A new noncentrosymmetric vanadoborate: synthesis, crystal structure and characterization of K2SrVB5O12

A new noncentrosymmetric vanadoborate compound, K(2)SrVB(5)O(12), is synthesized by the high temperature solution method. It crystallizes in the monoclinic space group P2(1) (no. 4) with lattice constants a = 6.618(3) ?, b = 8.378(4) ?, c = 9.974(5) ?, β = 99.789(6)°, Z = 2. The structure consists of vanadoborate anionic layers with K(+) and Sr(2+) cations filling the void spaces via electrostatic interactions to form the three-dimensional network. The TG-DSC curves and the UV-Vis-NIR diffuse reflectance spectrum were measured. Band structures and density of states were calculated. The powder second harmonic generation (SHG) effect of K(2)SrVB(5)O(12) is similar to that of KH(2)PO(4) (KDP).     

Contribution of disulfide S2(2-) anions to the crystal and electronic structures in ternary sulfides, Ba12In4S19, Ba4M2S8 (M=Ga, In)

Three semiconducting ternary sulfides have been synthesized from the mixture of elements with about 20% excess of sulfur (to establish oxidant rich conditions) by solid-state reactions at high temperature. Ba(12)In(4)S(19) ≡ (Ba(2+))(12)(In(3+))(4)(S(2-))(17)(S(2))(2-), 1, crystallizes in the trigonal space group R ?3 with a = 9.6182(5) ?, b = 9.6182(5) ?, c = 75.393(7) ?, and Z = 6, with a unique long period-stacking structure of a combination of monometallic InS(4) tetrahedra, linear dimeric In(2)S(7) tetrahedra, disulfide S(2)(2-) anions, and isolated sulfide S(2-) anions that is further enveloped by Ba(2+) cations. Ba(4)In(2)S(8) ≡ (Ba(2+))(4)(In(3+))(2)(S(2-))(6)(S(2))(2-), 2, crystallizes in the triclinic space group P ?1? with a = 6.236(2) ?, b = 10.014(4) ?, c = 13.033(5) ?, α = 104.236(6)°, β = 90.412(4)°, γ = 91.052(6)°, and Z = 2. Ba(4)Ga(2)S(8) ≡ (Ba(2+))(4)(Ga(3+))(2)(S(2-))(6)(S(2))(2-), 3, crystallizes in the monoclinic P2(1)/c with a = 12.739(5) ?, b = 6.201(2) ?, c = 19.830(8) ?, β = 104.254(6)° and Z = 4. Compounds 2 and 3 represent the first one-dimensional (1D) chain structure in ternary Ba/M/S (M = In, Ga) systems. The optical band gaps of 1 and 3 are measured to be around 2.55 eV, which agrees with their yellow color and the calculation results. The CASTEP calculations also reveal that the disulfide S(2)(2-) anions in 1-3 contribute mainly to the bottom of the conduction bands and the top of valence bands, and thus determine the band gaps.     

New quaternary tellurite and selenite: synthesis, structure, and characterization of centrosymmetric InVTe2O8 and noncentrosymmetric InVSe2O8

Two new quaternary mixed metal oxide materials--InVTe(2)O(8) and InVSe(2)O(8)--have been synthesized, as crystals and pure bulk powders by standard solid-state reactions using In(2)O(3), V(2)O(5), and TeO(2) (or SeO(2)) as reagents. The crystal structures of the reported materials were determined using single-crystal X-ray diffraction. InVTe(2)O(8) crystallizes in the monoclinic centrosymmetric space group P2(1)/n (No. 14), with unit-cell parameters of a = 7.8967(16) ?, b = 5.1388(10) ?, c = 16.711(3) ?, β = 94.22(3)°, and Z = 4, and InVSe(2)O(8) crystallizes in the noncentrosymmetric space group Pm (No. 6) with unit-cell parameters of a = 4.6348(9) ?, b = 6.9111(14) ?, c = 10.507(2) ?, β = 97.77(3)°, and Z = 2. While the centrosymmetric InVTe(2)O(8) shows a two-dimensional (2D) layered structure composed of InO(6) octahedra, VO(4) tetrahedra, and TeO(4) polyhedra, the noncentrosymmetric InVSe(2)O(8) exhibits a three-dimensional (3D) framework structure with distorted InO(6) octahedra, VO(5) square pyramids, and SeO(3) polyhedra. Powder second-harmonic generation (SHG) measurements on InVSe(2)O(8), using 1064-nm radiation, indicate that the material has a SHG efficiency ~30 times that of α-SiO(2). Additional SHG measurements reveal that the material is not phase-matchable (Type 1). Infrared, ultraviolet-visible light (UV-vis) diffuse reflectance, and thermogravimetric analyses for the two compounds are also presented, as are dipole moment calculations.     

