共查询到20条相似文献,搜索用时 62 毫秒
1.
Dinuclear nickel(II) complexes of the ligands 2,6-bis[bis((2-benzimidazolylmethyl)amino)methyl]-p-cresol (bbapOH), N,N,N',N'-tetrakis(2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane (tbpOH), N-methyl-N,N',N'-tris(2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane (m-tbpOH) and 1-[N,N-bis(2-benzimidazolylmethyl)amino]-3-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethoxy]-2-hydroxypropane (bpepOH) were prepared in order to model the active site of urease. The novel asymmetric structures of the dinuclear complexes were characterized by X-ray structure analysis. The complex [Ni(2)(bbapO)(ClO(4))(H(2)O)(MeOH)](ClO(4))(2).Et(2)O, 1, crystallizes in the monoclinic space group P2(1)/c, with a = 10.258(2) ?, b = 19.876(3) ?, c = 25.592(4) ?, and beta = 97.12(2) degrees. The nickel ions in 1 are bridged by the phenoxy donor of the ligand and a perchlorate anion. The complexes [Ni(2)(tbpO)(MeCOO)(H(2)O)](ClO(4))(2).H(2)O.Et(2)O, 2, [Ni(2)(m-tbpO)(PhCOO)(EtOH)(2)](ClO(4))(2).EtOH, 3, and [Ni(2)(bpepO)(MeCOO)(H(2)O)(2)](ClO(4))(2).H(2)O.Et(2)O.2EtOH, 4, also crystallize in the monoclinic crystal system with the following unit cell parameters: 2, C2/c, a = 35.360(13) ?, b = 10.958(3) ?, c = 24.821(10) ?, beta = 103.55(3) degrees; 3, Cc, a = 14.663(5) ?, b = 32.630(13) ?, c = 9.839(3) ?, beta = 92.49(2) degrees; 4, C2/c, a = 27.689(13) ?, b = 12.187(5) ?, c = 31.513(14) ?, beta = 115.01(3) degrees. The dinuclear centers of all these complexes are bridged by the alkoxy donor of the ligand and a carboxylate function. Compounds 2 and 3 have one of the nickel ions in a five-coordinated, trigonal bipyramidal coordination environment and thus show a high structural similarity to the dinuclear active site of urease from Klebsiella aerogenes. Furthermore, their magnetic and spectroscopic properties were determined and related to those of the urease enzymes. Activity toward hydrolysis of test substrates (4-nitrophenyl)urea, 4-nitroacetanilide, 4-nitrophenyl phosphate or bis(4-nitrophenyl) phosphate by the dinuclear complexes were examined by UV spectroscopic measurements. 相似文献
2.
Three compounds with formula [Mn(L)(2)(N(3))(2)](n)(), in which L is 4-acpy = 4-acetylpyridine (1), Etinc = ethyl isonicotinate (2), and py = pyridine (3), have been studied from the magnetic point of view. The new compound [Mn(L)(2)(N(3))(2)](n)() (2) crystallizes in the monoclinic system, space group P2(1)/a (No. 14), formula [C(16)H(18)MnN(8)O(4)], with a = 15.176(5) ?, b = 9.060(3) ?, c = 15.760(6) ?, beta = 111.62(3) degrees, and Z = 4. Compounds 1 and 2 are two-dimensional systems, whereas 3 is a 3-D compound. Compound 2 shows ferromagnetic Mn(2)(N(3))(2) dimeric entities linked antiferromagnetically to the four neighboring dimeric entities by four end-to-end azido bridges, leading to an alternate ferromagnetic-antiferromagnetic two-dimensional compound. MO calculations have been performed to study the superexchange pathway for the manganese 1,3-azido system. 相似文献
3.
The syntheses, structural characterization, and magnetic behavior of five new 2D manganese(II) complexes with empirical formulas [Mn(N(3))(2)(2,6-DiMepyz)(H(2)O)](n)() (1), [Mn(N(3))(2)(Etpyz)(H(2)O)](n)() (2), [Mn(N(3))(2)(H(2)O)(2)](n)()(2,3-DiMepyz)(n)() (3), [Mn(N(3))(2)(Clpyz)(2)](n)() (4), and [Mn(N(3))(2)(Ipyz)(2)](n)() (5) (pyz = pyrazine (1,4-diazine)) are reported. 1 crystallizes in the monoclinic system, space group P2(1)/c, with unit cell parameters a = 7.513(4) A, b = 17.438(7) A, c = 8.404(4) A, beta = 94.53(4) degrees , and Z = 4. 2 crystallizes in the triclinic system, space group P, with unit cell parameters a = 7.386(2) A, b = 8.434(2) A, c = 9.442(3) A, alpha = 71.82(2) degrees , beta = 72.08(2) degrees , gamma = 88.54(2) degrees , and Z = 2. 3 crystallizes in the monoclinic system, space group C2/c, with unit cell parameters a = 20.438(7) A, b = 7.711(2) A, c = 7.457(2) A, beta = 93.76(3) degrees , and Z = 4. 4 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.600(2) A, b = 13.440(4) A, c = 24.083(7) A, and Z = 8. 5 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.521(2) A, b = 13.787(3) A, c = 26.237(5) A, and Z = 8. The compounds 1-5 have only azido bridging ligands. In 1-3 each manganese atom is linked to the four nearest neighbors by only end-to-end azido bridges, forming square layers. 4 and 5 show alternating end-to-end and end-on azido bridges between manganese atoms. The magnetic properties of 1-5 are reported. At high temperatures the plots of chi(M) or chi(M)T vs T for the 1-3 compounds can be fitted as homogeneous 2D systems with J = -4.9, -4.4, and -3.9 cm(-)(1) for 1-3, respectively. For 1, 3, and 5 magnetic ordering and spontaneous magnetizations is achieved below T(c) = 35, 29, and 22 K, respectively, whereas 2 and 4 do not show spontaneous magnetization up to 2 K. 相似文献
4.
