Expanding the remarkable structural diversity of uranyl tellurites: hydrothermal preparation and structures of K[UO(2)Te(2)O(5)(OH)], Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O,beta-Tl(2)[UO(2)(TeO(3))(2)], and Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2)

The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4.     

Cation-cation interactions in Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 and Cs(UO2)9U3O16(OH)5

Two novel U6+ compounds, Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 (SrFm) and Cs(UO2)9U3O16(OH)5 (CsFm), have been synthesized by mild hydrothermal reactions. The structures of SrFm (orthorhombic, C2221, a = 11.668(1), b = 21.065 (3), c = 13.273 A, V = 3532.5(1) A3, Z = 2) and CsFm (trigonal, R3c, a = 11.395(2), c = 43.722(7) A, V = 4916.7(1) A3, Z = 6) are rare examples of uranyl compounds that contain cation-cation interactions where an O atom of one uranyl ion is directly linked to another uranyl ion. Both structures are complex frameworks. SrFm contains sheets of polyhedra that are linked through cation-cation interactions with uranyl ions located between the sheets. CsFm possesses an unusually complex framework of vertex- and edge-sharing U6+ polyhedra that incorporates cation-cation interactions.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

Expanding the crystal chemistry of actinyl peroxides: open sheets of uranyl polyhedra in Na5[(UO2)3(O2)4(OH)3](H2O)13

A uranyl peroxide, Na5[(UO2)3(O2)4(OH)3](H2O)13, with an open sheet of uranyl polyhedra has been synthesized under ambient conditions and structurally characterized. The structure (orthorombic, Cmca, a = 23.632(1) A, b = 15.886(1) A, c = 13.952(1) A, V = 5237.7 A(3), and Z = 8) consists of sheets composed of two symmetrically unique uranyl (UO2)2+ ions that are coordinated equatorially by two peroxide groups and two OH(-) groups, forming distorted uranyl hexagonal bipyramids of composition (UO2)(O2)2(OH)2(4-). The uranyl bipyramids are connected into sheets with openings with dimensions 13.7 A along [010] and 15.9 A along [100]. The shortest dimension of the cavity is 8.08 A. Sheets of two-dimensionally polymerized uranyl polyhedra are the most common structural type of inorganic uranyl phases; however, such an open topology has never been observed.     

An unprecedented uranyl phosphate framework in the structure of [(UO2)3(PO4)O(OH)(H2O)2](H2O)

The new uranyl phosphate [(UO2)3(PO4)O(OH)(H2O)2](H2O) (1) with an unprecedented framework structure has been synthesized at 150 and 185 degrees C. The structure (tetragonal, P4(2)/mbc, a = 14.015(1) A, c = 13.083(2) A, V = 2575.6(4) A(3), Z = 8) contains uranyl phosphate chains composed of uranyl pentagonal and hexagonal bipyramids and phosphate tetrahedra linked by sharing of polyhedral edges. The uranyl phosphate chains are aligned both along [100] and [010] and are linked into a novel framework structure involving channels along [001]. Topologically identical chains occur linked into sheets in more than a dozen uranyl phosphate minerals, but these chains have never been observed in opposing orientations and linked into a framework as in 1.     

Sulfates of the refractory metals: crystal structure and thermal behavior of Nb2O2(SO4)3, MoO2(SO4), WO(SO4)2, and two modifications of Re2O5(SO4)2

The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.     

