共查询到20条相似文献,搜索用时 31 毫秒
1.
I. V. Medrish E. V. Peresypkina A. V. Virovets L. B. Serezhkina 《Russian Journal of Coordination Chemistry》2006,32(12):910-914
The single crystals of (C2H7N4O)2[UO2(C2O4)2(H2O)] were studied by X-ray diffraction. The crystals are monoclinic, space group Pn, Z = 2, unit cell parameters: a = 9.4123(2) Å, b = 8.4591(2) Å, c = 11.8740(3) Å, β = 105.500(10)°, V = 911.02(4) Å3. The main structural units of the crystals of I are islet complex groups [UO2(C2O4)2(H2O)]2? corresponding to the crystal chemical group AB 2 01 M1 (A = UO UO 2 2+ , B01 = C2O 4 2? , M = H2O) of uranyl complexes. Uranium-containing mononuclear complexes are connected into a three-dimensional framework through the electrostatic interactions and hydrogen bonding system involving carbamyolguanidinium ions. 相似文献
2.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev 《Russian Journal of Coordination Chemistry》2012,38(4):245-248
The complex [Ag(2-MePyz)ReO4] (I) is synthesized, and its structure is determined. The crystals are monoclinic, space group P 21/c, a = 7.234(1), b = 15.451(1), c = 8.036(3) Å, β = 92.56(1)°, V = 897.3(2) Å3, ρcalcd = 3.347 g/cm3, Z = 4. Structure I consists of cationic polymer chains [Ag(2-MePyz)] ∞ + . Anions ReO 4 ? are weakly bound to Ag+ (Ag...Oaverage 2.693 Å) and join the latter into a supramolecular framework. The Ag+ ion has a linear coordination (NAgN 177.9(2)°, distances Ag-N 2.223(5) and 2.242(5) Å). 相似文献
3.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev 《Russian Journal of Inorganic Chemistry》2012,57(7):953-958
[AgL]NO3 and [AgL1.5]NO3 (I) complexes, where L = NH2-C6H4-C(CH3)2-C6H4-C(CH3)2-C6H4-NH2, were obtained. The structure of compound I was determined. Triclinic crystals, space group P $\bar 1$ , a = 6.259(1) ?, b = 15.663(1) ?, c = 20.653(3) ?, ?? = 71.13(1)°, ?? = 81.66(1)°, ?? = 82.45(1)°, V = 1887.8(3) ?3, ??calc = 1.208 g/cm3, Z = 2. Ag+ ion coordinated to three nitrogen atoms of ligands L has a distorted T-shaped coordination. The structure of I is built of cationic polymeric chains [Ag(L)] ?? + composed of one bridging ligand L (Ag-N(l) = 2.207(6) ? and Ag-N(2) = 2.221(6) ?, NAgN angle is 160.5(2)°). Second crystallographically nonequivalent centrosymmetrical ligand L pairwise combines the chains to form infinite tapes along direction [010] (Ag(l)-N(3) = 2.529(6)?). Noncoordinated NO 3 ? anion (Ag(1)??O(1) = 2.982(6) ?) participates in N-H??O hydrogen bonds as proton acceptor to form 3D supramolecular assembly. 相似文献
4.
L. B. Serezhkina E. V. Peresypkina S. A. Novikov A. V. Virovets V. N. Serezhkin 《Russian Journal of Inorganic Chemistry》2013,58(1):19-25
(CN3H6)2[UO2CrO4(C5H3N(COO)2)] crystals (where CN3H6 is the guanidinium cation and C5H3N(COO)2 is the pyridine-2,6-dicarboxylate anion) have been synthesized and studied by X-ray diffraction and IR spectroscopy. The compound crystallizes in triclinic system with the unit cell parameters a = 7.4115(3) Å, b = 10.0365(7) Å, c = 12.1822(10) Å, α = 93.992(6)°, β = 97.749(7)°, γ = 96.907(6)°; space group $P\bar 1$ , Z = 2, R = 0.0721. The structure consists of [UO2CrO4(C5H3N(COO)2)] 2 4? , centrosymmetric dimers linked with the outer-sphere guanidinium ions by means of electrostatic interactions and hydrogen bonds. [UO2CrO4(C5H3N(COO)2)] 2 4? dimers belong to the AT001B2 crystallochemical group (A = UO 2 2+ , T001 = C5H3N(COO) 2 2? B2 = CrO 4 2? ) of uranyl complexes. Using molecular Voronoi-Dirichlet polyhedra, we have established that, in addition to hydrogen bonds, the π-π stacking interaction also produces some effect on the packing of uranyl-containing complexes in the studied structure. 相似文献
5.