Kadish KM Autret M Ou Z Akiba Ky Masumoto S Wada R Yamamoto Y 《Inorganic chemistry》1996,35(19):5564-5569
The following five antimony(V) tetraphenylporphyrins with sigma-bonded antimony-carbon bonds were synthesized: [(TPP)Sb(CH(3))(2)](+)PF(6)(-), [(TPP)Sb(OCH(3))(OH)](+)PF(6)(-), [(TPP)Sb(CH(3))(OH)](+)ClO(4)(-), [(TPP)Sb(CH(3))(OCH(3))](+)ClO(4)(-), and [(TPP)Sb(CH(3))(F)](+)PF(6)(-). Each compound is stable toward air and moisture and has a high melting point (>250 degrees C). The electrochemistry and spectroelectrochemistry of these sigma-bonded porphyrins were examined in benzonitrile or dichloromethane containing 0.1 M tetrabutylammonium perchlorate as supporting electrolyte and the data compared to those for three previously synthesized OEP derivatives containing similar sigma-bonded and/or anionic axial ligands. Each porphyrin shows two reversible reductions and up to a maximun of one oxidation within the potential window of the solvent. Spectroelectrochemical data indicate formation of a porphyrin pi anion radical upon the first reduction as do ESR spectra of the singly reduced species. However, a small amount of the Sb(III) porphyrin products may be generated via a chemical reaction following electron tranfer. An X-ray crystallographic analysis of [(TPP)Sb(CH(3))(F)](+)PF(6)(-) is also presented: monoclinic, space group C2/c, Z = 8, a = 24.068(5) ?, b = 19.456(4) ?, c = 18.745(3) ?, beta = 94.69(2) degrees, R = 0.056. 相似文献
5.
Carranza J Brennan C Sletten J Clemente-Juan JM Lloret F Julve M 《Inorganic chemistry》2003,42(26):8716-8727
Four new copper(II) complexes of formula [Cu(2)(tppz)(dca)(3)(H(2)O)].dca.3H(2)O (1), [Cu(5)(tppz)(N(3))(10)](n)() (2), [[Cu(2)(tppz)(N(3))(2)][Cu(2)(N(3))(6)]](n)() (3), and [Cu(tppz)(N(3))(2)].0.33H(2)O (4) [tppz = 2,3,5,6-tetrakis(2-pyridyl)pyrazine and dca = dicyanamide anion] have been synthesized and structurally characterized by X-ray diffraction methods. The structure of complex 1 is made up of dinuclear tppz-bridged [Cu(2)(tppz)(dca)(3)(H(2)O)](+) cations, uncoordinated dca anions, and crystallization water molecules. The copper-copper separation across bis-terdentate tppz is 6.5318(11) A. Complex 2 is a sheetlike polymer whose asymmetric unit contains five crystallographically independent copper(II) ions. These units are building blocks in double chains in which the central part consists of a zigzag string of copper atoms bridged by double end-on azido bridges, and the outer parts are formed by dinuclear tppz-bridged entities which are bound to the central part through single end-on azido bridges. The chains are furthermore connected through weak, double out-of-plane end-on azido bridges, yielding a sheet structure. The intrachain copper-copper separations in 2 are 6.5610(6) A across bis-terdentate tppz, 3.7174(5) and 3.8477(5) A across single end-on azido bridges, and from 3.0955(5) to 3.2047(7) A across double end-on azido bridges. The double dca bridge linking the chains into sheets yields a copper-copper separation of 3.5984(7) A. The structure of 3 consists of centrosymmetric [Cu(2)(tppz)(N(3))(2)](2+) and [Cu(2)(N(3))(6)](2)(-) units which are linked through axial Cu.N(azido) (single end-on and double end-to-end coordination modes) type interactions to afford a neutral two-dimensional network. The copper-copper separations within the cation and anion are is 6.5579(5) A (across the bis-terdentate tppz ligand) and 3.1034(6) A (across the double end-on azido bridges), whereas those between the units are 3.6652(4) A (through the single end-on azido group) and 5.3508(4) A (through the double end-to-end azido bridges). The structure of complex 4 is built of neutral [Cu(tppz)(N(3))(2)] mononuclear units and uncoordinated water molecules. The mononuclear units are grouped by pairs to give a rather short copper-copper separation of 3.9031(15) A. The magnetic properties of 1-4 have been investigated in the temperature range 1.9-300 K. The magnetic behavior of complexes 1 and 4 is that of antiferromagnetically coupled copper(II) dimers with J = -43.7 (1) and -2.1 cm(-)(1) (4) (the Hamiltonian being H = -JS(A).S(B)). An overall ferromagnetic behavior is observed for complexes 2 and 3. Despite the structural complexity of 2, its magnetic properties correspond to those of magnetically isolated tppz-bridged dinuclear copper(II) units with an intermediate antiferromagnetic coupling (J = -37.5 cm(-)(1)) plus a ferromagnetic chain of hexanuclear double azido-bridged copper(II) units (the values of the magnetic coupling within and between the hexameric units being +61.1 and +0.0062 cm(-)(1), respectively). Finally, the magnetic properties of 3 were successfully analyzed through a model of a copper(II) chain with regular alternating of three ferromagnetic interactions, J(1) = +69.4 (across the double end-on azido bridges in the equatorial plane), J(2) = +11.2 (through the tppz bridge), and J(3) = +3.4 cm(-)(1) (across the single end-on azido bridge). 相似文献
6.