U(VI) uranyl cation-cation interactions in framework germanates

The isomorphous compounds NH(4)[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (1), K[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (2), Li(3)O[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (3), and Ba[(UO(6))(2)(UO(2))(9)(GeO(4))(2)] (4) were synthesized by hydrothermal reaction at 220 °C. The structures were determined using single crystal X-ray diffraction and refined to R(1) = 0.0349 (1), 0.0232 (2), 0.0236 (3), 0.0267 (4). Each are trigonal, P(3)1c. 1: a = 10.2525(5), c = 17.3972(13), V = 1583.69(16) ?(3), Z = 2; 2: a = 10.226(4), c = 17.150(9), V = 1553.1(12) ?(3), Z = 2; 3: a = 10.2668(5), c = 17.0558(11), V = 1556.94(15) ?(3), Z = 2; 4: a = 10.2012(5), c = 17.1570(12), V = 1546.23(15) ?(3), Z = 2. There are three symmetrically independent U sites in each structure, two of which correspond to typical (UO(2))(2+) uranyl ions and the other of which is octahedrally coordinated by six O atoms. One of the uranyl ions donates a cation-cation interaction, and accepts a different cation-cation interaction. The linkages between the U-centered polyhedra result in a relatively dense three-dimensional framework. Ge and low-valence sites are located within cavities in the framework of U-polyhedra. Chemical, thermal, and spectroscopic characterizations are provided.     

Crystal structure and spectroscopic characterization of K8(VO)2O(SO4)6

Red and yellow dichroistic crystals of a vanadium(V) compound, potassium (mu-oxo, di-mu-sulfato)bis(oxodisulfatovanadate), K(8)(VO)(2)O(SO(4))(6), have been obtained from the ternary catalytic model melt system K(2)S(2)O(7)[bond]K(2)SO(4)[bond]V(2)O(5). By slow cooling of the melt from 420 to 355 degrees C, crystal growth occurred, using solid V(2)O(5) crystals present in the melt as nucleation promoter. The compound crystallizes in the monoclinic space group P2(l) with a = 13.60(9) A, b = 13.93(9) A, c = 14.05(9) A, beta = 90.286(10) degrees, and Z = 2. It contains two VO(6) octahedra linked together by a mu-oxo and two mu-sulfato bridges. Furthermore, each octahedron has two monodentate sulfate ligands, making the dimeric entity coordinatively saturated. IR spectroscopy shows bands arising from V[bond]O[bond]V and V[double bond]O stretches as well as splitting of sulfate bands due to the different degrees of freedom present for different conformations of sulfate ligands. The coordination of vanadium in K(8)(VO)(2)O(SO(4))(6) is discussed in relation to the reaction mechanism of SO(2) oxidation catalysis.     

Methanesulfonates of high-valent metals: syntheses and structural features of MoO2(CH3SO3)2, UO2(CH3SO3)2, ReO3(CH3SO3), VO(CH3SO3)2, and V2O3(CH3SO3)4 and their thermal decomposition under N2 and O2 atmosphere

Oxide methanesulfonates of Mo, U, Re, and V have been prepared by reaction of MoO(3), UO(2)(CH(3)COO)(2)·2H(2)O, Re(2)O(7)(H(2)O)(2), and V(2)O(5) with CH(3)SO(3)H or mixtures thereof with its anhydride. These compounds are the first examples of solvent-free oxide methanesulfonates of these elements. MoO(2)(CH(3)SO(3))(2) (Pbca, a=1487.05(4), b=752.55(2), c=1549.61(5) pm, V=1.73414(9) nm(3), Z=8) contains [MoO(2)] moieties connected by [CH(3)SO(3)] ions to form layers parallel to (100). UO(2)(CH(3)SO(3))(2) (P2(1)/c, a=1320.4(1), b=1014.41(6), c=1533.7(1) pm, β=112.80(1)°, V=1.8937(3) nm(3), Z=8) consists of linear UO(2)(2+) ions coordinated by five [CH(3)SO(3)] ions, forming a layer structure. VO(CH(3)SO(3))(2) (P2(1)/c, a=1136.5(1), b=869.87(7), c=915.5(1) pm, β=113.66(1)°, V=0.8290(2) nm(3), Z=4) contains [VO] units connected by methanesulfonate anions to form corrugated layers parallel to (100). In ReO(3)(CH(3)SO(3)) (P1, a=574.0(1), b=1279.6(3), c=1641.9(3) pm, α=102.08(2), β=96.11(2), γ=99.04(2)°, V=1.1523(4) nm(3), Z=8) a chain structure exhibiting infinite O-[ReO(2)]-O-[ReO(2)]-O chains is formed. Each [ReO(2)]-O-[ReO(2)] unit is coordinated by two bidentate [CH(3)SO(3)] ions. V(2)O(3)(CH(3)SO(3))(4) (I2/a, a=1645.2(3), b=583.1(1), c=1670.2(3) pm, β=102.58(3), V=1.5637(5) pm(3), Z=4) adopts a chain structure, too, but contains discrete [VO]-O-[VO] moieties, each coordinated by two bidentate [CH(3)SO(3)] ligands. Additional methanesulfonate ions connect the [V(2)O(3)] groups along [001]. Thermal decomposition of the compounds was monitored under N(2) and O(2) atmosphere by thermogravimetric/differential thermal analysis and XRD measurements. Under N(2) the decomposition proceeds with reduction of the metal leading to the oxides MoO(2), U(3)O(7), V(4)O(7), and VO(2); for MoO(2)(CH(3)SO(3))(2), a small amount of MoS(2) is formed. If the thermal decomposition is carried out in a atmosphere of O(2) the oxides MoO(3) and V(2)O(5) are formed.     

