共查询到20条相似文献,搜索用时 31 毫秒
1.
Two new iron(III) oxalatophosphates, Cs2Fe(C2O4)(0.5)(HPO4)2 (1) and CsFe(C2O4)(0.5)(H2PO4)(HPO4) (2), have been synthesized by using a low melting point eutectic mixture of choline chloride and malonic acid as a solvent and characterized by single-crystal X-ray diffraction and magnetic susceptibility. Crystal data are as follows: compound 1, monoclinic, P2(1)/c (No. 14), a = 8.5085(4) A, b = 12.7251(6) A, c = 9.8961(4) A, beta = 107.117(1) degrees , V = 1024.01(8) A(3), Z = 4, and R(1) = 0.0264; compound 2, monoclinic, P2(1)/n (No. 14), a = 8.0038(3) A, b = 10.2923(3) A, c = 11.4755(4) A, beta = 100.507(1) degrees , V = 929.47(5) A(3), Z = 4, and R(1) = 0.0311. The structure of 1 comprises FeO6 octahedra connected by HPO4(2-) tetrahedra and bisbidentate oxalate anions to form a 3D framework containing intersecting 12-ring channels, with the charge-compensating Cs+ cations being located at the intersections of these channels. The structure of 2 consists of 2D layers of octahedral FeO6, tetrahedral H2PO4- and HPO4(2-) moieties, and bisbidentate oxalate ligands with the Cs+ cations between the layers. They are the first examples for the use of ionic liquid as a solvent in the synthesis of metal oxalatophosphates. 相似文献
2.
The first metal phosphatooxalate containing a chiral amine, (R-C5H14N2)2[Ga4(C2O4)(H2PO4)2(PO4)4].2H2O, has been synthesized hydrothermally and characterized by single-crystal X-ray diffraction and 31P MAS NMR spectroscopy. It crystallizes in the monoclinic space group P2(1) (No. 4) with a = 8.0248(4) A, b = 25.955(1) A, c = 9.0127(5) A, beta = 100.151(1) degrees, and Z = 2. The structure consists of GaO6 octahedra and GaO4 tetrahedra connected by coordinating C2O4(2-) and phosphate anions to form anionic sheets in the ac plane with charge-compensating diprotonated R-2-methylpiperazinium cations and water molecules between the layers. There is a good correlation between the NMR spectrum and the structure. 相似文献
3.
The 1/2V2O5-H2C2O4/H3PO4/NH4OH system was investigated using hydrothermal techniques. Four new phases, (NH4)VOPO(4).1.5H2O (1), (NH4)0.5VOPO(4).1.5H2O (2), (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O (3), and (NH4)2[VO(HPO4)]2(C2O4).H2O (4), have been prepared and structurally characterized. Compounds 1 and 2 have layered structures closely related to VOPO(4).2H2O and A0.5VOPO4.yH2O (A = mono- or divalent metals), whereas 3 has a 3D open-framework structure. Compound 4 has a layered structure and contains both oxalate and phosphate anions coordinated to vanadium cations. Crystal data: (NH4)VOPO(4).1.5H2O, tetragonal (I), space group I4/mmm (No. 139), a = 6.3160(5) A, c = 13.540(2) A, Z = 4; (NH4)0.5VOPO(4).1.5H2O, monoclinic, space group P2(1)/m (No. 11), a = 6.9669(6) A, b = 17.663(2) A, c = 8.9304(8) A, beta = 105.347(1) degrees, Z = 8; (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O, triclinic, space group P1 (No. 2), a = 10.2523(9) A, b = 12.263(1) A, c = 12.362(1) A, alpha = 69.041(2) degrees, beta = 65.653(2) degrees, gamma = 87.789(2) degrees, Z = 2; (NH4)2[VO(HPO4)]2(C2O4).5H2O, monoclinic (C), space group C2/m (No. 12), a = 17.735(2) A, b = 6.4180(6) A, c = 22.839(2) A, beta = 102.017(2) degrees, Z = 6. 相似文献
4.
