Synthesis and Crystal Structure of a Coordination Polymer [Zn（p-pdoa）（bbp）]n with a One-dimensional Helical Chain

The coordination polymer [Zn（p-pdoa）4（bbp）]n 1 （p-pdoa = p-phenylenedioxydiacetate dianion and bbp = 2,6-bis（benzimidazol-2-yl）pyridine） has been synthesized by hydrothermal method and characterized by elemental analysis, IR and X-ray single-crystal diffraction. The title complex crystallizes in the triclinic system, space group P1^- with a = 7.8383（2）, b = 12.6610（4）, c = 13.1792（5）A, a = 84.433（2）,β = 74.2980（1）, γ = 87.4290（1）°, V = 1252.93（7）A^3, Z = 2, Dc = 1.593 g/cm^3,/z = 1.038 mm^-1, F（000） = 616, the final R = 0.0361 and wR = 0.1139. The Zn（Ⅱ） atom assumes a distorted trigonal bipyramidal geometry, involving two carboxyl O atoms from two different p-pdoa ligands and three N atoms from the bbp ligand. The Zn（Ⅱ） atom is alternately interlinked by p-pdoa ligands in a bismonodentate mode into a helical chain with a long pitch of 12.661 A and the adjacent Zn…Zn distance of 11.056 and 12.245 A. There exists a 2D supramolecular framework linked by π-π stacking （3.312 A） between adjacent benzimidazoles of bbp ligands and intermolecular hydrogen-bonding interactions between the uncoordinated carboxylate oxygen atoms （O（2）, 0（5）） and the uncoordinated imidazolyl N atoms （N…O distances 2.706 and 2.786 A）. There also exist two interlayer π-π stacking interactions of 3.299 A between adjacent central pyridines of bbp ligand and 3.176 A between the phenyl groups of p-pdoa ligand. Such π-π stacking interactions extend the two-dimensional layers into a 3D supramolecular network.     

Synthesis and Structure of a La（Ⅲ） Complex of 1,10-Phenanthroline-2,9-dicarboxylate： a Three-dimensional Network via Hydrogen Bonding Interactions

A new La（Ⅲ） complex, {[La（L）（NO3）（H2O）3]·H2O}n （L = 1,10-phenanthroline- 2,9-dicarboxylate）, has been synthesized and structurally determined by X-ray diffraction analysis. The complex crystallizes in the monoclinic system, space group P21/c with a = 7.7358（17）, b = 8.1664（18）, c = 28.271（6） A, β= 95.184（4）°, V= 1778.6（7） A3, Z = 4, C14H14LaN3O11, Mr = 539.19, Dc = 2.014 g/cm^3, μ= 2.471 mm^-1, F（000） = 1056, the final R = 0.0350 and wR = 0.0659. In this complex, each metal center adopts a ten-coordination geometry formed by two N atoms from a ligand L and eight O atoms from three H2O molecules, a nitrate ion and carboxylates of two ligands. Each ligand adopts a N2,O3-pentdentate coordination mode using two N and two O atoms chelating a La（Ⅲ）, and using another O atom of carboxylate to bridge another La（Ⅲ） center resulting in a 1D helical chain molecule. Intermolecular strong O-H…O and weak C-H…O hydrogen bonds extend the 1D chain structure into a 3D supramolecular architecture.     

Synthesis and Characterization of a New Ligand 2-（4, 5-Dihydro-2-thiazolyl）-6-methoxylbenzothiazole and Its Dinuclear Co（II） Complex

A new ligand 2-(4,5-dihydro-2-thiazolyl)-6-methoxyl benzothiazole and its new dinuclear Co(II) coordination complex [Co(C11H10N2OS2)Cl2]2·2CHCl3 (1) have been synthesized and characterized. Complex 1 was synthesized by the reaction of Co(II) salt with 2-(4,5-dihydro- 2-thiazolyl)-6-methoxyl benzothiazole under room-temperature evaporation condition and struc- turally characterized by single-crystal X-ray diffraction analysis and IR spectroscopy. The supramolecular network of complex 1 is stabilized by the presence of intermolecular interaction, such as C–H···Cl hydrogen bonding and π-π stacking. The complex crystallizes in triclinic, space group P1 with a = 8.3288(12), b = 10.5273(15), c = 10.822(2), α = 93.416(3), β = 90.864(3), γ = 94.890(3)o, V = 943.60(2)3, Z = 2, Dc = 1.758 g/cm3, F(000) = 498 and μ = 1.840 mm-1. The final complex [Co(C11H10N2OS2)Cl2]2·2CHCl3 is a diplex bridged dinuclear complex consisting of two Co(II) ions, two ligands, two bridging Cl- anions and two terminal Cl- anions.     