Crystal structure and spectroscopic properties of Na(2)K(6)(VO)(2)(SO(4))(7)

Red-brown crystals of a new mixed alkali oxo sulfato vanadium(V) compound Na(2)K(6)(VO)(2)(SO(4))(7), suitable for X-ray determination, have been obtained from the catalytically important binary molten salt system M(2)S(2)O(7)-V(2)O(5) (M = 80% K and 20% Na). By slow cooling of a mixture with the mole fraction X(V(2)O(5)) = 0.24 from 325 degrees C, i.e., just below the liquidus temperature, to the solidus temperature of around 300 degrees C, a dark reddish amorphous phase was obtained containing crystals of the earlier described V(V)-V(IV) mixed valence compound K(6)(VO)(4)(SO(4))(8) and Na(2)K(6)(VO)(2)(SO(4))(7) described here. This compound crystallizes in the tetragonal space group P4(3)2(1)2 (No. 96) with a = 9.540(3) A, c = 29.551(5) A at 20 degrees C and Z = 4. It contains a distorted VO(6) octahedron with a short V-O bond of 1.552(6) A, a long one of 2.276(5) A trans to this, and four equatorial V-O bonds in the range 1.881(6)-1.960(6) A. The deformation of the VO(6) octahedron is less pronounced compared to that of the known oxo sulfato V(V) compounds. Each VO(3+) group is coordinated to five sulfate groups of which two are unidentately coordinated and three are bidentate bridging to neighboring VO(3+) groups. The length of the S-O bonds in the S-O-V bridges of the two unidentately coordinated sulfato groups are 1.551(6) A and 1.568(6) A, respectively, which are unusually long compared to our earlier measurements of sulfate groups in other V(III), V(IV), and V(V) compounds.     

K5(UO2)2[Si4O12(OH)]: a uranyl silicate containing chains of four silicate tetrahedra linked by SiO...HOSi hydrogen bonds

A new uranium(VI) silicate, K5(UO2)2[Si4O12(OH)], has been synthesized by a high-temperature, high-pressure hydrothermal method. It crystallizes in the orthorhombic space group Pbcm (No. 57) with a = 13.1274(7) A, b = 12.2635(7) A, c = 22.233(1) A, and Z= 8. Its structure consists of unbranched chains of four silicate tetrahedra extending along the b axis linked together via corner-sharing by UO6 tetragonal bipyramids to form a 3-D framework, which delimits intersecting channels along the c and b axes to accommodate K+ cations. A hydrogen atom is bonded to a terminal oxygen of a terminal silicate in the oligosilicate anion. Adjacent chains are linked along the b axis by hydrogen bonds. The sample shows a resonance at 14.7 ppm the 1H MAS NMR spectrum, which is assigned to the SiO...HOSi hydrogen bond. A comparison of uranyl silicate structures is made.     