Thomas C. W. Mak 《Journal of inclusion phenomena and macrocyclic chemistry》1990,8(1-2):199-214
The title complexes (1, X = F;2, X = C 1; 3, X = Br and isomorphous with2; 4, X = I) have been prepared and characterized by X-ray crystallography. Crystal data, MoKα radiation:1, space groupCc,Z =4,a = 12.017(3),b = 14.263(5),c = 17.210(7) Å,β = 103.06(2)°, andR F =0.053 for 2044 observed data;2, space groupCc,Z = 4,a = 12.817(3),b = 11.072(2),c = 16.781(5) Å,β =90.74(2)°,R F = 0.044 for 2249 data;3,a = 12.873(4),b = 11. 119(2),c = 16.957(2) Å,β = 89.11(2)°,R F = 0.049 for 2059 data;4, space groupP21/n,Z = 4,a = 8.858(2),b = 14.358(3),c = 15.379(3) Å,β = 93.88(1)°,R F = 0.068 for 3119 data. In all four structures each thiourea molecule interacts with adjacent thiourea molecules via N-H ... S hydrogen bonds to give a ribbon-like arrangement, and also forms a pair of ‘chelating’ N-H ... X hydrogen bonds with a halide ion, resulting in an anionic framework (in1–3) or composite ribbon (in4) as a component in the crystal packing. The measured ranges of N... X distances are: 2.819(5)-2.994(7) Å for1, 3.252(3)-3.291(3)Å for 2, 3.353(6)-3.459(6)Å for3, and 3.564(5)-3.680(5) Å for 4. 相似文献
6.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev 《Russian Journal of Inorganic Chemistry》2011,56(11):1733-1738
Coordination polymers [Ag(C4H10N2)]ReO4 (I) and [Ag(C4H10N2)]PF6 (II) (C4H10N2 is piperazine, Ppz) were synthesized and their structures were determined. Crystals of compound I are monoclinic, space group P21/c, a = 6.207(1) Å, b = 12.533(1) Å, c = 11.386(1) Å, β = 93.41(1)°, V = 884.2(2) Å3, ρcalc = 3.337 g/cm3, Z = 4. Crystals of II are monoclinic, space group C2/m, a = 8.723(1) Å, b = 9.083(1) Å, c = 5.797(1) Å, β = 95.07(1)°, V = 457.5(1) Å3, ρcalc = 2.548 g/cm3, Z = 2. Structure I contains polymer chains [Ag(Ppz)] ∞ + . The silver atom is linked with two nitrogen atoms of the adjacent Ppz ligands to form a nearly linear fragment; the Ag-Nav distance is 2.173 Å, and the NAgN angle is 169.4(3)°. The chains are linked with each other by weak interactions Ag…O(ReO4) (2.643(8) Å) and N-H…O hydrogen bonds. The structure of compound II also contains cationic polymer chains [Ag(Ppz)] ∞ + . The Ag+ ion is located in the inversion center and has a linear coordination (Ag-N distance is 2.171(9) Å). The central P atom of the octahedral fluorophos-phate ion is also located in the inversion center; the anion is slightly distorted and has no contacts with silver ions at a distance <3.4 Å. 相似文献
7.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev S. A. Kozyukhin 《Russian Journal of Coordination Chemistry》2013,39(8):565-570
