Copper and Bismuth Complexes Containing Dipyridyl gem-Diolato Ligands: Bi(III)(2)[(2-Py)(2)CO(OH)](2)(O(2)CCF(3))(4)(THF)(2), Cu(II)[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), and Cu(II)(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), a Ferromagnetically Coupled Tetranuclear Copper(II) Chain

The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1.     

Perturbation of the Electronic Structure of a Copper(II) ion by a Cu(I)Cl Moiety in a Class I Mixed Valence Copper Complex, Cu(II)(Me(5)dien)Cl(2)(Cu(I)Cl)

A new mixed valence copper complex Cu(II)(Me(5)dien)Cl(2)(Cu(I)Cl) (2) was obtained from the reaction of CuCl with Cu(II)(Me(5)dien)Cl(2) (1) in acetonitrile. The structures of 1 and 2 have been determined by single-crystal X-ray diffraction analyses. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 8.374(5) ?, b = 17.155(3) ?, c = 23.806(5) ?, beta = 94.40(4) degrees, Z = 8, and V = 3398(1) ?(3) while compound 2 crystallizes in orthorhombic space group Pbcn with a = 14.71(1) ?, b = 16.06(2) ?, c = 13.38(1) ?, Z = 8, and V = 3159(5) ?. The Cu(II)(Me(5)dien)Cl(2) unit in both compounds has a similar distorted square-pyramidal geometry. The Cu(I)Cl moiety in 2 is attached to the Cu(II) unit via two bridging chlorine atoms and has a distorted trigonal planar geometry. UV-vis and EPR spectroscopic studies and molecular orbital calculations established the presence of significant perturbation of the Cu(I)Cl unit to the electronic structure of the Cu(II) ion in compound 2.     

Syntheses and Crystal Structures of Ruthenium Complexes of 1,4,8,11-Tetraazacyclotetradecane, Tris(2-aminoethyl)amine (tren), and Bis(2-aminoethyl)(iminomethyl)amine. A Microporous Layered Structure Consisting of {[K(tren)](2)[RuCl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[RuCl(6)]}(n)()(n)()(+)

The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam).     

Crystal Structures and Magnetic Properties of Novel [Ln(III)Cu(II)(4)] (Ln = Gd, Dy, Ho) Pentanuclear Complexes. Topology and Ferromagnetic Interaction in the Ln(III)-Cu(II) Pair

The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data.     

Model for the Reduced Schiff Base Intermediate between Amino Acids and Pyridoxal: Copper(II) Complexes of N-(2-Hydroxybenzyl)amino Acids with Nonpolar Side Chains and the Crystal Structures of [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(phen)].H(2)O and [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)

Copper(II) complexes with reduced Schiff base ligands of amino acids possessing nonpolar side chains with salicylaldehyde have been synthesized. Ternary complexes with imidazole, 1,10-phenanthroline, and pyridine have been prepared and characterized for N-(2-hydroxybenzyl)-D,L-alanine. The crystal structures of [(N-(2-hydroxybenzyl)-D,L-alanine)(1,10-phenanthroline)Cu(II)] monohydrate ([Cu(SAla)phen].H(2)O) and [(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)Cu(II)] ([Cu(SAla)Him]), have been determined. [Cu(SAla)phen].H(2)O crystallized in space group P&onemacr;, with a = 8.718(2) ?, b = 10.886(3) ?, c = 11.693(2) ?, alpha = 71.32(2) degrees, beta = 85.27(2) degrees, gamma = 70.21(2) degrees, and Z = 2. The copper atom is five coordinate, with SAla acting as a tridentate ONO chelator through the carboxylato and phenolato oxygens and the amine nitrogen. The remaining donors are provided by the phen nitrogens. [Cu(SAla)Him] crystallized in space group P2(1)/n, with a = 10.353(1) ?, b = 6.714(1) ?, c = 18.769(2) ?, beta = 91.71(1) degrees, and Z = 4. The copper atom is four coordinate, with SAla acting as a tridentate ONO chelator with the neutral imidazole moiety coordinated through nitrogen. In both complexes the ligand has two chiral centers due to the coordination of the N. Molecular mechanics calculations show that unfavorable steric interactions would occur in the nonobserved R,R and S,S diastereomers. Compounds prepared have been characterized by a range of physicochemical techniques. The complexes may serve as stable models for the intermediates in enzymatic amino acid transformations.     

