Tetraaza analogues of lithium and sodium alums: synthesis and X-ray structures of the single strand polymer [Li(THF)2(Al[SO2(NtBu)2]2)] infinity and the contact ion pairs [Na(15-crown-5)][Al(SO2(NtBu)2)2] and ([Na(15-crown-5)][O2S(mu-NBn)2Al(mu-NBnSO2NBn)])2

The reaction of an alkali metal aluminohydride MAlH4 (M = Li, Na) with N,N'-bis-(tert-butyl)sulfamide or N,N'-bis-(benzyl)sulfamide in THF produces the complex ions (Al[SO2(NR)2]2)- (R = tBu, Bn). The X-ray structures of [Li(THF)2(Al[SO2(NtBu)2]2)] infinity (1), [Na(15-crown-5)][Al(SO2(NtBu)2)2], (2) and ([Na(15-crown-5)][O2S(mu-NBn)2Al(mu-NBnSO2NBn)])2 (3.3THF) are reported. The two diazasulfate ligands [SO2(NtBu)2]2- are N,N' chelated to Al3+ in both 1 and 2. In the lithium derivative 1 the spirocyclic (Al[SO2(NtBu)2]2)- anions are bridged by the bis-solvated cations Li(THF)2+ to give a polymeric strand. In the sodium salt 2 the complex anion is O,O' chelated to Na+, which is further encapsulated by a 15-crown-5 ligand to give a monomeric ion-pair complex. By contrast, the benzyl derivative 3 forms a dimer in which the terminal [SO2(NBn)2]2- ligands are (N,N'),(O,O') bis-chelated to Al3+ and Na+, respectively, and the bridging ligands adopt a novel N,O-chelate, N'-monodentate bonding mode. The central core of 3 consists of two four-membered AlOSN rings bridged by two NtBu groups. Crystal data: 1, orthorhombic, Pna2(1), a = 20.159(5) degrees, b = 10.354(3) degrees, c = 15.833(4) degrees, alpha = beta = gamma = 90 degrees, V = 3304.7(15) A3, Z = 4; 2, monoclinic, P2(1)/n, a = 16.031(2) A, b = 9.907(2) A, c = 23.963(4) A, beta = 103.326(2) degrees, Z = 4; 3, triclinic, P1, a = 12.7237(11) A, b = 14.0108(13) A, c = 16.2050(14) A, alpha = 110.351(2) degrees, beta = 111.538(2) degrees, gamma = 97.350(2) degrees, Z = 1.     

Polylithiated tetraaminosilanes: synthesis and characterization of (Et2O.Li)4[Si(Nnaph)4] and X-ray structure of (THF.Li3[Si(NiPr)3(NHiPr)])2

The treatment of SiCl4 with 4 equiv of Li2(Nnaph) (naph = 1-naphthyl) in diethyl ether gives (Et2O.Li)4[Si(Nnaph)4] (4), which, upon reaction with excess tBuNH3Cl or MeO3SCF3, generates Si[N(H)naph]4 (5) or Si[N(Me)naph]4 (6), respectively. The centrosymmetric dimer (THF.Li3[Si(NiPr)3(NHiPr)])2 (7), formed via trilithiation of Si[N(H)iPr]4 with n-butyllithium, consists of a bis-THF-solvated Li6(NiPr)6 cyclic ladder bicapped by two SiN(H)iPr units. Crystal data for 7: C32H74Li6N8O2Si2, monoclinic, P2(1)/n, a = 10.661(7) A, b = 16.964(5) A, c = 12.405(4) A, beta = 93.22(4) degrees, V = 2239.9(15) A3, and Z = 2.     

Polynuclear magnesium and magnesium-titanium species. Syntheses and crystal structures of [Mg4(mu3,eta2-ddbfo)2(mu,eta2-ddbfo)2(mu,eta1-ddbfo)29eta1-ddbfo2],