Reactions of AgReO4 and AgCH3SO3 with L = 2-amino-4-methylpyrimidine (Ampym, C5H7N3) in a ratio of 1: 2 in acetonitrile gave the complexes [AgL2(ReO4)] (I) and [AgL2(CH3SO3)] (II). Their structures were determined. The crystals of complex I are monoclinic, space group C2/c, a = 5.985(1), b = 3.465(1), c = 19.071(1) Å, β = 96.52(1)°, V = 1527.0(3) Å3, ρcalcd = 2.507 g/cm3, Z = 4. The crystals of complex II are orthorhombic, space group Pbca, a = 14.784(1), b = 11.991(1), c = 17.711(1) Å, V = 3139.7(4) Å3, ρcalcd= 1.782 g/cm3, Z = 8. Structure I shows discrete cationic complexes [AgL2]+. The silver atom is virtually linearly coordinated to two N atoms of crystallographically equivalent ligands L (Ag-N, 2.156(4) Å; the angle NAgN, 174.7(4)°). The complex cations are united into zigzag chains through the hydrogen bonds N-H...N. The resulting chains are linked by the hydrogen bonds N-H...O to uncoordinated perrhenate anions to form 2D supramolecular layers. In structure II, the Ag+ ion is coordinated by two crystallographically non-equivalent ligands L in a distorted linear fashion: Ag(1)-N(1), 2.166(7) Å;Ag(1)-N(4), 2.181(6) Å; the angle NAgN, 157.2(2)°. The anions CH3SO3 ? are weakly linked to the Ag+ ions (Ag...O 2.72 Å) and are hydrogen-bonded to the complex cations [AgL2]+, uniting them into supramolecular ribbons. 相似文献
8.
Synthetic methods are reported for the preparation of compounds containing the trinuclear triangular cluster [W3S4Br3(depe)3[+. These involve reactions between WBr5 and NaB(C2 H5)3H or NaBH4 as reducing agent in THF, and subsequent addition of methanolic solutions of NaHS and depe ligand. Both compounds, [W3S3Br3(depe)3]PF6·0.5C7H8,1, and [W3S4Br3(depe)3]Br·2CH3OH,2, are characterized by x-ray single crystal studies. Compounds1 and2 crystallize in space group \(P\bar 1\) . For1,a=10.427 (3) Å,b=15.415(4) Å,c=18.140(5) Å, α=79.36(2)°, β=73.59(2)°, γ=81.54(2)°, andV=2734.8(2) Å3;R=0.050 and for 2a=10.491(3) Å,b=15.074(3) Å,c=18.246 Å, α=95.76(2)°, β=105.82(2)°, γ=98.18(2)°, andV=2718.4(3) Å3;R=0.081. The two cations in1 and2 possess C3 symmetry. The W-W distances are in the range 2.783?2.891 Å (for1) and 2.778?2.785 Å (for2) and the average W-Br distances in1 and2 are 2.616[2] Å and 2.594[4] Å, respectively. Each metal atom in the [W3S4Br3(depe)3]+ ions is attached to one capping sulfur atom, two bridging sulfur atoms, one bromine atom, and one chelating depe ligand. One P atom in depe ligand istrans to μ3-S and the otherP atom istrans to a μ2-S atom. UV-Vis and NMR spectra for these compounds are also reported. 相似文献
9.