An Approach to Heterometallic Complexes with Selenolate and Tellurolate Ligands: Crystal Structures of cis-[Mn(CO)(4)(SePh)(2)](-), [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-), (CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3), and (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3)

Oxidative addition of diorganyl diselenides to the coordinatively unsaturated, low-valent transition-metal-carbonyl fragment [Mn(CO)(5)](-) produced cis-[Mn(CO)(4)(SeR)(2)](-). The complex cis-[PPN][Mn(CO)(4)(SePh)(2)] crystallized in triclinic space group P&onemacr; with a = 10.892(8) ?, b = 10.992(7) ?, c = 27.021(4) ?, alpha = 101.93(4) degrees, beta = 89.79(5) degrees, gamma = 116.94(5) degrees, V = 2807(3) ?(3), and Z = 2; final R = 0.085 and R(w) = 0.094. Thermolytic transformation of cis-[Mn(CO)(4)(SeMe)(2)](-) to [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-) was accomplished in high yield in THF at room temperature. Crystal data for [Na-18-crown-6-ether][(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)]: trigonal space group R&thremacr;, a = 13.533(3) ?, c = 32.292(8) ?, V = 5122(2) ?(3), Z = 6, R = 0.042, R(w) = 0.041. Oxidation of Co(2+) to Co(3+) by diphenyl diselenide in the presence of chelating metallo ligands cis-[Mn(CO)(4)(SePh)(2)](-) and cis-[Mn(CO)(4)(TePh)(2)](-), followed by a bezenselenolate ligand rearranging to bridge two metals and a labile carbonyl shift from Mn to Co, led directly to [(CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3)]. Crystal data: triclinic space group P&onemacr;, a = 11.712(3) ?, b = 12.197(3) ?, c = 15.754(3) ?, alpha = 83.56(2) degrees, beta = 76.13(2) degrees, gamma = 72.69(2) degrees, V = 2083.8(7) ?(3), Z = 2, R = 0.040, R(w) = 0.040. Addition of fac-[Fe(CO)(3)(SePh)(3)](-) to fac-[Mn(CO)(3)(CH(3)CN)(3)](+) resulted in formation of (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3). This neutral heterometallic complex crystallized in monoclinic space group P2(1)/n with a = 8.707(2) ?, b = 17.413(4) ?, c = 17.541(4) ?, beta = 99.72(2) degrees, V = 2621(1) ?(3), and Z = 4; final R = 0.033 and R(w) = 0.030.     

Synthesis, Structure, and Reactivities of [eta(2)-P(7)M(CO)(4)](3)(-), [eta(2)-HP(7)M(CO)(4)](2)(-), and [eta(2)-RP(7)M(CO)(4)](2)(-) Zintl Ion Complexes Where M = Mo, W

Ethylenediamine (en) solutions of [eta(4)-P(7)M(CO)(3)](3)(-) ions [M = W (1a), Mo (1b)] react under one atmosphere of CO to form microcrystalline yellow powders of [eta(2)-P(7)M(CO)(4)](3)(-) complexes [M = W (4a), Mo (4b)]. Compounds 4 are unstable, losing CO to re-form 1, but are highly nucleophilic and basic. They are protonated with methanol in en solvent giving [eta(2)-HP(7)M(CO)(4)](2)(-) ions (5) and are alkylated with R(4)N(+) salts in en solutions to give [eta(2)-RP(7)M(CO)(4)](2)(-) complexes (6) in good yields (R = alkyl). Compounds 5 and 6 can also be prepared by carbonylations of the [eta(4)-HP(7)M(CO)(3)](2)(-) (3) and [eta(4)-RP(7)M(CO)(3)](2)(-) (2) precursors, respectively. The carbonylations of 1-3 to form 4-6 require a change from eta(4)- to eta(2)-coordination of the P(7) cages in order to maintain 18-electron configurations at the metal centers. Comparative protonation/deprotonation studies show 4 to be more basic than 1. The compounds were characterized by IR and (1)H, (13)C, and (31)P NMR spectroscopic studies and microanalysis where appropriate. The [K(2,2,2-crypt)](+) salts of 5 were characterized by single crystal X-ray diffraction. For 5, the M-P bonds are very long (2.71(1) ?, average). The P(7)(3)(-) cages of 5 are not displaced by dppe. The P(7) cages in 4-6 have nortricyclane-like structures in contrast to the norbornadiene-type geometries observed for 1-3. (31)P NMR spectroscopic studies for 5-6 show C(1) symmetry in solution (seven inequivalent phosphorus nuclei), consistent with the structural studies for 5, and C(s)() symmetry for 4 (five phosphorus nuclei in a 2:2:1:1:1 ratio). Crystallographic data for [K(2,2,2-crypt)](2)[eta(2)-HP(7)W(CO)(4)].en: monoclinic, space group C2/c, a = 23.067(20) ?, b = 12.6931(13) ?, c = 21.433(2) ?, beta = 90.758(7) degrees, V = 6274.9(10) ?(3), Z = 4, R(F) = 0.0573, R(w)(F(2)) = 0.1409. For [K(2,2,2-crypt)](2)[eta(2)-HP(7)Mo(CO)(4)].en: monoclinic, space group C2/c, a = 22.848(2) ?, b = 12.528(2) ?, c = 21.460(2) ?, beta = 91.412(12) degrees, V = 6140.9(12) ?(3), Z = 4, R(F) = 0.0681, R(w)(F(2)) = 0.1399.     