Syntheses, structures, and ion-exchange properties of the three-dimensional framework uranyl gallium phosphates, Cs4[(UO2)2(GaOH)2(PO4)4].H2O and Cs[UO2Ga(PO4)2

The reaction of UO(2)(NO(3))(2).6H(2)O with Cs(2)CO(3) or CsCl, H(3)PO(4), and Ga(2)O(3) under mild hydrothermal conditions results in the formation of Cs(4)[(UO(2))(2)(GaOH)(2)(PO(4))(4)].H(2)O (UGaP-1) or Cs[UO(2)Ga(PO(4))(2)] (UGaP-2). The structure of UGaP-1 was solved from a twinned crystal revealing a three-dimensional framework structure consisting of one-dimensional (1)(infinity)[Ga(OH)(PO(4))(2)](4-) chains composed of corner-sharing GaO(6) octahedra and bridging PO(4) tetrahedra that extend along the c axis. The phosphate anions bind the UO(2)(2+) cations to form UO(7) pentagonal bipyramids. The UO(7) moieties edge-share to create dimers that link the gallium phosphate substructure into a three-dimensional (3)(infinity)[(UO(2))(2)(GaOH)(2)(PO(4))(4)](4-) anionic lattice that has intersecting channels running down the b and c axes. Cs(+) cations and water molecules occupy these channels. The structure of UGaP-2 is also three-dimensional and contains one-dimensional (1)(infinity)[Ga(PO(4))(2)](3-) gallium phosphate chains that extend down the a axis. These chains are formed from fused eight-membered rings of corner-sharing GaO(4) and PO(4) tetrahedra. The chains are in turn linked together into a three-dimensional (3)(infinity)[UO(2)Ga(PO(4))(2)](1-) framework by edge-sharing UO(7) dimers as occurs in UGaP-1. There are channels that run down the a and b axes through the framework. These channels contain the Cs(+) cations. Ion-exchange studies indicate that the Cs(+) cations in UGaP-1 and UGaP-2 can be exchanged for Ca(2+) and Ba(2+). Crystallographic data: UGaP-1, monoclinic, space group P2(1)/c, a = 18.872(1), b = 9.5105(7), c = 14.007(1) A, beta = 109.65(3)(o) , Z = 4 (T = 295 K); UGaP-2, triclinic, space group P, a = 7.7765(6), b = 8.5043(7), c = 8.9115(7) A, alpha = 66.642(1)(o), beta = 70.563(1)(o), gamma = 84.003(2)(o), Z = 2 (T = 193 K).     

Topological evolution in uranyl dicarboxylates: synthesis and structures of one-dimensional UO2(C6H8O4)(H2O)2 and three-dimensional UO2(C6H8O4)

Two novel uranyl adipates are reported as synthesized via hydrothermal treatment of uranium oxynitrate and adipic acid. One-dimensional UO(2)(C(6)H(8)O(4))(H(2)O)(2) (1) [a = 9.6306(6) A, c = 11.8125(10) A, tetragonal, P4(3)2(1)2 (No. 96), Z = 4] consists of chains of (UO(2))O(4)(H(2)O)(2) hexagonal bipyramids tethered through a linear adipic acid backbone. Three-dimensional UO(2)(C(6)H(8)O(4)) (2) [a = 5.5835(12) A, b = 8.791(2) A, c = 9.2976(17) A, alpha = 87.769(9) degrees, beta = 78.957(8) degrees, gamma = 81.365(11) degrees, triclinic, P1 (No. 2), Z = 2] is produced by decreasing the hydration level of the reaction conditions. This structure contains a previously unreported [(UO(2))(2)O(8)] building unit cross-linked into a neutral metal-organic framework topology with vacant channels.     

