共查询到20条相似文献,搜索用时 343 毫秒
1.
The reaction of silver 4,4′-biphenyldicarboxylate with 1,3-diaminopropane (DAP) and 2-amino-5-methylpyridine (AMP) respectively results in the formation of two dinuclear silver(I) complexes: [Ag2(DAP)2](BPC)·2H2O (1) and [Ag2(BPC)(AMP)4]·2H2O (2), where BPC is 4,4′-biphenyldicarboxylate. The complexes are characterized by elemental analysis and X-ray crystallography. Complex 1 crystallizes in the triclinic system, P-1 space group, a = 8.585(2) Å, b = 8.849(2) Å, c = 9.890(3) Å, α = 107.893(3)°, β = 94.139(3)°, γ = 113.202(3)°, V = 640.9(3) Å3, Z = 1. Complex 2 crystallizes in the triclinic system, P-1 space group, a = 11.818(3) Å, b = 13.132(4) Å, c = 13.281(4) Å, α = 92.571(4)°, β = 96.425(3)°, γ = 102.142(4)°, V = 1997.5(10) Å3, Z = 2. Complex 1 consists of a macrocyclic dinuclear silver(I) dication, a 4,4′-biphenyldicarboxylate anion, and two water molecules of crystallization. Each Ag atom is in a linear coordination. Complex 2 consists of a dinuclear silver(I) complex molecule and two water molecules of crystallization. Each Ag atom is in a T-shaped coordination. The Ag...Ag separations are 5.127(2) Å in 1 and 3.172(2) Å in 2. 相似文献
2.
A. O. Tokareva D. S. Tereshchenko A. I. Boltalin S. I. Troyanov 《Russian Journal of Coordination Chemistry》2006,32(9):663-668
Anhydrous and partially hydrated acid trinuclear trifluoroacetates of divalent transition metals of the composition [M3(CF3COO)6(CF3COOH)6)](CF3COOH) and [M3(CF3COO)6(CF3COOH)2(H2O)4)](CF3COOH)2, respectively, where M = Co (I, III) Ni (II, IV), were synthesized and studied by X-ray diffraction. Complexes I and II were obtained by crystallization from solutions of M(CF3COO)2 · 4H2O in trifluoroacetic anhydride; complexes III and IV were synthesized under the same conditions with the use of 99% trifluoroacetic acid as a solvent. Crystals I are triclinic: space group $P\bar 1$ , a = 13.199(6) Å, b = 14.649(6) Å, c = 15.818(6) Å, α = 90.04(4)°, β = 114.32(4)°, γ = 108.55(4)°, V = 2611.3(19) Å3, Z = 2, R = 0.0480. Crystals II are trigonal: space group $R\bar 3$ , a = 13.307(2) Å, c = 53.13(1) Å, V = 8148(2) Å3, Z = 6, R = 0.1112. Crystals III are triclinic: space group $P\bar 1$ , a = 9.001(8) Å, b = 10.379(9) Å, c = 12.119(9) Å, α = 83.67(5)°, β = 72.33(5)°, γ = 83.44(5)°, V = 1068.3(15) Å3, Z = 1 Å, R = 0.1031. Crystals IV are triclinic: space group $P\bar 1$ , a = 9.121(18) Å, b = 10.379(2) Å, c = 12.109(2) Å, α = 84.59(3)°, β = 72.20(3)°, γ = 82.80(3)°, V = 1080.94(40) Å3, Z = 1, R = 0.0334. 相似文献
3.
Yu. M. Chumakov N. M. Samus’ G. Bocelli K. Yu. Suponitskii V. I. Tsapkov A. P. Gulya 《Russian Journal of Coordination Chemistry》2006,32(1):14-20
3-Phenylpropenal thiosemicarbazone hydrate C6H5-HC=CH-CH=N-NH-C(S)-NH2 · H2O (HL · H2O, I) and two chelates [Ni(L)2] · nCH3OH (II) and [Zn(L)2] (III) are studied by X-ray diffraction. The crystals of I are orthorhombic: a = 6.227(1) Å, b = 7.763(2) Å, c = 25.585(5) Å, β = 90°, space group P212121, Z = 4, R = 0.0426. A nonplanar molecule of I has an E conformation. The crystals of II are triclinic: a = 6.551(2) Å, b = 10.752(3) Å, c = 10.885(3) Å, α = 64.751(5)°, β = 82.753(5)°, γ = 89.857(5)°, space group, Z = 1, R = 0.0661. In a centrosymmetric molecule of II, the central atom coordinates two deprotonated ligands L through the immine nitrogen atom and thioamide sulfur atom at the vertices of a distorted square. The crystals of III are monoclinic: a = 25.342(2) Å, b = 9.150(2) Å, c = 21.340(3) Å, α = 90°, β = 111.84(2)°, γ = 90°, space group C2/c, Z = 8, R = 0.0556. In a molecule of complex III, two deprotonated bidentate ligands L are coordinated by the zinc ion through the immine nitrogen atoms and thioamide sulfur atoms to form a distorted tetrahedron at the central atom. In both II and III, ligand L after coordination by the metal ion changes the E conformation with respect to the N(1)-C(2) bond for the Z conformation. In crystals I-III, molecules are packed to form infinite layers parallel to the planes (001) and (010). 相似文献
4.