A Ferromagnetic Interaction between Cu(2+) Centers through a [CrO(4)](2-) Bridge: Crystal Structures and Magnetic Properties of [{Cu(acpa)}(2)(&mgr;-MO(4))] (M = Cr, Mo) (Hacpa = N-(1-Acetyl-2-propyridene)(2-pyridylmethyl)amine)

The reaction of [Cu(acpa)](+) with [MO(4)](2)(-) (Hacpa = N-(1-acetyl-2-propyridene)(2-pyridylmethyl)amine and M = Cr and Mo) in water-methanol or water-acetonitrile solution affords dinuclear copper(II) complexes with metalate bridges, [{Cu(acpa)}(2)(&mgr;-CrO(4))].4CH(3)OH.4H(2)O (1) and [{Cu(acpa)}(2)(&mgr;-MoO(4))].4H(2)O (2), respectively. The crystal structures and the magnetic properties have been studied. Complexes 1 and 2 are isomorphous and the structures are made up of discrete dimers in which two copper(II) ions are bridged by the [MO(4)](2)(-) anion. The coordination geometry about the copper(II) ions is square planar with a N(2)O chelate group from acpa and an oxygen atom from [MO(4)](2)(-). Magnetic susceptibility measurements for 1 revealed that a ferromagnetic interaction between copper(II) ions is propagated through the [CrO(4)](2)(-) bridge and the coupling constant (2J) was evaluated to be 14.6(1) cm(-)(1) (H = -2JS(1).S(2)). In 2, two copper(II) ions bridged by [MoO(4)](2)(-) anion are antiferromagnetically coupled with the 2J value of -5.1(4) cm(-)(1). The ferromagnetic interaction in 1 is explained by means of the orbital topology of frontier orbitals. Crystal data: 1, monoclinic, space group P2(1)/m, a = 8.349(2) ?, b = 17.616(3) ?, c = 10.473 ?, beta = 107.40(2) degrees, Z= 2; 2, monoclinic, space group P2(1)/m, a = 8.486(2) ?, b = 18.043(3) ?, c = 9.753(2) ?, beta = 95.82(2) degrees, Z = 2.     

Assembly of Carbohydrates on a Nickel(II) Center by Utilizing N-Glycosidic Bond Formation with Tris(2-aminoethyl)amine (tren). Syntheses and Characterization of [Ni{N-(aldosyl)-tren}(H(2)O)](2+), [Ni{N,N'-bis(aldosyl)-tren}](2+) and [Ni{N,N',N"-tris(aldosyl)-tren}](2+)

Reactions of [Ni(tren)(H(2)O)(2)]X(2) (tren = tris(2-aminoethyl)amine; X = Cl (1a), Br (1b); X(2) = SO(4) (1c)) with mannose-type aldoses, having a 2,3-cis configuration (D-mannose and L-rhamnose), afforded {bis(N-aldosyl-2-aminoethyl)(2-aminoethyl)amine}nickel(II) complexes, [Ni(N,N'-(aldosyl)(2)-tren)]X(2) (aldosyl = D-mannosyl, X = Cl (2a), Br (2b), X(2) = SO(4) (2c); aldosyl = L-rhamnosyl, X(2) = SO(4) (3c)). The structure of 1c was confirmed by X-ray crystallography to be a mononuclear [Ni(II)N(4)O(2)] complex with the tren acting as a tetradentate ligand (1c.2H(2)O: orthorhombic, Pbca, a = 15.988(2) ?, b = 18.826(4) ?, c = 10.359(4) ?, V = 3118 ?(3), Z = 8, R = 0.047, and R(w) = 0.042). Complexes 2a,c and 3c were characterized by X-ray analyses to have a mononuclear octahedral Ni(II) structure ligated by a hexadentate N-glycoside ligand, bis(N-aldosyl-2-aminoethyl)(2-aminoethyl)amine (2a.CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 16.005(3) ?, b = 20.095(4) ?, c = 8.361(1) ?, V = 2689 ?(3), Z = 4, R = 0.040, and R(w) = 0.027. 2c.3CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 14.93(2) ?, b = 21.823(8) ?, c = 9.746(2) ?, V = 3176 ?(3), Z = 4, R = 0.075, and R(w) = 0.080. 3c.3CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 14.560(4) ?, b = 21.694(5) ?, c = 9.786(2) ?, V = 3091 ?(3), Z = 4, R = 0.072, and R(w) = 0.079). The sugar part of the complex involves novel intramolecular sugar-sugar hydrogen bondings around the metal center. The similar reaction with D-glucose, D-glucosamine, and D-galactosamine, having a 2,3-trans configuration, resulted in the formation of a mono(sugar) complex, [Ni(N-(aldosyl)-tren)(H(2)O)(2)]Cl(2) (aldosyl = D-glucosyl (4b), 2-amino-2-deoxy-D-glucosyl (5a), and 2-amino-2-deoxy-D-galactosyl (5b)), instead of a bis(sugar) complex. The hydrogen bondings between the sugar moieties as observed in 2 and 3 should be responsible for the assembly of two sugar molecules on the metal center. Reactions of tris(N-aldosyl-2-aminoethyl)amine with nickel(II) salts gave the tris(sugar) complexes, [Ni(N,N',N"-(aldosyl)(3)-tren)]X(2) (aldosyl = D-mannosyl, X = Cl (6a), Br (6b); L-rhamnosyl, X = Cl (7a), Br (7b); D-glucosyl, X = Cl (9); maltosyl, X = Br (10); and melibiosyl, X = Br (11)), which were assumed to have a shuttle-type C(3) symmetrical structure with Delta helical configuration for D-type aldoses on the basis of circular dichroism and (13)C NMR spectra. When tris(N-rhamnosyl)-tren was reacted with NiSO(4).6H(2)O at low temperature, a labile neutral complex, [Ni(N,N',N"-(L-rhamnosyl)(3)-tren)(SO(4))] (8), was successfully isolated and characterized by X-ray crystallography, in which three sugar moieties are anchored only at the N atom of the C-1 position (8.3CH(3)OH.H(2)O: orthorhombic, P2(1)2(1)2(1), a = 16.035(4) ?, b = 16.670(7) ?, c = 15.38(1) ?, V = 4111 ?(3), Z = 4, R = 0.084, and R(w) = 0.068). Complex 8 could be regarded as an intermediate species toward the C(3) symmetrical tris(sugar) complexes 7, and in fact, it was readily transformed to 7b by an action of BaBr(2).     