Mercuric ionic liquids: [C(n)mim][HgX3], where n = 3, 4 and X = Cl, Br

A series of mercury(II) ionic liquids, [C(n)mim][HgX(3)], where [C(n)mim] = n-alkyl-3-methylimidazolium with n = 3, 4 and X = Cl, Br, have been synthesized following two different synthetic approaches, and structurally characterized by means of single-crystal X-ray structure analysis ([C(3)mim][HgCl(3)] (1), Cc (No. 9), Z = 4, a = 16.831(4) ?, b = 10.7496(15) ?, c = 7.4661(14) ?, β = 105.97(2)°, V = 1298.7(4) ?(3) at 298 K; [C(4)mim][HgCl(3)] (2), Cc (No. 9), Z = 4, a = 17.3178(28) ?, b = 10.7410(15) ?, c = 7.4706(14) ?, β = 105.590(13)°, V = 1338.5(4) ?(3) at 170 K; [C(3)mim][HgBr(3)] (3), P2(1)/c (No. 14), Z = 4, a = 10.2041(10) ?, b = 10.7332(13) ?, c = 14.5796(16) ?, β = 122.47(2)°, V = 1347.2(3) ?(3) at 170 K; [C(4)mim][HgBr(3)] (4), Cc (No. 9), Z = 4, a = 17.093(3) ?, b = 11.0498(14) ?, c = 7.8656(12) ?, β = 106.953(13)°, V = 1421.1(4) ?(3) at 170 K). Compounds 1, 2, and 4 are isostructural and are characterized by strongly elongated trigonal [HgX(5)] bipyramids, which are connected via common edges in chains. In contrast, 3 contains [Hg(2)Br(6)] units formed by two edge-sharing tetrahedra. With melting points of 69.3 °C (1), 93.9 °C (2), 39.5 °C (3), and 58.3 °C (4), all compounds qualify as ionic liquids. 1, 2, and 4 solidify upon fast cooling as glasses, whereas 3 crystallizes. Cyclic voltammetry shows two separate, quasi-reversible redox processes, which can be associated with the 2Hg(2+)/Hg(2)(2+) and Hg(2)(2+)/2Hg redox couples.     

Crystal structure and magnetic properties of two new antiferromagnetic spin dimer compounds; FeTe3O7X (X = Cl, Br)

Two new isostructural layered oxohalides FeTe(3)O(7)X (X = Cl, Br) were synthesized by chemical vapor transport reactions, and their crystal structures and magnetic properties were characterized by single-crystal X-ray diffraction, Raman spectroscopy, magnetic susceptibility and magnetization measurements, and also by density functional theory (DFT) calculations of the electronic structure and the spin exchange parameters. FeTe(3)O(7)X crystallizes in the monoclinic space group P2(1)/c with the unit cell parameters a = 10.7938(5), b = 7.3586(4), c = 10.8714(6) ?, β = 111.041(5)°, Z = 4 for FeTe(3)O(7)Cl, and a = 11.0339(10), b = 7.3643(10), c = 10.8892(10) ?, β = 109.598(10)°, Z = 4 for FeTe(3)O(7)Br. Each compound has one unique Fe(3+) ion coordinating a distorted [FeO(5)] trigonal bipyramid. Two such groups share edges to form [Fe(2)O(8)] dimers that are isolated from each other by Te(4+) ions. The high-temperature magnetic properties of the compounds as well as spectroscopic investigations are consistent with an isolated antiferromagnetic spin dimer model with almost similar spin gaps of ~35 K for X = Cl and Br, respectively. However, deviations at low temperatures in the magnetic susceptibility and the magnetization data indicate that the dimers couple via an interdimer coupling. This interpretation is also supported by DFT calculations which indicate an interdimer exchange which amounts to 25% and 10% of the intradimer exchange for X = Cl and Br, respectively. The magnetic properties support the counterion character and a weak integration of halide ions into the covalent network similar to that in many other oxohalides.     

