共查询到20条相似文献,搜索用时 62 毫秒
1.
The coordination chemistry of the oxadiazole-containing rigid bidentate ligands 2,5-bis(4-pyridyl)-1,3,4-oxadiazole (L1), 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L2), and 2,5-bis(3-aminophenyl)-1,3,4-oxadiazole (L3) with inorganic Ag(I) salts has been investigated. Four new coordination polymers (1, 2, 3, and 5) and one new bimetallic macrocyclic supramolecular complex (4) were synthesized from solution reactions of L1-L3 with inorganic Ag(I) salts, respectively. Compounds [[Ag(L1)]SbF(6)](n) (1) (1, monoclinic, P2(1)/c, a = 6.6846(4) A, b = 27.1113(15) A, c = 8.6802(5) A, beta = 94.1080(10) degrees, Z = 4) and [[Ag(L1)]PF(6)](n) (2) (2, monoclinic, P2(1)/c, a = 6.6753(3) A, b = 27.2824(14) A, c = 8.2932(4) A, beta = 94.6030(10) degrees, Z = 4) were obtained from the reactions of L1 with AgSbF(6) and AgPF(6) in a CH(2)Cl(2)/CH(3)OH mixed solvent system, respectively. Compounds 1 and 2 are isostructural and feature a novel two-dimensional zeolite-like net with two different individual rings. [[Ag(L2)]SbF(6)](n) (3) (3, monoclinic, P2(1)/c, a = 5.5677(3) A, b = 17.3378(9) A, c = 15.6640(8) A, beta = 94.4100(10) degrees, Z = 2) and [Ag(2)(L2)(2)](SbF(6))(2) (4) (4, triclinic, P1, a = 8.7221(5) A, b = 9.2008(6) A, c = 10.7686(7) A, alpha = 70.6270(10) degrees, beta = 75.7670(10) degrees, gamma = 73.7560(10) degrees, Z = 1) were obtained from one-pot reaction of L2 with AgSbF(6) in a CH(2)Cl(2)/CH(3)OH mixed solvent system. Compound 3 features a one-dimensional chain pattern, while compound 4 adopts a novel bimetallic macrocyclic structural motif which consists of Ag(2)(L2)(2) ringlike units (crystallographic dimensions, 8.06 x 7.42 A(2)). [[Ag(L3)]SO(3)CF(3)](n) (5) is generated from L3 and AgSO(3)CF(3) in a CH(2)Cl(2)/CH(3)OH mixed solvent system and crystallizes in the unusual space group Pbcn, with a = 9.8861(5) A, b = 20.2580(10) A, c = 17.5517(8) A, Z = 8. It adopts novel two-dimensional sheets that are cross-linked to each other by strong interlayer N-H...O hydrogen bonding interactions into a novel H-bonded three-dimensional network. 相似文献
2.
Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated. 相似文献
3.
Two new bent oxadiazole bridging benzoacetylene ligands 2,5-bis(4-ethynylphenyl)-1,3,4-oxadiazole (L9) and 2,5-bis(3-ethynylphenyl)-1,3,4-oxadiazole (L10) were synthesized. The coordination chemistry of them with various inorganic Ag(I) salts has been investigated. Seven new coordination polymers were prepared by solution reactions and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. [Ag2(L9)](SO3CF3)2 (1) (triclinic, P; a =10.292(4), b = 10.794(4), c = 11.399(5) A; alpha = 98.894(5), beta = 102.360(6), gamma = 90.319(5) degrees ; Z = 2), [Ag(L9)]SbF6 (2) (orthorhombic, Cmca; a = 19.059(9), b = 12.922(6), c = 15.609(7) A; Z = 8), [Ag(L9)]BF4 (3) (orthorhombic, Cmca; a = 19.128(3), b = 12.6042(18), c = 28.003(4) A; Z = 16), [Ag(L9)]ClO4 (4) (monoclinic, P2(1)/c; a = 8.5153(16), b = 19.722(4), c = 10.320(2) A; beta = 105.307(3) degrees ; Z = 4), [Ag(L10)]SO3CF3 (5) (triclinic, P; a = 9.0605(13), b = 10.4956(15), c = 10.8085(16) A; alpha = 101.666(2), beta = 109.269(2), gamma = 100.944(2) degrees ; Z = 2), [Ag(L10)(H2O)(0.5)]BF4.0.5H2O (6) (monoclinic, C2/m; a = 32.180(6), b = 17.027(3), c = 8.1453(15) A; beta = 102.541(3) degrees ; Z = 8), and {[Ag2(L10)2(H2O)](ClO4)2}.o-xylene (7) (monoclinic, P2(1)/c; a = 8.1460(10), b = 17.326(2), c = 30.345(4) A; beta = 97.71 degrees ; Z = 4) were obtained by the combination of L9 and L10 with various Ag(I) salts in a benzene/methylene chloride mixed solvent system. In addition, the luminescent and electrical conductive properties of these new compounds were investigated. 相似文献
4.