Tetranuclear magnesium complexes with chelating alkoxo ligands have been synthesized with the aim of investigating coordinatively unsaturated magnesium sites able to bind TiX4 (X = Cl, OR), of the type necessary for the formation of the active centers in polymerization catalysts. The magnesium compound [Mg4(mu3,eta2-ddbfo)2(mu,eta2-ddbfo)2(mu,eta1-ddbfo)2(eta1-ddbfo)2] x 2CH2Cl2 (1) (ddbfo = 2,3-dihydro-2,2-dimethyl-7-benzofuranoxide) was prepared by the reaction of MgBu2 with ddbfoH in dichloromethane. Complex 1 exists as a centrosymmetric tetranuclear species with two different types of magnesium centers corresponding to octahedral MgO6 and trigonal bipyramidal MgO5 geometry. Compound 1 is monoclinic, space group P2(1/c), with a = 12.053(2) A, b = 13.323(3) A, c = 17.069(3) A, beta = 98.50(3) degrees , and Z = 4. The reaction of 1 with methanol in tetrahydrofuran (THF) gave compound [Mg4(mu3-OMe)2(mu,eta2-ddbfo)2(mu,eta1-ddbfo)2(eta1-ddbfo)2(CH3OH)5] x CH3OH x THF (2). During this reaction one of the two five-coordinate MgO5 centers in 1 is completed by a methanol molecule and becomes octahedral in 2. Species 2 belongs to the P2(1/n) monoclinic space group, with a = 13.323(3) A, b = 20.768(4) A, c = 27.584(6) A, beta = 104.26(3) degrees , and Z = 4. Compound [Mg4(mu3,eta2-thffo)2(mu,zeta2-thffo)2(mu,eta1-thffo)2[mu-OTi(DIPP)3]2] x 2CH2Cl2 (3) is formed as a result of substitution of two thffo (thffo = 2-tetrahydrofurfuroxide) ligands bonded to the five-coordinate magnesium atom in [Mg4(thffo)8] by bulky OTi(DIPP)3 (DIPP = diisopropylphenolate) groups. Crystals of 3 are monoclinic, space group P2(1/n), with a = 17.069(3) A, b = 18.421(4) A, 17.815(4) A, beta = 90.77(3) degrees , and Z = 4. The X-ray crystal structures of complexes 1-3 are discussed in terms of explaining the role of the coordinatively unsaturated magnesium site in chiral catalyst active center formation.     

Synthesis and structural characterization of trinuclear Cu(II)-pyrazolato complexes containing mu(3)-OH, mu(3)-O, and mu(3)-Cl ligands. Magnetic susceptibility study of [PPN](2)[(mu(3)-O)Cu(3)(mu-pz)(3)Cl(3)

The nine-membered [-Cu(II)-N-N-](3) ring of trimeric copper-pyrazolato complexes provides a sturdy framework on which water is twice deprotonated in consecutive steps, forming mu(3)-OH and mu(3)-O species. In the presence of excess chlorides the mu(3)-O(H) ligand is replaced by two mu(3)-Cl ions. The interconversion of mu(3)-OH and mu(3)-O and the exchange of mu(3)-O(H) and mu(3)-Cl are reversible, and the three species involved have been structurally characterized: [PPN][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(thf)].CH(2)Cl(2) (1a), monoclinic P2(1)/n, a = 10.055(2) A, b = 35.428(5) A, c = 15.153(2) A, beta = 93.802(3) degrees, V = 5386(1) A(3), Z = 4; [Bu(4)N][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)] (1b), triclinic P-1, a = 9.135(2) A, b = 13.631(2) A, c = 14.510(2) A, alpha = 67.393(2) degrees, beta = 87.979(2) degrees, gamma = 80.268(3) degrees, V = 1643.2(4) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-O)(mu-pz)(3)Cl(3)] (2), monoclinic P2/c, a = 12.807(2) A, b = 13.093(2) A, c = 23.139(4) A, beta = 105.391(3) degrees, V = 3741(1) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)].0.75H(2)O.0.5CH(2)Cl(2) (3a), triclinic P-1, a = 14.042(2) A, b = 23.978(4) A, c = 25.195(4) A, alpha = 76.796(3) degrees, beta = 79.506(3) degrees, gamma = 77.629(3) degrees, V = 7988(2) A(3), Z = 4; [Bu(4)N](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)] (3b), monoclinic C2/c, a = 17.220(2) A, b = 15.606(2) A, c = 20.133(2) A, beta = 103.057(2) degrees, V = 5270(1) A(3), Z = 4; [Et(3)NH][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(pzH)] (4), triclinic P-1, a = 11.498(2) A, b = 11.499(2) A, c = 12.186(2) A, alpha = 66.475(3) degrees, beta = 64.279(3) degrees, gamma = 80.183(3) degrees, V = 1331.0(5) A(3), Z = 2. Magnetic susceptibility measurements show that the three copper centers of 2 are strongly antiferromagnetically coupled with J(Cu-Cu) = -500 cm(-1).     

