Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

The series of molecular conductors and superconductors ET4[AFe(C2O4)3]·PhX (ET = bis(ethylenedithio)tetrathiafulvalene; (C2O4)2- = oxalate; A+ = H3O+, K+; X = F, Cl, Br, and I): influence of the halobenzene guest molecules on the crystal structure and superconducting properties

An extensive series of radical salts formed by the organic donor bis(ethylenedithio)tetrathiafulvalene (ET), the paramagnetic tris(oxalato)ferrate(III) anion [Fe(C(2)O(4))(3)](3-), and halobenzene guest molecules has been synthesized and characterized. The change of the halogen atom in this series has allowed the study of the effect of the size and charge polarization on the crystal structures and physical properties while keeping the geometry of the guest molecule. The general formula of the salts is ET(4)[A(I)Fe(C(2)O(4))(3)]·G with A/G = H(3)O(+)/PhF (1); H(3)O(+)/PhCl (2); H(3)O(+)/PhBr (3), and K(+)/PhI (4), (crystal data at room temperature: (1) monoclinic, space group C2/c with a = 10.3123(2) ?, b = 20.0205(3) ?, c = 35.2732(4) ?, β = 92.511(2)°, V = 7275.4(2) ?(3), Z = 4; (2) monoclinic, space group C2/c with a = 10.2899(4) ?, b = 20.026(10) ?, c = 35.411(10) ?, β = 92.974°, V = 7287(4) ?(3), Z = 4; (3) monoclinic, space group C2/c with a = 10.2875(3) ?, b = 20.0546(15) ?, c = 35.513(2) ?, β = 93.238(5)°, V = 7315.0(7) ?(3), Z = 4; (4) monoclinic, space group C2/c with a = 10.2260(2) ?, b = 19.9234(2) ?, c = 35.9064(6) ?, β = 93.3664(6)°, V = 7302.83(18) ?(3), Z = 4). The crystal structures at 120 K evidence that compounds 1-3 undergo a structural transition to a lower symmetry phase when the temperature is lowered (crystal data at 120 K: (1) triclinic, space group P1 with a = 10.2595(3) ?, b = 11.1403(3) ?, c = 34.9516(9) ?, α = 89.149(2)°, β = 86.762(2)°, γ = 62.578(3)°, V = 3539.96(19) ?(3), Z = 2; (2) triclinic, space group P1 with a = 10.25276(14) ?, b = 11.15081(13) ?, c = 35.1363(5) ?, α = 89.0829(10)°, β = 86.5203(11)°, γ = 62.6678(13)°, V = 3561.65(8) ?(3), Z = 2; (3) triclinic, space group P1 with a = 10.25554(17) ?, b = 11.16966(18) ?, c = 35.1997(5) ?, α = 62.7251(16)°, β = 86.3083(12)°, γ = 62.7251(16)°, V = 3575.99(10) ?(3), Z = 2; (4) monoclinic, space group C2/c with a = 10.1637(3) ?, b = 19.7251(6) ?, c = 35.6405(11) ?, β = 93.895(3)°, V = 7128.7(4) ?(3), Z = 4). A detailed crystallographic study shows a change in the symmetry of the crystal for compound 3 at about 200 K. This structural transition arises from the partial ordering of some ethylene groups in the ET molecules and involves a slight movement of the halobenzene guest molecules (which occupy hexagonal cavities in the anionic layers) toward one of the adjacent organic layers, giving rise to two nonequivalent organic layers at 120 K (compared to only one at room temperature). The structural transition at about 200 K is also observed in the electrical properties of 1-3 and in the magnetic properties of 1. The direct current (dc) conductivity shows metallic behavior in salts 1-3 with superconducting transitions at about 4.0 and 1.0 K in salts 3 and 1, respectively. Salt 4 shows a semiconductor behavior in the temperature range 300-50 K with an activation energy of 64 meV. The magnetic measurements confirm the presence of high spin S = 5/2 [Fe(C(2)O(4))(3)](3-) isolated monomers together with a Pauli paramagnetism, typical of metals, in compounds 1-3. The magnetic properties can be very well reproduced in the whole temperature range with a simple model of isolated S = 5/2 ions with a zero field splitting plus a temperature independent paramagnetism (Nα) with the following parameters: g = 1.965, |D| = 0.31 cm(-1), and Nα = 1.5 × 10(-3) emu mol(-1) for 1, g = 2.024, |D| = 0.65 cm(-1), and Nα = 1.4 × 10(-3) emu mol(-1) for 2, and g = 2.001, |D| = 0.52 cm(-1), and Nα = 1.5 × 10(-3) emu mol(-1) for 3.     