One new conjugated symmetric fulvene ligand L1 and two new unsymmetric fulvene ligands L2 and L3 were synthesized. Five new supramolecular complexes, namely Ag2(L1)3(SO3CF3)3 (1) (1, monoclinic, P2(1)/c; a = 12.702(3) A, b = 26.118(7) A, c = 13.998(4) A, beta = 96.063(4) degrees, Z = 4), [Ag(L1)]ClO4 (2) (monoclinic, C2/c; a = 17.363(2) A, b = 13.2794(18) A, c = 13.4884(18) A, beta = 100.292(2) degrees, Z = 8), [Ag(L1)(C6H6)SbF6] x 0.5C6H6 x H2O (3) (monoclinic, P2(1)/c; a = 6.8839(11) A, b = 20.242(3) A, c = 18.934(3) A, beta = 91.994(3) degrees, Z = 4), Ag(L2)(SO3CF3) (4) (triclinic, P1; a = 8.629(3) A, b = 10.915(3) A, c = 11.178(3) A, alpha = 100.978(4) degrees, beta = 91.994(3) degrees, gamma = 105.652(4) degrees, Z = 2), and Ag(L3)(H2O)(SO3CF3) (5) (triclinic, P1; a = 8.914(5) A, b = 10.809(6) A, c = 11.283(6) A, alpha = 69.255(8) degrees, beta = 87.163(9) degrees, gamma = 84.993(8) degrees, Z = 2) were obtained through self-assembly based on these three new fulvene ligands in a benzene/toluene mixed-solvent system. Compounds 1-5 have been fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. The results indicate that the coordination chemistry of new fulvene ligands is versatile. They can adopt either cis- or trans-conformation to bind soft acid Ag(I) ion through not only the terminal -CN and furan functional groups but also the fulvene carbon atoms into organometallic coordination polymers or discrete complexes. In addition, the luminescent properties of L1-L3 and their Ag(I) complexes were investigated preliminarily in EtOH and solid state. 相似文献
5.
The reaction of various CuII salts with 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L) in CH3CN-H2O medium affords different complexes, the solid structures of which are controlled only by the choice of the counteranions. Reaction of Cu-(ClO4)2.6H2O or Cu(NO3)2.3H2O and L yields the novel bimetallic macrocyclic complex [Cu2L2(H2O)6](ClO4)4(H2O)4 (1) [monoclinic, space group P21/m, a = 8.745(5) A, b = 16.179(10) A, c = 14.930(8) A, beta = 93.253(10) degrees, Z = 2] or [CuL(NO3)2]2(CH3CN)2 (2) [triclinic, space group P1, a = 7.863(3) A, b = 8.679(3) A, c = 13.375(5) A, alpha = 74.121(5) degrees, beta = 78.407(6) degrees, gamma = 86.307(6) degrees, Z = 1]. However, with the replacement of CuII perchlorate or nitrate salts with CuSO4.5H2O or Cu(OAc)2.H2O in the above reaction, two different one-dimensional (1-D) coordination polymers [[Cu2L2(H2O)6(SO4)2](H2O)6]n (3) [triclinic, space group P1, a = 7.078(3) A, b = 11.565(4) A, c = 12.561(5) A, alpha = 109.511(6) degrees, beta = 105.265(6) degrees, gamma = 94.042(6) degrees, Z = 1] or [[Cu2L(mu-OAc)4]]n (4) [monoclinic, space group C2/c, a = 20.007(7) A, b = 7.506(2) A, c = 16.062(5) A, beta = 108.912(5) degrees, Z = 4] were obtained. These results unequivocally indicate that the nature of the counteranions, which play different roles in each complex, is the key factor governing the structural topologies of them. The magnetic properties of these CuII complexes have been investigated by variable-temperature magnetic susceptibility and magnetization measurements, and the magneto-structural correlation has been analyzed in detail. 相似文献
6.
The reactions of 1,4-bis(phenylthio)butane (L) with Ag(I) salts in varied conditions (varying the solvents, metal-to-ligand ratios, and counteranions) lead to the formation of four new two-dimensional (2D) coordination polymers with different network structures: [Ag(2)L(3)(ClO(4))(2)](infinity) 1, [Ag(2)L(3)(ClO(4))(2) x CH(3)OH](infinity) 2, [[AgL(2)](ClO(4))](infinity) 3, and [AgLNO(3)](infinity) 4. All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 1: triclinic, P-1, a = 11.0253(9) A, b = 11.3455(9) A, c = 11.5231(9) A, alpha = 93.931(2) degrees, beta = 92.689(2) degrees, gamma = 112.9810(10) degrees, Z = 2. 2: triclinic, P-1, a = 11.9147(13) A, b = 16.1534(17) A, c = 16.2259(17) A, alpha = 74.977(2) degrees, beta = 69.030(2) degrees, gamma = 69.986(2) degrees, Z = 2. 3: triclinic, P-1, a = 12.1617(9) A, b = 12.5054(10) A, c = 13.1547(10) A, alpha = 64.3370(10) degrees, beta =85.938 (2) degrees, gamma = 69.3010(10) degrees, Z = 2. 4: monoclinic, P2(1)/c, a = 5.4032(17) A, b = 16.974(6) A, c = 19.489(6) A, beta = 94.234(6) degrees, Z = 4. In all four complexes, each Ag(I) center has a tetracoordination geometry, and the 2D networks consist of fused large macrometallacyclic ring systems. The "hexagonal" 42-membered rings, Ag(6)L(6), observed in 1 and 2 are nearly identical, which could be considered as unique examples of self-sustaining noninterpenetrated frameworks formed with flexible ligands. The repeating rectangular 28-membered macrometallacycle, Ag(4)L(4), is the basis for the network of 3, in which the perchlorate anions occupy the voids to prevent the ring from collapsing. In 4, columns of the fused rectangular 22-membered rings, Ag(4)L(2)(NO(3))(2), are cross-linked through the L ligands to form a unique 2D network consisting of two types of 22-membered repeating units. 相似文献
7.