Photolysis of a series of octahedral monoazido complexes of the type [LM(III)(didentate ligand)(N(3))](n)(+)X(n) of vanadium(III), chromium(III), and manganese(III) in the solid state or in solution yields quantitatively the corresponding six-coordinate nitrido complexes [LM(V)(didentate ligand)(N)](n)(+)X(n) and 1 equiv of dinitrogen. L represents the macrocycle 1,4,7-triazacyclononane or its N-methylated derivative (L'), the didentate ligands are pentane-2,4-dionate (acac), 2,2,6,6-tetramethylheptane-3,5-dionate (tacac), picolinate (pic), phenanthroline (phen), and oxalate (ox), and X(-) represents perchlorate or hexafluorophosphate. The following nitrido complexes were prepared: [LV(V)(N)(acac)](ClO(4)) (6), [LCr(V)(N)(acac)](ClO(4)) (13), [LCr(V)(N)(tacac)](ClO(4)) (14), [LCr(V)(N)(pic)](ClO(4)) (15), [LCr(V)(N)(phen)](ClO(4))(2) (16), [LCr(V)(N)(ox)] (19), [L'Mn(V)(N)(acac)]PF(6) (21). Photolysis of [LCr(III)(N(3))(ox)] (17) in the solid state produces the &mgr;-nitrido-bridged mixed-valent species [L(2)Cr(2)(ox)(2)(&mgr;-N)](N(3)) (18). The structures of the precursor complex [L'Mn(acac)(N(3))]BPh(4) (20), of 13, and of [L'Mn(V)(N)(acac)]BPh(4) (21) have been determined by X-ray crystallography. Complex 13 crystallizes in the orthorhombic space group Pnma, with cell constants a = 27.187(5) ?, b = 9.228(2) ?, c = 7.070(1) ?, V = 1773.7(6) ?(3), and Z = 4; complex 20 crystallizes in the triclinic space group P&onemacr; with a = 14.769(5) ?, b = 16.83(1) ?, c = 16.96(1) ?, alpha = 108.19(5) degrees, beta = 105.06(4) degrees, gamma = 99.78(4) degrees, V = 3719(2) ?(3), and Z = 4; and complex 21 crystallizes in the monoclinic space group P2(1)/n with a = 10.443(3) ?, b = 16.035(4) ?, c = 21.463(5) ?, beta = 95.76(1) degrees, V = 3575.9(14) ?(3), and Z = 4. The Cr(V)&tbd1;N and Mn(V)&tbd1;N distances are short at 1.575(9) and 1.518(4) ?, respectively, and indicate a metal-to-nitrogen triple bond. 相似文献
7.
Koolhaas GJ Driessen WL Reedijk J van Der Plas JL de Graaff RA Gatteschi D Kooijman H Spek AL 《Inorganic chemistry》1996,35(6):1509-1517
The synthesis and characterization of three dinuclear copper(II) complexes and one mixed-valence tetranuclear cluster with the asymmetric imidazole-containing ligand bis(1,1'-imidazole-2-yl)(4-imidazole-4(5)-yl)-2-azabutane (biib) are described. X-ray crystallographic parameters for the copper complexes are as follows. [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4): triclinic, space group P&onemacr;, a = 10.178(1) ?, b = 9.4881(9) ?, c = 11.037(1) ?, alpha = 95.130(10) degrees, beta = 112.20(1) degrees, gamma = 92.142(9) degrees, and Z = 1. [Cu(2)(biib)(2)(NO(3))(2)](NO(3))(2)(H(2)O)(4): monoclinic, space group &Pmacr;2(1)/n, a = 9.207(6) ?, b = 17.0516(6) ?, c = 12.6107(7) ?, beta = 109.82(1) degrees, and Z = 2. [Cu(2)(biib)(2)(CuBr(3))(2)]: monoclinic, space group P2(1)/c, a = 11.583(2) ?, b = 11.864(2) ?, c = 16.070(2) ?, beta = 112.459(12) degrees, and Z = 2. The two Cu(II) ions in all four complexes are coordinated in a square-pyramidal geometry by three imidazole nitrogens and one amine nitrogen donor in the equatorial plane, and each copper ion is weakly coordinated at the axial position by respectively a tetrafluoroborate, a perchlorate, a nitrate, or a tribromocuprate(I) anion. By comparison of the structural data of the four complexes a relationship has been established between the donor strength of the anion and some structural features, like the Cu(II)-Cu(II) distance, of the dinuclear Cu(II)-Cu(II) unit in the four complexes. Single-crystal EPR spectra of [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4) were recorded at room temperature at X-band frequencies. The triplet spectra have been fit with nonparallel g and D tensors, whose principle values are as follows: g(xx)() = 2.022(8), g(yy)() = 2.060(7), g(zz)() = 2.211(8), D(x)()(')(x)()(') = -0.0182(9) cm(-)(1), D(y)()(')(y)()(') = -0.081(6) cm(-)(1), D(z)()(')(z)()(') = 0.0264(7) cm(-)(1). The compounds were further characterized and studied by ligand field and by frozen-solution and polycrystalline powder EPR spectroscopy. EPR spectra recorded at 77 K of frozen solutions of the perchlorate complex show that upon dilution in methanol the dinuclear complex reacts to form a mononuclear species. 相似文献
8.