[Li(THF)_4][GdCl_4(THF)_2]的晶体结构

氯化钆与对-甲基苯基锂在四氢呋喃中反应得到产物之一为[Li(THF)_4][GdCl_4-(THF)_2],(M_r=738.2),在-70℃下进行X-射线衍射研究。其晶体属单斜晶系,P2/n空间群。晶体学参数为a=13.263(2),b=8.474(1),c=14.961(0);β=99.72(1)°,V=1657.23(?)~3,Z=2,D_c=1.48g/cm~3,F(000)=750,μ_c=24.2cm~(-1),最终偏离子为R=0.0614。研究结果表明,本题晶体是离子型晶体,围绕Gd~(3+)的四个Cl~-离子和两个THF分子的氧原子构成畸变的八面体。Li~+周围的四个THF分子的氧原子构成一个近似的四面体。     

Selenium imides: 77Se NMR investigations of the SeCl2-tBuNH2 reaction and X-ray structures of Se3(NtBu)3, tBuNSe(mu-NtBu)2SO2, and tBuNSe(mu-NtBu)2SeO

The reaction of SeCl2 with tert-butylamine in various molar ratios in THF at -78 degrees C has been investigated by 77Se NMR spectroscopy. In addition to the known Se-N heterocycles Se6(NtBu)2 (1) and Se9(NtBu)6 (2), the acyclic imidoselenium(II) dichlorides ClSe[N(tBu)Se]nCl (4, n = 1; 5, n = 2) and two new cyclic selenium imides [Se3(NtBu)2]n (3, n = 1 or 2) and Se3(NtBu)3 (6) have been isolated and identified. An X-ray analysis shows that 6 is a six-membered ring in a chair conformation with magnitude of d(Se-N) = 1.833 A. Crystal data: 6, trigonal, P3c1, a = 9.8660(3) A, c = 20.8427(7) A, V = 1757.0(1) A3, Z = 6. The 1H, 13C, and 77Se NMR data for 1-6 are reported, and some reassignments of earlier literature data for 1-3 (n = 1) are made. The decomposition of tBuN=Se=NtBu at 20 degrees C in toluene was monitored by 77Se NMR. The major products are 6 and 3. The Se(IV)-N systems tBuNSe(mu-NtBu)2E (7, E = SO2; 8, E = SeO) were prepared by the reaction of a mixture of SeCl4 and excess tBuNH2 with SO2Cl2 or SeOCl2, respectively. Compound 8 is also generated by the cycloaddition reaction of tBuNSeNtBu with tBuNSeO. Both 7 and 8 consist of slightly puckered four-membered rings. The mean terminal and bridging Se-N distances in 7 are 1.665(2) and 1.948(2) A, respectively. The corresponding values for 8 are 1.687(4) and 1.900(4) A, and d(Se=O) = 1.628(4) A. Crystal data: 7, monoclinic, P2(1)/c, a = 18.669(4) A, b = 12.329(2) A, c = 16.463(3) A, beta = 115.56(3) degrees, V = 3418.4(11) A3, Z = 4; 8, triclinic, P1, a = 6.372(1) A, b = 9.926(2) A, c = 14.034(3) A, alpha = 99.320(3) A, beta = 95.764(3) A, gamma = 103.876(3) A, V = 841.3(3) A3, Z = 2.     

A novel group of alkaline earth metal amides: syntheses and characterization of M[N(2,6-(i)Pr(2)C(6)H(3))(SiMe(3))](2)(THF)(2) (M = Mg,Ca, Sr,Ba) and the linear,two-coordinate Mg[N(2,6-(i)Pr(2)C(6)H(3))(SiMe(3))](2)

Novel alkaline earth metal aryl-substituted silylamides were prepared using alkane (Mg) and salt elimination reactions (Mg, Ca, Sr, and Ba). The salt elimination regime involved the treatment of the alkaline earth metal iodides with 2 equiv of the respective potassium amide KNDiip(SiMe(3)), (Diip = 2,6-i-Pr(2)C(6)H(3)). The organomagnesium source for the alkane elimination was ((n)()Bu/(s)()Bu)(2)Mg. All compounds were characterized using (1)H, (13)C NMR, and IR spectroscopy, in addition to X-ray crystallography (except Mg[NDiip(SiMe(3))](2)THF(2)). Crystal data with Mo Kalpha (lambda = 0.710 73 A) are as follows: Mg[NDiip(SiMe(3))](2), 1, a = 9.4687(6) A, b = 9.6818(6) A, c = 17.9296(1) A, alpha = 96.487(1) degrees, beta = 94.537(1) degrees, gamma = 89.222(1) degrees, V = 1608.8(2) A(3), Z = 2 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0508; (n)()BuMg[NDiip(SiMe(3))]THF(2), 2, a = 9.5413(1) A, b = 16.493(2) A, c = 9.8218(1) A, beta = 108.149(2) degrees, V = 1468.7(4) A(3), Z = 2, monoclinic, space group P2(1), R1(all data) = 0.1232; Ca[NDiip(SiMe(3))](2)THF(2), 4, a = 9.7074(1) A, b = 20.9466(4) A, c = 21.6242(3) A, alpha = 73.573(1) degrees, beta = 78.632(1) degrees, gamma = 89.621(1) degrees, V = 4129.1(1) A(3), Z = 4 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0902; Sr[NDiip(SiMe(3))](2)THF(2), 5, a = 20.5874(5) A, b = 9.8785(2) A, c = 20.8522(5) A, beta = 102.035(2) degrees, V = 4147.6(2) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0756; Ba[NDiip(SiMe(3))](2)THF(2), 6, a = 20.5476(2) A, b = 10.0353(2) A, c = 20.9020(4) A, beta = 101.657(1) degrees, V = 4221.0(1) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0573.     