The novel dimeric silicotungstates [[SiM2W9O34(H2O)]2]12- (M = Mn2+, Cu2+, Zn2+) have been synthesized and characterized by IR spectroscopy, elemental analysis, and magnetic measurements. X-ray single-crystal analyses were carried out on K4Na6Mn[[SiMn2W9O34(H2O)]2].33H2O (1), which crystallizes in the triclinic system, space group P1, with a = 12.2376(7) A, b = 13.6764(8) A, c = 15.6177(9) A, alpha = 70.2860(10) degrees, beta = 79.9150(10) degrees, gamma = 70.2760(10) degrees, and Z = 1; K3Na5[[SiCu2W9O34(H2O)]2].26H2O (2) crystallizes in the triclinic system, space group P1, with a = 11.4271(12) A, b = 12.5956(13) A, c = 15.3223(16) A, alpha = 80.456(2)degrees, beta = 76.383(2) degrees, gamma = 76.968(2) degrees, and Z = 1; K4Na6[[SiZn2W9O34(H2O)]2].34H2O (3) crystallizes also in the triclinic system, space group P1, with a = 12.2596(14) A, b = 13.2555(15) A, c = 16.2892(18) A, alpha = 96.431(2) degrees, beta = 100.944(2) degrees, gamma = 110.404(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[SiW9O34]10- Keggin moieties linked via a rhomblike M4O16 (M = Mn, Cu, Zn) group leading to a sandwich-type structure. Magnetic measurements show that the central Mn4 unit in 1 exhibits antiferromagnetic (J = -1.77(5) cm(-1)) as well as weak ferromagnetic (J' = 0.08(2) cm(-1)) Mn-Mn exchange interactions. In 2 the Cu-Cu exchange interactions are antiferromagnetic (J = -0.10(2) cm(-1), J' = -0.29(2) cm(-1)). 相似文献
8.
The synthesis and crystal structure of the three-dimensional coordination polymer of an angular dipyridyl ligand 2,5-bis(4-pyridyl)-1,3,4-oxadiazole (L) and Cu(ClO(4))(2), exhibiting the first Cu(II) diamondoid network with 2-fold interpenetration, ([Cu(L)(2)(H(2)O)(2)](ClO(4))(OH)(H(2)O)(2.5))(n) (1), together with the Cu(OAc)(2) complex of L, [Cu(L)(2)(OAc)(2)(H(2)O)](H(2)O)(2)(CH(3)OH) (2), with an unexpected mononuclear structure, are reported. Crystal data for 1: tetragonal, space group I4(1)/a, a = b = 13.477(3) A, c = 46.167(13) A, Z = 8. Crystal data for 2: triclinic, space group P(-)1, a = 7.847(2) A, b = 13.189(4) A, c = 15.948(5) A, alpha = 75.225(7) degrees, beta = 79.945(6) degrees, gamma = 77.540(5) degrees, Z = 2. The magnetic properties and anion effect are also discussed. 相似文献
9.
Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space. 相似文献
10.