Hydrolysis studies on bismuth nitrate: synthesis and crystallization of four novel polynuclear basic bismuth nitrates

Hydrolysis of Bi(NO(3))(3) in aqueous solution gave crystals of the novel compounds [Bi(6)O(4)(OH)(4)(NO(3))(5)(H(2)O)](NO(3)) (1) and [Bi(6)O(4)(OH)(4)(NO(3))(6)(H(2)O)(2)]·H(2)O (2) among the series of hexanuclear bismuth oxido nitrates. Compounds 1 and 2 both crystallize in the monoclinic space group P2(1)/n but show significant differences in their lattice parameters: 1, a = 9.2516(6) ?, b = 13.4298(9) ?, c = 17.8471(14) ?, β = 94.531(6)°, V = 2210.5(3) ?(3); 2, a = 9.0149(3) ?, b = 16.9298(4) ?, c = 15.6864(4) ?, β = 90.129(3)°, V = 2394.06(12) ?(3). Variation of the conditions for partial hydrolysis of Bi(NO(3))(3) gave bismuth oxido nitrates of even higher nuclearity, [{Bi(38)O(45)(NO(3))(24)(DMSO)(26)}·4DMSO][{Bi(38)O(45)(NO(3))(24)(DMSO)(24)}·4DMSO] (3) and [{Bi(38)O(45)(NO(3))(24)(DMSO)(26)}·2DMSO][{Bi(38)O(45)(NO(3))(24)(DMSO)(24)}·0.5DMSO] (5), upon crystallization from DMSO. Bismuth oxido clusters 3 and 5 crystallize in the triclinic space group P1? both with two crystallographically independent molecules in the asymmetric unit. The following lattice parameters are observed: 3, a = 20.3804(10) ?, b = 20.3871(9) ?, c = 34.9715(15) ?, α = 76.657(4)°, β = 73.479(4)°, γ = 60.228(5)°, V = 12021.7(9) ?(3); 5, a = 20.0329(4) ?, b = 20.0601(4) ?, c = 34.3532(6) ?, α = 90.196(1)°, β = 91.344(2)°, γ = 119.370(2)°, V = 12025.8(4) ?(3). Differences in the number of DMSO molecules (coordinated and noncoordinated) and ligand (nitrate, DMSO) coordination modes are observed.     

Sulfates of the refractory metals: crystal structure and thermal behavior of Nb2O2(SO4)3, MoO2(SO4), WO(SO4)2, and two modifications of Re2O5(SO4)2

The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.     

Two new neptunyl(V) selenites: a novel cation-cation interaction framework in (NpO2)3(OH)(SeO3)(H2O)2 3H2O and a uranophane-type sheet in Na(NpO2)(SeO3)(H2O)

Dark green crystals of (NpO(2))(3)(OH)(SeO(3))(H(2)O)(2)·H(2)O (1) have been prepared by a hydrothermal reaction of neptunyl(V) and Na(2)SeO(4) in an aqueous solution at 150 °C, while green plates of Na(NpO(2))(SeO(3))(H(2)O) (2) have been synthesized by evaporation of a solution of neptunyl(V), H(2)SeO(4), and NaOH at room temperature. Both compounds have been characterized by single-crystal X-ray diffraction. The structure of compound contains three crystallographically unique Np atoms that are bonded to two O atoms to form a nearly linear O═Np═O NpO(2)(+) cation. Neighboring Np(5+) ions connect to each other through a bridging oxo ion from the neptunyl unit, a configuration known as cation-cation interactions (CCIs), to build a complex three-dimensional network. More specifically, each Np(1)O(2)(+), Np(2)O(2)(+), and Np(3)O(2)(+) cation is involved in three, five, and four CCIs with other units, respectively. The framework of neptunyl(V) pentagonal bipyramids is decorated by selenite trigonal pyramids with one-dimensional open channels where uncoordinated waters are trapped via hydrogen bonding interactions. Compound adopts uranophane-type [(NpO(2))(SeO(3))](-) layers, which are separated by Na(+) cations and water molecules. Within each layer, neptunyl(V) pentagonal bipyramids share equatorial edges with each other to form a single chain that is further connected by both monodentate and bidentate selenite trigonal pyramids. Crystallographic data: compound, monoclinic, P2(1)/c, Z = 4, a = 6.6363(8) ?, b = 15.440(2) ?, c = 11.583(1) ?, β = 103.549(1)°, V = 1153.8(2) ?(3), R(F) = 0.0387 for I > 2σ(I); compound (2), monoclinic, C2/m, Z = 4, a = 14.874(4) ?, b = 7.271(2) ?, c = 6.758(2) ?, β = 112.005(4)°, V = 677.7(3) ?(3), R(F) = 0.0477 for I > 2σ(I).     