W. Chen X. G. Wang R. Q. Zhang Y. J. Cai Y. M. Cui 《Russian Journal of Coordination Chemistry》2013,39(8):609-614
A series of copper(II) complexes, [Cu(L1)(NCS)] (I), [CuBr(L2)] (II), and [CuCl(L3)] (III), where L1, L2, and L3 are 2,4-dibromo-6-[(pyridin-2-ylmethylimino)methyl]phenolate, 4-chloro-2-[(pyridin-2-ylmethylimino)methyl]phenolate, and 1-[(pyridin-2-ylmethylimino)methyl]-naphthalen-2-ol, respectively, were prepared. The complexes were characterized by elemental analysis, IR spectra, and single crystal X-ray determination. The crystals of the three complexes crystalize in the monoclinic space group P21/n. For I, a = 8.127(2), b = 13.077(3), c = 14.967(3) Å, β = 91.975(2)°, V = 1589.8(6) Å3, Z = 4. For II, a = 7.736(2), b = 10.613(2), c = 16.199(3) Å, β = 91.130(2)°, V = 1329.8(5) Å3, Z = 4. For III, a = 8.062(2), b = 8.599(2), c = 21.087(2) Å, β = 100.338(2)°, V = 1438.1(4) Å3, Z = 4. The Cu atom in each of the complexes is in square planar geometry. 相似文献
10.
Zh. V. Akhmerkina E. V. Peresypkina A. V. Virovets L. B. Serezhkina 《Russian Journal of Coordination Chemistry》2006,32(3):221-225
An X-ray diffraction study of the single crystals of (C2H7N4O)2[(UO2)2(OH)2(C2O4)(CHO2)2] was carried out. The compound crystallizes in the triclinic system, space group $P\bar 1$ , Z = 2, a = 5.5621(8) Å, b = 8.1489(10) Å, c = 11.8757(16) Å, α = 88.866(7)°, β = 82.204(6)°, γ = 87.378(6)°, V = 532.7(1) Å3, ρcalcd = 2.988 g/cm3. The main structural units in the crystal are the [(UO2)2(OH)2(C2O4)(CHO2)2)]2? chains corresponding to the crystal chemical group A2M 2 2 K02M 2 1 (A = UO 2 2+ , M2 = OH?, K02 = C2O 4 2? , M1 = CHO 2 ? ) of uranyl complexes. The chains are united into a three-dimensional framework through the electrostatic interaction and hydrogen bonds involving uranyl, oxalate, and hydroxyl groups, formate ions, and 1-carbamoylguanidinium cations. 相似文献
11.
The reaction of Ru3(CO)12 with MeO2C(H)C=C=C(H)CO2 Me has yielded two isomeric productsanti-Ru2(CO)6[μ-η 3-η 1-MeO2C(H)CCC(H)CO2Me],1 in 70% yield andsyn-Ru2(CO)6[μ-η 3-η 1-MeO2C(H)CCC(H)CO2Me],2 in 5% yield. Both compounds were characterized by single crystal X-ray diffraction analysis. Both products are diruthenium complexes with bridging di(carboxylate)allene ligands in which the oxygen atom of the carbonyl group of one of the carboxylate groupings is coordinated to one of the metal atoms. Compound1 isomerizes partially to2 at 68°C. Crystal Data for1: space group=P21/n,a=11.131(1) Å,b=10.228(2) Å,c=15.978(2) Å,β=102.01(1)°,Z=4, 1653 reflections,R=0.025; for2: space group=P $\bar 1$ ,a=9.340(1) Å,b=14.925(4) Å,c=6.778(2) Å,α=99-02(2)°,β=104 62(2)°,γ=94.58(2)°,Z=2, 1857 reflections,R=0.027. 相似文献
12.
The [Ag(CF3CO2)(2-Me-Pyz)] complex (where 2-Me-Pyz is 2-methylpyrazine) was synthesized and its structure was determined. The crystals are monoclinic, space group P21/n, a = 12.440(2) Å, b = 2.605(3) Å, c = 12.646(3) Å, β = 95.95(3)°, V = 1972.3(7) Å3, ρ = 2.122 g/cm3, Z = 8. The structure consists of the polymer zigzag chains of [Ag(C5H6N2)] ? ∞ united into a three-dimensional framework through (CF3CO2)? anions. 相似文献
13.