Makowska-Grzyska MM Szajna E Shipley C Arif AM Mitchell MH Halfen JA Berreau LM 《Inorganic chemistry》2003,42(23):7472-7488
Divalent manganese, cobalt, nickel, and zinc complexes of 6-Ph(2)TPA (N,N-bis((6-phenyl-2-pyridyl)methyl)-N-((2-pyridyl)methyl)amine; [(6-Ph(2)TPA)Mn(CH(3)OH)(3)](ClO(4))(2) (1), [(6-Ph(2)TPA)Co(CH(3)CN)](ClO(4))(2) (2), [(6-Ph(2)TPA)Ni(CH(3)CN)(CH(3)OH)](ClO(4))(2) (3), [(6-Ph(2)TPA)Zn(CH(3)CN)](ClO(4))(2) (4)) and 6-(Me(2)Ph)(2)TPA (N,N-bis((6-(3,5-dimethyl)phenyl-2-pyridyl)methyl)-N-((2-pyridyl)methyl)amine; [(6-(Me(2)Ph)(2)TPA)Ni(CH(3)CN)(2)](ClO(4))(2) (5) and [(6-(Me(2)Ph)(2)TPA)Zn(CH(3)CN)](ClO(4))(2) (6)) have been prepared and characterized. X-ray crystallographic characterization of 1A.CH(3)()OH and 1B.2CH(3)()OH (differing solvates of 1), 2.2CH(3)()CN, 3.CH(3)()OH, 4.2CH(3)()CN, and 6.2.5CH(3)()CN revealed mononuclear cations with one to three coordinated solvent molecules. In 1A.CH(3)()OH and 1B.2CH(3)()OH, one phenyl-substituted pyridyl arm is not coordinated and forms a secondary hydrogen-bonding interaction with a manganese bound methanol molecule. In 2.2CH(3)()CN, 3.CH(3)()OH, 4.2CH(3)()CN, and 6.2.5CH(3)()CN, all pyridyl donors of the 6-Ph(2)TPA and 6-(Me(2)Ph)(2)TPA ligands are coordinated to the divalent metal center. In the cobalt, nickel, and zinc derivatives, CH/pi interactions are found between a bound acetonitrile molecule and the aryl appendages of the 6-Ph(2)TPA and 6-(Me(2)Ph)(2)TPA ligands. (1)H NMR spectra of 4 and 6 in CD(3)NO(2) solution indicate the presence of CH/pi interactions, as an upfield-shifted methyl resonance for a bound acetonitrile molecule is present. Examination of the cyclic voltammetry of 1-3 and 5 revealed no oxidative (M(II)/M(III)) couples. Admixture of equimolar amounts of 6-Ph(2)TPA, M(ClO(4))(2).6H(2)O, and Me(4)NOH.5H(2)O, followed by the addition of an equimolar amount of acetohydroxamic acid, yielded the acetohydroxamate complexes [((6-Ph(2)TPA)Mn)(2)(micro-ONHC(O)CH(3))(2)](ClO(4))(2) (8), [(6-Ph(2)TPA)Co(ONHC(O)CH(3))](ClO(4))(2) (9), [(6-Ph(2)TPA)Ni(ONHC(O)CH(3))](ClO(4))(2) (10), and [(6-Ph(2)TPA)Zn(ONHC(O)CH(3))](ClO(4))(2) (11), all of which were characterized by X-ray crystallography. The Mn(II) complex 8.0.75CH(3)()CN.0.75Et(2)()O exhibits a dinuclear structure with bridging hydroxamate ligands, whereas the Co(II), Ni(II), and Zn(II) derivatives all exhibit mononuclear six-coordinate structures with a chelating hydroxamate ligand. 相似文献
9.
Decaborane(14) reacts with 1-(CH(3))(3)SiC&tbd1;CC(4)H(9) in the presence of dimethyl sulfide to give the new alkenyldecaborane 5-(S(CH(3))(2))-6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11) (I). Crystal data for 5-(S(CH(3))(2))-6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11): space group P2(1)/n, monoclinic, a = 9.471(1) ?, b = 13.947(3) ?, c = 17.678(3) ?, beta = 100.32(1) degrees. A total of 3366 unique reflections were collected over the range 2.0 degrees = 2theta = 56.0 degrees, of which 1763 reflections had F(o)(2) >/= 3sigma(F(o)(2)) and were used in the final refinement. R(F)() = 0.083; R(w)(F)() = 0.094. The single-crystal X-ray structure of 5-(S(CH(3))(2))-6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11) (A) is also reported. Crystal data for 5-(S(CH(3))(2))-6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11): space group, P2(1)2(1)2(1), orthorhombic, a = 9.059 (3) ?, b = 12.193(4) ?, c = 21.431(3) ?. A total of 4836 unique reflections were collected over the range 6 degrees = 2theta = 140 degrees, of which 3705 reflections had F(o)(2) >/= 3sigma(F(o)(2)) and were used in the final refinement. R(F)() = 0.052; R(w)(F)() = 0.059. The reactions of 5-(S(CH(3))(2))6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11) and 5-(S(CH(3))(2))6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11) with a variety of alkyl isocyanides were investigated. All of the alkenyl monocarbon carboranes reported are the result of incorporation of the carbon atom from the isocyanide into the alkenyldecaborane framework and reduction of N&tbd1;C bond to a N-C single bond. The characterization of these compounds is based on (1)H and (11)B NMR data, IR spectroscopy, and mass spectrometry. 相似文献
10.