Synthesis and structure of Ag(6)[(UO(2))(3)O(MoO(4))(5)]: a novel sheet of triuranyl clusters and MoO(4) tetrahedra

The new uranyl molybdate Ag(6)[(UO(2))(3)O(MoO(4))(5)] (1) with an unprecedented uranyl molybdate sheet has been synthesized at 650 degrees C. The structure (monoclinic, C2/c, a = 16.4508(14) A, b = 11.3236(14) A, c = 12.4718(13) A, beta = 100.014(4)(o), V = 2337.4(4) A(3), Z = 4) contains [(UO(2))(3)O(MoO(4))(5)] sheets composed of triuranyl [(UO(2))(3)O] clusters that are connected by MoO(4) tetrahedra. The topology of the uranyl molybdate sheet in 1 represents a major departure from sheets observed in other uranyl compounds. Of the approximately 120 known inorganic uranyl compounds containing sheets of polyhedra, 1 is the only structure that contains trimers of uranyl pentagonal bipyramids that are connected only by the sharing of vertexes with other polyhedra. The sheets are parallel to (001) and are linked by Ag cations.     

Excision of uranium oxide chains and ribbons in the novel one-dimensional uranyl iodates K(2)[(UO(2))3(IO(3))(4)O(2)] and Ba[(UO(2)2(IO(3))(2)O(2)](H(2)O)

The alkali metal and alkaline-earth metal uranyl iodates K(2)[(UO(2))(3)(IO(3))(4)O(2)] and Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) have been prepared from the hydrothermal reactions of KCl or BaCl(2) with UO(3) and I(2)O(5) at 425 and 180 degrees C, respectively. While K(2)[(UO(2))(3)(IO(3))(4)O(2)] can be synthesized under both mild and supercritical conditions, the yield increases from <5% to 73% as the temperature is raised from 180 to 425 degrees C. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), however, has only been isolated from reactions performed in the mild temperature regime. Thermal measurements (DSC) indicate that K(2)[(UO(2))(3)(IO(3))(4)O(2)] is more stable than Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) and that both compounds decompose through thermal disproportionation at 579 and 575 degrees C, respectively. The difference in the thermal behavior of these compounds provides a basis for the divergence of their preparation temperatures. The structure of K(2)[(UO(2))(3)(IO(3))(4)O(2)] is composed of [(UO(2))(3)(IO(3))(4)O(2)](2)(-) chains built from the edge-sharing UO(7) pentagonal bipyramids and UO(6) octahedra. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) consists of one-dimensional [(UO(2))(2)(IO(3))(2)O(2)](2)(-) ribbons formed from the edge sharing of distorted UO(7) pentagonal bipyramids. In both compounds the iodate groups occur in both bridging and monodentate binding modes and further serve to terminate the edges of the uranium oxide chains. The K(+) or Ba(2+) cations separate the chains or ribbons in these compounds forming bonds with terminal oxygen atoms from the iodate ligands. Crystallographic data: K(2)[(UO(2))(3)(IO(3))(4)O(2)], triclinic, space group P_1, a = 7.0372(5) A, b = 7.7727(5) A, c = 8.9851(6) A, alpha = 93.386(1) degrees, beta = 105.668(1) degrees, gamma = 91.339(1) degrees, Z = 1; Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), monoclinic, space group P2(1)/c, a = 8.062(4) A, b = 6.940(3) A, c = 21.67(1), beta= 98.05(1) degrees, Z = 4.     

Unsymmetrical linear pentanuclear nickel string complexes: [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3))

The one-electron oxidized linear pentanuclear nickel complexes [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) (1) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3)) (2) have been synthesized by reacting the neutral compound [Ni(5)(tpda)(4)Cl(2)] with the corresponding silver salts. These compounds have been characterized by various spectroscopic techniques. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.3022(1) A, b = 31.0705(3) A, c = 15.8109(2) A, beta = 92.2425(4) degrees, V = 7511.49(13) A(3), Z = 4, and compound 2 crystallizes in the monoclinic space group C2/c with a = 42.1894(7) A, b = 17.0770(3) A, c = 21.2117(4) A, beta = 102.5688(8) degrees, V = 14916.1(5) A(3), Z = 8. X-ray structural studies reveal an unsymmetrical Ni(5) unit for both compounds 1 and 2. Compounds 1 and 2 show stronger Ni-Ni interactions as compared to those of the neutral compounds.     