The reaction of UO(2)(NO(3))(2).6H(2)O with Cs(2)CO(3) or CsCl, H(3)PO(4), and Ga(2)O(3) under mild hydrothermal conditions results in the formation of Cs(4)[(UO(2))(2)(GaOH)(2)(PO(4))(4)].H(2)O (UGaP-1) or Cs[UO(2)Ga(PO(4))(2)] (UGaP-2). The structure of UGaP-1 was solved from a twinned crystal revealing a three-dimensional framework structure consisting of one-dimensional (1)(infinity)[Ga(OH)(PO(4))(2)](4-) chains composed of corner-sharing GaO(6) octahedra and bridging PO(4) tetrahedra that extend along the c axis. The phosphate anions bind the UO(2)(2+) cations to form UO(7) pentagonal bipyramids. The UO(7) moieties edge-share to create dimers that link the gallium phosphate substructure into a three-dimensional (3)(infinity)[(UO(2))(2)(GaOH)(2)(PO(4))(4)](4-) anionic lattice that has intersecting channels running down the b and c axes. Cs(+) cations and water molecules occupy these channels. The structure of UGaP-2 is also three-dimensional and contains one-dimensional (1)(infinity)[Ga(PO(4))(2)](3-) gallium phosphate chains that extend down the a axis. These chains are formed from fused eight-membered rings of corner-sharing GaO(4) and PO(4) tetrahedra. The chains are in turn linked together into a three-dimensional (3)(infinity)[UO(2)Ga(PO(4))(2)](1-) framework by edge-sharing UO(7) dimers as occurs in UGaP-1. There are channels that run down the a and b axes through the framework. These channels contain the Cs(+) cations. Ion-exchange studies indicate that the Cs(+) cations in UGaP-1 and UGaP-2 can be exchanged for Ca(2+) and Ba(2+). Crystallographic data: UGaP-1, monoclinic, space group P2(1)/c, a = 18.872(1), b = 9.5105(7), c = 14.007(1) A, beta = 109.65(3)(o) , Z = 4 (T = 295 K); UGaP-2, triclinic, space group P, a = 7.7765(6), b = 8.5043(7), c = 8.9115(7) A, alpha = 66.642(1)(o), beta = 70.563(1)(o), gamma = 84.003(2)(o), Z = 2 (T = 193 K). 相似文献
5.
The first two low-dimensional beryllium phosphates, [C5H14N2]2[Be3(HPO4)5].H2O (BePO-CJ29) and [C6H18N2]0.5[Be2(PO4)(HPO4)OH].0.5 H2O (BePO-CJ30), have been successfully synthesized under mild hydrothermal/solvothermal conditions. BePO-CJ29 is built up from strict alternation of BeO4 and HPO4 tetrahedra forming a unique one-dimensional double chains with 12-ring apertures. There are pseudo-10-ring apertures enclosed by two double chains through H-bonds. BePO-CJ29 can also be viewed as a pseudo 2-D layered structure stabilized by strong H-bonds. The diprotonated 2-methylpiperazium cations are located at three positions (i.e., inside the 12-ring aperture, inside the pseudo-10-ring aperture, and in the interlayer of the inorganic pseudo-layers. BePO-CJ30 is constructed by the alternation of Be-centered tetrahedra (including BeO4 and HBeO4) and P-centered tetrahedra (including PO4 and HPO4) resulting in a two-dimensional layered structure parallel to the (0 1 1) direction. The complex layer is composed of coupled 4.8 net sheets. The diprotonated 1,6-hexandiamine cations and water molecules reside in the interlayer regions and interact with the inorganic layers through H-bonds. Crystal data are as follows: [C5H14N2]2[Be3(HPO4)5].H2O (BePO-CJ29), triclinic, P1 (No. 2), a = 8.1000(9) A, b = 8.4841(14) A, c = 19.665(2) A, alpha = 89.683(10) degrees, beta = 78.182(8) degrees, gamma = 87.932(9) degrees, V = 1321.9(3) A3, Z = 2, R1 = 0.0523 (I > 2sigma(I)), and wR2 = 0.1643 (all data); [C6H18N2]0.5[Be2(PO4)(HPO4)OH].0.5 H2O (BePO-CJ30), orthorhombic, Pccn (No. 56), a = 26.01(4) A, b = 8.431(12) A, c = 9.598(13) A, V = 2105(5) A3, Z = 8, R1 = 0.0833 (I > 2sigma(I)), and wR2 = 0.2278 (all data). 相似文献
6.