The first two transition metal compounds incorporating triazole-nitronyl-nitroxide radicals as ligands have been synthesized. These compounds are [Cu(4-Me-3-Nit-trz)(4)](ClO(4))(2) (1) and [Ni(4-Me-3-Nit-trz)(4)](ClO(4))(2) (2) with 4-Me-3-Nit-trz = 2-(3-[4-methyl-1,2,4-triazolyl])-4,4,5,5-tetramethylimidazoline-1-oxyl 3-oxide. Compound 1 crystallizes in the triclinic system, space group P&onemacr;. The lattice parameters are a = 9.742(2) ?, b = 12.214(12) ?, c = 12.981(4) ?, alpha = 67.19(4) degrees, beta = 81.48(2) degrees, and gamma = 79.24(4) degrees, with Z = 1. The structure consists of centrosymmetrical [Cu(4-Me-3-Nit-trz)(4)]](2+)cations and noncoordinated perchlorate anions. The Cu(II) ion is in an N(4)O(2) elongated tetragonal environment with two oxygen atoms of two nitroxide groups occupying the apical positions. Within the lattice the cations form infinite chains with short intermolecular contacts involving the nitronyl-nitroxide moieties of two adjacents cations. The temperature dependence of the magnetic susceptibility and the field dependence of the magnetization at 2 K have been investigated. Both intermolecular antiferromagnetic and intramolecular ferromagnetic interactions are operative. A theoretical model has been developed to interpret quantitatively the magnetic data, which allows us to determine the values of the interaction parameters. 相似文献
11.
The reaction of nitric oxide with the carboxylate-bridged diiron(II) complex [Fe(2)(Et-HPTB)(O(2)CPh)](BF(4))(2) (1a) afforded the dinitrosyl adduct, [Fe(2)(NO)(2)(Et-HPTB)(O(2)CPh)](BF(4))(2) (1b), where Et-HPTB = N,N,N',N'-tetrakis(N-ethyl-2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane, in 69% yield. Compound 1b further reacts with dioxygen to form the bis(nitrato) complex, [Fe(2)(Et-HPTB)(NO(3))(2)(OH)](BF(4))(2) (1c). The structure of 1b was determined by X-ray crystallography (triclinic, P&onemacr;, a = 13.5765(8) ?, b = 15.4088(10) ?, c = 16.2145(10) ?, alpha = 73.656(1) degrees, beta = 73.546(1) degrees, gamma = 73.499(1) degrees, V = 3043.8(7) ?(3), T = -80 degrees C, Z = 2, and R = 0.085 and R(w) = 0.095 for 5644 independent reflections with I > 3sigma(I)). The two nitrosyl units are equivalent with an average Fe-N-O angle of 167.4 +/- 0.8 degrees. Spectroscopic characterization of solid 1b revealed an NO stretch at 1785 cm(-)(1) in the infrared and M?ssbauer parameters of delta = 0.67 mm s(-)(1) and DeltaE(Q) = 1.44 mm s(-)(1) at 4.2 K. These data are comparable to those for other {FeNO}(7) systems. An S = (3)/(2) spin state was assigned from magnetic susceptibility studies to the two individual {FeNO} centers, each of which has a nitrosyl ligand antiferromagnetically coupled to iron. A least-squares fit of the chi vs temperature plots to a theoretical model yielded an exchange coupling constant J of -23 cm(-)(1), where H = -2JS(1).S(2), indicating that the two S = (3)/(2) centers are antiferromagnetically coupled to one another. An extended Hückel calculation on a model complex, [Fe(2)(NO)(2)(NH(3))(6)(O(2)CH)(OH)](2+), revealed that the magnitudes of Fe-N-O angles are dictated by pi-bonding interactions between the Fe d(xz)() and NO pi orbitals. 相似文献
12.