Intermolecular Ferromagnetic and Antiferromagnetic Interactions in Halogen-Bridged Copper(I) Imino Nitroxides: Crystal Structures and Magnetic Properties of [Cu(I)(&mgr;-X)(imino nitroxide)](2) (X = I or Br)

Reaction of CuI or CuBr with some imino nitroxides in methanol gave the halogen bridged dinuclear Cu(I) complexes [Cu(&mgr;-I)(impy)](2) (1), [Cu(&mgr;-I)(immepy)](2) (2), [Cu(&mgr;-Br)(immepy)](2) (3), and [Cu(&mgr;-Br)(imph-NO(2))](2) (4), respectively (impy = 2-(2'-pyridyl)-4,4,5,5-tetramethyl-4,5-dihydro-1H-imidazolyl-1-oxyl, immepy = 2-(6'-methyl-2'-pyridyl)-4,4,5,5-tetramethyl-4,5-dihydro-1H-imidazolyl-1-oxyl, imph-NO(2) = 2-(4'-nitrophenyl)-4,4,5,5-tetramethyl-4,6-dihydro-1H-imidazolyl-1-oxyl). Crystal structures and magnetic properties have been studied. Complexes 1-4 have dimeric structures where two copper ions are doubly bridged by halide ions in a &mgr;(2) fashion. In 1-3, each copper ion is tetrahedral with a bidentate imino nitroxide and two halide ions, and the two copper ions are separated by 2.592(2), 2.6869(8), and 2.7357(6) ?, respectively. In 4, triangular coordination sites of the copper ions are completed with a nitrogen atom from the imino nitroxide and two bromide ions bridging the two copper ions with a separation of 3.074(2) ?. Ligand imino nitroxides in 1-4 form one-dimensional radical chains, and the chains are linked with halocuprate dimer units. Structural and magnetic susceptibility data support that radicals in 1 and 4 are ferromagnetically stacked, while radicals in 2 and 3 form an antiferromagnetic chain. The magnetic behaviors are discussed in connection with the stacking modes of the radicals and bridging conformations. Crystal data (Mo Kalpha, lambda = 0.71069 ?): 1, orthorhombic, space group P2(1)2(1)2(1), a = 17.807(2) ?, b = 8.595(2) ?, c = 19.336(6) ?, and Z = 4; 2, monoclinic, space group P2(1)/c, a = 9.941(2) ?, b = 18.482(2) ?, c = 8.337(2) ?, beta = 96.41(2) degrees, and Z = 2; 3, monoclinic, space group P2(1)/c, a = 9.964(6) ?, b = 18.167(4) ?, c = 8.009(7) ?, beta = 95.81(6) degrees, and Z = 2; 4, monoclinic, space group P2(1)/c, a = 11.991(7) ?, b = 17.998(8) ?, c = 7.215(6) ?, beta = 104.07(6) degrees, and Z = 2.     

Investigations of the TeCl(4)-(t)BuNHLi Reaction: Synthesis, X-ray Structures, and Fluxional Behavior of the Tellurium-Nitrogen Compounds [Li(2)Te(N(t)Bu)(3)](2), {[LiTe(N(t)Bu)(2)(NH(t)Bu)](2)LiCl}(2), and {Te(2)(N(t)Bu)(4)[LiTe(N(t)Bu)(2)(NH(t)Bu)]LiCl}(2)

