined. [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] crystallizes in the space group P2(1)/c with a = 12.448(3) ?, b = 10.363(3) ?, c = 28.228(3) ?, beta = 94.92(1) degrees, V = 3628(5) ?(3), and Z = 4. [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) crystallizes in the space group P2(1)/c with a = 9.586(4) ?, b = 12.385(4) ?, c = 11.695(4) ?, beta = 112.89(2) degrees, V = 1279.0(6) ?(3), and Z = 2. [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.285(3) ?, b = 11.208(3) ?, c = 23.867(6) ?, beta = 97.53 degrees, V = 2727(1) ?(3), and Z = 2. [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.273(1) ?, b = 11.241(2) ?, c = 23.929(7) ?, beta = 97.69(2) degrees, V = 2695(2) ?(3), and Z = 2. These findings are discussed in the context of niobium and tantalum nitride film depositions from molecular precursors. 相似文献
16.
Reactions of the linear triplatinum complex [Pt(3)(&mgr;-dpmp)(2)(XylNC)(2)](2+) (3) with small organic molecules led to formation of asymmetrical A-frame triplatinum complexes with an additional bridge across one of the metal-metal bonds, where dpmp is bis((diphenylphosphino)methyl)phenylphosphine. Reaction of complex 3 with electron deficient alkynes (R(1)C&tbd1;CR(2): R(1) = R(2) = CO(2)Me; R(1) = H, R(2) = CO(2)Me; R(1) = R(2) = CO(2)Et) afforded a new series of triplatinum clusters formulated as [Pt(3)(&mgr;-dpmp)(2)(&mgr;-R(1)CCR(2))(XylNC)(2)](PF(6))(2) (5a, R(1) = R(2) = CO(2)Me; 5b, R(1) = H, R(2) = CO(2)Me; 5c, R(1) = R(2) = CO(2)Et) in good yields. The complex cation of 5b was characterized by X-ray crystallography to have an asymmetrical A-frame structure comprising three Pt atoms bridged by two dpmp ligands, in which an acetylene molecule was inserted into one of the Pt-Pt bonds (triclinic, P&onemacr;, a = 19.507(3) ?, b = 20.327(4) ?, c = 14.499(4) ?, alpha = 107.69(2) degrees, beta = 102.08(2) degrees, gamma = 71.30(1) degrees, V = 5148 ?(3), Z = 2, R = 0.070, and R(w) = 0.084). The Pt-Pt bond length is 2.718(1) ? and the Pt.Pt nonbonded distance is 3.582(1) ?. Treatment of 3 with an excess of HBF(4).Et(2)O gave the asymmetrical cluster [Pt(3)(&mgr;-dpmp)(2)(&mgr;-H)(XylNC)(2)](BF(4))(3).CH(2)Cl(2) (6.CH(2)Cl(2)), in 61% yield, and a similar reaction with p-NO(2)C(6)H(4)NC led to the formation of [Pt(3)(&mgr;-dpmp)(2)(&mgr;-R(3)NC)(XylNC)(2)](PF(6))(2).CH(2)Cl(2) (7.CH(2)Cl(2)) in 94% yield (R(3) = p-NO(2)C(6)H(4)). Complexes 6 and 7 are assumed to have a single atom-bridged, asymmetrical A-frame structures. Reaction of the complex syn-[Pt(2)(&mgr;-dpmp)(2)(XylNC)(2)](2+) (1) with [MCl(2)(cod)] (M = Pt, Pd) gave the dimer-monomer combined trinuclear cluster [Pt(2)MCl(2)(&mgr;-dpmp)(2)(XylNC)(2)](PF(6))(2) (8a, M = Pt, 89%; 8b, M = Pd, 55%). The structure of 8a was determined by X-ray crystallography to be comprised of a metal-metal-bonded diplatinum core and a monomeric platinum center bridged by two dpmp ligands with a face-to-face arrangement (triclinic, P&onemacr;, a = 18.082(7) ?, b = 19.765(6) ?, c = 15.662(4) ?, alpha = 98.51(2) degrees, beta = 94.24(3) degrees, gamma = 109.82(2) degrees, V = 5161 ?(3), Z = 2, R = 0.069, and R(w) = 0.080). The Pt-Pt bond length is 2.681(2) ? and the Pt.Pt nonbonded distance is 3.219(2) ?. The heteronuclear complex 8b was transformed to an A-frame trinuclear cluster, [Pt(2)PdCl(&mgr;-Cl)(&mgr;-dpmp)(2)(XylNC)](PF(6))(2) (9), which was characterized by X-ray crystallography (monoclinic, C2/c, a = 33.750(9) ?, b = 28.289(9) ?, c = 23.845(8) ?, beta = 118.19(4) degrees, V = 20066 ?(3), Z = 8, R = 0.082, and R(w) = 0.077). The diplatinum unit (Pt-Pt = 2.606(2) ?) is connected to the mononuclear Pd center by a chloride bridge (Pt.Pd = 3.103(3) ?, Pt-Cl-Pd = 79.6(3) degrees ). 相似文献
17.