Two new cobalt(III) complexes of the Schiff base N,N′-disalicylidene-1,2-phenylendiimine dianion (salophen), trans- [CoIII(salophen)(ta)2]ClO4, (ta = thioacetamide) (1) and trans-[CoIII(salophen)(tb)2]ClO4, (tb = thiobenzamide) (2) were synthesized and characterized using single-crystal X-ray diffraction and spectroscopic techniques. Both complexes show solvatochromism in a variety of solvents. Complex (1) crystallized from CHCl3 as a solvate of orthorhombic symmetry, space group Pca21 with a = 17.3480(10) Å, b = 18.7522(10) Å, c = 18.8128(11) Å, α = β = γ = 90°, and Z = 8. The cobalt(III) center lies in a distorted octahedral environment. The crystal structure of (1) consists of two independent [CoIII(salophen)(ta)2]+ cations and ClO4 - anions held together essentially via hydrogen bonds and π-π stacking interactions. Complex (2), forming also a CHCl3 solvate, crystallized in the monoclinic space group P21/n with a = 14.710(3) Å, b = 13.506(3) Å, c = 18.595(4) Å, β = 100.295(4)°, and Z = 4. The geometry around cobalt(III) center is a distorted octahedron. The crystal structure of (2) contains a [CoIII(salophen)(tb)2]+ complex with a remarkably twisted salophen ligand. Both complexes, (1) and (2), contain approximately one disordered CHCl3 molecule per Co in the solid state. 相似文献
14.
The self-assembly of unsymmetrical tecton 3-nitro-5-(pyridin-4-yl)benzoic acid (HL)with cobalt chloride under hydrothermal conditions affords a new 2D coordination polymer [Co(L)2] n (1, L = 3-nitro-5-(pyridin-4-yl)benzoate), which is characterized by elemental analysis, infrared spectroscopy, thermogravimetric analysis, powder X-ray diffraction analysis, and single crystal X-ray diffraction. Compound 1 is of the triclinic system, space group P-1 with a = 9.7857(12) Å, b = 10.3417(13) Å, c = 10.8463(13) Å, α = 85.155(2)°, β = 74.785(2)°, γ = 88.962(2)°, V = 1055.4(2) Å3. The crystal structural analysis of complex 1 shows that the cobalt center is six-coordinated in an octahedral geometry by four O atoms from four different L ligands and two N atoms from two different L ligands; the Co(II) cations are bridged by μ3-L into an interesting two-dimensional network structure. It should be pointed out that the thermal analysis results indicate that complex 1 is quite stable up to 420°C. 相似文献
15.
Shariff E. Kabir Edward Rosenberg Michael Day Kenneth I. Hardcastle Mark Irving 《Journal of Cluster Science》1994,5(3):481-503
The synthesis of $(\mu - H)(\mu - \eta ^2 - H_2 )_4 )Os_3 (CO)_{10} $ (4) from piperidine and Os3(CO)10(CH3CN)2 and its solid state structure are reported. The room temperature reactions of the decarbonylation product of4, $(\mu - H)(\mu _3 - \eta ^2 - H_2 )_4 )Os_3 (CO)_9 $ (3), with P(C6H5)3, CNCH3, HCl and H2 are reported. Overall, the products obtained closely resemble those obtained from the analogous, $(\mu - H)(\mu _3 - \eta ^2 - H_2 )_3 )Os_3 (CO)_9 $ (1). The isomerizations of the phosphine addition products $(\mu - H)(\mu - \eta ^2 - H_2 )_n )Os_3 (CO)_9 P(C_6 H_5 )_3 $ (n = 3,6a;n = 4,5a) have been studied by1H-NMR techniques and the initial rearrangement was shown to be an intramolecular process. Slower conversion to the complex $(\mu - H)(\mu _3 - \eta ^2 - H_2 )_4 )Os_3 (CO)_8 P(C_6 H_5 )_3 $ (8) was observed and the solid state structure of this product is reported and compared with a related compound containing an ethyl,n-propylμ 3-imidoyl ligand. Compound4 crystallizes in the triclinic space group Pl (#2) withZ= 2, and unit cell parametersa = 9.294(3) Å,b = 15.758(5) Å,c = 7.406(2) Å,a = 81.10(2)°,β=76.47(2)°,y =74.88(2)°, andV =1013(l) Å3. Least-squares refinement of 2677 reflections gave a final discrepancy factor ofR = 0.054 (R w = 0.066). Compound8 crystallizes in the space group C2/c with unit cell parametersa = 24.818(3) Å,b = 16.389(3) Å,c = 18.111(3) Å,β= 120.94(2)°,V = 6318(4) Å3, andZ = 8. Least squares refinement of 3439 reflections gave a final discrepancy factor ofR = 0.039 (R w =0.047). 相似文献
16.