The reaction of (t)BuNHLi with TeCl(4) in toluene at -78 degrees C produces (t)BuNTe(&mgr;-N(t)Bu)(2)TeN(t)Bu (1) (55%) or [((t)BuNH)Te(&mgr;-N(t)Bu)(2)TeN(t)Bu]Cl (2) (65%) for 4:1 or 7:2 molar ratios, respectively. The complex {Te(2)(N(t)Bu)(4)[LiTe(N(t)Bu)(2)(NH(t)Bu)]LiCl}(2) (5) is obtained as a minor product (23%) from the 4:1 reaction. It is a centrosymmetric dimer in which each half consists of the tellurium diimide dimer 1 bonded through an exocyclic nitrogen atom to a molecule of LiTe(N(t)Bu)(2)(NH(t)Bu) which, in turn, is linked to a LiCl molecule. Crystals of 5 are monoclinic, of space group C2/c, with a = 27.680(6) ?, b = 23.662(3) ?, c = 12.989(2) ?, beta = 96.32(2) degrees, V = 8455(2) ?(3), and Z = 4. The final R and R(w) values were 0.046 and 0.047. At 65 degrees C in toluene solution, 5 dissociates into 1, LiCl, and {[LiTe(N(t)Bu)(2)(NH(t)Bu)](2)LiCl}(2) (4), which may also be prepared by treatment of [Li(2)Te(N(t)Bu)(3)](2) (6) with 2 equiv of HCl gas. The centrosymmetric structure of 6 consists of a distorted hexagonal prism involving two pyramidal Te(N(t)Bu)(3)(2)(-) anions linked by four Li atoms to give a Te(2)N(6)Li(4) cluster. Crystals of 6 are monoclinic, of space group P2(1)/c, with a = 10.194(2) ?, b = 17.135(3) ?, c = 10.482(2) ?, beta = 109.21(1) degrees, V = 1729.0(5) ?(3), and Z = 2. The final R and R(w) values were 0.026 and 0.023. VT (1)H and (7)Li NMR studies reveal that, unlike 1, compounds 2, 4, and 6 are fluxional molecules. Possible mechanisms for these fluxional processes are discussed.     

Molecular Assemblies Containing Unsupported [Fe(III)-(&mgr;(2):eta(2)-RCO(2))-Cu(II)] Bridges

Formate is an inhibitor of cytochrome oxidases and also effects conversion of the bovine heart enzyme from the "fast" to the "slow" cyanide-binding form. The molecular basis of these effects is unknown; one possibility is that formate inserts as a bridge into the binuclear heme a(3)-Cu(B) site, impeding the binding of dioxygen or cyanide. Consequently, Fe-Cu-carboxylate interactions are a matter of current interest. We have initiated an examination of such interactions by the synthesis of the first examples of [Fe(III)-(&mgr;(2):eta(2)-RCO(2))-Cu(II)] bridges, minimally represented by Fe(III)-L + Cu(II)-O(2)CR --> [Fe(III)-(RCO(2))-Cu(II)] + L. A series of Cu(II) precursor complexes and solvate forms have been prepared and their structures determined, including [Cu(Me(5)dien)(O(2)CH)](+) (3), [Cu(Me(5)dien)(O(2)CH)(MeOH)](+) (4), [Cu(Me(6)tren)(O(2)CH)](+) (5), and [Cu(Me(5)dien)(OAc)](+) (6). [4](ClO(4)) was obtained in monoclinic space group P2(1)/n with a = 8.166(3) ?, b = 15.119(5) ?, c = 15.070(4) ?, beta = 104.65(2) degrees, and Z = 4. [5](ClO(4))/[6](ClO(4)) crystallize in orthorhombic space groups Pnma/Pna2(1) with a = 16.788(2)/14.928(5) ?, b = 9.542(1)/9.341(4) ?, c = 12.911(1)/12.554(4) ?, and Z = 4/4. In all cases, the carboxylate ligand is terminal and is bound in a syn orientation. Also prepared for the purpose of structural comparison was [Fe(OEP)(O(2)CH)], which occurred in monoclinic space group P2(1)/c with a = 13.342(2) ?, b = 13.621(2) ?, c = 19.333(2) ?, beta = 106.12(2) degrees, and Z = 4. The desired bridges were stabilized in the assemblies [(OEP)Fe(O(2)CH)Cu(Me(5)dien)(OClO(3))](+) (9), [(OEP)Fe(OAc)Cu(Me(5)dien)](2+) (10), and {(OEP)Fe[(O(2)CH)Cu(Me(6)tren)](2)}(3+) (11), which were prepared by the reaction of 3, 6, and 5, respectively, with [Fe(OEP)(OClO(3))] in acetone or dichloromethane. [9](ClO(4))/[10](ClO(4))(2).CH(2)Cl(2) crystallize in triclinic space group P&onemacr; with a = 9.016(3)/13.777(3) ?, b = 15.377(5)/13.847(3) ?, c = 19.253(5)/17.608(4) ?, alpha = 78.12(3)/96.82(3) degrees, beta = 86.30(4)/108.06(3) degrees, gamma = 76.23(3)/114.32(3) degrees, and Z = 2/2. Each assembly contains a [Fe(III)-(RCO(2))-Cu(II)] bridge but with the differing orientations anti-anti (9) and syn-anti (10, 11). The compound [11](ClO(4))(2)(SbF(6)) occurs in orthorhombic space group Pbcn with a = 12.517(6) ?, b = 29.45(1) ?, c = 21.569(8) ?, and Z = 4. Complex 11 is trinuclear; the Fe(III) site has two axial formate ligands with bond distances indicative of a high-spin configuration. Structural features of 9-11 are discussed and are considered in relation to the possible insertion of formate into the binuclear sites of two oxidases whose structures were recently determined. The present results contribute to the series of molecular assemblies with the bridge groups [Fe(III)-X-Cu(II)], X = O(2)(-), OH(-), and RCO(2)(-), all with a common high-spin heme, thereby allowing an examination of electronic structure as dependent on the bridging atom or group and bridge structure. (Me(5)dien = 1,1,4,7,7-pentamethyldiethylenetriamine; Me(6)tren = tris(2-(dimethylamino)ethyl)amine; OEP = octaethylporphyrinate(2-).)     