Hydrothermal Synthesis, Crystal Structure and Luminescent Properties of an Organically Templated 2-D Uranyl Sulfate

An organically templated 2-D uranyl sulfate, {（C2H8N）[（UO2）Cl（SO4）（H2O）] }n 1, has been hydrothermally synthesized. The crystal and molecular structures have been determined by X-ray crystallography method and spectral techniques. 1 belongs to monoclinic, space group P21/c with a = 8.3545（17）, b = 10.550（2）, c = 12.370（3）A, β = 102.64（3）°, V = 1063.9（4）A3, Mr = 464.64, De= 2.901 g/cm^3, F（000） = 836,μ = 15.710 mm^-1, Z= 4, the final R = 0.0286 and wR = 0.0685 for 10164 observed reflections with Ⅰ 〉 2σ（Ⅰ）. 1 presents a two-dimensional layer-like structure constructed from infinite anionic [（UO2）Cl（H2O）（SO4）]^- layers with [C2H8N]^＋ cations balancing the charge and a number of intermoleeular hydrogen bonds （C-H…O and O-H…Cl） existing in the solid state. The fluorescence properties of 1 have also been discussed.     

Monomeric oxovanadium(IV) compounds of the general formula cis-[V(IV)(=O)(X)(L(NN))(2)](+/0) [X = OH(-), Cl(-), SO(4)(2)(-) and L(NN) = 2,2'-bipyridine (bipy) or 4,4'-disubstituted bipy

Reaction of [V(IV)OCl(2)(THF)(2)] in aqueous solution with 2 equiv of AgBF(4) or AgSbF(6) and then with 2 equiv of 2,2'-bipyridine (bipy), 4,4'-di-tert-butyl-2,2'-bipyridine (4,4'-dtbipy), or 4,4'-di-methyl-2,2'-bipyridine (4,4'-dmbipy) affords compounds of the general formula cis-[V(IV)O(OH)(L(NN))(2)]Y [where L(NN) = bipy, Y = BF(4)(-) (1), L(NN) = 4,4'-dtbipy, Y = BF(4)(-) (2.1.2H(2)O), L(NN) = 4,4'-dmbipy, Y = BF(4)(-) (3.2H(2)O), and L(NN) = 4,4'-dtbipy, Y = SbF(6)(-) (4)]. Sequential addition of 1 equiv of Ba(ClO(4))(2) and then of 2 equiv of bipy to an aqueous solution containing 1 equiv of V(IV)OSO(4).5H(2)O yields cis-[V(IV)O(OH)(bipy)(2)]ClO(4) (5). The monomeric compounds 1-5 contain the cis-[V(IV)O(OH)](+) structural unit. Reaction of 1 equiv of V(IV)OSO(4).5H(2)O in water and of 1 equiv of [V(IV)OCl(2)(THF)(2)] in ethanol with 2 equiv of bipy gives the compounds cis-[V(IV)O(OSO(3))(bipy)(2)].CH(3)OH.1.5H(2)O (6.CH(3)OH.1.5H(2)O) and cis-[V(IV)OCl(bipy)(2)]Cl (7), respectively, while reaction of 1 equiv of [V(IV)OCl(2)(THF)(2)] in CH(2)Cl(2) with 2 equiv of 4,4'-dtbipy gives the compound cis-[V(IV)OCl(4,4'-dtbipy)(2)]Cl.0.5CH(2)Cl(2) (8.0.5CH(2)Cl(2)). Compounds cis-[V(IV)O(BF(4))(4,4'-dtbipy)(2)]BF(4) (9), cis-[V(IV)O(BF(4))(4,4'-dmbipy)(2)]BF(4) (10), and cis-[V(IV)O(SbF(6))(4,4'-dtbipy)(2)]SbF(6) (11) were synthesized by sequential addition of 2 equiv of 4,4'-dtbipy or 4,4'-dmbipy and 2 equiv of AgBF(4) or AgSbF(6) to a dichloromethane solution containing 1 equiv of [V(IV)OCl(2)(THF)(2)]. The crystal structures of 2.1.2H(2)O, 6.CH(3)OH.1.5H(2)O, and 8.0.5CH(2)Cl(2) were demonstrated by X-ray diffraction analysis. Crystal data are as follows: Compound 2.1.2H(2)O crystallizes in the orthorhombic space group Pbca with (at 298 K) a = 21.62(1) A, b = 13.33(1) A, c = 27.25(2) A, V = 7851(2) A(3), Z = 8. Compound 6.CH(3)OH.1.5H(2)O crystallizes in the monoclinic space group P2(1)/a with (at 298 K) a = 12.581(4) A, b = 14.204(5) A, c = 14.613(6) A, beta = 114.88(1) degrees, V = 2369(1), Z = 4. Compound 8.0.5CH(2)Cl(2) crystallizes in the orthorhombic space group Pca2(1) with (at 298 K) a = 23.072(2) A, b = 24.176(2) A, c = 13.676(1) A, V = 7628(2) A(3), Z = 8 with two crystallographically independent molecules per asymmetric unit. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, conductivity, and CW EPR properties of these oxovanadium(IV) compounds as well as theoretical studies on [V(IV)O(bipy)(2)](2+) and [V(IV)OX(bipy)(2)](+/0) species (X = OH(-), SO(4)(2)(-), Cl(-)).     