A novel gallium phosphate, Ga(2,2'-bipy)(HPO(4))(H(2)PO(4)) (denoted FJ-12; FJ = Fujian Institute of Research on the Structure of Matter), which is the first example of layered inorganic-organic hybrid gallium phosphate with neutral framework, has been hydrothermally synthesized and structurally characterized by single-crystal X-ray diffraction. This compound crystallizes in the monoclinic system, space group P2(1)/c (No. 14), with a = 10.9443(9), b = 15.8253(13), and c = 8.4201(7) A, beta = 108.898(2) degrees, V = 1379.7(2) A(3), and Z = 4. The structure consists of HPO(4) and H(2)PO(4) tetrahedra and unusual GaO(4)N(2) octahedra which are linked through their vertexes forming an undulated sheetlike structure with 4.12-net. The adjacent layers are stably packed together and exhibit interesting 3-D supramolecular arrays pi-pi interactions of the 2,2'-bipy groups. 相似文献
7.
Natarajan S 《Inorganic chemistry》2002,41(21):5530-5537
Hydro/solvothermal reactions of ZnO, HCl, H(3)PO(4), 1,4-diazacycleheptane (homopiperazine), and H(2)O under a variety of conditions yielded three new organic-inorganic hybrid materials, [C(5)N(2)H(14)][Zn(HPO(4))(2)].xH(2)O (x = approximately 0.46), I, [C(5)N(2)H(14)][Zn(3)(H(2)O)(PO(4))(2)(HPO(4))], II, and [C(5)N(2)H(14)][Zn(2)(HPO(4))(3)].H(2)O, III. While I has a one-dimensional structure, II possesses a two-dimensional layered structure, and III has a three-dimensional structure closely related to the ABW zeolitic architecture. All the compounds consist of vertex linking of ZnO(4), PO(4), and HPO(4) tetrahedral units. The fundamental building unit, single four-membered ring (S4R), is present in all the cases, and the observed differences in their structures result from variations in the connectivity between the S4R units. Thus I has a corner-shared S4R forming an infinite one-dimensional chain, II has two corner-shared chains fused through a 3-coordinated oxygen atom forming a strip and a layer with eight-membered apertures, and III has S4R units connected via oxygen atoms to give rise to channels bound by eight T atoms (T = Zn, P) in all crystallographic directions. Crystal data: I, monoclinic, space group = P2(1)/n (No. 14), a = 8.6053(3) A, b = 13.7129(5) A, c = 10.8184(4) A, beta = 97.946(1) degrees, V = 1264.35(8) A(3), Z = 4; II, monoclinic, space group = P2(1)/c (No. 14), a = 11.1029(1) A, b = 17.5531(4) A, c = 8.2651(2) A, beta = 97.922(2) degrees, V = 1595.42(5) A(3), Z = 4; III, monoclinic, space group = P2(1) (No. 4), a = 8.0310(2) A, b = 10.2475(3) A, c = 10.570(3) A, beta = 109.651(1) degrees, V = 819.24(3) A(3), Z = 2. 相似文献
8.
Josien L Simon-Masseron A Gramlich V Patarin J 《Chemistry (Weinheim an der Bergstrasse, Germany)》2002,8(7):1614-1620
Mu-23, [(C(6)H(15)N(2))(C(6)H(16)N(2))Ga(5)F(6)(H(2)O)(2)(PO(4))(4)] x 4 H(2)O, the first layered fluorinated gallophosphate with a Ga/P molar ratio of 5:4, was obtained in the presence of fluoride ions with 1,4-dimethylpiperazine as an organic template. It crystallizes in the triclinic space group P1 (no. 2) with unit cell parameters a=8.735(11), b=8.864(5), c=12.636(10) A, alpha=98.36(5), beta=100.18(8), gamma=115.84(7) degrees. The layers consist of GaO(2)F(3)(H(2)O), GaO(4)F(2) octahedra, and GaO(4) and PO(4) tetrahedra; these moieties share their oxygen and some of their fluorine atoms. The connectivity scheme of these different polyhedra leads to the formation of eight-membered rings. 相似文献
9.