Polyfluorinated Tris(pyrazolyl)borates. Syntheses and Spectroscopic and Structural Characterization of Group 1 and Group 11 Metal Complexes of [HB(3,5-(CF(3))(2)Pz)(3)](-) and [HB(3-(CF(3))Pz)(3)](-)

The fluorinated tris(pyrazolyl)borate ligands [HB(3,5-(CF(3))(2)Pz)(3)](-) and [HB(3-(CF(3))Pz)(3)](-) (where Pz = pyrazolyl) have been synthesized as their sodium salts from the corresponding pyrazoles and NaBH(4) in high yield. These sodium complexes and the related [HB(3,5-(CF(3))(2)Pz)(3)]K(DMAC) were used as ligand transfer agents in the preparation of the copper and silver complexes [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3), and [HB(3-(CF(3))Pz)(3)]AgPPh(3). Metal complexes of the fluorinated [HB(3,5-(CF(3))(2)Pz)(3)](-) ligand have highly electrophilic metal sites relative to their hydrocarbon analogs. This is evident from the formation of stable adducts with neutral oxygen donors such as H(2)O, dimethylacetamide, or thf. Furthermore, the metal compounds derived from fluorinated ligands show fairly long-range coupling between fluorines of the trifluoromethyl groups and the hydrogen, silver, or phosphorus. The solid state structures show that the fluorines are in close proximity to these nuclei, thus suggesting a possible through-space coupling mechanism. Crystal structures of the sodium adducts exhibit significant metal-fluorine interactions. The treatment of [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O) with Et(4)NBr led to [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], which contains a well-separated [Et(4)N](+) cation and the [HB(3,5-(CF(3))(2)Pz)(3)](-) anion in the solid state. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 193 K: [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O), C(15)H(6)BF(18)N(6)NaO, a = 7.992(2) ?, b = 15.049(2) ?, c = 9.934(2) ?, beta = 101.16(2) degrees, monoclinic, P2(1)/m, Z = 2; [{HB(3-(CF(3))Pz)(3)}Na(thf)](2), C(32)H(30)B(2)F(18)N(12)Na(2)O(2), a = 9.063(3) ?, b = 10.183(2) ?, c = 12.129(2) ?, alpha = 94.61(1) degrees, beta = 101.16(2) degrees, gamma = 95.66(2) degrees, triclinic, &Pmacr;1, Z = 1; [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), C(19)H(13)BCuF(18)N(7)O, a = 15.124(4) ?, b = 8.833(2) ?, c = 21.637(6) ?, beta = 105.291(14) degrees, monoclinic, P2(1)/n, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), C(33)H(19)BCuF(18)N(6)P, a = 9.1671(8) ?, b = 14.908(2) ?, c = 26.764(3) ?, beta = 94.891(1) degrees, monoclinic, P2(1)/c, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3).0.5C(6)H(14), C(36)H(26)AgBF(18)N(6)P, a = 13.929(2) ?, b = 16.498(2) ?, c = 18.752(2) ?, beta = 111.439(6) degrees, monoclinic, P2(1)/c, Z = 4; [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], C(23)H(24)BF(18)N(7), a = 10.155(2) ?, b = 18.580(4) ?, c = 16.875(5) ?, beta = 99.01(2) degrees, monoclinic, P2(1)/n, Z = 4.     

Synthesis and Characterization of Copper(II), Zinc(II), and Potassium Complexes of a Highly Fluorinated Bis(pyrazolyl)borate Ligand

Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4.     

Structural and Electrochemical Comparison of Copper(II) Complexes with Tripodal Ligands

A series of copper(II) complexes with tripodal polypyridylmethylamine ligands, such as tris(2-pyridylmethyl)amine (tpa), ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Me(1)tpa), bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), and tris((6-methyl-2-pyridyl)methyl)amine (Me(3)tpa), have been synthesized and characterized by X-ray crystallography. [Cu(H(2)O)(tpa)](ClO(4))(2) (1) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.029(7) ?, b = 9.268(2) ?, c = 17.948(5) ?, beta = 113.80(3) degrees, and Z = 4 (R = 0.061, R(w) = 0.059). [CuCl(Me(1)tpa)]ClO(4) (2) crystallized in the triclinic system, space group P&onemacr;, with a = 13.617(4) ?, b = 14.532(4) ?, c = 12.357(4) ?, alpha = 106.01(3) degrees, beta = 111.96(2) degrees, gamma = 71.61(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.037). [CuCl(Me(2)tpa)]ClO(4) (3) crystallized in the monoclinic system, space group P2(1)/n, with a = 19.650(4) ?, b = 13.528(4) ?, c = 8.55(1) ?, beta = 101.51(5) degrees, and Z = 4 (R = 0.071, R(w) = 0.050). [CuCl(Me(3)tpa)][CuCl(2)(Me(3)tpa)]ClO(4) (4) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.698(6) ?, b = 14.687(7) ?, c = 19.475(4) ?, beta = 97.13(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.038). All the Cu atoms of 1-4 have pentacoordinate geometries with three pyridyl and one tertiary amino nitrogen atoms, and a chloride or aqua oxygen atom. Nitrite ion coordinated to the Cu(II) center of Me(1)tpa, Me(2)tpa, and Me(3)tpa complexes with only oxygen atom to form nitrito adducts. The cyclic voltammograms of [Cu(H(2)O)(Me(n)()tpa)](2+) (n = 0, 1, 2, and 3) in the presence of NO(2)(-) in H(2)O (pH 7.0) revealed that the catalytic activity for the reduction of NO(2)(-) increases in the order Me(3)tpa < Me(2)tpa < Me(1)tpa < tpa complexes.     