A. V. Noshchenko Yu. I. Slyvka A. V. Pavlyuk M. G. Mys’kiv 《Russian Journal of Coordination Chemistry》2010,36(8):585-590
Reactions of a solution of AgNO3 in aqueous methanol with solutions of 1,4-diallylpiperazine (acidified with HNO3 to pH = 4) and 1-allyloxybenzotriazole in ethanol gave the crystalline silver(I) π-complexes [Ag2(C4H8N2(C3H5)2(H+)2)(H2O)2(NO3)2](NO3)2 (I) and [Ag(C6H4N3(OC3H5)(NO3))] (II). Their crystal structures were determined by X-ray diffraction. Crystals of complexes I and II are monoclinic, space group P21/c; for I: a = 7.053(3)Å, b = 9.389(3)Å, c = 15.488(4)Å, β = 91.60°, V = 1025.3(6)Å3, Z = 4; for II: a = 10.650(4)Å, b = 15.062(5)Å, c = 7.412(4)Å, β = 104.20(3)°, V = 1152.6(8)Å3, Z = 4. In both structures, the organic components act as bidentate ligands forming with AgNO3 34- and 14-membered topological rings, respectively. In complex I, the nearly tetrahedral environment of the Ag(I) atom is made up of the olefinic C=C bond, the O atoms of the nitrate anions, and the water molecule. 1-Allyloxybenzotriazole in structure II causes the deformation of the coordination polyhedron of Ag into a trigonal pyramid via inclusion of the ligand N atom in its coordination sphere. The topological units of the complexes form infinite polymer layers linked by anionic NO 3 ? bridges. In structure I, these layers are united through a system of hydrogen bonds into a three-dimensional framework. 相似文献
5.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev 《Russian Journal of Coordination Chemistry》2011,37(2):95-99
The coordination polymers [Ag(C4H10N2)]CH3SO3 (I) and [Ag(C4H10N2)]PO2F2 (II) (C4H10N2 is piperazine (Ppz)) are synthesized, and their structures are determined. The crystals of I are monoclinic, space group P21/c, a = 6.280(1) Å, b = 11.781(1) Å, c = 12.112(1) Å, β = 97.21(1)°, V = 889.0(2) Å3, ρcalcd = 2.160 g/cm3, and Z = 4. The crystals of II are orthorhombic, space group Cmca, a = 13.039(1) Å, b = 10.450(1) Å, c = 12.837(1) Å, V = 1749.1(3) Å3, ρcalcd = 2.240 g/cm3, and Z = 8. Structure I contains cationic polymer chains [Ag(Ppz)] ∞ + . The silver atom bound to two nitrogen atoms of two Ppz ligands has an almost linear coordination mode (Ag-Naverage 2.197 Å, angle NAgN 161.2(1)°). The structure includes supramolecular layers due to weak interactions Ag…O(CH3SO3). Structure II is built of zigzag polymer chains [Ag(Ppz)]+ and tetrahedral cations PO2F 2 ? . The Ag+ ion has a linear coordination mode (Ag-N 2.220(3) Å, and the NAgN angle is 164.3(2)°). The tetrahedral anions PO2F 2 ? having weak contacts with the silver ions (Ag…O 2.630(3)Å) join the [Ag(Ppz)] ∞ + chains into wavy layers. 相似文献
6.