The long, rigid ligands 1,4-bis[(3-pyridyl)ethynyl]benzene (L1) and 1,4-bis[(4-pyridyl)ethynyl]benzene (L2) were used in the synthesis of 10 new organic-inorganic coordination frameworks, each of them adopting different structural motifs. Synthesis, single-crystal X-ray structure determination, and spectroscopic and thermogravimetric analyses are presented. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] with L1 afforded the following one-dimensional zigzag chain structures: [Cd(C20H12N2)0.5(NO3)(CH3OH)]n (1, monoclinic, C2/c; a = 7.586(1) A, b = 23.222(1) A, c = 13.572(1) A, beta = 92.824(1), Z = 4); [{Cu(C20H12N2)(NO3)2(CH3OH)} x CH3OH]n (2, orthorhombic, P2(1)2(1)2(1); a = 8.589(1) A, b = 15.766(1) A, c = 17.501(1) A, Z = 4); [Co(C20H12N2)2(NO3)2(H2O)2] (5, triclinic, P1; a = 7.493(1) A, b = 8.948(1) A, c = 14.854(1) A, alpha = 100.427(1), beta = 97.324(1), gamma = 110.901(1), Z = 1); [Cu(C20H12N2)(hfac)2]n (4, monoclinic, C2/c, a = 18.828(1) A, b = 14.671(1) A, c = 13.427(1) A, beta = 90.447(1) degrees, Z = 4). Moreover, the minority phase compound formed from Cu(NO3)2 x 3H2O and L1 yielded a metallocyclic chain structure, [Cu(C20H12N2)(NO3)]n (3, triclinic, P; a = 8.728(1) A, b = 10.018(1) A, c = 11.893(1) A, alpha = 109.991(1), beta = 97.109(1), gamma = 115.542(1), Z = 1). In addition to the dinuclear coordination complex 5, all other polymeric structures (1-4) from L1 are composed of interpenetrating 2D and 3D cross-linked zigzag chains via hydrogen-bonding interactions. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] and L2 were dependent on the nature of the metal center and resulted in the formation of four different interpenetrating and noninterpenetrating compounds (6-10): [Co(C20H12N2)1.5(NO3)2]n (6, triclinic, P; a = 14.172(1) A, b = 15.795(1) A, c = 18.072(1) A, alpha = 115.380(1), beta = 101.319(1), gamma = 93.427(2), Z = 4), which consists of T-shaped building blocks assembled into three-dimensional interpenetrating polycatenated ladders; [Cd(C20H12N2)2(NO3)2]n (7, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), which adopts a two-dimensional noninterpenetrating square-grid motif; [Cu(C20H12N2)(hfac)2]n (8, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), composed of three sets of distinct one-dimensional linear chains; [Cu(C20H12N2)(EtOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2EtOH (9, triclinic, P; a = 12.248(2) A, b = 13.711(3) A, c = 18.257(4) A, alpha = 108.078(4) degrees, beta = 97.890(4) degrees, gamma = 103.139(5) degrees, Z = 2) and [Cu(C20H12N2)(MeOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2MeOH (10, triclinic, P; a = 12.136(1) A, b = 13.738(2) A, c = 17.563(3) A, alpha = 107.663(3) degrees, beta = 94.805(4) degrees, gamma = 104.021(4) degrees, Z = 2). Both 9 and 10 stack into infinite interpenetrating ladders through bundles of infinite chains and are described in our preliminary communication. 相似文献
11.
Six new metal-organic coordination networks based on linking unit 2,5-bis(4-pyridyl)-1,3,4-thiadiazole (L(1)) or 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L(3)) and inorganic Cu(II), Cd(II), and Co(II) salts have been prepared and structurally characterized by single-crystal X-ray analysis. Using L(1) to react with three different Cu(II) salts, Cu(OAc)(2).H(2)O, Cu(NO(3))(2).3H(2)O, and CuSO(4).5H(2)O, respectively, two different one-dimensional (1-D) coordination polymers, [[Cu(2)L(1)(mu-OAc)(4)](CHCl(3))(2)](n) (1) [triclinic, space group P1, a = 7.416(3) A, b = 8.207(3) A, c = 14.137(5) A, alpha = 100.333(7) degrees, beta = 105.013(6) degrees, gamma = 94.547(6) degrees, Z = 1] and [[CuL(1)(NO(3))(2)](CHCl(3))(0.5)](n) (2) [monoclinic, space group C2/c, a = 28.070(8) A, b = 9.289(3) A, c = 15.235(4) A, beta = 113.537(5) degrees, Z = 8], and a chiral 3-D open framework, [[CuL(1)(H(2)O)(SO(4))](H(2)O)(2)](n) (3) [orthorhombic, space group P2(1)2(1)2(1), a = 5.509(2) A, b = 10.545(4) A, c = 29.399(11) A, Z = 4], were obtained. Reaction of L(1) and Cd(ClO(4))(2).6H(2)O or Co(ClO(4))(2).6H(2)O, in the presence of NH(4)SCN, yielded another 3-D open framework, [[CdL(1)(NCS)(2)](CH(3)OH)(1.5)](n) (4) [monoclinic, space group C2/c, a = 28.408(10) A, b = 9.997(5) A, c = 7.358(4) A, beta = 99.013(8) degrees, Z = 4], or a 2-D network, [[Co(L(1)())(2)(NCS)(2)](H(2)O)(2.5)](n) (5) [orthorhombic, space group Pnna, a = 22.210(5) A, b = 12.899(3) A, c = 20.232(4) A, Z = 4]. When L(1) was replaced by L(3) to react with Co(ClO(4))(2).6H(2)O and NH(4)SCN, another 2-D coordination polymer, [Co(L(3))(2)(NCS)(2)](n) (6) [monoclinic, space group P2(1)/c, a = 8.120(3) A, b = 9.829(4) A, c = 17.453(6) A, beta = 103.307(6) degrees, Z = 2], was constructed. These results indicate that the nature of the ligands, metal centers, or counteranions plays the critical role in construction of these novel coordination polymers. The interesting porous natures of two 3-D open frameworks 3 and 4 were investigated by TGA and XPRD techniques, and the magnetic properties of the Cu(II) and Co(II) complexes were studied by variable-temperature magnetic susceptibility and magnetization measurements. 相似文献
12.