A novel one-dimensional inorganic-organic hybrid gallophosphate compound, Ga(2,2′-bipy)(HPO4)· (H2PO4)(denoted JGP-2) was synthesized hydrothermally with 2,2′-bipyridine as a ligand and characterized by X-ray powder diffraction (XRD), elemental analysis, inductively coupled plasma(ICP), TGA analysis, solid-state 31P NMR, and luminescence spectra and structurally determined by single-crystal X-ray diffraction analysis. JGP-2 crystallized in the triclinic system, space group Pī(No.2), with a=0.7818(1) nm, b=0... 相似文献
10.
Two new transition-metal gallophosphates, (H(2)C(4)H(10)N(2))(3)[(Ti(2.5)(H(2)O)(4)Ga(5.5)(PO(4))(10)].2H(2)O (TGP-1) and [H(3.5)(C(4)H(13)N(3))(2)][(Ni(0.5)(OH)(4)Ga(5.5)(PO(4))(3)(HPO(4))(4)].2H(2)O (NGP-1), have been synthesized under mild hydrothermal conditions and characterized by single-crystal X-ray diffraction, thermogravimetric analysis, electron paramagnetic resonance, electron probe microanalysis, and magnetic susceptibility data. TGP-1 exhibits a unique two-dimensional structure consisting of tetrahedral and octahedral metals centers and is the foremost paramagnetic TiGaPO material ever prepared. NGP-1 as well represents the first NiGaPO compound and adopts a layer structure that is constructed from hexameric M-O clusters of trigonal bipyramids and octahedra. In both compounds, the transition metals incorporate with gallium into octahedral sites only, while the four- and five-coordinated metals centers are only Ga(3+) ions. The unique sites for Ti(3+) and Ni(2+) ions have been initially elucidated from single-crystal structure refinements and further confirmed by bond-valence-sum calculations, EPR, and magnetic susceptibility studies. Crystal data: TGP-1, monoclinic, P2(1)/c; a = 25.692(2) A, b = 9.6552(8) A, c = 9.8418(8) A, beta = 96.737(2)(o) , V = 2424.5(3) A(3), and Z = 2; NGP-1, monoclinic, C2/c, a = 20.8363(12) A, b = 11.9546(7) A, c = 16.4577(9) A, beta = 117.285(1)(o) , V = 3643.3(1) A(3), Z = 4. 相似文献
11.
A new rubidium zinc hydrogen phosphate, Rb2Zn2(HPO4)3, is prepared by an unusual method utilizing long nucleation times. This material is crystallized from a gel with an initial composition of 1.0 ZnO/0.94 P2O5/0.96 Rb2O/0.04 Li2O/41 H2O, while the phosphate concentration equals 1.6 M and pH = 3.5. The gel is placed in a sealed Pyrex flask at 52 degrees C, and after 4.5 months crystallization of Rb2Zn2(HPO4)3 is noticed. This new crystalline compound has a three-dimensional framework structure built from spiral chains of alternating PO4 and ZnO4 tetrahedra connected pairwise and assembled by other PO4 tetrahedra, rubidium ions, and hydrogen bonds. The two rubidium ions, Rb(1) and Rb(2), have an exceptionally low number of oxygen contacts in the first coordination sphere, five and seven, respectively. Crystal data: monoclinic, P2(1)/c (no. 14), a = 12.5880(4), b = 12.7170(8), c = 7.5827(8) A, beta = 96.100(1) degrees, Z = 4. A single-crystal 31P NMR investigation of Rb2Zn2(HPO4)3 was performed employing a two-axis goniometer probe and reveals the presence of three chemically and six magnetically nonequivalent phosphorus sites, in accordance with the crystal structure. 31P chemical shielding anisotropies and isotropic chemical shifts (-3.3(3), -2.6(3), and 2.0(3) ppm) have been determined for the three phosphorus sites. 相似文献
12.