Hydrothermal synthesis and crystal structure of two new hydrated alkaline earth metal borates Sr3B6O11(OH)2 and Ba3B6O11(OH)2

Two new hydrated borates Sr(3)B(6)O(11)(OH)(2) (1) and Ba(3)B(6)O(11)(OH)(2) (2) were hydrothermally synthesized. Their structures were determined by single-crystal X-ray diffraction and further characterized by IR, powder XRD, and DSC/TGA. Compound 1 crystallizes in the triclinic space group P-1 with unit cell parameters of a = 6.6275(13) ?, b = 6.6706(13) ?, c = 11.393(2) ?, α = 91.06(3)°, β = 94.50(3)°, and γ = 93.12(3)°, while compound 2 crystallizes in the noncentrosymmetric monoclinic space group Pc with a = 6.958(14) ?, b = 7.024(14) ?, c = 11.346(2) ?, and β = 90.10(3)°. In spite of the differences in symmetry and packing of the borate chains, both structures consist of the same fundamental building block (FBB) of a [B(6)O(11)(OH)(2)](-6) unit and three unique alkaline earth metal atoms.     

Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

Solid-state photoluminescence sensitization of Tb3+ by novel Au2Pt2 and Au2Pt4 cyanide clusters

The syntheses are reported for two novel Tb(3+) heterotrimetallic cyanometallates, K(2)[Tb(H(2)O)(4)(Pt(CN)(4))(2)]Au(CN)(2)·2H(2)O (1) and [Tb(C(10)N(2)H(8))(H(2)O)(4)(Pt(CN)(4))(Au(CN)(2))]·1.5C(10)N(2)H(8)·2H(2)O (2) (C(10)N(2)H(8) = 2,2'-bipyridine). Both compounds have been isolated as colorless crystals, and single-crystal X-ray diffraction has been used to investigate their structural features. Crystallographic data (MoKα, λ = 0.71073 ?, T = 290 K): 1, tetragonal, space group P4(2)/nnm, a = 11.9706(2) ?, c = 17.8224(3) ?, V = 2553.85(7) ?(3), Z = 4; 2, triclinic, space group P1, a = 10.0646(2) ?, b = 10.7649(2) ?, c = 17.6655(3) ?, α = 101.410(2)°, β = 92.067(2)°, γ = 91.196(2)°, V = 1874.14(6) ?(3), Z = 2. For the case of 1, the structure contains Au(2)Pt(4) hexameric noble metal clusters, while 2 includes Au(2)Pt(2) tetrameric clusters. The clusters are alike in that they contain Au-Au and Au-Pt, but not Pt-Pt, metallophilic interactions. Also, the discrete clusters are directly coordinated to Tb(3+) and sensitize its emission in both solid-state compounds, 1 and 2. The Photoluminescence (PL) spectra of 1 show broad excitation bands corresponding to donor groups when monitored at the Tb(3+) ion f-f transitions, which is typical of donor/acceptor energy transfer (ET) behavior in the system. The compound also displays a broad emission band at ～445 nm, assignable to a donor metal centered (MC) emission of the Au(2)Pt(4) clusters. The PL properties of 2 show a similar Tb(3+) emission in the visible region and a lack of donor-based emission at room temperature; however, at 77 K a weak, broad emission occurs at 400 nm, indicative of uncoordinated 2,2'-bipyridine, along with strong Tb(3+) transitions. The absolute quantum yield (QY) for the Tb(3+) emission ((5)D(4) → (7)F(J (J = 6-3))) in 1 is 16.3% with a lifetime of 616 μs when excited at 325 nm. In contrast the weak MC emission at 445 nm has a quantum yield of 0.9% with a significantly shorter lifetime of 0.61 μs. For 2 the QY value decreases to 9.3% with a slightly shorter lifetime of 562 μs. The reduced QY in 2 is considered to be a consequence of (1) the slightly increased donor-acceptor excited energy gap relative to the optimal gap suggested for Tb(3+) and (2) Tb(3+) emission quenching via a bpy ligand-to-metal charge transfer (LMCT) excited state.     