A Novel Two-dimensional Lead(Ⅱ) Coordination Polymer Based on Dinuclear Lead(Ⅱ) Unit Containing(5-Chloro-quinolin-8-yloxy) Acetate

A novel two-dimensional lead(II) coordination polymer 1, [C11H7Cl2NO3Pb]n, has been prepared by solvothermal reaction of new bridging ligand(5-chloro-quinolin-8-yloxy)acetic acid(HL) with PbCl2, and its structure was characterized by IR, elemental analysis, TG-DTA and single-crystal X-ray diffraction analysis. The crystal is of monoclinic system, space group P21/c with a = 16.7603(7), b = 8.6907(4), c = 8.4745(3), β = 101.1110(11)°, C11H7Cl2NO3 Pb, Mr = 479.27, V = 1211.25(9)3, Z = 4, Dc = 2.628 g/cm3, F(000) = 880, μ = 14.367 mm-1, R = 0.0173 and wR = 0.0508. The asymmetric unit contains one lead(II) cation, one(5-chloro-quinolin-8-yloxy)acetate(L) ligand and a chloride ion. The PbII center is hepta-coordinated in a distorted pentagonal bipyramidal geometry. The coordination sphere of the Pb atom is completed by two oxygen atoms and one nitrogen atom of the same L ligand, two bridging chloride ions and two bridging oxygen atoms of two adjacent L ligands. Two PbII centers are linked by the two L ligands to form a C2-symmetric dimer unit with a planar [Pb2O2] ring. Each dimer unit acts as a secondary building unit(SBU) and links adjacent four dimer units by the chloride atoms and oxygen atoms of carboxylate groups of L, forming a two-dimensional array. Such two-dimensional layers are packed through intermolecular C–H···Cl hydrogen bonds into a three-dimensional supramolecular structure. When the dimer unit is viewed as a 4-connected node, 1 is simplified as a 4-nodal 2-D network with square lattices of the diagonal lengths to be 6.079(1). The fluorescence emission peak of complex 1 appears near 407 nm.     

N,N′-苄基-1,2二胺合铜的合成和晶体结构及与DNA的相互作用(英文)

A ligand,(N,N′-dibenzylethane-1,2-diamine)(L),and its complex with copper acetate was synthesized and characterized by some spectral analyses.The copper ! ion is six-coordinated and exhibites octahedral coordination geometry,the coordination atoms are four nitrogen atoms from two(L) ligands and two carboxyl oxygen atoms from two acetic acid groups,respectively.After studying the interaction of the complex with calf thymus DNA through UV and fluorescence spectra,we can find that there is a strong binding and a large affinity berween the complex and calf thymus DNA.CCDC: 649416.     

N，N′-苄基-1，2二胺合铜的合成和晶体结构及与DNA的相互作用

A ligand， (N，N′-dibenzylethane-1，2-diamine) (L)， and its complex with copper acetate was synthesized and characterized by some spectral analyses. The copper(Ⅱ) ion is six-coordinated and exhibites octahedral coordination geometry， the coordination atoms are four nitrogen atoms from two(L) ligands and two carboxyl oxygen atoms from two acetic acid groups， respectively. After studying the interaction of the complex with calf thymus DNA through UV and fluorescence spectra， we can find that there is a strong binding and a large affinity berween the complex and calf thymus DNA. CCDC: 649416.     