The coordination chemistry of the multidentate Schiff-base ligands 2,5-bis(3-methylpyrazinyl)-3,4-diaza-2,4-hexadiene (L5) and 2,5-bis(pyrazinyl)-3,4-diaza-2,4-hexadiene (L6) with inorganic Ag(I) salts has been investigated. Six new Ag(I)-coordination polymers were prepared by solution reactions and fully characterized by infrared spectroscopy, elemental analysis, thermogravimetric analysis, and single-crystal X-ray diffraction. [Ag(L5)]ClO(4).0.5CH(3)OH (1, orthorhombic, Fdd2; a = 20.0896(11) A, b = 48.224(3) A, c = 7.8432(4) A, Z = 16), [Ag(L5)]PF(6).0.5CH(3)OH (2, orthorhombic, Fdd2; a = 20.7255(11) A, b = 46.166(2) A, c = 8.4332(4) A, Z = 16), [Ag(L5)]SbF(6).0.5CH(3)OH (3, orthorhombic, Fdd2; a = 21.5481(11) A, b = 45.196(2) A, c = 8.7331(4) A, Z = 16), and [Ag(L5)](BF(4)).0.5CH(3)OH (4, orthorhombic, Fdd2; a = 19.8897(11) A, b = 48.358(3) A, c = 7.7491(5) A, Z = 16) were obtained by combination of L5 with AgClO(4).xH(2)O, AgPF(6), AgSbF(6), and AgBF(4), respectively, in a methylene chloride/methanol mixed solvent system. Compounds 1-4 are isostructural and feature noninterpenetrating three-dimensional zeolite-like networks. [Ag(4)(L6)(4)](PF(6))(4).CHCl(3) (5, tetragonal, Pc2; a = 16.1067(3) A, b = 16.1067(3) A, c = 14.4935(5) A, Z = 2) was generated from the reaction of L6 with AgPF(6) in a chloroform/ethanol mixed solvent system. It forms with a unique one-dimensional nanometer-tube that can be considered a new polymeric motif based on the [AgN5] coordination sphere. The tubes are square with crystallographic dimensions of 10.3 x 10.0 A. The tubes are further linked together through weak interpolymer C-H...F hydrogen bonding interactions into a novel H-bonded three-dimensional network containing square tubes, in which uncoordinated PF(6)(-) counterions and chloroform guest molecules are located. Compound 6 ([Ag(mu-C(6)H(6)N(2)O)](SO(3)CF(3)), monoclinic, P2(1)/c; a = 12.3435(6) A, b = 20.3548(10) A, c = 9.0861(5) A, Z = 8) was obtained by combination of AgSO(3)CF(3) and L6 in a methylene chloride/benzene mixed solvent system. In 6, 2-acetylpyrazine, which was generated from the hydrolysis reaction of L6 in the presence of CF(3)SO(3)(-) and a small quantity of water in solvent, chelates the Ag(I) centers through the carbonyl O-donor, and the vicinal pyrazine N-donor, furthermore, uses the para-N atoms to link other Ag(I) centers into one-dimensional zigzag chains. The triflate anions link the chains into a three-dimensional network by somewhat long Ag.O contacts. 相似文献
13.
The reactions of four flexible tetradentate ligands, 1,3-bis(2-pyridylthio)propane (L1), 1,4-bis(2-pyridylthio)butane (L2), 1,5-bis(2-pyridylthio)pentane (L3) and 1,6-bis(2-pyridylthio)hexane (L4) with AgX (X = BF4-, ClO4-, PF6-, or CF3SO3-) lead to the formation of seven new complexes: [AgL1(BF4)]2 (1), [[AgL2](ClO4)]infinity (2), [[AgL2(CH3CN)](PF6)]infinity (3), [[AgL3](BF4)(CHCl3)]2 (4), [[AgL3(CF3SO3)](CH3OH)(0.5)]infinity (5), [[Ag2L4(2)](BF4)2]infinity (6), and [[AgL4](PF6)]infinity (7), which have been characterized by elemental analyses, IR spectroscopy, and X-ray crystallography. Single-crystal X-ray analyses show that complexes 1 and 4 possess dinuclear macrometallacyclic structures, and complexes 2, 3 and 5-7 take chain structures. In all the complexes, the nitrogen atoms of ligands preferentially coordinate to silver atoms to form normal coordination bonds, while the sulfur atoms only show weak interactions with silver atoms and the intermolecular AgS weak contacts connect the low-dimensional complexes into high-dimensional supramolecular networks. Additional weak interactions, such as pi-pi stacking, F...F weak interactions, Ag...O contacts or C-H...O hydrogen bonds, also help to stabilize the crystal structures. It was found that the parity of the -(CH2)n- spacers (n = 3-6) affect the orientation of the two terminal pyridyl rings, thereby significantly influence the framework formations of these complexes. The coordination features of ligands and their conformation changes between free and coordination states have been investigated by DFT calculations. 相似文献
14.