H(x)TeV9O28]((5-x)-) (x=1 and 2): vanadotellurates with decavanadate structure

Two new vanadotellurates, [HTeV(9)O(28)](4-) and [H(2)TeV(9)O(28)](3-) have been synthesized and structurally characterized as tetra-n-butylammonium (TBA) salts: TBA(4)[HTeV(9)O(28)]·2CH(3)CN [triclinic, space group P ?1, a = 16.7102(6) ?, b = 17.4680(7) ?, c = 17.9634(7) ?, α = 74.412(1)°, β = 67.494(1)°, γ = 74.160(2)°, Z = 2] and TBA(3)[H(2)TeV(9)O(28)] [monoclinic, space group P2(1)/c, a = 13.0013(5) ?, b = 19.157(1) ?, c = 28.453(1) ?, β = 97.222(2)°, Z = 4]. The results of the structural analyses indicate that the four O atoms that bridge two V atoms on the Te side are the most basic ones in the structure. The results of density-functional theory (DFT) calculations support this view.     

Unusual nitro-coordination of europium(iii) and terbium(iii) with pyridinyl ligands

A new ligand family based on picoline, bipyridine and terpyridine containing a nitro moiety has been synthesized and its coordination and sensitization ability for lanthanide ions has been studied. Three new complexes were characterized by X-ray single crystal diffraction and all three show uncommon coordination of the nitro moiety to the lanthanide ion. , a terpyridine-nitro derivative with Tb(NO(3))(3), crystallizes in the orthorhombic space group Pbca with a = 15.125(3), b = 13.776(3), c = 18.716(4) ?, and V = 3899.8(13) ?(3) and is isostructural with its Eu(iii) analog () with cell parameters a = 15.1341(4), b = 13.7070(4), c = 18.8277(5) ?. , a tripodal amine with a nitro-derivatized pyridine with Eu(CF(3)SO(3))(3), crystallizes in the triclinic space group P1[combining macron] with a = 11.067(2), b = 11.633(2), c = 12.772(3) ?, α = 110.94(3), β = 97.49(3), γ = 91.42(3)° and V = 1518.1(5) ?(3). Finally, ligand , a bipyridine-nitro derivative, crystallizes in the orthorhombic space group P2(1)/n with a = 3.7128(3), b = 11.7806(8), c = 19.9856(14) ?, β = 92.925(2)° and V = 873.01(11) ?(3). All four ligands show sensitization of Eu(iii) and Tb(iii) luminescence.     

Aluminosilicate relatives: Chalcogenoaluminogermanates Rb(3)(AlQ(2))(3)(GeQ(2))(7) (Q = S, Se)

The new compounds Rb(3)(AlQ(2))(3)(GeQ(2))(7) [Q = S (1), Se (2)] feature the 3D anionic open framework [(AlQ(2))(3)(GeQ(2))(7)](3-) in which aluminum and germanium share tetrahedral coordination sites. Rb ions are located in channels formed by the connection of 8, 10, and 16 (Ge/Al)S(4) tetrahedra. The isostructural sulfur and selenium derivatives crystallize in the space group P2(1)/c. 1: a = 6.7537(3) ?, b = 37.7825(19) ?, c = 6.7515(3) ?, and β = 90.655(4)°. 2: a = 7.0580(5) ?, b = 39.419(2) ?, c = 7.0412(4) ?, β = 90.360(5)°, and Z = 2 at 190(2) K. The band gaps of the congruently melting chalcogenogermanates are 3.1 eV (1) and 2.4 eV (2).     

Structures of vanadium(III)-ethylenediamine-N,N'-diacetato-N,N'-di-3-propionato complexes. Critical role of pπ-dπ donation in determining the coordination number

Li[V(eddadp)]·3H(2)O (1a) and Cs[V(eddadp)]·2H(2)O (1b) were characterized by X-ray crystallography. 1a crystallizes in the monoclinic space group Cc with a = 11.467(7) ?, b = 13.398(8) ?, c = 12.529(8) ?, β = 114.85(4)°; V = 1746.7(2) ?(3), and Z = 4; 1b crystallizes in the monoclinic space group P2(1)/n with a = 10.265(5) ?, b = 11.673(6) ?, c = 15.507(8) ?, β = 104.29(2)°, V = 1800.6(2) ?(3), and Z = 4. The solution structure of 1 has been ascertained to be predominantly six-coordinated with a hexadentate eddadp which is based on a comparison of the electronic and Raman spectra of aqueous solutions of 1 with those in the solid state.     