Five- and Six-Coordinate 2-Methyl-2-propanethiolato Complexes of Zirconium(IV): Synthesis and Structures of [Li(DME)(3)][Zr(SCMe(3))(5)] and [(THF)Li](2)Zr(SCMe(3))(6)

Five-coordinate and six-coordinate 2-methyl-2-propanethiolato complexes of zirconium, [Li(DME)(3)][Zr(SCMe(3))(5)] (1) and [(THF)Li](2)Zr(SCMe(3))(6) (2), were obtained from the ZrCl(4)/LiSCMe(3) reaction system. The control of the Zr coordination number, by the ether ligands, THF or DME, bound to Li, is demonstrated by the conversion of 2 into 1 upon dissolution in DME. 1 and 2 were crystallographically characterized. The structures are extensively disordered. Crystal data follow: 1, hexagonal P6(3)/m, a = b = 12.496(3) ?, c = 17.561(9) ?, Z = 2, V = 2375(1) ?(3), R = 5.0%, R(w) = 6.8%; 2, trigonal R32, a = b = 11.813(3) ?, c = 28.37(1) ?, Z = 3, V = 3428(1) ?(3), R = 5.2%, R(w) = 6.4%.     

New metalloligands [M(SC[O]Ph)(4)](-): synthesis and characterization of polymeric [A(MeCN)(x)[M(SC[O]Ph)(4)]] compounds (A = Li,Na and K; M = Ga and In; x = 0-2)

Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials.     

Darstellung und Kristallstruktur von [Li(DME)2I]

Synthesis and Crystal Structure of [Li(DME)₂I] . LiI can be dissolved at 50°C in toluene/DME (2:1). At - 20°C [Li(DME)₂I] ( 1 ) was isolated in 75% yield. 1 was characterized by NMR techniques as well as an X-Ray structure determination. 1 crystallizes in the space group C2/c with a = 1 356.9(2), b = 813.2(1), c = 1 259.1(2) pm, and β = 99.74(1)°.     

Syntheses and structures of magnesium and zinc boraamidinates: EPR and DFT investigations of Li, Mg, Zn, B, and In complexes of the [PhB(NtBu)2].- anion radical

The first magnesium and zinc boraamidinate (bam) complexes have been synthesized via metathetical reactions between dilithio bams and Grignard reagents or MCl2 (M = Mg, Zn). The following new classes of bam complexes have been structurally characterized: heterobimetallic spirocycles {(L)mu-Li[PhB(mu-NtBu)2]}2M (6a,b, M = Mg, L = Et2O, THF; 6c, M = Zn, L = Et(2)O); bis(organomagnesium) complexes {[PhB(mu3-NtBu)2](MgtBu)2(mu3-Cl)Li(OEt2)3} (8) and {[PhB(mu3-NtBu)2](MgR)2(THF)2} (9a, R = iPr; 9b, R = Ph); mononuclear complex {[PhB(mu-NDipp)2]Mg(OEt2)2} (10). Oxidation of 6a or 6c with iodine produces persistent pink (16a, M = Mg) or purple (16b, M = Zn) neutral radicals {Lx-mu-Li[PhB(mu-NtBu)2]2M}. (L = solvent molecule), which are shown by EPR spectra supported by DFT calculations to be Cs-symmetric species with spin density localized on one of the bam ligands. In contrast, characterization of the intensely colored neutral radicals {[PhB(mu-NtBu)2]2M}. (5c, M = In, dark green; 5d, M = B, dark purple) reveals that the spin density is equally delocalized over all four nitrogen atoms in these D2d-symmetric spirocyclic systems. Oxidation of the dimeric dilithio complex {Li2[PhB(mu4-NtBu)2]}2 with iodine produces the monomeric neutral radical {[PhB(mu-NtBu)2]Li(OEt2)x}. (17), characterized by EPR spectra and DFT calculations. These findings establish that the bam anionic radical [PhB(NtBu)2].- can be stabilized by coordination to a variety of early main-group metal centers to give neutral radicals whose relative stabilities are compared and discussed.     