This is the first work to synthesize 4,4,10,10-tetramethyl-1,3,7,9-tetraazospiro[5.5]undecane-2,8-dione monohydrate, monochloride, mononitrate, and teteraiodotellurate: C11H20N4O2·H2O (I), C11H21N4O 2 + ·Cl? (II), C11H21N4O 2 + ·NO 3 ? (III), and 2(C11H21N4O 2 + )·TeI 4 2? ·C3H6O (IV) and determine their structures. Crystals of I are monoclinic: space group P21/c, at 298 K a = 5.7118(7) Å, b = 17.842(2) Å, and c = 13.5905(16) Å; β = 91.621(11)°; V = 1384.5(3) Å3; d x = 1.239 g/cm3, Z = 4. Crystals of II are tetragonal: space group P43, at 298 K a = 6.4134(3) Å and c = 34.292(2) Å; V = 1410.47(14) Å3; d x = 1.303 g/cm3; Z = 4. Crystals of III are triclinic: space group \(P\bar 1\) , at 298 K a = 8.7614(14) Å, b = 9.3904(18) Å, and c = 10.028(2) Å; α = 63.27(2)°, β = 78.591(16)°, and γ = 84.308(15)°; V = 722.3(2) Å3; d x = 1.40 g/cm3; Z = 2. Crystals of IV are triclinic: space group \(P\bar 1\) , at 100 K a = 10.4630(4) Å, b = 11.9372(6) Å, and c = 16.4118(5) Å; α = 72.058(3)°, β = 76.406(3)°, and γ = 87.029(3)°; V = 1895.04(12) Å3; d x = 2.06 g/cm3; Z = 2. The synthesis of s and p metals with spirocarbone in acetone medium is found to be impossible due to the protonation by the oxygen atom of the carbonyl group. The main crystalline product of the complexation reaction is a monosalt. Evidence is provided that the recrystallization and drying of the synthesized spirocarbone preparation yields monohydrate (I); its purity and monophasity is confirmed by a Rietveld refinement of the powder X-ray pattern. The lattice parameters at room temperature are: a = 5.6885(12) Å, b = 17.8496(12) Å, and c = 13.518(3) Å; β = 91.449(15)°; V = 1372.1(4) Å3. The sample is monophasic. 相似文献
17.
P. Wu 《Journal of Structural Chemistry》2014,55(3):515-519
Two compounds of 2-ferrocenylmethylidenehydrazono-1,3-dithiane (1) and 2-ferrocenylmethylidenehydrazono-1,3-dithiepane (2) are synthesized and their single crystal structures are determined by the X-ray diffraction method. Compound 1 belongs to the orthorhombic Pca21 space group with the cell parameters: a = 13.989(4) Å, b = 5.785(2) Å, c = 18.231(5) Å, V = 1475.4(7) Å3; while compound 2 crystallizes in a monoclinic symmetry, P21/c space group with a = 15.320(2) Å, b = 5.8028(6) Å, c = 36.584(4) Å, β = 91.932(1)° and V = 3250.4(6) Å3. 相似文献
18.