Syntheses and crystal structures of two new bismuth hydroxyl borates containing [Bi2O2]2+ layers: Bi2O2[B3O5(OH)] and Bi2O2[BO2(OH)

Two new bismuth hydroxyl borates, Bi(2)O(2)[B(3)O(5)(OH)] (I) and Bi(2)O(2)[BO(2)(OH)] (II), have been synthesized under hydrothermal conditions. Their structures were determined by single-crystal and powder X-ray diffraction data, respectively. Compound I crystallizes in the orthorhombic space group Pbca with the lattice constants of a = 6.0268(3) ?, b = 11.3635(6) ?, and c = 19.348(1) ?. Compound II crystallizes in the monoclinic space group Cm with the lattice constants of a = 5.4676(6) ?, b = 14.6643(5) ?, c = 3.9058(1) ?, and β = 135.587(6)°. The borate fundamental building block (FBB) in I is a three-ring unit [B(3)O(6)(OH)](4-), which connects one by one via sharing corners, forming an infinite zigzag chain along the a direction. The borate chains are further linked by hydrogen bonds, showing as a borate layer within the ab plane. The FBB in II is an isolated [BO(2)(OH)](2-) triangle, which links to two neighboring FBBs by strong hydrogen bonds, resulting in a borate chain along the a direction. Both compounds contain [Bi(2)O(2)](2+) layers, and the [Bi(2)O(2)](2+) layers combine with the corresponding borate layers alternatively, forming the whole structures. These two new bismuth borates are the first ones containing [Bi(2)O(2)](2+) layers in borates. The appearance of Bi(2)O(2)[BO(2)(OH)] (II) completes the series of compounds Bi(2)O(2)[BO(2)(OH)], Bi(2)O(2)CO(3), and Bi(2)O(2)[NO(3)(OH)] and the formation of Bi(2)O(2)[B(3)O(5)(OH)] provides another example in demonstrating the polymerization tendency of borate groups.     

Crystal Structure and Electrochemical Behavior of Copper Complex with 6-Hydroxymethyl-substituted Tris（2-pyridylmethyl） Amine, [CuCl（C19H20N4O）]ClO4

1 INTRODUCTION The copper plays an important role in metallo-proteins involved in significant electron transfer andoxygenation reactions[1]. Various model complexesfor such enzymes have been synthesized and the re-activity to oxygen been investigated…     

Syntheses, crystal structures and characterizations of two new quaternary thioborates: PbMBS4 (M = Sb, Bi)

Two new quaternary thioborates, PbSbBS(4) and PbBiBS(4), have been synthesized from solid-state reaction methods at temperatures from 1073 to 1123 K in evacuated sealed quartz tubes. The crystal structures have been determined by means of single crystal X-ray diffraction and they both crystallize in the P2(1)/m space group of the monoclinic system with a = 5.9532(18) ?, b = 6.2031(13) ?, c = 9.250(3) ?, β = 108.200(16)°, Z = 2 for PbSbBS(4) and a = 5.971(10) ?, b = 6.273(9) ?, c = 9.132(15) ?, β = 107.75(2)°, Z = 2 for PbBiBS(4), respectively. The two compounds are isostructural and both constructed with the infinite one-dimensional [MBS(4)](2-) (M = Sb or Bi) chains as building blocks, which are composed of [BS(3)](3-) trigonal plane units with [MS(3)](3-) (M = Sb or Bi) trigonal pyramids connected alternatively through corner-sharing along the crystallographic b axis. Two adjacent [MBS(4)](2-) chains are further bridged by the intermediate Pb(2+) cations, forming a novel S-shaped Pb-[MBS(4)] dimeric chain structure. In addition, first-principles electronic structure calculations based on the density functional theory (DFT) were performed on compound PbSbBS(4), indicating that the compound belongs to direct semiconductor with a band gap of 1.803 eV, which is in good agreement with the experimental value estimated from the UV-Vis diffuse reflectance spectroscopy.     

Sulfates of the refractory metals: crystal structure and thermal behavior of Nb2O2(SO4)3, MoO2(SO4), WO(SO4)2, and two modifications of Re2O5(SO4)2

The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.     