K. K. Palkina A. N. Kochetov E. V. Savinkina L. Yu. Alikberova 《Russian Journal of Inorganic Chemistry》2006,51(11):1743-1749
An Ag(I) complex with HL (I), AgL (AgC23H15O3, II), has been synthesized. Compounds I and II have been studied by X-ray diffraction. The crystals are monoclinic, I: space group P21/n, a = 10.459(2) Å, b = 12.354(2) Å, c = 13.390(3) Å, β = 96.67(3)°, Z = 4; II: space group P21/c, a = 10.764(2) Å, b = 10.683(2) Å, c = 15.939(3) Å, β = 101.57(3)°, Z = 4. The structural units of the crystal of I are neutral molecules with intramolecular hydrogen bonds. In structure II, the Ag2O6 dimeric groups and the ligands form infinite openwork layers perpendicular to the x axis and containing cavities. The layers are penetrated by channels with an oblong cross section. In the crystal of II, all intermolecular distances exceed the sums of the van der Waals radii of the corresponding atoms. 相似文献
7.
Complexes RbL (I) and [Li2(C2H5OH)L2] (II) (L = C23H15O3) have been synthesized and their crystal structures have been studied. Both compounds have monoclinic crystals with space group P21/c and Z = 4; I: a = 11.632(2) Å, b = 15.154(3) Å, c = 11.457(2) Å, β = 104.34(3)°; II: a = 12.982(3)Å, b = 12.083(2) Å, c = 25.317(5) Å β = 100.11(3)°. In the structure of I, dimeric groups [Rb2O6] with a shared edge are linked by the ligands to give infinite layers perpendicular to the x axis and cavities that form oblong channels. In the structure of II, Li2O7 dimers are formed by vertex sharing. The coordination of one of the lithium atoms (Li(1)) is completed to tetrahedral by the oxygen atom of the ethanol molecule. The structure of II, like that of I, is layered. 相似文献
8.
Thomas C. W. Mak 《Journal of inclusion phenomena and macrocyclic chemistry》1990,8(1-2):199-214
The title complexes (1, X = F;2, X = C 1; 3, X = Br and isomorphous with2; 4, X = I) have been prepared and characterized by X-ray crystallography. Crystal data, MoKα radiation:1, space groupCc,Z =4,a = 12.017(3),b = 14.263(5),c = 17.210(7) Å,β = 103.06(2)°, andR F =0.053 for 2044 observed data;2, space groupCc,Z = 4,a = 12.817(3),b = 11.072(2),c = 16.781(5) Å,β =90.74(2)°,R F = 0.044 for 2249 data;3,a = 12.873(4),b = 11. 119(2),c = 16.957(2) Å,β = 89.11(2)°,R F = 0.049 for 2059 data;4, space groupP21/n,Z = 4,a = 8.858(2),b = 14.358(3),c = 15.379(3) Å,β = 93.88(1)°,R F = 0.068 for 3119 data. In all four structures each thiourea molecule interacts with adjacent thiourea molecules via N-H ... S hydrogen bonds to give a ribbon-like arrangement, and also forms a pair of ‘chelating’ N-H ... X hydrogen bonds with a halide ion, resulting in an anionic framework (in1–3) or composite ribbon (in4) as a component in the crystal packing. The measured ranges of N... X distances are: 2.819(5)-2.994(7) Å for1, 3.252(3)-3.291(3)Å for 2, 3.353(6)-3.459(6)Å for3, and 3.564(5)-3.680(5) Å for 4. 相似文献
9.
The self-assembly of unsymmetrical tecton 3-nitro-5-(pyridin-4-yl)benzoic acid (HL)with cobalt chloride under hydrothermal conditions affords a new 2D coordination polymer [Co(L)2] n (1, L = 3-nitro-5-(pyridin-4-yl)benzoate), which is characterized by elemental analysis, infrared spectroscopy, thermogravimetric analysis, powder X-ray diffraction analysis, and single crystal X-ray diffraction. Compound 1 is of the triclinic system, space group P-1 with a = 9.7857(12) Å, b = 10.3417(13) Å, c = 10.8463(13) Å, α = 85.155(2)°, β = 74.785(2)°, γ = 88.962(2)°, V = 1055.4(2) Å3. The crystal structural analysis of complex 1 shows that the cobalt center is six-coordinated in an octahedral geometry by four O atoms from four different L ligands and two N atoms from two different L ligands; the Co(II) cations are bridged by μ3-L into an interesting two-dimensional network structure. It should be pointed out that the thermal analysis results indicate that complex 1 is quite stable up to 420°C. 相似文献
10.