Hydrothermal synthesis and structure of a new one-dimensional, mixed-metal U(VI) iodate, Cs(2)[(UO(2))(CrO(4))(IO(3))(2)

The reaction of the molecular transition metal iodate, Cs[CrO(3)(IO(3))], with UO(3) under mild hydrothermal conditions provides access to a new low-dimensional, mixed-metal U(VI) compound, Cs(2)[(UO(2))(CrO(4))(IO(3))(2)] (1). The structure of 1 is quite unusual and consists of one-dimensional (1)(infinity)[(UO(2))(CrO(4))(IO(3))(2)](2-) ribbons separated by Cs(+) cations. These ribbons are formed from [UO(7)] pentagonal bipyramids that contain a uranyl core, [CrO(4)] tetrahedra, and both monodentate and bridging iodate anions. Crystallographic data: 1, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4 (T = 193 K).     

Expanding the crystal chemistry of uranyl peroxides: synthesis and structures of di- and triperoxodioxouranium(VI) complexes

Four compounds containing tri- and diperoxodioxouranium(VI) complexes have been synthesized under ambient conditions and structurally characterized. The crystal structures of Na4(UO2)(O2)3(H2O)12 (monoclinic, P21/c, a=6.7883(6) A, b=16.001(2) A, c=16.562(2) A, beta=91.917(2) degrees, V=1797.9(3) A3, Z=4) and Ca2(UO2)(O2)3(H2O)9 (orthorhombic, Pbcn, a=9.576(3) A, b=12.172(3) A, c=12.314(2) A, V=1435.4(6) A3, Z=4) contain clusters of triperoxodioxouranium(VI). These clusters are bonded through a network of H bonding to H2O groups and in the Ca compound by bonds to Ca2+ cations. In the crystal structure of Na2Rb4(UO2)2(O2)5(H2O)14 (orthorhombic, Pbcm, a=6.808(2) A, b=16.888(6) A, c=23.286(8) A, V=2677.5(16) A3, Z=4), triperoxodioxouranium(VI) polyhedra share a peroxide edge, forming dimers of polyhedra of composition (UO2)2(O2)5(6-). Adjacent dimers are linked through bonding to Rb+ cations and by H bonds to H2O groups. The crystal structure of K6[(UO2)(O2)2(OH)]2(H2O)7 (orthorhombic, Pcca, a=15.078(8) A, b=6.669(4) A, c=23.526(13) A, V=2366(2) A3, Z=4) contains diperoxodioxouranium(VI) polyhedra that include two OH groups. These polyhedra share an OH-OH edge, forming dimers of composition (UO2)2(O2)4(OH)2(6-). The dimers are linked by bonds to K+ cations and by H bonding to H2O groups.