Synthesis, characterization, and structure-property relationships in two new polar oxides: Zn2(MoO4)(SeO3) and Zn2(MoO4)(TeO3)

Two new noncentrosymmetric (NCS) polar oxide materials, Zn(2)(MoO(4))(AO(3)) (A = Se(4+) or Te(4+)), have been synthesized by hydrothermal and solid-state techniques. Their crystal structures have been determined, and characterization of their functional properties (second-harmonic generation, piezoelectricity, and polarization) has been performed. The isostructural materials exhibit a three-dimensional network consisting of ZnO(4), ZnO(6), MoO(4), and AO(3) polyhedra that share edges and corners. Powder second-harmonic generation (SHG) measurements using 1064 nm radiation indicate the materials exhibit moderate SHG efficiencies of 100 × and 80 × α-SiO(2) for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Particle size vs SHG efficiency measurements indicate the materials are type 1 non-phase-matchable. Converse piezoelectric measurements resulted in d(33) values of ～14 and ～30 pm/V for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively, whereas pyroelectric measurements revealed coefficients of -0.31 and -0.64 μC/m(2) K at 55 °C for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Frequency-dependent polarization measurements confirmed that all of the materials are nonferroelectric; that is, the macroscopic polarization is not reversible, or "switchable". Infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were also performed. First-principles density functional theory (DFT) electronic structure calculations were also done. Crystal data: Zn(2)(MoO(4))(SeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.1809(4) ?, b = 8.3238(7) ?, c = 7.1541(6) ?, β = 99.413(1)°, V = 305.2(1) ?(3), Z = 2; Zn(2)(MoO(4))(TeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.178(4) ?, b = 8.409(6) ?, c = 7.241(5) ?, β = 99.351(8)°, V = 311.1(4) ?(3), Z = 2.     

Investigation of the crystal structure of a basic bismuth(III) nitrate with the composition [Bi6O4(OH)4](0.54(1))[Bi6O5(OH)3](0.46(1))(NO3)(5.54(1))

A basic bismuth(III) nitrate with the composition [Bi(6)O(4)(OH)(4)](0.5)[Bi(6)O(5)(OH)(3)](0.5)(NO(3))(5.5) formed in a slow crystal growth mode has an ordered crystal structure with the monoclinic space group P2(1) and lattice parameters a = 15.850(3), b = 14.986(3), c = 18.230(4) ?, β = 107.329(17)° and volume V = 4133.6 ?(3) (Henry et al. 2003). In a very fast crystal growth mode the complex ions disorder in another P2(1) cell with slightly different lattice parameters a = 15.8404(1), b = 15.1982(1), c = 18.3122(1) ?, β = 106.829(1)° and V = 4219.8 ?(3). This cell can be related to two smaller cells: a monoclinic C2/m cell with a = 13.7161(1), b = 15.1943(1), c = 10.2399(1) ?, β = 98.586(1)° and V = 2110.1 ?(3) and a trigonal R3 cell with a = 15.18650(6), c = 15.8416(1) ? (hexagonal setting) and V = 3164.1 ?(3). These smaller cells correspond to average structures and hence the X-ray data do not account for the difference in the structures of the two different complex ions. However, when analysing neutron powder diffraction data, it is possible to distinguish between the two complex ions using a trigonal R3 cell with a = 15.1865(1) and c = 15.8416(1) ? (hexagonal setting). In a Rietveld type structure model refinement with a total of 28 atom sites (4 Bi, 3 N, 15 O and 6 H), the composition of this sample is determined to be [Bi(6)O(4)(OH)(4)](0.54(1))[Bi(6)O(5)(OH)(3)](0.46(1))(NO(3))(5.54(1)).     