Rb(4)Hg(5)(Te(2))(2)(Te(3))(2)Te(3), [Zn(en)3](4)In(16)(Te2)4(Te3)Te22, and K2Cu2(Te2)(Te3): novel metal polytellurides with unusual metal-tellurium coordination

Three novel metal polytellurides Rb(4)Hg(5)(Te(2))(2)(Te(3))(2)Te(3) (I), [Zn(en)(3)](4)In(16)(Te(2))(4)(Te(3))Te(22) (II), and K(2)Cu(2)(Te(2))(Te(3)) (III) have been prepared by solvothermal reactions in superheated ethylenediamine at 160 degrees C. Their crystal structures have been determined by single-crystal X-ray diffraction techniques. Crystal data for I: space group Pnma, a = 9.803(2) A, b = 9.124(2) A, c = 34.714(7) A, Z = 4. Crystal data for II: space group C2/c, a = 36.814(7) A, b = 16.908(3) A, c = 25.302(5) A, beta = 128.46(3) degrees, Z = 4. Crystal data for III: space group Cmcm, a = 11.386(2) A, b = 7.756(2) A, c = 11.985(2) A, Z = 4. The crystal structure of I consists of 1D infinite ribbons of [Hg(5)(Te(2))(2)(Te(3))(2)Te(3)](4-), which are composed of tetrahedral HgTe(4) and trigonal HgTe(3) units connected through the bridging Te(2-), (Te(2))(2-), and (Te(3))(2-) ligands. II is a layered compound containing InTe(4) tetrahedra that share corners and edges via Te, Te(2), and Te(3) units to form a 2D slab that contains relatively large voids. The [Zn(en)(3)](2+) template cations are filled in these voids and between the slabs. The primary building blocks of III are CuTe(4) tetrahedra that are linked by intralayer (Te(3))(2-) and interlayer (Te(2))(2-) units to form a 3D network with open channels that are occupied by the K(+) cations. All three compounds are rare polytelluride products of solvothermal reactions that contain both Te(2) and Te(3) fragments with unusual metal-tellurium coordination.     

Anionic Halomolybdate(III) Chemistry. Tetrahydrofuran Loss from [MoX(3)Y(THF)(2)](-) (X, Y = Cl, Br, I), Preparation and Properties of [Mo(3)X(12)](3)(-) (X = Br, I), and Crystal Structure of the Edge-Sharing Trioctahedral [PPh(4)](3)[Mo(3)I(12)

By interaction of MoX(3)(THF)(3) with [Cat]X in THF, the salts [Cat][MoX(4)(THF)(2)] have been synthesized [X = I, Cat = PPh(4), NBu(4), NPr(4), (Ph(3)P)(2)N; X = Br, Cat = NBu(4), PPh(4) (Ph(3)P)(2)N]. Mixed-halide species [MoX(3)Y(THF)(2)](-) (X, Y = Cl, Br, I) have also been generated in solution and investigated by (1)H-NMR. When the tetraiodo, tetrabromo, and mixed bromoiodo salts are dissolved in CH(2)Cl(2), clean loss of all coordinated THF is observed by (1)H-NMR. On the other hand, [MoCl(4)(THF)(2)](-) loses only 1.5 THF/Mo. The salts [Cat](3)[Mo(3)X(12)] (X = Br, I) have been isolated from [Cat][MoX(4)(THF)(2)] or by running the reaction between MoX(3)(THF)(3) and [Cat]X directly in CH(2)Cl(2). The crystal structure of [PPh(4)](3)[Mo(3)I(12)] exhibits a linear face-sharing trioctahedron for the trianion: triclinic, space group P&onemacr;; a = 11.385(2), b = 12.697(3), c = 16.849(2) ?; alpha = 76.65(2), beta = 71.967(12), gamma = 84.56(2) degrees; Z = 1; 431 parameters and 3957 data with I > 2sigma(I). The metal-metal distance is 3.258(2) ?. Structural and magnetic data are consistent with the presence of a metal-metal sigma bond order of (1)/(2) and with the remaining 7 electrons being located in 7 substantially nonbonding orbitals. The ground state of the molecule is predicted to be subject to a Jahn-Teller distortion, which is experimentally apparent from the nature of the thermal ellipsoid of the central Mo atom. The [Mo(3)X(12)](3)(-) ions reacts with phosphines (PMe(3), dppe) to form products of lower nuclearity by rupture of the bridging Mo-X bonds.     

Synthesen und Kristallstrukturanalysen von [SbI3(SbMe3)(THF)]2 und [Li(THF)4]2[Bi2Cl8(THF)2]

Syntheses and Crystal Structure Analyses of [SbI₃(SbMe₃)(THF)]₂ and [Li(THF)₄]₂[Bi₂Cl₈(THF)₂] The reaction of Me₃Sb with SbI₃ in tetrahydrofuran (THF) gives [SbI₃(SbMe₃)(THF)]₂ ( 1 ). [Li(THF)₄]₂[Bi₂Cl₈(THF)₂] ( 2 ) is formed by reaction of LiCl and BiCl₃ in tetrahydrofuran. The structures of ( 1 ) and ( 2 ) have been determined by X-ray diffractometry. Both structures contain centrosymmetric dimers with the geometry of edge sharing octahedra.     