Two novel acentric borate fluorides: M3B6O11F2 (M = Sr, Ba)

Two novel, noncentrosymmetric borate fluorides, Sr(3)B(6)O(11)F(2) and Ba(3)B(6)O(11)F(2), have been synthesized hydrothermally and their structures determined. The compounds are isostructural, crystallizing in space group P2(1), having lattice parameters of a = 6.4093 (13) ?, b = 8.2898 (17) ?, c = 9.3656 (19) ?, and β = 101.51 (3)° for Sr(3)B(6)O(11)F(2) and a = 6.5572 (13) ?, b = 8.5107 (17) ?, c = 9.6726 (19) ?, and β = 101.21 (3)° for Ba(3)B(6)O(11)F(2). The structure consists of a complex triple-ring borate framework having aligned triangular [BO(3)] groups that impart polarity. Fluorine atoms are bound only to the alkaline-earth metals and are not part of the borate framework, resulting in a vastly different structure from those of the hydrated borates Sr(3)B(6)O(11)(OH)(2) and Ba(3)B(6)O(11)(OH)(2) with similar formulas. The title compounds are transparent to nearly 200 nm, making them potentially useful for deep-ultraviolet nonlinear-optical applications.     

Two new neptunyl(V) selenites: a novel cation-cation interaction framework in (NpO2)3(OH)(SeO3)(H2O)2 3H2O and a uranophane-type sheet in Na(NpO2)(SeO3)(H2O)

Dark green crystals of (NpO(2))(3)(OH)(SeO(3))(H(2)O)(2)·H(2)O (1) have been prepared by a hydrothermal reaction of neptunyl(V) and Na(2)SeO(4) in an aqueous solution at 150 °C, while green plates of Na(NpO(2))(SeO(3))(H(2)O) (2) have been synthesized by evaporation of a solution of neptunyl(V), H(2)SeO(4), and NaOH at room temperature. Both compounds have been characterized by single-crystal X-ray diffraction. The structure of compound contains three crystallographically unique Np atoms that are bonded to two O atoms to form a nearly linear O═Np═O NpO(2)(+) cation. Neighboring Np(5+) ions connect to each other through a bridging oxo ion from the neptunyl unit, a configuration known as cation-cation interactions (CCIs), to build a complex three-dimensional network. More specifically, each Np(1)O(2)(+), Np(2)O(2)(+), and Np(3)O(2)(+) cation is involved in three, five, and four CCIs with other units, respectively. The framework of neptunyl(V) pentagonal bipyramids is decorated by selenite trigonal pyramids with one-dimensional open channels where uncoordinated waters are trapped via hydrogen bonding interactions. Compound adopts uranophane-type [(NpO(2))(SeO(3))](-) layers, which are separated by Na(+) cations and water molecules. Within each layer, neptunyl(V) pentagonal bipyramids share equatorial edges with each other to form a single chain that is further connected by both monodentate and bidentate selenite trigonal pyramids. Crystallographic data: compound, monoclinic, P2(1)/c, Z = 4, a = 6.6363(8) ?, b = 15.440(2) ?, c = 11.583(1) ?, β = 103.549(1)°, V = 1153.8(2) ?(3), R(F) = 0.0387 for I > 2σ(I); compound (2), monoclinic, C2/m, Z = 4, a = 14.874(4) ?, b = 7.271(2) ?, c = 6.758(2) ?, β = 112.005(4)°, V = 677.7(3) ?(3), R(F) = 0.0477 for I > 2σ(I).     

Spectroscopic and magnetic properties of a series of μ-cyano bridged bimetallic compounds of the type M(II)-NC-Fe(III) (M = Mn, Co, and Zn) using the building block [Fe(III)(CN)5imidazole]2-