With the new substituted pyrazine ligand pyrazine-2,3-dicarboxylic acid bis[(pyridin-2-ylmethyl)amide], H(2)L, a binuclear complex [Cu(2)(LH)(Cl(3))(H(2)O)].H(2)O (1) and two [2 x 2]G grid complexes, [[Cu(4)(LH)(4)](ClO(4))(4)].5CH(3)OH.4H(2)O (2) and [[Ni(4)(LH)(4)]Cl(4)].5CH(3)CN.13H(2)O (3), have been synthesized and characterized spectroscopically and crystallographically. The ligand H(2)L crystallized in the triclinic space group P1, with a = 4.9882(7) A, b = 12.079(2) A, c = 14.454(2) A, alpha = 107.08(2) degrees, beta = 98.61(2) degrees, gamma = 97.54(2) degrees, V = 808.8(2) A(3), Z = 2, R1 = 0.0747, and R(w) = 0.1829 for 1319 observed reflections [I > 2 sigma(I)]. The molecule is L-shaped with a strong intramolecular bifurcated hydrogen bond in half of the molecule. In the crystal the molecules are linked by an intermolecular hydrogen bond to form a 1D polymer. The binuclear complex [Cu(2)(LH)(Cl(3))(H(2)O)].H(2)O (1) crystallized in the monoclinic space group P2(1)/a, with a = 8.6859(7) A, b = 28.060(2) A, c = 9.5334(9) A, beta = 107.89(1) degrees, V = 2211.2(3) A(3), Z = 4, R1 = 0.039, and R(w) = 0.097 for 1408 observed reflections [I > 2 sigma(I)]. There are two independent copper atoms both having square pyramidal geometry. Both coordinate to a pyrazine, a pyridine, and an amide N atom. Two chlorines complete the coordination sphere of one of the copper atoms, while one chlorine atom and a water molecule complete the coordination sphere of the other. The copper(II) [2 x 2] grid complex [[Cu(4)(LH)(4)](ClO(4))(4)].5CH(3)OH.4H(2)O (2) crystallized in the triclinic space group P1, with a = 17.1515(14) A, b = 17.7507(13) A, c = 19.3333(15) A, alpha = 67.34(1) degrees, beta = 69.79(1) degrees, gamma = 71.50(1) degrees, V = 4980.3(7) A(3), Z = 2, R1 = 0.083, and R(w) = 0.207 for 5532 observed reflections [I > 2 sigma(I)]. The four Cu(II) atoms are octahedrally coordinated by two pyrazine, two pyridine, and two amide N atoms and occupy the corners of a [2 x 2] grid with edge lengths, Cu...Cu, varying from 7.01 to 7.39 A. The nickel(II) [2 x 2] grid complex [[Ni(4)(LH)(4)]Cl(4)].5CH(3)CN.13H(2)O (3) crystallized in the monoclinic space group C2/c, with a = 16.3388(10) A, b = 29.754(2) A, c = 20.857(1) A, beta = 101.845(1) degrees, V = 9923.6(12) A(3), Z = 4, R1 = 0.050, and wR2 = 0.101 for 3391 observed reflections [I > 2 sigma(I)]. Here the complex possesses C(2) symmetry and again each metal atom is octahedrally coordinated to two pyrazine, two pyridine, and two amide N atoms. They occupy the corners of a [2 x 2] grid with an average edge length, Ni.Ni, of 6.97 A. Of the four anions (ClO(4)(-)'s in 2 and Cl(-)'s in 3) required to equilibrate the charges in the grid complexes, two are encapsulated, one above and one below the plane of the four metal atoms. The remaining two anions are located between the "wings" of the ligands. Magnetic susceptibility measurements indicate that the binuclear complex 1 is antiferromagnetic, with a J value of -15.07 cm(-1). This is larger than the J values found for the Cu(II) (2) and Ni(II) (3) grid complexes, which were -5.87 and -2.64 cm(-1), respectively. DFT calculations have been carried out to explain the difference in the J values found for complexes 1 and 2. 相似文献
15.
Three unusual compounds based on polyoxometalate building blocks, [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2][Ag2IMo6O24(H2O)4] x 6.25H2O (1), [(H2O)4Na2(C6NO2H5)6Ag3][IMo6O24] x 6H2O (2), and (C6NO2H6)2[(C6NO2H5)2Ag][Cr(OH)6Mo6O18] x 4H2O (3), have been synthesized and characterized by elemental analysis; IR, XPS, and ESR spectroscopy; TG analysis; and single-crystal X-ray diffraction. Compound 1 is constructed from the cationic two-dimensional (2D) coordination polymer sheets which are constituted of [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2]3+ and anionic [Ag2IMo6O24(H2O)4]3- chains as pillars, forming a three-dimensional (3D) supramolecular framework via weak Ag-O interactions. Compound 2 is composed of the well-defined [IMo6O24]5- building blocks, which are linked through trinuclear Ag-pyridine-3-carboxylic acid, [(C6NO2H5)6Ag3]3+, fragments into a one-dimensional (1D) hybrid chain; adjacent chains are further connected by sodium cations to yield a novel 2D network. Compound 3 has a 1D chainlike structure constructed from [Cr(OH)6Mo6O18]3- building blocks and Ag-pyridine-4-carboxylic acid coordination units. The crystal data for these compounds are the following: 1, triclinic, P1, a = 13.280(3) A, b = 13.641(3) A, c = 16.356(3) A, alpha = 89.68(3) degrees, beta = 88.31(3) degrees, gamma = 75.87(3) degrees, Z = 2; 2, triclinic, P1, a = 11.978(2) A, b = 12.008(2) A, c = 13.607(3) A, alpha = 116.14(3) degrees, beta = 108.85(3) degrees, gamma = 93.86(3) degrees, Z = 1; 3, triclinic, P1, a = 10.458(2) A, b = 10.644(2) A, c = 12.295(3) A, alpha = 97.40(3) degrees, beta = 112.38(3) degrees, gamma = 113.59(3) degrees, Z = 1. 相似文献
16.