N-Methyl-2-(methylamino)troponiminate Complexes of Tin(II), Gallium(III), and Indium(III). Syntheses of [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl Using the Tin(II) Reagent [(Me)(2)ATI](2)Sn

The N-methyl-2-(methylamino)troponimine [(Me)(2)ATI]H reacts with bis[bis(trimethylsilyl)amido]tin(II) to yield [(Me)(2)ATI](2)Sn in excellent yield. The treatment of [(Me)(2)ATI](2)Sn with GaI and InCl led to the bis(ligand)gallium(III) and -indium(III) compounds [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl. These metal complexes were characterized by elemental analysis, (1)H and (13)C NMR spectroscopy, and X-ray crystallography. All three metal adducts show fluxional behavior in solution at room temperature. [(Me)(2)ATI](2)Sn exhibits a pseudo trigonal bipyramidal structure in the solid state. The gallium and indium atoms in [(Me)(2)ATI](2)GaI and [(Me)(2)ATI](2)InCl adopt trigonal bipyramidal geometry around the metal center with the halide occupying an equatorial site. A convenient, high-yield route to [(Me)(2)ATI]H is also reported. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 183 K: [(Me)(2)ATI](2)Sn, C(18)H(22)N(4)Sn, a = 8.4347(11) ?, b = 10.5564(13) ?, c = 11.5527(11) ?, alpha = 66.931(8) degrees, beta = 73.579(9) degrees, gamma = 67.437(7) degrees, V = 863.3(2) ?(3), triclinic, space group P&onemacr;, Z = 2, R = 0.0224; [(Me)(2)ATI](2)GaI, C(18)H(22)GaIN(4), a = 12.947(2) ?, b = 9.5834(9) ?, c = 16.0132(12) ?, beta = 107.418(8) degrees, V = 1895.8(3) ?(3), monoclinic, space group P2(1)/c, Z = 4, R = 0.0214; [(Me)(2)ATI](2)InCl, C(18)H(22)ClInN(4), a = 24.337(3) ?, b = 8.004(2) ?, c = 19.339(3) ?, beta = 101.537(13) degrees, V = 3691.1(11) ?(3), monoclinic, space group C2/c, Z = 8, R = 0.0224.     

X-ray Crystallographic Study of the Ruthenium Blue Complexes [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2): Steric Interactions and the Ru-Ru "Bond Length"

X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions.     

Extensively Conjugated Dianionic Tetrathiooxalate-Bridged Copper(II) Complexes for Synthetic Metals

Using a unique three-solvent biphasic method, we have prepared and characterized three new fully conjugated, chalcogen-rich, bridged copper(II) complexes for the preparation of molecular conductors and magnetic materials, having the general formula (Bu(4)N)(2){tto[Cu(L)](2)} (tto = C(2)S(4)(2)(-) = tetrathiooxalato; L = mnt = C(4)N(2)S(2)(2)(-) = 1,2-dicyanoethene-1,2-dithiolato for complex 2, dsit = C(3)Se(2)S(3)(2)(-) = 2-thioxo-1,3-dithiole-4,5-diselenolato for complex 3, dmid = C(3)OS(4)(2)(-) = 2-oxo-1,3-dithiole-4,5-dithiolato for complex 4a). The single-crystal X-ray structures of 2 and 3 have been determined: 2, (Bu(4)N)(2){tto[Cu(mnt)](2)}, monoclinic, space group C2/m, a = 19.549(4) ?, b = 13.519(3) ?, c = 10.162(2) ?, beta = 90.33(1) degrees, Z = 2; 3, (Bu(4)N)(2){tto[Cu(dsit)](2)}, monoclinic, space group P2(1)/c, a = 9.903(1) ?, b = 15.589(1) ?, c = 18.218(1) ?, beta = 90.40(1) degrees, Z = 2. Complex 2 displays perfect planarity, while 3 shows a slight tetrahedral distortion at the metal centers, resulting in a dihedral angle of 24.86(3) degrees. Cyclic voltammetry of (Bu(4)N)(2){tto[Cu(mnt)](2)} (2), (Bu(4)N)(2){tto[Cu(dsit)](2)} (3), and (Bu(4)N)(2){tto[Cu(dmid)](2)} (4a) shows each complex to exhibit two reversible redox processes which can be attributed to {tto[Cu(L)](2)}(2)(-) right arrow over left arrow tto[Cu(L)](2)}(-) and {tto[Cu(L)](2)}(1)(-) right arrow over left arrow {tto[Cu(L)](2)}(0) couples. The structural and electronic properties of 2, 3, and 4a will be compared to those of the recently communicated analogous complex (Bu(4)N)(2){tto[Cu(dmit)](2)} (1).     