New vanadium selenites: centrosymmetric Ca2(VO2)2(SeO3)3(H2O)2, Sr2(VO2)2(SeO3)3, and Ba(V2O5)(SeO3), and noncentrosymmetric and polar A4(VO2)2(SeO3)4(Se2O5) (A = Sr2+ or Pb2+)

Five new vanadium selenites, Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), Sr(2)(VO(2))(2)(SeO(3))(3), Ba(V(2)O(5))(SeO(3)), Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), have been synthesized and characterized. Their crystal structures were determined by single crystal X-ray diffraction. The compounds exhibit one- or two-dimensional structures consisting of corner- and edge-shared VO(4), VO(5), VO(6), and SeO(3) polyhedra. Of the reported materials, A(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) (A = Sr(2+) or Pb(2+)) are noncentrosymmetric (NCS) and polar. Powder second-harmonic generation (SHG) measurements revealed SHG efficiencies of approximately 130 and 150 × α-SiO(2) for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Piezoelectric charge constants of 43 and 53 pm/V, and pyroelectric coefficients of -27 and -42 μC/m(2)·K at 70 °C were obtained for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Frequency dependent polarization measurements confirmed that the materials are not ferroelectric, that is, the observed polarization cannot be reversed. In addition, the lone-pair on the Se(4+) cation may be considered as stereo-active consistent with calculations. For all of the reported materials, infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were performed. Crystal data: Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), orthorhombic, space group Pnma (No. 62), a = 7.827(4) ?, b = 16.764(5) ?, c = 9.679(5) ?, V = 1270.1(9) ?(3), and Z = 4; Sr(2)(VO(2))(2)(SeO(3))(3), monoclinic, space group P2(1)/c (No. 12), a = 14.739(13) ?, b = 9.788(8) ?, c = 8.440(7) ?, β = 96.881(11)°, V = 1208.8(18) ?(3), and Z = 4; Ba(V(2)O(5))(SeO(3)), orthorhombic, space group Pnma (No. 62), a = 13.9287(7) ?, b = 5.3787(3) ?, c = 8.9853(5) ?, V = 673.16(6) ?(3), and Z = 4; Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.161(3) ?, b = 12.1579(15) ?, c = 12.8592(16) ?, V = 3933.7(8) ?(3), and Z = 8; Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.029(2) ?, b = 12.2147(10) ?, c = 13.0154(10) ?, V = 3979.1(6) ?(3), and Z = 8.     

Unprecedented lanthanide-containing coordination polymers constructed from hexanuclear molecular building blocks: {[Ln6O(OH)8](NO3)2(bdc)(Hbdc)2·2NO3·H)bdc}∞

Reactions in acetonitrile between 1,4-benzene-dicarboxylic acid (C(8)H(6)O(4)) and a hexanuclear complex of lanthanide [Ln(6)O(OH)(8)(NO(3))(6)·2NO(3)] with Ln = Y or Tb lead to 1D-coordination polymers with the general chemical formula {[Ln(6)O(OH)(8)](NO(3))(2)(bdc)(Hbdc)(2)·2NO(3)·H(2)bdc}(∞) where H(2)bdc stands for 1,4-benzene-dicarboxylic acid (or terephthalic acid). These two compounds are isostructural. The crystal structure has been solved on the basis of the X-ray powder diffraction diagram of the Y-containing compound. This compound crystallizes in the triclinic system, space group P1 (no. 2) with a = 10.4956(6) ?, b = 11.529(2) ?, c = 12.357(2) ?, α = 86.869(9)°, β = 114.272(6)°, γ = 71.624(7)°, V = 1264.02 ?(3), and Z = 2. The crystal structure can be described as the juxtaposition of linear chains of hexanuclear entities linked to each other by terephthalate ligands. Two additional partially protonated terephthalate ligands spreading laterally to the chain are bound to each hexanuclear entity. Another diprotonated terephthalic ligand and two nitrate ions ensuring the electroneutrality of the crystal structure lie in the interchain space. These two compounds are thermally stable until 200 °C. Thanks to a so-called antenna effect, the Tb-containing compound, despite short intermetallic distances, exhibits a strong luminescence under UV irradiation.     