V. N. Serezhkin E. V. Peresypkina S. A. Novikov A. V. Virovets L. B. Serezhkina 《Russian Journal of Inorganic Chemistry》2014,59(8):788-797
Four new fluorochromatouranylates, namely, K[UO2(CrO4)F] · 1.5H2O (I), Rb[UO2(CrO4)F] · 1.5H2O (II), Rb[UO2(CrO4)F] · 0.5H2O (III), and Cs[UO2(CrO4)F] · 0.5H2O (IV), have been synthesized, and their crystallographic characteristics have been determined. All the compounds crystallize in monoclinic system, space group P21/c, with the unit cell parameters a = 13.1744(5) Å, b = 9.4598(3) Å, c = 13.0710(4) Å, β = 103.746(1)°, Z = 4, R = 0.0235 (I); a = 13.5902(7) Å, b = 9.5022(4) Å, c = 13.2271(6) Å, β = 102.914(2)°, Z = 4, R = 0.0247 (II); a = 24.7724(8) Å, b = 12.6671(4) Å, c = 9.4464(3) Å, β = 97.661(1)°, Z = 8, R = 0.0448 (III); a = 25.725(1) Å, b = 12.8261(5) Å, c = 9.4929(4) β = 97.208(1)°, Z = 8 (IV). The pairs of compounds I and II and compounds III and IV are isostructural. Crystals of compounds I–III have been subjected to complete X-ray diffraction study. It has been established that the structures of compounds I–III are built of [UO2(CrO4)F] n n? layers, which are parallel to the (100) plane and linked into a framework by alkali-metal cations located between layers, together with water molecules. The effect of topological and geometric isomerism on the structural features of 34 known uranyl compounds of the AT3M2 crystallochemical group, to which the studied compounds I–III also belong, is discussed. 相似文献
11.
Synthetic methods are reported for the preparation of compounds containing the trinuclear triangular cluster [W3S4Br3(depe)3[+. These involve reactions between WBr5 and NaB(C2 H5)3H or NaBH4 as reducing agent in THF, and subsequent addition of methanolic solutions of NaHS and depe ligand. Both compounds, [W3S3Br3(depe)3]PF6·0.5C7H8,1, and [W3S4Br3(depe)3]Br·2CH3OH,2, are characterized by x-ray single crystal studies. Compounds1 and2 crystallize in space group \(P\bar 1\) . For1,a=10.427 (3) Å,b=15.415(4) Å,c=18.140(5) Å, α=79.36(2)°, β=73.59(2)°, γ=81.54(2)°, andV=2734.8(2) Å3;R=0.050 and for 2a=10.491(3) Å,b=15.074(3) Å,c=18.246 Å, α=95.76(2)°, β=105.82(2)°, γ=98.18(2)°, andV=2718.4(3) Å3;R=0.081. The two cations in1 and2 possess C3 symmetry. The W-W distances are in the range 2.783?2.891 Å (for1) and 2.778?2.785 Å (for2) and the average W-Br distances in1 and2 are 2.616[2] Å and 2.594[4] Å, respectively. Each metal atom in the [W3S4Br3(depe)3]+ ions is attached to one capping sulfur atom, two bridging sulfur atoms, one bromine atom, and one chelating depe ligand. One P atom in depe ligand istrans to μ3-S and the otherP atom istrans to a μ2-S atom. UV-Vis and NMR spectra for these compounds are also reported. 相似文献
12.
New heteroligand Cu(II) and Zn(II) complexes with the α-naphthylacetic acid anion (NAA) and monoethanolamine (MEA), [M(NAA)2(MEA)2] (M = Cu2+, (I), Zn2+ (II)), are synthesized. The crystal structures of the obtained complexes are determined by X-ray diffraction analysis (CIF files CCDC 984097 (I) and 930946 (II)). The crystals are monoclinic, for I: a = 18.8140(9) Å, b = 4.82500(14) Å, c = 16.0360(7) Å, β = 115.135(6)°, V = 1317.87(11) Å3, space group P21/c, Z = 2; for II: a = 32.9760(14) Å, b = 5.0911(3) Å, c = 15.7994(10) Å, β = 94.418(5)°, V = 2644.6(3) Å3, space group C2/c, Z = 4. In the structure of complex I, the Cu2+ ion arranged in the symmetry center is coordinated at the vertices of the distorted octahedron by the oxygen atoms of two NAA molecules (Cu-O(2) 2.019(4) Å) and two MEA molecules. The latter is the bidentate-chelating ligand and coordinates the metal through the O and N atoms to form the five-membered metallocycle (Cu-O(3) 2.457(5), Cu-N(1) 1.986(5) Å). In complex II, the Zn atom (on axis 2) is coordinated at the vertices of the distorted tetrahedron by the oxygen atoms of two NAA molecules (Zn-O(2) 1.976(4) Å) and the nitrogen atoms of two MEA molecules (Zn-N 2.034(6) Å). The character of the interaction of coordinated NAA and MEA ligands and methods for packing complexes I and II are considered on the basis of the structural data. 相似文献
13.