In this contribution, we describe the preparation and single-crystal X-ray diffraction of a new building block for bimetallic solid state materials. X-ray diffraction data of these complexes indicate that (PPh(4))(2)[Fe(CN)(5)imidazole]·2H(2)O crystallizes in the triclinic space group P1 with a = 9.8108(15) ?, b = 11.1655(17) ?, c = 23.848(4) ?, α = 87.219(2)°, β = 85.573(2)°, γ = 70.729(2)°, and Z = 2, while its precursor Na(3)[Fe(CN)(5)(en)]·5H(2)O crystallizes in the monoclinic space group P2(1)/n with a = 8.3607(7) ?, b = 11.1624(9) ?, c = 17.4233(14) ?, β = 90.1293(9)°, and Z = 4. Spectroscopic and magnetic properties of a series of bimetallic materials were obtained by reaction of the complex [Fe(CN)(5)imidazole](2-) with hydrated transition metal ions [M(H(2)O)(n)](2+) (M = Mn, Co, Zn; n = 4 or 6). The new bimetallic materials obtained are [Co(H(2)O)(2)][Fe(CN)(5)imidazole]·2H(2)O (1), [Mn(CH(3)OH)(2)][Fe(CN)(5)imidazole] (2), Zn[Fe(CN)(5)imidazole]·H(2)O (3), and [Mn(bpy)][Fe(CN)(5)imidazole].H(2)O (4). All of the complexes crystallize in the orthorhombic system. X-ray single-crystal analysis of the compounds identified the Imma space group with a = 7.3558(10) ?, b = 14.627(2) ?, c = 14.909(2) ?, and Z = 4 for 1; the P2(1)2(1)2(1) space group with a = 7.385(5) ?, b = 13.767(9) ?, c = 14.895(10) ?, and Z = 4 for 2; the Pnma space group with a = 13.783(2) ?, b = 7.167(11) ?, c = 12.599(2) ?, and Z = 4 for 3; and the Pnma space group with a = 13.192(3) ?, b = 7.224(16) ?, c = 22.294(5) ?, and Z = 4 for 4. The structures of 1, 2, and 4 consist of two-dimensional network layers containing, as the repeating unit, a cyclic tetramer [M(2)Fe(2)(CN)(4)] (M = Mn, Co). H bonding between the layers in the structure of 1 results in a quasi-three-dimensional network. The structure of 3 was found to be three-dimensional, where all of the cyano ligands are involved in bridging between the metal centers. The bridging character of the cyano is confirmed spectroscopically. The magnetic properties have been investigated for all of the bimetallic systems. Compound 1 shows ferromagnetic behavior with an ordering temperature at 25 K, which is higher than the corresponding Prussian Blue analogue Co(x)[Fe(CN)(6)](y)?·zH(2)O. Compound 2 shows weak ferromagnetic behavior and an interlayer antiferromagnetic character, while 3, as expected, shows paramagnetic character due to the diamagnetic character of Zn(2+). Compound 4 shows antiferromagnetic behavior.     

Palladium(II)-substituted tungstosilicate [Cs2K(H2O)7Pd2WO(H2O)(A--SiW9O34)2]9-

The palladium(II)-substituted tungstosilicate [Cs(2)K(H(2)O)(7)Pd(2)WO(H(2)O)(A-alpha-SiW(9)O(34))(2)](9)(-) (1) has been synthesized and characterized by IR, elemental analysis, and electrochemistry. Single-crystal X-ray analysis was carried out on Cs(3)K(2)Na(4)[Cs(2)K(H(2)O)(7)Pd(2)WO(H(2)O)(A-alpha-SiW(9)O(34))(2)].5H(2)O (1a), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 16.655(3) A, b = 19.729(4) A, c = 25.995(5) A, beta = 95.46(3) degrees , and Z = 4. Polyanion 1represents the first structurally characterized palladium(II)-substituted tungstosilicate. The title polyanion consists of two (A-alpha-SiW(9)O(34)) Keggin moieties linked via a [WO(H(2)O)](4+) group and two equivalent, square-planar Pd(2+) ions leading to a sandwich-type structure with C(2)(v) symmetry. The central belt of 1 contains also one potassium and two cesium ions. Polyanion 1 was synthesized by reaction of Pd(CH(3)COO)(2) with K(10)[A-alpha-SiW(9)O(34)] in aqueous acidic medium (pH 4.8). A cyclic voltammetry study of polyanion 1 in a pH 5 medium shows a Pd(0) deposition process on the glassy carbon electrode surface. The corresponding wave and that of tungsten redox processes could be separated clearly during the first few runs before their merging into a broad composite wave. The film thickness increases with the number of potential cycles or the duration of potentiostatic electrolysis. As judged from hydrogen sorption/desorption pattern, the quality of the film deposited from polyanion 1 is better than that of a film deposited directly from Pd(2+) solutions.