A trigonal bipyramidal uranyl amido complex: synthesis and structural characterization of [Na(THF)2][UO2(N(SiMe3)2)3

The synthesis and structural characterization of a rare example of a uranyl complex possessing three equatorial ligands, [M(THF)2][UO2(N(SiMe3)2)3] (3a, M = Na; 3b, M = K), are described. The sodium salt 3a is prepared by protonolysis of [Na(THF)2]2[UO2(N(SiMe3)2)4], whereas the potassium salt 3b is obtained via a metathesis reaction of uranyl chloride UO2Cl2(THF)2 (4) with 3 equiv of K[N(SiMe3)2]. A single-crystal X-ray diffraction study of 3a revealed a trigonal-bipyramidal geometry about uranium, formed by two axial oxo and three equatorial amido ligands, with average U=O and U-N bond distances of 1.796(5) and 2.310(4) A, respectively. One of the oxo ligands is also coordinated to the sodium counterion. 1H NMR spectroscopic studies indicate that THF adds reversibly as a ligand to 3 to expand the trigonal bipyramidal geometry. The degree to which the coordination sphere in 3 is electronically satisfied with only three amido donors is suggested by (1) the reversible THF coordination, (2) a modest elongation in the bond distances for a five-coordinate U(VI) complex, and (3) the basicity of the oxo ligands as evidenced in the contact to Na. The vibrational spectra of the series of uranyl amido complexes [UO2(N(SiMe3)2)n]2-n (n = 2-4) are compared, to evaluate the effects on the axial U=O bonding as a function of increased electron density donated from the equatorial region. Raman spectroscopic measurements of the nu 1 symmetric O=U=O stretch show progressive axial bond weakening as the number of amido donors is increased. Crystal data for [Na(THF)2][UO2(N(SiMe3)2)3]: orthorhombic space group Pna2(1), a = 22.945(1) A, b = 15.2830(7) A, c = 12.6787(6) A, z = 4, R1 = 0.0309, wR2 = 0.0524.     

Darstellung und Charakterisierung von Organodilithiumphosphiden. Die Kristallstruktur von [Li(THF)(TMEDA)P(H)Mes]

Synthesis and Characterization of Organodilithium Phosphides. The Crystal Structure of [Li(THF)(TMEDA)P(H)Mes] t-BuPH₂ and MesPH₂ can be reacted with two equivalents n-BuLi at R. T. in Et₂O/n-hexane to yield the corresponding organodilithium phosphides t-BuPLi₂ ( 1 ) and MesPLi₂ ( 2 ). 1 and 2 can be isolated solvent-free as bright orange-yellow solids. 1 and 2 were characterized by NMR, IR, and RE spectra. When MesPH₂ is treated with one equivalent of n-BuLi, MesP(H)Li is crystallizing as [Li(THF)(TMEDA)P(H)Mes] ( 3 ) from THF/TMEDA/n-pentane in the space group P2₁/n with a = 893.41(6), b = 1 734.7(1), c = 1 391.1(1) pm and β = 90.613(6)°.     

Experimental and theoretical investigations of lithium and magnesium derivatives of bis(tert-butylamido)cyclodiphosph(III/V)- and (V/V)azane mono- and ditellurides

Deprotonation of bis(tert-butylamido)cyclophosph(III/III)azane with organolithium or organomagnesium reagents followed by oxidation with elemental tellurium is a viable approach to the preparation of metal cyclodiphosphazane mono- and ditellurides. The reaction of the cyclodiphosph(III)azane [tBu(H)NP(mu-NtBu)2PN(H)tBu] (1) with elemental tellurium in boiling toluene affords the monotelluride [tBu(H)N(Te)P(mu-NtBu)2PN(H)tBu] (9). A similar reaction involving the magnesium salt Mg[tBuNP(mu-NtBu)2PNtBu](THF)2 (2) also yields a monotelluride Mg[tBuN(Te)P(mu-NtBu)2PNtBu]-(THF)2 (10). By contrast, reaction of the lithium salt Li2[tBuNP(mu-NtBu)2PNtBu](THF)2 (3) with tellurium results in double oxidation and the formation of the ditellurides Li2[tBuN(Te)P(mu-NtBu)2P(Te)NtBu](THF)4 (11) and Li2-[tBuN(Te)P(mu-NtBu)2P(Te)NtBu](tmeda)2 (12). Compounds 9-12 have been characterized by multinuclear (1H, 7Li, 13C, 31P, and 125Te) NMR, while 9, 10, and 12 have also been characterized by X-ray crystallography. The structure of 9 reveals a typical cis/endo, exo arrangement, with no intermolecular contacts to tellurium. The seco-heterocubic structure, observed in 2, is retained in 10, with the ligand chelating magnesium in an N,N',N"-manner. Unique coordination behavior is exhibited by the ditelluride 12, in which the dianionic ligand is attached to the two lithium centers in both Te,Te' and Te,N bonding modes. Multinuclear NMR data are consistent with retention of the solid-state structures of 9-12 in solution at low temperatures. The reactivity of cyclodiphosph(III/III)azanes toward chalcogens is rationalized by using theoretical calculations (semiempirical PM3 level of theory), which show an inverse correlation between the charge at the phosphorus center and the ease of oxidation.     