The reaction of [MCl2(NCMe)2] (M = Pd or Pt) with 2 molar equiv of MeC(CH2ER)3 (E = Se, R = Me; E = Te, R = Me or Ph) and 2 molar equiv of TlPF6 affords the bis ligand complexes [M(MeC(CH2ER)3)2][PF6]2. The crystal structure of [Pt(MeC(CH2SeMe)3)2][PF6]2 (C16H36F12P2PtSe6, a = 12.272(10) A, b = 18.563(9) A, c = 15.285(7) A, beta = 113.18(3) degrees, monoclinic, P2(1)/n, Z = 4) confirms distorted square planar Se4 coordination at Pt(II), derived from two bidentate tripod selenoethers with the remaining arm not coordinated and directed away from the metal center. Solution NMR studies indicate that these species are fluxional and that the telluroether complexes are rather unstable in solution. The octahedral bis tripod complexes [Ru(MeC(CH2SMe)3)2][CF3-SO3]2 and [Ru(MeC(CH2TePh)3)2][CF3SO3]2 are obtained from [Ru(dmf)6][CF3SO3]3 and tripod ligand in EtOH solution. The thioether complex (C18H36F6O6RuS8, a = 8.658(3) A, b = 11.533(3) A, c = 8.659(2) A, alpha = 108.33(2) degrees, beta = 91.53(3) degrees, gamma = 106.01(2) degrees, triclinic, P1, Z = 1) is isostructural with its selenoether analogue, involving two facially coordinated trithioether ligands in the syn configuration. NMR spectroscopy confirms that this configuration is retained in solution for all of the bis tripod Ru(II) complexes. These low-spin d6 complexes show unusually high ligand field splittings. The hexaselenoether Rh(III) complex [Rh(MeC(CH2SeMe)3)2][PF6]3 was obtained by treatment of [Rh(H2O)6]3+ with 2 molar equiv of MeC(CH2SeMe)3 in aqueous MeOH in the presence of excess PF6- anion, while the iridium(III) analogue [Ir(MeC(CH2SeMe)3)2][PF6]3 was obtained via the reaction of the Ir(I) precursor [IrCl(C8H14)2]2 with the selenoether tripod in MeOH/aqueous HBF4. NMR studies reveal different invertomers in solution for both the Rh and Ir species. The Cu(I) complexes [Cu(MeC(CH2ER)3)2]PF6 were obtained from [Cu(NCMe)4]PF6 and tripod ligand in CH2Cl2 solution. The corresponding Ag(I) species [Ag(MeC(CH2TeR)3)2]CF3SO3 (R = Me or Ph) were obtained from Ag[CF3SO3] and tripod telluroether. In contrast, a similar reaction with 2 molar equiv of MeC(CH2SeMe)3 afforded only the 1:1 complex [Ag(MeC(CH2SeMe)3)]CF3SO3. The structure of this species (C9H18AgF3O3SSe3, a = 8.120(3) A, b = 15.374(3) A, c = 14.071(2) A, beta = 93.86(2) degrees, monoclinic, P2(1)/n, Z = 4) reveals a distorted trigonal planar geometry at Ag(I) derived from one bidentate selenoether and one monodentate selenoether. These units are then linked to adjacent Ag(I) ions to give a one-dimensional linear chain cation. 相似文献
17.
Amine-templated vanadium sulfates of the formula [HN(CH(2))(6)NH][(V(IV)O)(2)(OH)(2)(SO(4))(2)].H(2)O, I, [H(3)N(CH(2))(2)NH(3)][V(III)(OH)(SO(4))(2)].H(2)O, II, and [H(2)N(CH(2))(4)NH(2)][(V(IV)O)(H(2)O)(SO(4))(2)], III, have been prepared under hydrothermal conditions. These vanadium sulfates add to the new emerging family of organically templated metal sulfates. Compound I has a linear chain structure consisting of V(2)O(8) square-pyramid dimers connected by corner-sharing SO(4) tetrahedra, creating four-membered rings along the chain. Both II and III possess simple linear chain topologies formed by VO(6) octahedra and SO(4) tetrahedra, with II having the tancoite chain structure. Compound I crystallizes in the triclinic space group P1 (No. 2) with a = 7.4852(4) A, b = 9.5373(5) A, c = 11.9177(6) A, alpha = 77.22 degrees, beta = 76.47(2) degrees, gamma = 80.86 degrees, Z = 2. Compound II: monoclinic, space group P2(1)/c (No. 14), a = 6.942(2) A, b = 10.317(3) A, c = 15.102(6) A, beta = 90.64(4) degrees, Z = 4. Compound III: triclinic, space group P1 (No. 2) with a = 6.2558(10) A, b = 7.0663(14) A, c = 15.592(4) A, alpha = 90.46(2) degrees, beta = 90.47(2) degrees, gamma = 115.68(2) degrees, Z = 2. Magnetic susceptibility measurements reveal weak antiferromagnetic interactions in I and III and ferromagnetic interactions in II. 相似文献
18.