T.-T. Xu X.-Y. Xu J. Gao Sh.-Sh. Ni D.-Q. Wang L.-D. Lu X.-J. Yang X. Wang 《Journal of Structural Chemistry》2007,48(1):193-197
Two new Schiff bases were prepared by the condensation reaction of paeonol with ethylenediamine (for compound 1) and 1,3-propylenediamine (for compound 2). The compounds were studied with single crystal X-ray diffraction method. Compound 1 is monoclinic, space group P21/c, a = 10.956(15) Å, b = 6.767(10) Å, c = 12.494(18) Å; β = 104.66(2)°, V = 896(2) Å3, Z = 2. Compound 2 is triclinic, space group P-1, a = 6.878(2) Å, b = 12.141(4) Å, c = 12.414(4) Å; α = 101.023(6)°, β = 103.415(6)°, γ = 102.337(6)°, V = 952.8(6) Å3, Z = 2. The molecular structures of 1 and 2 are similar; the molecule being centrosymmetric in 1 but asymmetric in 2. 相似文献
14.
P. Wu 《Journal of Structural Chemistry》2014,55(3):515-519
Two compounds of 2-ferrocenylmethylidenehydrazono-1,3-dithiane (1) and 2-ferrocenylmethylidenehydrazono-1,3-dithiepane (2) are synthesized and their single crystal structures are determined by the X-ray diffraction method. Compound 1 belongs to the orthorhombic Pca21 space group with the cell parameters: a = 13.989(4) Å, b = 5.785(2) Å, c = 18.231(5) Å, V = 1475.4(7) Å3; while compound 2 crystallizes in a monoclinic symmetry, P21/c space group with a = 15.320(2) Å, b = 5.8028(6) Å, c = 36.584(4) Å, β = 91.932(1)° and V = 3250.4(6) Å3. 相似文献
15.
P. A. Stabnikov I. V. Korolkov V. V. Krisyuk I. A. Baidina 《Journal of Structural Chemistry》2013,54(1):123-128
The synthesis and X-ray single crystal study of two mixed-ligand Cu(II) complexes are performed: (CH3C(NCH3)CHC(O)CH3)(CF3C(O)CHC(O)CF3)Cu (1) (space group P21/c, a = 7.0848(12) Å, b = 17.854(3) Å, c = 11.837(2) Å, β = 100.495(6)°, V = 1472.4(4) Å3, Z = 4), (CH3C(NC6H5)CHC(O)CH3)· (CF3C(O)CHC(O)CF3)Cu (2) (space group P-1, a = 9.1119(4) Å, b = 9.6954(4) Å, c = 11.1447(6) Å, α = 113.784(2)°, β = 92.383(2)°, γ = 95.402(2)°, V = 893.52(7) Å3, Z = 2). The structures are molecular, formed from neutral mixed-ligand copper complexes. The central copper atom has the (3O+N) coordination environment with average Cu-O distances of 1.948 Å and Cu-N of 1.932 Å; the chelate O-Cu-N angle (average) is 94.0°. In the structures, the complexes are linked into dimeric associates with Cu…Cu distances of 3.197 Å (for 1) and 3.246 Å (for 2). The volatility of mixed-ligand complexes 1 and 2 is in between of that of the starting homo-ligand complexes. 相似文献
16.