Synthesis of TiRru2 heterobimetallic and TiRuM (M = Rh, Rr, Pd, Pt) heterotrimetallic sulfido clusters from a hydrosulfido-bridged titanium-ruthenium complex

Treatment of the hydrosulfido-bridged titanium-ruthenium heterobimetallic complex [Cp2Ti(mu2-SH)2RuCl(eta5-C5Me5)] (1; Cp = eta5-C5H5) with an excess of triethylamine followed by addition of [RuCl2(PPh3)3] and [[(cod)M]2(mu2-Cl)2] (M = Rh, Ir; cod = 1,5-cyclooctadiene) led to the formation of the TiRu2 and TiRuM mixed-metal sulfido clusters [(CpTi)[(eta5-C5Me5)Ru][Ru(PPh3)2](mu3-S)2(mu2-Cl)2] (3) and [(CpTi)[(eta5-C5Me5)Ru][M(cod)](mu3-S)2(mu2-Cl)] (M = Rh (4a), Ir (4b)), respectively. On the other hand, the reactions of 1 with [M(PPh3)4] (M = Pd, Pt) afforded the TiRuM trinuclear clusters [(CpTiCl)[(eta5-C5Me5)Ru][M(PPh3)2](mu3-S)(mu2-S)(mu2-H)] (M = Pd (5a), Pt (5b)) with an unprecedented M3(mu3-S)(mu2-S) core. The detailed structures of these triangular clusters 3-5 have been determined by X-ray crystallography. Crystal data: 3, triclinic, P1, a = 12.448(4) A, b = 12.773(4) A, c = 17.270(4) A, alpha = 100.16(2) degrees, beta = 99.93(2) degrees, gamma = 114.11(3) degrees, V = 2373(1) A(3), Z = 2; 4a, triclinic, P1, a = 7.714(2) A, b = 11.598(3) A, c = 14.802(4) A, alpha = 80.46(2) degrees, beta = 82.53(2) degrees, gamma = 71.47(2) degrees, V = 1234.0(6) A3, Z = 2; 4b, triclinic, P1, a = 7.729(1) A, b = 11.577(2) A, c = 14.766(3) A, alpha = 80.14(1) degrees, beta = 82.71(1) degrees, gamma = 71.55(1) degrees, V = 1231.1(4) A3, Z = 2; 5a, monoclinic, P2(1)/c, a = 11.259(4) A, b = 16.438(4) A, c = 26.092(5) A, beta = 102.23(3) degrees, V = 4719(2) A(3), Z = 4; 5b, monoclinic, P2(1)/n, a = 11.369(2) A, b = 16.207(3) A, c = 26.116(2) A, beta = 102.29(1) degrees, V = 4701(1) A3, Z = 4.     

Chemistry of thiocarboxylates: synthesis and structures of neutral copper(I) thiocarboxylates with triphenylphosphine