Crystal Structure and Magnetic Properties of [Cu(4-Me-3-Nit-trz)(4)](ClO(4))(2), with 4-Me-3-Nit-trz = 2-(3-[4-Methyl-1,2,4-triazolyl])-4,4,5,5-tetramethylimidazoline-1-oxyl 3-Oxide. Intra- and Intermolecular Spin Interactions

The first two transition metal compounds incorporating triazole-nitronyl-nitroxide radicals as ligands have been synthesized. These compounds are [Cu(4-Me-3-Nit-trz)(4)](ClO(4))(2) (1) and [Ni(4-Me-3-Nit-trz)(4)](ClO(4))(2) (2) with 4-Me-3-Nit-trz = 2-(3-[4-methyl-1,2,4-triazolyl])-4,4,5,5-tetramethylimidazoline-1-oxyl 3-oxide. Compound 1 crystallizes in the triclinic system, space group P&onemacr;. The lattice parameters are a = 9.742(2) ?, b = 12.214(12) ?, c = 12.981(4) ?, alpha = 67.19(4) degrees, beta = 81.48(2) degrees, and gamma = 79.24(4) degrees, with Z = 1. The structure consists of centrosymmetrical [Cu(4-Me-3-Nit-trz)(4)]](2+)cations and noncoordinated perchlorate anions. The Cu(II) ion is in an N(4)O(2) elongated tetragonal environment with two oxygen atoms of two nitroxide groups occupying the apical positions. Within the lattice the cations form infinite chains with short intermolecular contacts involving the nitronyl-nitroxide moieties of two adjacents cations. The temperature dependence of the magnetic susceptibility and the field dependence of the magnetization at 2 K have been investigated. Both intermolecular antiferromagnetic and intramolecular ferromagnetic interactions are operative. A theoretical model has been developed to interpret quantitatively the magnetic data, which allows us to determine the values of the interaction parameters.     

Magnetostructural Correlations in Bis(&mgr;(2)-phenoxide)-Bridged Macrocyclic Dinuclear Copper(II) Complexes. Influence of Electron-Withdrawing Substituents on Exchange Coupling

Macrocyclic dicopper(II) complexes derived from 2,6-di(R)formylphenols and various linking diamines are surveyed and their magnetic and structural properties assessed. For those systems with "flat" dinuclear centers and no electronic perturbations associated with electron-withdrawing ligands or ligand groups, the complexes exhibit a "straight-line" relationship between exchange integral and phenoxide bridge angle. Within the angle range 98.8-104.7 degrees, 11 complexes are included with -2J in the range 689-902 cm(-)(1). When electron-withdrawing species are present, either as ligands or as groups bound to the macrocycle itself, considerable suppression of the antiferromagnetic exchange component is observed. Single-crystal X-ray diffraction studies are reported for three complexes. [Cu(2)(L1)(H(2)O)(2)]F(2)(CH(3)OH)(2) (1) crystallized in the triclinic system, space group P&onemacr;, with a = 8.1878(5) ?, b = 9.0346(7) ?, c = 10.4048(7) ?, alpha = 103.672(6) degrees, beta = 101.163(5) degrees, gamma = 104.017(5) degrees, and Z = 1. [Cu(2)(L2)Cl(2)] [Cu(2)(L2) (H(2)O)(2)]Cl(ClO(4)).5.5H(2)O (2) crystallized in the monoclinic system, space group P2(1)/n, with a = 14.4305(5) ?, b = 24.3149(8) ?, c = 18.6584(8) ?, beta = 111.282(3) degrees, and Z = 4. [Cu(2)(L3)(H(2)O)(2)](BF(4))(2) (3) crystallized in the triclinic system, space group P&onemacr;, with a = 8.6127(4) ?, b = 8.6321(7) ?, c = 10.8430(10) ?, a = 74.390(10) degrees, beta = 86.050(10) degrees, gamma = 76.350(10) degrees, and Z = 2. Square pyramidal copper ion stereochemistries are observed in all cases, with axially coordinated halogens or water molecules. Strong antiferromagnetic exchange is observed for all complexes (-2J = 784(8) cm(-)(1), Cu-O-Cu 103.65(10) degrees (1); -2J = 801(11) cm(-)(1), Cu-O-Cu 102.4(3), 107.5(3), 102.9(3), 106.1(3) degrees (2); -2J = 689(3) cm(-)(1), Cu-O-Cu 98.8(4) degrees (3)). The presence of electron-withdrawing CN groups on the periphery of the macrocyclic ligand leads to substantially reduced antiferromagnetic exchange.