Yu. V. Kokunov Yu. E. Gorbunova V. V. Kovalev 《Russian Journal of Inorganic Chemistry》2010,55(10):1552-1558
The coordination polymers [AgPF6(Me4Pyz)2] (I) and [AgPF6(2,3-Et2Pyz)2] (II) were synthesized, and their structures were determined. Crystals of I are monoclinic, space group C2/c, a = 10.213(2) Å, b = 16.267(3) Å, c = 12.663(3) Å, β = 92.90(3)°, V = 2102.1(7) Å3, ρcalcd = 1.660 g/cm3, Z = 4. The structure of I is built of polymeric zigzag [Ag(C8H12N2)] ∞ + chains and octahedral [PF6] anions. The coordination polyhedron of the Ag+ ion is a flat triangle. Crystals of II are tetragonal, space group P \(\bar 4\)2(1)/c,a = b = 10.641(1) Å, c = 18.942(1) Å, V = 2144.6(2) Å3, ρcalcd = 1.627 g/cm3, Z = 4. In the structure of II, 2D cationic layers of fused square rings exist; the rings consist of four Ag+ cations linked by four bridging ligands of diethylpyrazine Et2Pyz. The coordination polyhedron of the Ag+ ion is an irregular four-vertex polyhedron. 相似文献
19.
New (C17H20FN3O3)2[CoCl4]2·3H2O (I) and C17H20FN3O3[CoCl4]·H2O (II) compounds, where C17H18FN3O3 is ciprofloxacin (CfH), are synthesized and their crystal structures are determined. Crystallographic data for I: a = 18.441(5) Å, b = 9.030(3) Å, c = 27.551(8) Å, V = 4588(4) Å3, space group Pca21, Z = 4; for II: a = 9.305(3) Å, b = 9.885(3) Å, c = 12.999(4) Å, α = 82.782(4)°, β = 72.954(4)°, γ = 89.736(4)°, V = 1133(1) Å3, P-1 space group, Z = 2. Both structures contain CfH 3 2+ ion pairs bonded by the π-π interaction. Additionally, in the crystal of I there is a stacking interaction between the π clouds of aromatic rings and hydrogen atoms of the cyclopropyl group linking the pairs of molecules with each other. The structure of the centrosymmetric crystal of triclinic phase II is also formed from CfH 3 2+ ion pairs bonded by the π-π interaction, which, in this case, are not independent because they are related by the symmetry center. Hydrogen bonds form a branched three-dimensional network linking the CfH 3 2+ and CoCl 4 2? ions and water molecules. 相似文献
20.
A. V. Noshchenko Yu. I. Slyvka A. V. Pavlyuk M. G. Mys’kiv 《Russian Journal of Coordination Chemistry》2010,36(8):585-590
Reactions of a solution of AgNO3 in aqueous methanol with solutions of 1,4-diallylpiperazine (acidified with HNO3 to pH = 4) and 1-allyloxybenzotriazole in ethanol gave the crystalline silver(I) π-complexes [Ag2(C4H8N2(C3H5)2(H+)2)(H2O)2(NO3)2](NO3)2 (I) and [Ag(C6H4N3(OC3H5)(NO3))] (II). Their crystal structures were determined by X-ray diffraction. Crystals of complexes I and II are monoclinic, space group P21/c; for I: a = 7.053(3)Å, b = 9.389(3)Å, c = 15.488(4)Å, β = 91.60°, V = 1025.3(6)Å3, Z = 4; for II: a = 10.650(4)Å, b = 15.062(5)Å, c = 7.412(4)Å, β = 104.20(3)°, V = 1152.6(8)Å3, Z = 4. In both structures, the organic components act as bidentate ligands forming with AgNO3 34- and 14-membered topological rings, respectively. In complex I, the nearly tetrahedral environment of the Ag(I) atom is made up of the olefinic C=C bond, the O atoms of the nitrate anions, and the water molecule. 1-Allyloxybenzotriazole in structure II causes the deformation of the coordination polyhedron of Ag into a trigonal pyramid via inclusion of the ligand N atom in its coordination sphere. The topological units of the complexes form infinite polymer layers linked by anionic NO 3 ? bridges. In structure I, these layers are united through a system of hydrogen bonds into a three-dimensional framework. 相似文献