Single crystals of three new layered uranium phosphate fluorides, A(UO2)F(HPO4).xH2O (A = Cs+, Rb+, and K+; x = 0-1) have been synthesized by hydrothermal reactions using UO3, H3PO4, HF, and corresponding alkali metal halides as reagents. Although all three new materials have layered structures, each of them contains different structural motifs within the layer. While Cs(UO2)F(HPO4).0.5H2O and Rb(UO2)F(HPO4) reveal noncentrosymmetric crystal structures, K(UO2)F(HPO4).H2O crystallizes in a centrosymmetric space group. In addition, the ion-exchanged phases for all three materials are highly crystalline. Crystal data: Cs(UO2)F(HPO4).0.5H2O, orthorhombic, space group Pca21 (No. 29), with a = 25.656(5) A, b = 6.0394(12) A, c = 9.2072(18) A, and Z = 4; Rb(UO2)F(HPO4), orthorhombic, space group Cmc21 (No. 36), with a = 17.719(4) A, b = 6.8771(14) A, c = 12.139(2) A, and Z = 8; K(UO2)F(HPO4).H2O, monoclinic, P21/n (No. 14), with a = 6.7885(14) A, b = 8.7024(17) A, c = 12.020(2) A, beta = 94.09(3), and Z = 4. 相似文献
13.
The syntheses, crystal structures, and properties of C(4)N(3)OH(7).ZnHPO(3), C(4)N(3)OH(7).Zn(H(2)O)HPO(3), and (C(4)N(3)OH(7))(2).ZnHPO(3).H(2)O are reported. These new creatinine zinc phosphites are built up from networks of vertex-sharing HPO(3) pseudopyramids and various types of ZnO(2)N(2), ZnO(3)N, and ZnO(2)N(H(2)O) tetrahedra, resulting in extended structures of different dimensionalities (as sheets, clusters, and chains, respectively). They demonstrate the structural effect of incorporating "terminal" (nonnetworking) Zn-N and Zn-OH(2) moieties into zinc centers. Crystal data: C(4)N(3)OH(7).ZnHPO(3), triclinic, P1 (No. 2), a = 8.9351(4) A, b = 9.5011(4) A, c = 9.9806(4) A, alpha = 87.451(1) degrees, beta = 85.686(1) degrees, gamma = 89.551(1) degrees, Z = 4; C(4)N(3)OH(7).Zn(H(2)O)HPO(3), monoclinic, P2(1)/c (No. 14), a = 10.1198(7) A, b = 7.2996(5) A, c = 13.7421(9) A, beta = 107.522(1) degrees, Z = 4; (C(4)N(3)OH(7))(2).ZnHPO(3).H(2)O, triclinic, P1 (No. 2), a = 10.7289(6) A, b = 10.9051(6)A, c = 13.9881(8) A, alpha = 89.508(1) degrees, beta = 74.995(1) degrees, gamma = 74.932(1) degrees, Z = 4. 相似文献
14.
New amine-templated zinc phosphates with a temperature-induced increase of structural dimensionality
Three new amine-templated zinc phosphates, [C4N2H14][Zn(HPO4)2].H2O, AU-I, [C4N2H14][Zn2(H(0.5)PO4)2(H2PO4)], AU-II, and [C4N2H14][Zn5(H2O)(PO4)4], AU-III, are prepared by hydrothermal synthesis using an organic amine, N,N'-dimethylethylendiamine CH3NHCH2CH2NHCH3, as structure-directing agent. The three materials are prepared from the same reaction mixture, 1Zn(CH3CO2)2:3.05H3PO4:2.25CH3NHCH2CH2NHCH3:138H2O (pH = 5.1), AU-I at RT, AU-II at 60 degrees C, and AU-III at 170 degrees C. The materials are built from corner-sharing ZnO4 and PO4 tetrahedra forming chains, layers, or framework structures for AU-I to III, respectively, and are linked together by hydrogen bonds via the diprotonated amine ions. The complete hydrogen-bond scheme is resolved for these new compounds and reveals some interesting phenomena, for example, a hydrogen shared between two phosphate groups in AU-II, thereby forming H(0.5)PO4 groups. Furthermore, the water molecules are different; that is, in AU-I they act as hydrogen-bond donor and acceptor, whereas they act as ligand in AU-III with coordination to Zn. The structures of the compounds are determined by single-crystal X-ray diffraction analysis. AU-I, [C4N2H14][Zn(HPO4)2].H2O, crystallizes in the triclinic space group P-1, a = 8.215(2), b = 8.810(3), c = 8.861(3) A, alpha = 88.001(4) degrees , beta = 89.818(5) degrees , and gamma = 89.773(5) degrees , Z = 2. AU-II, [C4N2H14][Zn2(H(0.5)PO4)2(H2PO4)], is monoclinic, P2/n, a = 11.7877(4), b = 5.2093(2), c = 12.2031(4) A, beta = 98.198(1) degrees , Z = 2. AU-III, [C4N2H14][Zn5(H2O)(PO4)4], crystallizes in the orthorhombic space group Pna2(1) with lattice parameters, a = 20.723(2), b = 5.2095(6), c = 17.874(2) A, Z = 4. The phase stability investigated by systematic hydrothermal synthesis is presented, and the materials are further characterized by 31P solid-state MAS NMR, for example, by determination of 31P chemical shift anisotropies for AU-III, while the thermal behavior is investigated by thermogravimetry (TG). 相似文献
15.