Ionothermal syntheses and characterizations of new open-framework metal borophosphates

Three new open-framework metal borophosphates, [Na(6)Co(3)B(2)P(5)O(21)Cl]·H(2)O (JIS-4), K(5)Mn(2)B(2)P(5)O(19)(OH)(2) (JIS-5), (NH(4))(8)[Co(2)B(4)P(8)O(30)(OH)(4)] (JIS-6), have been prepared under ionothermal conditions using ionic liquid 1-ethyl-3-methylimidazolium ([Emim]Br) as the solvent. They are the first examples of metalloborophosphate prepared by the ionothermal method. Their structures are determined by single-crystal X-ray diffraction. The 3-D open framework of JIS-4 is made of CoO(5)Cl octahedra, CoO(5) square pyramids, and PO(4) and BO(4) tetrahedra forming 12-ring channels along the [010] direction. It is noted that JIS-4 is the first 3-D open-framework structure in the family of borophosphate with the B/P ratio of 2/5, which features a borophosphate cluster anionic partial structure. Such cluster anionic partial structures connect with MnO(6) octahedra and MnO(5) trigonal bipyramids resulting in the formation of the 2-D layer structure of JIS-5 with the same B/P ratio as JIS-4. The 2-D layer structure of JIS-6 belongs to the largest family of borophosphate with a B/P ratio of 1/2 which features a unique 1-D chain anionic partial structure. Crystal data for JIS-4, orthorhombic, Pnma, a = 14.0638(8) ?, b = 9.8813(7) ?, c = 14.0008(10) ?, V = 1945.7(2) ?(3), and Z = 2; for JIS-5, monoclinic, P2(1)/n, a = 14.4939(3) ?, b = 9.2539(3) ?, c = 14.8031(4) ?, β = 101.4600(10)°, V = 1945.88(9) ?(3), and Z = 4. For JIS-6, triclinic, P1, a = 9.6928(3) ?, b = 9.8747(3) ?, c = 10.0125(2) ?, α = 62.057(2)°, β = 82.456(2)°, γ = 76.095(2)°, V = 821.60(4) ?(3), and Z = 1.     

Structures of vanadium(III)-ethylenediamine-N,N'-diacetato-N,N'-di-3-propionato complexes. Critical role of pπ-dπ donation in determining the coordination number

Li[V(eddadp)]·3H(2)O (1a) and Cs[V(eddadp)]·2H(2)O (1b) were characterized by X-ray crystallography. 1a crystallizes in the monoclinic space group Cc with a = 11.467(7) ?, b = 13.398(8) ?, c = 12.529(8) ?, β = 114.85(4)°; V = 1746.7(2) ?(3), and Z = 4; 1b crystallizes in the monoclinic space group P2(1)/n with a = 10.265(5) ?, b = 11.673(6) ?, c = 15.507(8) ?, β = 104.29(2)°, V = 1800.6(2) ?(3), and Z = 4. The solution structure of 1 has been ascertained to be predominantly six-coordinated with a hexadentate eddadp which is based on a comparison of the electronic and Raman spectra of aqueous solutions of 1 with those in the solid state.     

The unique bis-(disulfato)-aurate anion [Au(S2O7)2](-): synthesis and characterization of Li[Au(S2O7)2] and Na[Au(S2O7)2)