Synthesis and Structure of Manganese Coordinated Polymer with Regular X-shaped Cavity

A coordination polymer [Mn(IDA)2(H2o)47, (H2IDA=N-iminodiacetic acid) was synthesized and char-acterized by single crystal X-ray diffraction. The crystal belongs to the tetragonal system, the space group is P-421C with the crystal cell parameters a=0.81120(8) nm, b=0.81120(8)nm, c=0.96196(4)nm, V=0.6330(1)nm^3, Mr=355.17, R=0.0224, ωR=0.061. The four carboxylic oxygen atoms of the differentN-iminodiacetic acid ligands and two water molecules coordinate to the manganese atom. The manganeseatom is in an approximates octahedral coordination sphere. Each carboxylic acid ligand bridges two man-ganese atoms, forming two zig-zag supramolecular chains. The twisted chains construct a two-dimension lay-er structure with regularly arranged X-shaped window cavity. The three-dimension supramolecular networkis formed by coordination bonds and hydrogen bonds.     

Synthesis and Crystal Structure of a Novel 1D Magnesium （Ⅱ） Coordination Polymer Constructed by L-Cysteic Acid

A novel coordination polymer [Mg(L)(H2O)2]·H2O] (LH2=L-cysteic acid) has been synthesized and characterized by elemental analysis, IR and single-crystal X-ray diffraction.The crystal crystallizes in orthorhombic system, space group P212121, with a=5.962(3), b=11.224(6), c=13.664(7)(A), V=914.3(8) (A)3, Z=4, Mr=245.50, Dc=1.783 g/cm3,μ=0.445 mm-1,flack parameter=0.32(16), F(000)=512, the final R=0.0458 and wR=0.1172 for 1578 observed reflections with I ＞ 2σ(Ⅰ). The Mg(Ⅱ) atom shows an octahedral geometry defined by two carboxyl O atoms from two different L-cysteic acid ligands, one carboxyl O atom and one amino N atom from the adjacent ligand, and two aqua ligands. The Mg(Ⅱ) atoms are bridged by L-cysteic acid ligands, leading to a 1D infinite zigzag chain. In the structure there are extensive hydrogen bonds,through which the complex completes its 3D framework structure.     

Synthesis and Crystal Structure of a New Complex [Cu（C_（14）H_9O_3）_2（C_5H_5N）_2（C_2H_5OH）_2]

The title compound of Cu(C14H9O3)2(C5H5N)2(C2H5OH)2(1) was synthesized via the hy- drothermal reaction of CuCl2·2H2O and 9-hydroxy-fluorene-9-carboxylic acid(HHF) with pyridine, and characterized by elemental analysis and infrared spectra. The crystal belongs to triclinic, space group P1 with a = 8.8302(12), b = 10.1625(14), c = 12.2708(17), α = 86.207(2), β = 69.562(2), γ = 64.932(2)o, V = 930.3(2) 3, Z = 1, Mr = 764.30, Dc = 1.364 g/cm3, F(000) = 399, S = 1.059 and μ(MoKα) = 0.644 mm-1. The final R = 0.0459 and wR = 0.1274 for 3414 observed reflections with I 2σ(I). The copper atom is six-coordinated by two oxygen atoms from two different 9-hydroxy-fluorene-9-carboxylate ligands, two pyridine nitrogen atoms and two ethanol oxygen atoms, forming a distorted octahedral coordination geometry. The extensive O–H···O hydrogen bonding connects the molecules to form a one-dimensional chain structure. Between adjacent one-dimensional chains, a two-dimensional layered structure was formed by fluorene ring π-π packing interaction. Between the layers, a three-dimensional structure was formed through the π-π packing interaction of the pyridine ring. Moreover, the thermal stability and photoluminescent property of the complex has been investigated.     

One—dimensional Zigzag Chain Coordination Polymer [Zn（μ—phth）（imi）2]∞ Bridged by o—Phthalato

The reaction of zinc carbonate with o-phthalic acid and imidazole in an aqueous-alcohol solution led to the formation of colorless crystals of [Znμ-phthimi2]∞. Single-crystal X-ray analysis has revealed that the complex crystallizes in a monoclinic system, space group Pn with a = 8.394(2), b = 9.976(3), c = 9.959(3)A, β = 104.409(4)°, V = 807.6(4)A3, Z = 2, C14H12N4O4Zn, Mr = 365.6(5), Dc = 1.504 g/cm3, μ = 1.544 mm-1, F000 = 372, the final R = 0.0466 and wR = 0.1171 for 1834 reflections with I>2σ(I). The complex displays a zigzag infinite chain structure in which each zinc(Ⅱ)center is coordinated by two oxygen atoms and two nitrogen atoms to generate a ZnN2O2 distorted tetrahedral geometry. The neighboring zinc atoms are bridged by the o-phthalate ligand. Each chain is linked by hydrogen bonds with its neighbors to form a three-dimensional coordination polymer.     