The reactions of Na+ R[O]CS- (R = Me, Ph) with mixtures of CuCl and PPh3 in stoichiometric ratios yielded the compounds [Cu4(SC[O]Me)4(PPh3)4] (1), [Cu4(SC[O]Ph)4(PPh3)3] (2), [Cu2(SC[O]Me)2(PPh3)4] (3), [Cu(SC[O]Ph)(PPh3)2] (4), and [Cu2(SC[O]Ph)2(PPh3)3] (5) quantitatively. Compound 2 was also obtained from mixtures of CuCl, PPh3, and NaSC[O]Ph in the ratio 1:1:1. The analogous thioacetate compound similar to 2 and the thiobenzoate analogue of 1 could not be obtained. Attempts to prepare the unsymmetrical dimer of a thioacetate compound similar to 5 gave a mixture of 1 and 3. The structures of 1-4 have been determined by single-crystal X-ray diffraction methods. Crystal data for 1: triclinic space group Pl, a = 11.5844(3) A, b = 13.2459(3) A, c = 14.3433(3) A, alpha = 64.019(1) degrees, beta = 79.297(1) degrees, gamma = 69.426(1) degrees, V = 1850.98(7) A3, Z = 1, Dcalcd = 1.439 g.cm-3. Crystal data for 2.0.5CH2Cl2.H2O: triclinic space group P1, a = 12.4413(1) A, b = 15.5443(1) A, c = 20.4637(3) A, alpha = 94.974(1) degrees, beta = 95.976(1) degrees, gamma = 100.450(1) degrees, V = 3848.09(7) A3, Z = 2, Dcalcd = 1.416 g.cm-3. Single-crystal data for 3: monoclinic space group P2(1)/n, a = 15.2746(2) A, b = 23.2947(2) A, c = 19.0518(3) A, beta = 96.713(1) degrees, V = 6732.5(2) A3, Z = 4, Dcalcd = 1.309 g.cm-3. Crystal data for 4: triclinic space group P1, a = 10.2524(3) A, b = 12.9826(4) A, c = 14.5340(4) A, alpha = 87.723(1) degrees, beta = 75.322(1) degrees, gamma = 75.978(1) degrees, V = 1815.14(9) A3, Z = 2, Dcalcd = 1.327 g.cm-3. Compound 1, [mu 3-SC[O]Me-S)2(mu-SC[O]Me-S)2(CuPPh3)4], is a tetramer with a distorted stepladder structure in which two copper atoms are trigonally coordinated and the other two are tetrahedrally coordinated. Two bonding modes, namely, mu 3-S and mu 2-S, were observed for the Me[O]CS- anion. The structure of 2 may be described as a highly distorted cubanoid structure and formulated as [(mu 3-SC[O]Ph-S3)(mu 3-SC[O]Ph-S2,O)3(Cu)(CuPPh3)3]. In 2, three copper atoms have tetrahedral coordination geometry and one copper atom is trigonally coordinated. Unprecedented bonding modes, namely, mu 3-S, have been observed for the R[O]CS- anions, in 1 and 2 and mu 3-S2,O in 2. Compound 3, [(mu-SC[O]MeS)(mu-SC[O]Me-S,O)[Cu(PPh3)2]2] is a dimer with mu 2-S and mu 2-S,O bonding modes of Me[O]CS- ligands. Monomeric structure was found in 4 in which the copper atom has trigonal planar geometry with a very weak intramolecular interaction with O. Variable temperature 31P NMR studies in solution show the presence of various species in equilibria.     

Hexanuclear iron(III) salicylaldoximato complexes presenting the [Fe6(mu3-O)2(mu2-OR)2]12+ core: syntheses, crystal structures, and spectroscopic and magnetic characterization

The use of salicylaldehyde oxime (H2salox) in iron(III) carboxylate chemistry has yielded two new hexanuclear compounds [Fe6(mu3-O)2(O2CPh)10(salox)2(L)2].xMeCN.yH2O [L = MeCONH2, x = 6, y = 0 (1); L = H2O, x = 2, y = 3 (2)]. Compound 1 crystallizes in the triclinic space group P with (at 25 degrees C) a = 13.210(8) A, b = 13.87(1) A, c = 17.04(1) A, alpha = 105.79(2) degrees , beta = 96.72(2) degrees , gamma = 116.69(2) degrees , V = 2578.17(2) A(3), and Z = 1. Compound 2 crystallizes in the monoclinic space group C2/c with (at 25 degrees C) a = 21.81(1) A, b = 17.93(1) A, c = 27.72(1) A, beta = 111.70(2) degrees , V = 10070(10) A(3), and Z = 4. Complexes 1 and 2 contain the [Fe6(mu3-O)2(mu2-OR)2]12+ core and can be considered as two [Fe3(mu3-O)] triangular subunits linked by two mu2-oximato O atoms of the salox2- ligands, which show the less common mu3:eta1:eta2:eta1 coordination mode. The benzoato ligands are coordinated through the usual syn,syn-mu2:eta1:eta1 mode. The terminal MeCONH2 ligand in 1 is the hydrolysis product of the acetonitrile solvent in the presence of the metal ions. M?ssbauer spectra from powdered samples of 2 give rise to two well-resolved doublets with an average isomer shift consistent with that of high-spin Fe(III) ions. The two doublets, at an approximate 1:2 ratio, are characterized by different quadrupole splittings and are assigned to the nonequivalent Fe(III) ions of the cluster. Magnetic measurements of 2 in the 2-300 K temperature range reveal antiferromagnetic interactions between the Fe(III) ions, stabilizing an S = 0 ground state. NMR relaxation data have been used to investigate the energy separation between the low-lying states, and the results are in agreement with the susceptibility data.