[PrAl(CF3COO)2(CF3CHOO)(C2H5)2(C4H8O)2]2 Mr=1420.56, monoclinic, P21/n, a=10.651(6), b=24.276(9), c=11.110(5)(), β=107.650(4)°, V=2737.4(1)()3, Z=2, Dc=3.45 g/cm3, F(000)=2816, T=233K, MoKα radiation (λ=0.71069()), μ(MoKα)=38.017 cm-1, R=0.048 for 2847 observed reflections (I≥3σ(I)). It is isostructural with [LnAl(CF3COO)2(CF3CHOO)-R2(C4H8O)2]2 (Ln=Ho, R=Et; Ln=Nd, Y, R=iBu). Pr3+ is coordinated by eight oxygen atoms from five bridging ligands and two THF forming a distorted bicap-prism. 相似文献
18.
Hogerheide MP Ringelberg SN Janssen MD Boersma J Spek AL van Koten G 《Inorganic chemistry》1996,35(5):1195-1200
The structural characterization of two new sodium phenolate complexes, containing ortho-amino substituents, enables the influence of intramolecular coordination on the aggregation of sodium phenolate complexes to be determined. Crystals of hexameric [NaOC(6)H(4)(CH(2)NMe(2))-2](6) (1a) are monoclinic, space group P2(1)/c, with a = 11.668(4) ?, b = 18.146(4) ?, c = 14.221(5) ?, beta = 110.76(3) ?, V = 2815.5(16) ?(3), and Z = 2; R = 0.0736 for 2051 reflections with I > 2.0sigma(I). Complex 1a contains a unique Na(6)O(6) core, consisting of two face-fused cubes, with the ortho-amino substituent of each phenolate coordinating to a sodium atom. In addition, two of the phenolate ligands have an eta(2)-arene interaction with an additional sodium atom in the core. Crystals of dimeric [(NaOC(6)H(2)(CH(2)NMe(2))(2)-2,6-Me-4)(HOC(6)H(2)(CH(2)NMe(2))(2)-2,6-Me-4)](2) (2b) are triclinic, space group P&onemacr;, with a = 10.0670(8) ?, b = 10.7121(7) ?, c = 27.131(3) ?, alpha = 92.176(8) degrees, beta = 99.928(8) degrees, gamma = 106.465(6) degrees, V = 2752.1(4) ?(3), and Z = 2; R = 0.0766 for 5329 reflections with I > 2.0sigma(I). Dimeric complex 2b contains two phenolate ligands, which bridge the two sodium atoms, each coordinating with one ortho-amino substituent to a sodium atom, while the second available ortho-amino substituent remains pendant. The coordination sphere of each sodium atom is completed by a (neutral) bidentate O,N-coordinated parent phenol molecule. The second ortho-amino substituent of this neutral phenol is involved in a hydrogen bridge with its acidic hydrogen. On the basis of these two new crystal structures and previously reported solid state structures for sodium phenolate complexes, it is shown that the introduction of first one and then two ortho-amino substituents into the phenolate ligands successively lowers the degree of association of these complexes in the solid state. In this process, the basic Na(2)O(2) building block of the molecular structures remains intact. 相似文献
19.
Musie G Farmer PJ Tuntulani T Reibenspies JH Darensbourg MY 《Inorganic chemistry》1996,35(8):2176-2183
A redox model study of [NiFe] hydrogenase has examined a series of five polymetallics based on the metalation of the dithiolate complex [1,5-bis(mercaptoethyl)-1,5-diazacyclooctane]Ni(II), Ni-1. Crystal structures of three polymetallics of the series have been reported earlier: [(Ni-1)(2)()Ni]Cl(2)(), [(Ni-1)(2)()FeCl(2)()](2)(), and [(Ni-1)(3)()(ZnCl)(2)()]Cl(2)(). Two are described here: [(Ni-1)(2)()Pd]Cl(2)().2H(2)()Ocrystallizes in the monoclinic system, space group P2(1)/c with cell constants a = 12.212(4) ?, b = 7.642(2) ?, c = 16.625(3) ?, beta = 107.69(2) degrees, V = 1443.230(0) ?(3), Z = 2, R = 0.051, and R(w) = 0.056. [(Ni-1)(2)()CoCl]PF(6)() crystallizes in the triclinic system, space group P&onemacr;, with cell constants a = 8.14(2) ?, b = 13.85(2) ?, c = 15.67(2) ?, alpha = 113.59(10) degrees, beta = 101.84(14) degrees, gamma = 94.0(2) degrees, V = 1561.620(0)?(3), Z = 2, R = 0.072, and R(w) = 0.077. In all Ni-1 serves as a bidentate metallothiolate ligand with a "hinge" angle in the range 105-118 degrees and Ni-M distances of 2.7- 3.7 ?. The most accessible redox event is shown by EPR and electrochemistry to reside in the N(2)S(2)Ni unit and is the Ni(II/I) couple. Charge neutralization of the thiolate sulfurs by metalation can (dependent on the interacting metal) stabilize the Ni(I) state as efficiently as methylation forming a thioether. The implication of these results for the heterometallic active site of [NiFe]-hydrogenase as structured from Desulfovibrio gigas (Volbeda, A., et al. Nature, 1995, 373, 580), the generality of the Ni(&mgr;-SR)(2)M hinge structure, and a possible explanation for the unusual redox potentials are discussed. 相似文献
20.
An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters. 相似文献