Synthesis and Characterization of a New Symmetric Dinucleating Ligand and Its Dizinc(Ⅱ)Complex with Alkoxo and Carboxylate Bridges

<正>A novel dinuclear zinc(Ⅱ)complex[Zn_2L(μ-OAc)](PF_6)_2(CH_3OH)has been synthesized from a new symmetrical compartmental ligand HL in which the pendant arms,bearing pyridyl groups,are bridged by 1,3-diaminopropan-2-ol.X-ray crystal structure shows that the two zinc atoms reside within the adjacent ligand compartments and are bridged by the endogenous alkoxo-O from ligand and one exogenous carboxylate from acetate with a syn-syn mode.The coordination geometry of two zinc atoms is a distorted trigonal bipyramid with the pyridyl-N atoms and bridging alkoxo-O atom providing the equatorial donor set.Such coordination geometry observed in this complex is similar to that found in the dinuclear unit of phospholipase C.     

一维链状锰配位聚合物[Mn(1,5-nds)(Him)_4]_n的合成、晶体结构及热稳定性研究(英文)

The synthesis,structural characterization and thermal behavior of a novel one-dimensional manganese (Ⅱ) complex of formula [Mn(1,5-nds)(Him)4]n [1,5-nds=naphthalene-1,5-disulfonate,Him=imidazole] is reported.The complex crystallizes in the triclinic system,space group P1,with a=0.835 42(13) nm,b=0.983 45(18) nm,c= 0.987 42(19) nm,α=60.523 0(10)°,β=97.748(2)°,γ=87.189(2)° and Z=2.The 1,5-nds ligand assumes the μ2 coordination mode and interlinks Mn(Ⅱ) ions into infinite one-dimensional chain structure along [111] direction,with the adjacent Mn…Mn distance being 1.144 99(12) nm.The chains are assembled into a three-dimensional supramolecular architecture via hydrogen bonds and C-H…π interactions.IR spectra and thermal analysis data are in agreement with the crystal structure.     

Synthesis and Structure of a La(Ⅲ) Complex of 1,10-Phenanthroline-2,9-dicarboxylate:a Three-dimensional Network via Hydrogen Bonding Interactions

A new La(Ⅲ) complex, {[La(L)(NO3)(H2O)3]·H2O}n (L = 1,10-phenanthroline- 2,9-dicarboxylate), has been synthesized and structurally determined by X-ray diffraction analysis. The complex crystallizes in the monoclinic system, space group P21/c with a = 7.7358(17), b = 8.1664(18), c = 28.271(6) , β = 95.184(4)°, V = 1778.6(7)3, Z = 4, C14H14LaN3O11, Mr = 539.19, Dc = 2.014 g/cm3, μ = 2.471 mm–1, F(000) = 1056, the final R = 0.0350 and wR = 0.0659. In this complex, each metal center adopts a ten-coordination geometry formed by two N atoms from a ligand L and eight O atoms from three H2O molecules, a nitrate ion and carboxylates of two ligands. Each ligand adopts a N2,O3-pentdentate coordination mode using two N and two O atoms chelating a La(III), and using another O atom of carboxylate to bridge another La(III) center resulting in a 1D helical chain molecule. Intermolecular strong O–H···O and weak C–H···O hydrogen bonds extend the 1D chain structure into a 3D supramolecular architecture.     