Colin JF Bataille T Ashbrook SE Audebrand N Le Pollès L Pivan JY Le Fur E 《Inorganic chemistry》2006,45(15):6034-6040
The vanadyl oxalatophosphate Na2[(VO)2(HPO4)2C2O4].2H2O has been synthesized by hydrothermal treatment. Its structure has been determined and refined by combining X-ray powder diffraction and solid-state NMR techniques. It crystallizes with monoclinic symmetry in space group P2(1), a = 6.3534(1) A, b = 17.1614(3) A, c = 6.5632(1) A, beta = 106.597(1) degrees . The structure is related to that of (NH4)2[(VO)2(HPO4)2C2O4].5H2O, which was previously reported. The vanadium phosphate framework consists of infinite [(VO)(HPO4)] chains of corner-sharing vanadium octahedra and hydrogenophosphate tetrahedra. The oxalate groups ensure the connection between the chains to form a 2D structure. The sodium ions and the water molecules are located between the anionic [(VO)2(HPO4)2C2O4]2- layers. The thermal decomposition has been studied in situ by temperature-dependent X-ray diffraction and thermogravimetry. It takes place in three stages, where the first two correspond to water removal and the last to the decomposition of the oxalate group and water elimination, leading to the final product NaVOPO4. 相似文献
16.
C(4)N(3)OH(7).Zn(H(2)O)HPO(4), built up from 4-rings of ZnO(2)(H(2)O)N and HPO(4) tetrahedra, is the first neutral, molecular, zincophosphate cluster. The unit-cell packing involves numerous O-H...O and N-H...O hydrogen bonds and pi...pi stacking interactions. Crystal data: C(4)N(3)OH(7).Zn(H(2)O)HPO(4), M(r) = 292.49, triclinic, P1 (No. 2), a = 9.2956(5) A, b = 11.2077(6) A, c = 19.8319(12) A, alpha = 80.314(1) degrees, beta = 78.829(1) degrees, gamma = 89.241(1) degrees, V = 1997.7(2) A(3), Z = 4. 相似文献
17.
Four new ethylenediamine-templated iron arsenates and fluoroarsenates have been hydrothermally synthesized from iron metal, hydrofluoric and arsenic acids, and ethylenediamine. Fe(H2AsO4)(HAsO4)2.enH2.H2O (1) is one-dimensional and contains chains, FeIIIFeIIF2(HAsO4)(AsO4).enH2.2H2O (2) is a layered fluoroarsenate, and Fe3(HAsO4)6.enH2.NH3.NH4 (3) and Fe2F2(AsO4)2(H2O).enH2 (4) are an arsenate and a fluoroarsenate, respectively, with three-dimensional open-framework type structures. Compounds 1, 3, and 4 contain Fe(III) only, while 2 is a mixed-valence compound of Fe(III) and Fe(II). The structures were determined from single-crystal X-ray diffraction. Crystal data: (1) P2(1), a = 4.762(1) A, b = 16.086(3) A, c = 8.698(2) A, beta = 90.65(3) degrees, Z = 2; (2) P-1, a = 5.289(1) A, b = 7.573 (1) A, c = 8.888(2) A, alpha = 67.32(3) degrees, beta = 82.77(3) degrees, gamma = 69.76(3) degrees, Z = 1; (3) C2/c, a = 18.384(3) A, b = 8.785(1) A, c = 16.052(2) A, beta = 111.11(1) degrees, Z = 4; (4) Pbca, a = 10.490(2) A, b = 10.090(2) A, c = 20.540(4) A, Z = 8. Strong hydrogen bonding exists between the chains and the layers in 1 and 2, and between the diprotonated ethylenediamine and the inorganic part of the structures of 1, 2, and 4. The ethylenediamine in 3 is not hydrogen bonded, and as a result it is disordered. The compounds are characterized also by thermogravimetric analysis, infrared spectroscopy, elemental analysis, and magnetic measurements. 相似文献
18.