Two new dimeric oxovanadium(V) complexes, [VO2L1]2 · 2H2O (I) and [VO2L2]2 (II), where L1 and L2 are the monoanionic form of 5-methoxy-2-[(2-methylaminoethylimino)methyl]phenol (HL1) and 5-diethylamino-2-[(2-methylaminoethylimino)methyl]phenol (HL2), respectively, have been synthesized and characterized by elemental analysis, FT-IR spectra, and single crystal X-ray determination. The crystal of I is monoclinic: space group P21, a = 6.858(2), b = 16.630(3), c = 12.306(2) Å, β = 103.985(2)°, V = 1361.9(5) Å3, Z = 2. The crystal of II is triclinic: space group $P\bar 1$ , a = 7.378(2), b = 8.838(2), c = 13.312(3) Å, α = 102.576(2)°, β = 92.044(2)°, γ = 113.017(2)°, V = 772.7(3) Å3, Z = 2. The V...V distances are 3.140(1) Å in I and 3.254(1) Å in II. The V atoms in the complexes are in octahedral coordination. The effect of the complexes on the antimicrobial activity against Staphylococcus aureus, Escherichia coli, and Candida albicans was studied. 相似文献
17.
A. Yu. Rogachev L. Kh. Minacheva V. S. Sergienko N. P. Kuz’mina A. V. Nemukhin 《Russian Journal of Inorganic Chemistry》2007,52(9):1365-1377
Mixed-ligand complexes of asymmetric gadolinium β-diketonates with 2,2′-bipyridyl (Bipy)—[Gd(Pa)3(Bipy)] (HPa is pivaloylacetone) (I) and [Gd(Pta)3(Bipy)] (HPta is pivaloyltrifluoroacetone) (II)-have been obtained by direct interaction of initial reagents and their structures have been studied by X-ray crystallography. Crystals of I are monoclinic: a = 9.536(1) Å, b = 15.037(1) Å, c = 13.280(1) Å, β = 109.56(1)°, V = 1798.7(3) Å3, Z = 2, space group P21. Crystals of II are triclinic: a = 9.6696(17) Å, b = 12.1348(9) Å, c = 18.243(3) Å, α = 100.257(12)°, β = 103.997(2)°, γ = 101.438(11)°, V = 1977.4(5), Z = 2, space group P $\bar 1$ . The coordination polyhedron of the central gadolinium atom in I and II is a distorted square antiprism formed by six oxygen atoms of the three β-diketonate ligands (av. Gd-O, 2.35(2) and 2.351(5) Å in I and II, respectively) and two nitrogen atoms of the Bipy ligand (av. Gd-N, 2.47(2) and 2.584(7) Å in I and II, respectively). Although the molecular structures of these complexes are similar, they have different crystal packings. In II, the planes of the Bipy ligands of neighboring molecules related by an inversion center are bound by stacking interaction (the distance between the Bipy planes is 3.45 Å). The structure and properties of these mixed-ligand complexes have been discussed based on the results of quantum-chemical density functional theory calculations (DFT/B3PW91). The nature of the substituents in the β-diketonate ligand has an effect on the structure and properties of the complexes. The correlation between the Gd-Dik and Gd (Dik)3-Bipy bond energies has been studied. 相似文献
18.
I. B. Baranovskii M. D. Surazhskaya M. A. Golubnichaya 《Russian Journal of Inorganic Chemistry》2006,51(8):1181-1191
Heating of an aqueous solution of [Pt(en)Py2Cl2]Cl2 · 2H2O (I) with KBr excess leads to the formation of [Pt(en)Py2Br2]Br2 · H2O (II). The interaction of a solution of II with bromine water results in the precipitation of polybromide ([Pt(en)Py2Br2]Br2 · Br2), which within a few days in the reaction solution partly transforms into oximide platinum(IV) complex, [Pt(HN-C(O)-C(O)-NH)Py2Br2] · H2O (III). Complex [Pt(en)PyBr3]Br · H2O (IV) with an impurity of II was prepared by reacting KBr excess and the product of [Pt(en)Py2]Cl2 oxidation with chlorine in 0.05 N HCl. The action of HNO3 on the solution of IV produced a nitrate derivative ([Pt(en)PyBr3]NO3, V). Complex IV, unlike II, does not react with bromine. The IR spectra of all the obtained compounds were recorded. Complexes II, III, and V were studied by X-ray crystallography. The crystals of II are monoclinic, space group P21/c, a = 15.640(2) Å, b = 9.345(1) Å, c = 14.167(2) Å, β = 102.63(1)°, V = 2020.5(5) Å3, Z = 4, R hkl = 0.033. The crystals of III are triclinic, space group P $\bar 1$ , a = 7.108(1) Å, b = 10.946(1) Å, c = 11.020(2) Å, α = 83.63(1)°, β = 80.31(1)°, γ = 75.02(1)°, V = 814.4(2) Å3, Z = 2, R hkl = 0.033. In the near-planar five-membered chelate ring (torsion angle NCCN is 7°), the C-O distances (1.23(1) Å) correspond to double bonds; the C-C (1.53(1) Å) and C-N (1.31(1) Å), distances correspond to ordinary bonds. The crystals of V are monoclinic, space group P21/c, a = 8.306(2) Å, b = 8.995(2) Å, c = 20.231(4) Å, β = 97.48(2)°, V = 1498.6(6) Å3, Z = 4, R hkl = 0.037. 相似文献
19.