Synthesis,Crystal Structure and Characterization of a New Coordination Polymer from the Self-assembly of CoCl_2 Salt and Flexible Ligand 1,3-Bis（4-pyridyl）propane

A new 1D coordination polymer [Co(bpp)3Cl2(H2O)2]n 1 (bpp = 1,3-bis(4-pyridyl)-propane) was synthesized and characterized by elemental analysis,IR spectrum and single-crystal X-ray diffraction. The crystal belongs to the orthorhombic system,space group Ibca with a = 16.569(9),b = 17.240(10),c = 27.087(16) ,V = 7738(8) 3,Z = 8,Dc = 1.306 g/cm3,Mr = 760.65,λ(MoKa) = 0.71073 ,μ = 0.623 mm1,F(000) = 3192,the final R = 0.0678 and wR = 0.2011. The Co(II) atom is coordinated in a slightly distorted octahedral CoN4Cl2 geometry by two Cl atoms in the axial positions,four N atoms from the two bridging bpp ligands and two pendant bpp ligands. The CoN4Cl2 octahedra are connected by the bridging bpp ligands to form a 1D neutral coordination polymer chain. The chains are linked by face-to-face π-π interactions between adjacent pendant bpp ligands to give rise to a 3D supramolecular architecture. The photoluminescent investigation indicates that the emission of 1 is attributed to ligand-centered emission. The variable-temperature magnetic susceptibility measurement shows weak antiferromagnetic behavior in the complex.     

Synthesis and Structural Characterization of Co( Ⅱ ) Coordination Polymer [Co(μ-phth)(imi)2]n

A new cobalt( Ⅱ ) complex [Co(μ-phth)(imi)2]n (phth = o-phthalato, imi = imidazole)has been synthesized by the reaction of CoCl2 with disodium o-phthalate and imidazole. The crystal structure of the compound has been determined by single-crystal X-ray diffraction. The crystal is of monoclinic system, space group Pn with a = 8.405(1), b = 9.995(1), c = 9.996(2) (A),β= 104.479(2),V= 813.0(2) (A)3, Dc= 1.467 g/cm3, C14H12N4O4Co, Mr= 359.21, F(000) = 366,μ = 1.079 mm-1, Z = 2, R = 0.0483 and wR = 0.1209 for 1583 observed reflections (Ⅰ＞ 2σ(Ⅰ)). In the title complex, the Co(Ⅱ) ions are bridged by o-phthalate ligands in a bidentate mode, producing a zigzag infinite chain structure. Each four-coordinated cobalt( Ⅱ ) center was coordinated by two oxygen atoms and two nitrogen atoms to give a distorted tetrahedral geometry. The chains are linked by hydrogen bonds between oxygen atoms belonging to carboxylate groups and hydrogen atoms of imidazole molecules, forming an unusual two-dimensional coordination polymer.     

Synthesis and Structure of Dibenzoyl-bissemicarbazone Neodymium(Ⅲ) Perchlorate

A new Schiff base Dibenzoyl-bissemicarbazone C15H16N6O2(L) and its complex with neodymium(Ⅲ ) perchlorate [NdL2(H2O)2](ClO4)3 were synthesized. The crystal and molecular structure of the title complex were determined by single crystal X-ray diffraction. The crystal is monoclinic and conforms to space group P. with cell constants a=10. 893(2) A, b= 12. 118(3) A , c=22. 494(5) A , β=89. 86(3)% V = 2969.19A3. The final standard deviation R=0. 0919. In the complex Nd is coordinated by four nitrogen and six oxygen atoms, of which four nitrogen and four oxygen atoms are provided by two neutral ligands L, and the other two oxygen atoms are provided by two water molecules, forming a ten-coordinated complex cation, which the perchlorate groups exist in the outer sphere. The coordination polyhedron takes a bicapped anti-square prism arrangement. That the average bond length of Nd-N is 2. 735 A indicates that the coordination of N in groups to Nd( Ⅲ ) is very weak.     

Synthesis and Crystal Structure of a Vanadium（V） Complex with 2-Hydroxy-1-naphthaldehyde Isonicotinoyl Hydrazone

The mononuclear vanadium(Ⅴ) complex with 2-hydroxyl-1-naphthaldehyde isoncotinoyl hydrazone was synthesized and characterized by single-crystal X-ray diffraction.The crystal is of monoclinic,space group P2 1/n with a = 10.3153(15),b = 7.4024(11 ),c = 24.413(4) (A),β= 101.911(2)°,V= 1824.0(5) (A)3,Z = 4,Mr = 427.28,Dc = 1.556 g/cm3,F(000) = 880,μ(MoKα) =0.591,the final R = 0.0372 and wR = 0.0926.The vanadium(Ⅴ) atom adopts a distorted square-pyramidal geometry coordinated by the tridentate ligand and two oxygen atoms.The hydrogen bonds and strong π…π stacking interactions link the complex molecules into a 3-D network structure.     