A new series of square planar Pt(II) complexes with the mer-coordinating tridentate ligand, pip(2)NCN(-) (pip(2)NCNH = 1,3-bis(piperdylmethyl)benzene), has been prepared: Pt(pip(2)NCN)Cl (2), Pt(pip(2)NCN)Br (3), Pt(pip(2)NCN)I (4), and [Pt(pip(2)NCN)(CH(3)N=C(CH(3))(2))][CF(3)SO(3)] (5). The complexes have been fully characterized by (1)H NMR spectroscopy, elemental analysis, and UV-vis spectroscopy. The X-ray crystal structures of pip(2)NCNBr (1), 2, and 5 are reported. Compound 1: triclinic, P, a = 10.081(1) A, b = 10.153(2) A, c = 10.390(1) A, alpha = 66.05(1) degrees, beta = 79.07(1) degrees, gamma = 64.51(1) degrees, V = 877.1(2) A(3), Z = 2. Complex 2: triclinic, P, a = 9.897(2) A, b = 10.191(2) A, c = 19.174(4) A, alpha = 75.09(3) degrees, beta = 76.14(3) degrees, gamma = 71.00(3) degrees, V = 1741.2(6) A(3), Z = 4. Complex 5: triclinic, P, a = 10.709(2) A, b = 11.2321(10) A, c = 12.447(2) A, alpha = 110.509(8) degrees, beta = 112.417(10) degrees, gamma = 91.066(9) degrees, V = 1276.1(3) A(3), Z = 2. In 77 K 3:1 EtOH/MeOH glassy solution, these colorless complexes exhibit weak red-orange to red emissions originating from a lowest spin-forbidden ligand field excited state. 相似文献
19.
Four new oxadiazole-bridging ligands (L1-L4) were designed and synthesized by the reaction of 2,5-bis(2-hydroxyphenyl)-1,3,4-oxadiazole with isonicotinoyl chloride and nicotinoyl chloride, respectively. L1 and L3 are unsymmetric single-armed ligands (4- or 3-pyridinecarboxylate arm), and L2 and L4 are symmetric double-armed ligands (4- or 3-pyridinecarboxylate arms). Nine new complexes, [Ag(L1)]PF6.CH3OH (1), [Ag(L1)]ClO4.CH3OH (2), Cu(L2)(NO3)2.2(CH2Cl2) (3), [Cu(L2)2](ClO4)2.2(CH2CCl2) (4), Cu(L2)Cl2 (5), [Cu4(L3)2(H2O)2](L3)4(ClO4)4 (6), [Ag(L4)(C2H5OH)]ClO4 (7), [Ag(L4)(C2H5OH)]BF4 (8), and [Ag(L4)(CH3OH)]SO3CF3 (9), were isolated from the solution reactions based on these four new ligands, respectively. L1, L2, and L3 act as convergent ligands and bind metal ions into discrete molecular complexes. In contrast, L4 exhibits a divergent spacer to link metal ions into one-dimensional coordination polymers. New coordination compounds were fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescent and electrical conductive properties of these new compounds were investigated. 相似文献
20.
Three-dimensional open frameworks [Co2(nicotinate)4(mu-H2O)]-CH3CH2OH-H2O, 1, and [Ni2(nicotinate)4(mu-H2O)]-CH3CH2OH-H2O, 2, were obtained by hydro(solvo)thermal reactions between 3-cyanopyridine and cobalt(II) nitrate and nickel(II) perchlorate, respectively. Both 1 and 2 exhibit complicated 3-D structures based on [M2(nicotinate)4(mu-H2O)] (M = Co or Ni) building blocks and possess open channels that are occupied by removable solvent molecules. 3-D open frameworks [M2L4(mu-H2O)]-HL-(H2O)x (where M = Co, x = 2, 3, and M = Ni, x = 1, 4, and L = trans-3-(3-pyridyl)acrylate) were similarly prepared with trans-3-(3-pyridyl)acrylic acid in place of 3-cyanopyridine. Compounds 3 and 4 are isostructural and exhibit network topologies similar to that of 1 with open channels occupied by disordered trans-3-(3-pyridyl)acrylic acid and water guest molecules. Crystal data for 1: triclinic space group Ponebar, a = 10.534(1) A, b = 11.907(1) A, c = 14.046(1) A, alpha = 106.645(1) degrees, beta = 101.977(1) degrees, gamma = 112.078(1) degrees, and Z = 4. Crystal data for 2: tetragonal space group P4/ncc, a = 20.089(1) A, c = 14.016(1) A, and Z = 4. Crystal data for 3: monoclinic space group C2/c, a = 14.082(2) A, b = 15.278(2) A, c = 18.537(2) A, beta = 105.360(2) degrees, and Z = 2. Crystal data for 4: monoclinic space group C2/c, a = 14.082(1) A, b = 15.250(1) A, c = 18.606(1) A, beta = 106.747(1) degrees, and Z = 2. 相似文献