M. M. Monchak A. V. Pavlyuk V. V. Kinzhibalo V. V. Glukhyi M. G. Mys’kiv 《Russian Journal of Coordination Chemistry》2010,36(3):198-203
Alkylation of ethylenediamine with allyl bromide in the presence of NaHCO3 in benzene-ethanol and acetone-ethanol gave N,N,N′,N′-tetraallylethylenediamine L4 and N,N,N,N′,N′-pentaallylethylenediaminium bromide (L5(H+)Br2), respectively. The ac electrochemical synthesis at copper wire electrodes in solutions of copper(II) halide and an appropriate ligand yielded single crystals of Cu(I) complexes with ethylenediaminium ([L0(H+)2]0.5CuCl2 (I) and [L0(H+)2]0.5CuBr1.67Cl0.33 (II)) and its N-allyl derivatives N,N,N′,N′-tetraallylethylenediaminium ([{L4(H+)2}0.5Cu2Cl3] (III)) and N,N,N,N′,N′-pentaallylethylenediaminium ([L5(H+)Cu4Br6] (IV)). The crystal structures of complexes I–IV were determined by X-ray diffraction. The isostructural crystals of complexes I and II are triclinic, space group P $ \bar 1 $ , Z = 2. For I: a = 5.936(3), b = 6.387(3), c = 7.126(4) Å, α = 67.82(4)°, β = 72.98(4)°, γ = 67.55(4)°, V = 227.7(2) Å3. For II a = 6.110(3), b = 6.657(3), c = 7.309(3) Å, α = 68.40(3)°, β = 72.38(3)°, γ = 67.23(3)°, V = 250.4(2) Å3. In structures I and II, the organic cations are between infinite anionic chains (Cu 2 ? ) n . The crystals of π-complex III are triclinic, space group P $ \bar 1 $ , a = 6.851(4), b = 8.729(4), c = 9.960(4) Å, α = 98.25(3)°, β = 102.29(3)°, γ = 107.30(3)°, V = 541.8(5) Å3, Z = 2. In structure III, all the four allyl groups are π-coordinated by the metal atoms of four discrete anions Cu4Cl 6 2? . The crystals of π-complex IV are monoclinic, space group C2/c, a = 15.228(5), b = 17.095(6), c = 20.182(6) Å, β = 92.43(4)°, V = 5249(3) Å3, Z = 8. Only two of five allyl groups at the same N atom are coordinated by copper(I) atoms. Structure IV contains a complex inorganic fragment of the formula (Cu4Br 6 2? ) n . 相似文献
20.
A new end-to-end thiocyanato-bridged polynuclear copper(II) complex, [Cu(CP)(μ1,3-NCS)] n · nMeOH (I), and a new mononuclear copper(II) complex, [Cu(MP)(ONO2)(OH2)] (II) (CP = 4-chloro-2-[(pyridin-2-ylmethylimino)methyl]phenolate, MP = 5-methoxy-2-[(pyridin-2-ylmethylimino)methyl]phenolate), were prepared and structurally characterized by elemental analyses, infrared spectroscopy, and single-crystal X-ray diffraction. The crystal of I is orthorhombic: space group Pbca, a = 10.6161(16) Å, b = 16.340(3) Å, c = 18.840(3) Å, V = 3268.0(9) Å3, Z = 8. The crystal of II is triclinic: space group P $ \bar 1 $ , a = 7.5645(2), b = 8.9811(2), c = 11.9412(3) Å, α = 74.4610(10)°, β = 80.5040(10)°, γ = 71.0940(10)°, V = 736.71(3) Å3, Z = 2. The Cu atoms in the complexes are in square-pyramidal coordination. The biological test shows that both complexes have strong urease inhibitory activity. 相似文献