Synthesis,Crystal Structure and Antitumor Activity of a Na(Ⅰ) Coordination Polymer Based on 2-Propyl-4,5-imidazoledicarboxylic Acid and 1,10-Phenanthroline Ligands

A new Na(I) coordination polymer, [Na2(Hpimdc)(H2 pimdc)(phen)2]n(1), has been synthesized by the reaction of NaOH with 2-propyl-4,5-imidazoledicarboxylic acid(H3 pimdc)and 1,10-phenanthroline(phen). The Na(I) coordination polymer 1 was characterized by single-crystal X-ray diffraction analysis and elemental analysis. In 1, the bridged ligand H3 pimdc adopts two modes(singly deprotonated and doubly deprotonated) to coordinate with the Na(I) ion.The Na(1) ion is six-coordinated with three N atoms from a phen ligand and a H2 pimdc ligand,three O atoms from a Hpimdc ligand and two other different H2 pimdc ligands. The Na(2) ion is also six-coordinated with three N atoms from a phen ligand and a Hpimdc ligand, three O atoms from a H2 pimdc ligand and other two different Hpimdc ligands. Complex 1 exhibits a 1 D chain structure built up by μ-H2 pimdc-and μ-Hpimdc2-ligands. The antitumor activities of complex 1 against human SGC7901, A549 and H08910 cells have been tested.     

Syntheses and Characterization of Half—Sandwich Zirconium Complexes with Dichalcogenolate o—Carborane Ligands

Metallocene complex Cp2^ttZrCl2(Cp^tt=η^5-1,3-^tBu2C5H3)(1)has been prepared from the reaction of LiCp^tt with ZrCl4 in good yield.Reactions of 1 with dilithium dichalcogenolate o-carboranes afforded new type of half-sandwich compounds with dichalcogenolate o-carboranyl ligands,[Li(THF)4][Cp^ttZr(E2C2B10H10)2](E=S,2a;E=Se,2b)in which only one cyclopentadienyl ring ligand existed.Complexes 1 and 2a were structurally characterized by X-ray analyses.In complex 2a,the Zr(IV)ion is η^5-bound to one 1,3-ditert-cyclopentadienyl ring and σ-bound to four μ2-sulfur atoms of two dithio-carboranes.the zirconium atom and four sulfur atoms form a distorted pyramid.The coordination sphere around the zirconium atom resembles in a piano stool structure with four legs of sulfur stoms and the fulcrum at the zirconium stom.     

Synthesis,Crystal Structure and Properties of a New Zn(II) Coordination Polymer Constructed from 2,3-Pyridine Dicarboxylic Acid and 1,1′-(1,4-Butanediyl)bis(imidazole)

A new coordination polymer, namely [Zn(pdc)(bbi)]n {H2 pdc = 2,3-pyridine dicar- boxylic acid, bbi = 1,1-(1,4-butanediyl)bis(imidazole)}, has been prepared under hydrothermal conditions and characterized by elemental analysis, IR, and single-crystal X-ray diffraction. It crystallizes in monoclinic, space group P21 /n with a = 8.436(3), b = 16.988(5), c = 12.106(4), β = 92.204(5)°, V = 1733.6(9)3, Z = 4, C17 H17 N5 O4 Zn, Mr = 420.73, Dc = 1.612 g/cm3, F(000) = 864, μ(MoKa) = 0.452 mm-1, the R = 0.0672 and wR = 0.1645. In the mononuclear complex, each Zn(II) is five-coordinated by one carboxylate O and one pyridyl N atoms from one pdc anion, one carboxylate O atom from another pdc anion, and two N atoms from two bib ligands. The Zn(II) ions are connected by pdc ligands to form skeleton chains, and bbi ligands further link them to construct a 2D framework. The thermal and luminescence properties of the complex were also investigated.