The reaction of Au(OH)(3) and oleum (65% SO(3)) in the presence of M(2)SO(4) (M = Li, Na) afforded yellow single crystals of Li[Au(S(2)O(7))(2)] (triclinic, P ?1, Z = 1, a = 532.20(3), b = 649.69(4), c = 836.72(5) pm, α = 107.982(2)°, β = 90.171(2)°, γ = 102.583(2)°, V = 267.80(3) ?(3)) and Na[Au(S(2)O(7))(2)] (monoclinic, P2(1)/n, Z = 2, a = 533.31(3), b = 1193.38(7), c = 907.67(5) pm, β = 98.548(3)°, V = 571.26(6) ?(3)). Both compounds exhibit the unprecedented [Au(S(2)O(7))(2)](-) anion in which a square planar coordination of the central gold atom is achieved by the chelating attachment of two disulfate groups. The disulfates were characterized by means of IR spectroscopy and DTA/TG measurements. For both compounds, the decomposition occurs via several steps and is finished at about 450 °C at the stage of elemental gold and the sulfates M(2)SO(4) (M = Li, Na), as revealed by X-ray powder diffraction of the residues.     

ZnIO3(OH): a new layered noncentrosymmetric polar iodate--hydrothermal synthesis, crystal structure, and second-harmonic generating (SHG) properties

A new noncentrosymmetric polar iodate material, ZnIO(3)(OH), has been hydrothermally synthesized as crystals and pure powders by using ZnO (or Zn(CH(3)CO(2))(2)·2H(2)O), HIO(3), and water. Single crystal X-ray diffraction was used to determine the crystal structure of the reported material. ZnIO(3)(OH) exhibits a layered structure that is composed of ZnO(6) and IO(3) polyhedra. Powder nonlinear optical (NLO) properties measurements on ZnIO(3)(OH) using 1064 nm radiation indicate the material has a second-harmonic generating (SHG) efficiency of approximately 20 times that of α-SiO(2). Additional SHG measurements reveal that the material is not phase-matchable (type 1). Infrared spectroscopy, elemental analysis, and thermogravimetric analysis for the reported compound are also presented. Crystal data: ZnIO(3)(OH), monoclinic, space group Cc (no. 9) with a = 4.67670(10) ?, b = 11.2392(4) ?, c = 6.3308(2) ?, β = 90.019(2)°, and Z = 4.     

Effect of the framework flexibility on the centricities in centrosymmetric In2Zn(SeO3)4 and noncentrosymmetric Ga2Zn(TeO3)4

The solid-state syntheses, crystal structures, and characterization of two stoichiometrically similar quaternary mixed metal selenite and tellurite, In(2)Zn(SeO(3))(4) and Ga(2)Zn(TeO(3))(4), respectively, are reported. While In(2)Zn(SeO(3))(4) crystallizes in the centrosymmetric monoclinic space group P2(1)/n (No. 14) with a = 8.4331(7) ?, b = 4.7819(4) ?, c = 14.6583(13) ?, and β = 101.684(6)°, Ga(2)Zn(TeO(3))(4) crystallizes in the non-centrosymmetric space group I-43d (No. 220) with a = b = c = 10.5794(8) ?. In(2)Zn(SeO(3))(4) exhibits a two-dimensional crystal structure consisting of distorted InO(6) octahedra, ZnO(6) octahedra, and SeO(3) polyhedra. Ga(2)Zn(TeO(3))(4) shows a three-dimensional framework structure that is composed of GaO(4) or ZnO(4) and TeO(3) polyhedra. An effect of the framework flexibility on the space group centricity is discussed. The SHG (second harmonic generation) efficiency of noncentrosymmetric Ga(2)Zn(TeO(3))(4), using 1064 nm radiation, is similar to that of KH(2)PO(4) (KDP) and is not phase-matchable (Type 1). Complete characterizations including infrared spectroscopy and thermal analyses for the reported materials are also presented, as are dipole moment calculations.     

Spectroscopic and magnetic properties of a series of μ-cyano bridged bimetallic compounds of the type M(II)-NC-Fe(III) (M = Mn, Co, and Zn) using the building block [Fe(III)(CN)5imidazole]2-