Gahan LR Grillo VA Hambley TW Hanson GR Hawkins CJ Proudfoot EM Moubaraki B Murray KS Wang D 《Inorganic chemistry》1996,35(4):1039-1044
Reaction of manganese(II) perchlorate hexahydrate with a methanol solution of 1-thia-4,7-diazacyclononane ([9]aneN(2)S) resulted in the isolation of the manganese(II) complex [Mn([9]aneN(2)S)(2)](ClO(4))(2). The X-ray structure of this complex is reported: crystal system orthorhombic, space group Pbam, No. 55, a = 7.937(2) ?,b = 8.811(2) ?, c = 15.531(3) ?, Z = 2, R = 0.0579. The complex is high spin (S = (5)/(2)) with an effective magnetic moment (&mgr;(eff)) 5.82 &mgr;(B) at 298 K and 5.65 &mgr;(B) at 4.2 K. Computer simulation of the Q-band EPR spectrum of [Mn([9]aneN(2)S)(2)](ClO(4))(2) yields g = 1.99 +/- 0.01, |D| = 0.19 +/- 0.005 cm(-)(1), and E/D = 0.04 +/- 0.02. For the analogous hexaamine complex [Mn([9]aneN(3))(2)](ClO(4))(2) ([9]aneN(3) = 1,4,7-triazacyclononane) analysis of the EPR spectra produced the following values: g = 1.98 +/- 0.01, |D| = 0.09 +/- 0.003 cm(-)(1), and E/D = 0.1 +/- 0.01. The spin Hamiltonian parameters for [Mn([9]aneN(2)S)(2)](ClO(4))(2) derived from the EPR spectra produced a good fit to the magnetic susceptibility data. 相似文献
13.
A series of copper(II) complexes with tripodal polypyridylmethylamine ligands, such as tris(2-pyridylmethyl)amine (tpa), ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Me(1)tpa), bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), and tris((6-methyl-2-pyridyl)methyl)amine (Me(3)tpa), have been synthesized and characterized by X-ray crystallography. [Cu(H(2)O)(tpa)](ClO(4))(2) (1) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.029(7) ?, b = 9.268(2) ?, c = 17.948(5) ?, beta = 113.80(3) degrees, and Z = 4 (R = 0.061, R(w) = 0.059). [CuCl(Me(1)tpa)]ClO(4) (2) crystallized in the triclinic system, space group P&onemacr;, with a = 13.617(4) ?, b = 14.532(4) ?, c = 12.357(4) ?, alpha = 106.01(3) degrees, beta = 111.96(2) degrees, gamma = 71.61(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.037). [CuCl(Me(2)tpa)]ClO(4) (3) crystallized in the monoclinic system, space group P2(1)/n, with a = 19.650(4) ?, b = 13.528(4) ?, c = 8.55(1) ?, beta = 101.51(5) degrees, and Z = 4 (R = 0.071, R(w) = 0.050). [CuCl(Me(3)tpa)][CuCl(2)(Me(3)tpa)]ClO(4) (4) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.698(6) ?, b = 14.687(7) ?, c = 19.475(4) ?, beta = 97.13(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.038). All the Cu atoms of 1-4 have pentacoordinate geometries with three pyridyl and one tertiary amino nitrogen atoms, and a chloride or aqua oxygen atom. Nitrite ion coordinated to the Cu(II) center of Me(1)tpa, Me(2)tpa, and Me(3)tpa complexes with only oxygen atom to form nitrito adducts. The cyclic voltammograms of [Cu(H(2)O)(Me(n)()tpa)](2+) (n = 0, 1, 2, and 3) in the presence of NO(2)(-) in H(2)O (pH 7.0) revealed that the catalytic activity for the reduction of NO(2)(-) increases in the order Me(3)tpa < Me(2)tpa < Me(1)tpa < tpa complexes. 相似文献
14.
Tercero J Diaz C Ribas J Maestro M Mahía J Stoeckli-Evans H 《Inorganic chemistry》2003,42(10):3366-3373
Eight oxamato-bridged heterotrinuclear Ni(II)Cu(II)Ni(II) complexes of formula ([Ni(H(2)O)(dpt)](2)(mu-Cu(H(2)O)(opba)))(ClO(4))2 (1), ([Ni(H(2)O)(dien)](2)(mu-Cu(pba)))(ClO(4))(2).6H(2)O (2), ([Ni(H(2)O)(Medpt)](2)(mu-Cu(OHpba)))(ClO(4))(2).4H(2)O (3), ([Ni(H(2)O)(dien)](2)(mu-Cu(Me(2)pba)))(ClO(4))(2).2.5H(2)O (4), ([Ni(H(2)O)(dpt)](2)(mu-Cu(Me(2)pba)))(ClO(4))(2).2H(2)O (5), ([Ni(H(2)O)(dien)](2)(mu-Cu(OHpba)))(ClO(4))(2).4H(2)O (6), ([Ni(2)(dpt)(2)(mu-Cu(H(2)O)(pba))](2)(mu-N(3))(2))Na(2)(ClO(4))(4).6H(2)O (7), and ([Cu(H(2)O)(2)(dpt)Ni(2)(H(2)O)(dpt)(2)](mu-H(2)Me(2)pba(2-)))(ClO(4))(4).3H(2)O (8) in which opba = o-phenylenbis(oxamato), pba = 1,3-propylenebis(oxamato), OHpba = 2-hydroxy-1,3-propylenebis(oxamato), Me(2)pba = 2,2-dimethyl-1,3-propylenbis(oxamato), dpt = 3,3'-diaminodipropylamine, dien = 2,2'-diaminodiethylamine, and Medpt = 3,3'-diamino-N-methyldipropylamine were synthesized and characterized. The crystal structures of 1, 7, and 8 were solved. For complex 1, the trinuclear entities are linked by hydrogen bonds forming a one-dimensional system, and for complex 8, the presence of van der Waals interactions gives a one-dimensional system, too. For complex 7, the trinuclear entities are self-assembled by azido ligands, given a hexanuclear system; each of these hexanuclear entities are self-assembled through two [Na(O)(3)(H(2)O)(3)] octahedral-sharing one-edge entities, given a one-dimensional system. The magnetic behavior of complexes 2-7 was investigated by variable-temperature magnetic susceptibility measurements. Complexes 2-6 exhibit the minimum characteristic of this kind of polymetallic species with an irregular spin state structure. The Jvalue through the oxamato bridge varied between -88 cm(-1) (for 6) and -111.2 cm(-1) (for 5). For complex 7, the values obtained were J(1) = -101.7 cm(-1) (through the oxamato ligand) and J(2) = -3.2 cm(-1) (through the azido ligand). 相似文献
15.