A new layered aluminophosphate, [C6N3H17][Al2(HPO4)(PO4)2] (denoted AlPO-CJ21), has been prepared in an alcoholic system by the use of N-(2-aminoethyl)-piperazine (AEPP) as the template. Its inorganic layer containing a series of bridged six-membered rings (MRs) is a new type of 4.6-net sheet built up from AlO4, PO2(OH)(=O), and PO3(=O) tetrahedra. Interestingly, inorganic helical chains of right- or left-handedness are presented in the aluminophosphate layers, and fascinating hydrogen-bonded helices are self-assembled under solvothermal conditions between organic templates and inorganic sheets via strong hydrogen bondings of O...N atoms. Crystal data: monoclinic, P2(1) (No. 4), a = 10.069(2) A, b = 8.0875(16) A, c = 10.598(2) A, beta = 94.71(3) degrees, z = 2, R(1) = 0.0325 [I > 2sigma(I)], and wR(2) = 0.0807 (all data); Flack parameter: 0.03. 相似文献
19.
C(4)N(2)O(3)H(8).ZnHPO(3) is the first zincophosphite framework to be templated by an amino acid (l-asparagine), which bonds to Zn via a carboxyl O atom. It contains infinite, homochiral, helical 4-ring chains of ZnO(4) and HPO(3) groups, stabilized by intra- and interchain N-H.O hydrogen bonds. Crystal data: C(4)N(2)O(3)H(8).ZnHPO(3), M(r) = 277.49, orthorhombic, P2(1)2(1)2(1) (No. 19), a = 5.0349(2) A, b = 9.4539(4) A, c = 18.6092(8) A, V = 885.79 (6) A(3), Z = 4. 相似文献
20.
A new manganese gallium phosphate, Mn3(H2O)6Ga4(PO4)6, has been synthesized under hydrothermal conditions at 150 degrees C and characterized by single-crystal X-ray diffraction, thermogravimetric analysis, magnetic susceptibility, and electron paramagnetic resonance (EPR) spectroscopy. It crystallized in the monoclinic space group, P2(1)/n, with a = 8.9468(4) A, b = 10.148(5) A, c = 13.5540(7) A, beta = 108.249(1) degrees, and Z = 2. The compound is unusual in that it is not only the first nonoranically templated MnGaPO phase but also the first instance where edge-shared trinuclear manganese-oxygen clusters are encapsulated in a metal phosphate lattice. The trimer involves a central Mn(H2O)4O2 octahedron, which links to two Mn (H2O)2O4 octahedra at trans edges. The Mn3(H2O)6O8 clusters reside in tunnels built from GaO5 trigonal bipyramids and PO4 tetrahedra. Our magnetic study revealed that superexchange interactions occurred between the neighboring MnII centers. A good fit of the magnetic susceptibility data for the isolated trimers was obtained by using a derived expression based on Van Vleck's equation. Unlike all existing linear trinuclear MnII complexes, the chi MT product in the range 8-4 K remains at a constant value corresponding to one spin S = 5/2 per three MnII centers. The Curie behavior at such low temperatures has been confirmed by EPR data. According to the thermogravimetric analysis/differential thermal analysis (TGA/DTA) results, the title compound is thermally stable up to ca. 200 degrees C. 相似文献