The electrochemical and spectral properties of some copper(I) polypyridyl complexes based on 6,7-dihydrodibenzo[b,j][1,10]phenanthroline, dmbiq, and 6,7-dihydrodipyrido[2,3-b:3',2'-j][1,10]phenanthroline, dmbinap, are reported. These complexes are [Cu(dmbiq)(2)](+), 1; [Cu(dmbiq)(PPh(3))(2)](+), 2; [Cu(dmbinap)(2)](+), 3; and [Cu(dmbinap)(PPh(3))(2)](+), 4. 3 and 4 may be reduced to form ligand-based radical anion species. The resonance Raman spectra of 3(*)()(-)() and 4(*)()(-)() are almost identical and correspond closely to the spectrum of dmbinap(*)()(-)() and the reported spectra of complexes containing 2,2'-biquinoline radical anion moieties. Reduction processes for 1 and 2 are irreversible. For 1 the electronic spectral changes arising from reduction suggest demetallation of the complex. The structure of [Cu(C(18)H(12)N(4))(2)][BF(4)].CH(2)Cl(2) (3[BF(4)].CH(2)Cl(2)) was determined by single-crystal X-ray diffraction. It crystallized in the monoclinic space group P2(1)/c with cell dimensions a = 14.059(7) ?, b = 15.058(6) ?, c = 16.834(9) ?, beta = 111.56(5) degrees, Z = 4, rho(calcd) = 1.611 g/cm(3), and R(F(o)) = 0.0497. 相似文献
16.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions. 相似文献
17.
Musie G Farmer PJ Tuntulani T Reibenspies JH Darensbourg MY 《Inorganic chemistry》1996,35(8):2176-2183
A redox model study of [NiFe] hydrogenase has examined a series of five polymetallics based on the metalation of the dithiolate complex [1,5-bis(mercaptoethyl)-1,5-diazacyclooctane]Ni(II), Ni-1. Crystal structures of three polymetallics of the series have been reported earlier: [(Ni-1)(2)()Ni]Cl(2)(), [(Ni-1)(2)()FeCl(2)()](2)(), and [(Ni-1)(3)()(ZnCl)(2)()]Cl(2)(). Two are described here: [(Ni-1)(2)()Pd]Cl(2)().2H(2)()Ocrystallizes in the monoclinic system, space group P2(1)/c with cell constants a = 12.212(4) ?, b = 7.642(2) ?, c = 16.625(3) ?, beta = 107.69(2) degrees, V = 1443.230(0) ?(3), Z = 2, R = 0.051, and R(w) = 0.056. [(Ni-1)(2)()CoCl]PF(6)() crystallizes in the triclinic system, space group P&onemacr;, with cell constants a = 8.14(2) ?, b = 13.85(2) ?, c = 15.67(2) ?, alpha = 113.59(10) degrees, beta = 101.84(14) degrees, gamma = 94.0(2) degrees, V = 1561.620(0)?(3), Z = 2, R = 0.072, and R(w) = 0.077. In all Ni-1 serves as a bidentate metallothiolate ligand with a "hinge" angle in the range 105-118 degrees and Ni-M distances of 2.7- 3.7 ?. The most accessible redox event is shown by EPR and electrochemistry to reside in the N(2)S(2)Ni unit and is the Ni(II/I) couple. Charge neutralization of the thiolate sulfurs by metalation can (dependent on the interacting metal) stabilize the Ni(I) state as efficiently as methylation forming a thioether. The implication of these results for the heterometallic active site of [NiFe]-hydrogenase as structured from Desulfovibrio gigas (Volbeda, A., et al. Nature, 1995, 373, 580), the generality of the Ni(&mgr;-SR)(2)M hinge structure, and a possible explanation for the unusual redox potentials are discussed. 相似文献
18.
The synthesis, characterization, and reactivity of new polyether adducts of strontium and barium carboxylates of general composition M(O(2)CCF(3))(n)()(L) (M = Ba, L = 15-crown-5, (1); M = Ba (2), Sr (3), respectively, with L = tetraglyme are reported. The compounds were synthesized by reaction of BaCO(3) or MH(2) (M = Sr or Ba) with organic acids in the presence of the polyether ligands. These compounds have been characterized by IR and (13)C and (1)H NMR spectroscopies, elemental analyses, and thermogravimetric analysis. The species Ba(2)(O(2)CCF(3))(4)(15-crown-5)(2) (1) and [Ba(2)(O(2)CCF(3))(4)(tetraglyme)](infinity) (2), were also characterized by single-crystal X-ray diffraction. Ba(2)(O(2)CCF(3))(4)(15-crown-5)(2) (1) crystallizes in the orthorhombic space group Cccm with cell dimensions of a = 13.949(1) ?, b = 19.376(2) ?, c = 16.029(1) ?, and Z = 8. [Ba(2)(O(2)CCF(3))(4)(tetraglyme)](infinity) (2) crystallizes in the monoclinic space group C2/c with cell dimensions of a = 12.8673(12) ?, b = 16.6981(13) ?, c = 15.1191(12) ?, beta = 99.049(8) degrees, and Z = 4. Compounds 1-3 thermally decompose at high temperatures in the solid state to give MF(2). However, solutions of compounds 1-3 dissolved in ethanol with Ti(O-i-Pr)(4) give crystalline perovskite phase MTiO(3) films, or in the case of mixtures of 2 and 3, Ba(1)(-)(x)()Sr(x)()TiO(3) films below 600 degrees C when spin coated onto silicon substrates and thermally treated. The crystallinity, purity, and elemental composition of the films was determined by glancing angle X-ray diffraction and Auger electron spectroscopy. 相似文献
19.
The copper(I) and copper(II) complexes with the nitrogen donor ligands bis[(1-methylbenzimidazol-2-yl)methyl]amine (1-BB), bis[2-(1-methylbenzimidazol-2-yl)ethyl]amine (2-BB), N-acetyl-2-BB (AcBB), and tris[2-(1-methylbenzimidazol-2-yl)ethyl]nitromethane (TB) have been studied as models for copper nitrite reductase. The copper(II) complexes form adducts with nitrite and azide that have been isolated and characterized. The Cu(II)-(1-BB) and Cu(II)-AcBB complexes are basically four-coordinated with weak axial interaction by solvent or counterion molecules, whereas the Cu(II)-(2-BB) and Cu(II)-TB complexes prefer to assume five-coordinate structures. A series of solid state structures of Cu(II)-(1-BB) and -(2-BB) complexes have been determined. [Cu(1-BB)(DMSO-O)(2)](ClO(4))(2): triclinic, P&onemacr; (No. 2), a = 9.400(1) ?, b = 10.494(2) ?, c = 16.760(2) ?, alpha = 96.67(1) degrees, beta = 97.10(1) degrees, gamma = 108.45(1) degrees, V = 1534.8(5) ?(3), Z = 2, number of unique data [I >/= 3sigma(I)] = 4438, number of refined parameters = 388, R = 0.058. [Cu(1-BB)(DMSO-O)(2)](BF(4))(2): triclinic, P&onemacr; (No. 2), a = 9.304(5) ?, b = 10.428(4) ?, c = 16.834(8) ?, alpha = 96.85(3) degrees, beta = 97.25(3) degrees, gamma = 108.21(2) degrees, V = 1517(1) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3388, number of refined parameters = 397, R = 0.075. [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 7.533(2) ?, b = 8.936(1) ?, c = 19.168(2) ?, alpha = 97.66(1) degrees, beta = 98.62(1) degrees, gamma = 101.06(1) degrees, V = 1234.4(7) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3426, number of refined parameters = 325, R = 0.081. [Cu(2-BB)(MeOH)(ClO(4))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 8.493(3) ?, b = 10.846(7) ?, c = 14.484(5) ?, alpha = 93.71(4) degrees, beta = 103.13(3) degrees, gamma = 100.61(4) degrees, V = 1270(1) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2612, number of refined parameters = 352, R = 0.073. [Cu(2-BB)(N(3))](ClO(4)): monoclinic, P2(1)/n (No. 14), a = 12.024(3) ?, b = 12.588(5) ?, c = 15.408(2) ?, beta = 101,90(2) degrees, V = 2282(1) ?(3), Z = 4, number of unique data [I >/= 2sigma(I)] = 2620, number of refined parameters = 311, R = 0.075. [Cu(2-BB)(NO(2))](ClO(4))(MeCN): triclinic, P&onemacr; (No. 2), a = 7.402(2) ?, b = 12.500(1) ?, c = 14.660(2) ?, alpha = 68.14(1) degrees, beta = 88.02(2) degrees, gamma = 78.61(1) degrees, V = 1233.0(4) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2088, number of refined parameters = 319, R = 0.070. In all the complexes the 1-BB or 2-BB ligands coordinate the Cu(II) cations through their three donor atoms. The complexes with 2-BB appear to be more flexible than those with 1-BB. The nitrito ligand is bidentate in [Cu(2-BB)(NO(2))](ClO(4))(MeCN) and essentially monodentate in [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)). The copper(I) complexes exhibit nitrite reductase activity and react rapidly with NO(2)(-) in the presence of stoichiometric amounts of acid to give NO and the corresponding copper(II) complexes. Under the same conditions the reactions between the copper(I) complexes and NO(+) yield the same amount of NO, indicating that protonation and dehydration of bound nitrite are faster than its reduction. The NO evolved from the solution was detected and quantitated as the [Fe(EDTA)(NO)] complex. The order of reactivity of the Cu(I) complexes in the nitrite reduction process is [Cu(2-BB)](+) > [Cu(1-BB)](+) > [Cu(TB)](+) > [Cu(AcBB)](+). 相似文献
20.
Jüstel T Bendix J Metzler-Nolte N Weyhermüller T Nuber B Wieghardt K 《Inorganic chemistry》1998,37(1):35-43
Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible. 相似文献