In this contribution, we describe the preparation and single-crystal X-ray diffraction of a new building block for bimetallic solid state materials. X-ray diffraction data of these complexes indicate that (PPh(4))(2)[Fe(CN)(5)imidazole]·2H(2)O crystallizes in the triclinic space group P1 with a = 9.8108(15) ?, b = 11.1655(17) ?, c = 23.848(4) ?, α = 87.219(2)°, β = 85.573(2)°, γ = 70.729(2)°, and Z = 2, while its precursor Na(3)[Fe(CN)(5)(en)]·5H(2)O crystallizes in the monoclinic space group P2(1)/n with a = 8.3607(7) ?, b = 11.1624(9) ?, c = 17.4233(14) ?, β = 90.1293(9)°, and Z = 4. Spectroscopic and magnetic properties of a series of bimetallic materials were obtained by reaction of the complex [Fe(CN)(5)imidazole](2-) with hydrated transition metal ions [M(H(2)O)(n)](2+) (M = Mn, Co, Zn; n = 4 or 6). The new bimetallic materials obtained are [Co(H(2)O)(2)][Fe(CN)(5)imidazole]·2H(2)O (1), [Mn(CH(3)OH)(2)][Fe(CN)(5)imidazole] (2), Zn[Fe(CN)(5)imidazole]·H(2)O (3), and [Mn(bpy)][Fe(CN)(5)imidazole].H(2)O (4). All of the complexes crystallize in the orthorhombic system. X-ray single-crystal analysis of the compounds identified the Imma space group with a = 7.3558(10) ?, b = 14.627(2) ?, c = 14.909(2) ?, and Z = 4 for 1; the P2(1)2(1)2(1) space group with a = 7.385(5) ?, b = 13.767(9) ?, c = 14.895(10) ?, and Z = 4 for 2; the Pnma space group with a = 13.783(2) ?, b = 7.167(11) ?, c = 12.599(2) ?, and Z = 4 for 3; and the Pnma space group with a = 13.192(3) ?, b = 7.224(16) ?, c = 22.294(5) ?, and Z = 4 for 4. The structures of 1, 2, and 4 consist of two-dimensional network layers containing, as the repeating unit, a cyclic tetramer [M(2)Fe(2)(CN)(4)] (M = Mn, Co). H bonding between the layers in the structure of 1 results in a quasi-three-dimensional network. The structure of 3 was found to be three-dimensional, where all of the cyano ligands are involved in bridging between the metal centers. The bridging character of the cyano is confirmed spectroscopically. The magnetic properties have been investigated for all of the bimetallic systems. Compound 1 shows ferromagnetic behavior with an ordering temperature at 25 K, which is higher than the corresponding Prussian Blue analogue Co(x)[Fe(CN)(6)](y)?·zH(2)O. Compound 2 shows weak ferromagnetic behavior and an interlayer antiferromagnetic character, while 3, as expected, shows paramagnetic character due to the diamagnetic character of Zn(2+). Compound 4 shows antiferromagnetic behavior.     

A new organic-inorganic hybrid layered molybdenum(V) cobalt phosphate constructed from [H24(Mo16O32)Co16(PO4)24(OH)4(C5H4N)2(H2O)6](4-) wheels and 4,4'-bipyridine linkers

A new layered molybdenum cobalt phosphate, Na(2)[Co(H(2)O)(6)][(Mo(16)O(32))Co(16)(PO(4))(4) (HPO(4))(16)(H(2)PO(4))(4)(OH)(4)(C(10)H(8)N(2))(4)(C(5)H(4)N)(2)(H(2)O)(6)]·4H(2)O (1), has been hydrothermally synthesized and structurally characterized. 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.6825(18) ?, b = 39.503(4) ?, c = 17.2763(17) ?, β = 93.791(2)°, V = 10679.4(18) ?(3), and Z = 2. A polyoxoanion of 1 exhibits an unusual organic-inorganic hybrid wheel-type cluster, in which two pyridine ligands link to the surface Co(II) atoms of a [H(24)(Mo(16)O(32))Co(16)(PO(4))(24)(OH)(4)(H(2)O)(6)] (namely, {Mo(16)Co(16)P(24)}) wheel via the Co-N bonds. Furthermore, each {Mo(16)Co(16)P(24)} wheel is connected to four adjacent wheels by four pairs of 4,4'-bipyridine linkers, forming a 2D layered network. The susceptibility measurement shows the existence of dominant antiferromagnetic interactions in 1.     

Synthesis and Characterization of Copper(II), Zinc(II), and Potassium Complexes of a Highly Fluorinated Bis(pyrazolyl)borate Ligand

Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4.     

para-Benzene disulfonic acid and its tetrachloro and tetrafluoro derivatives--studies towards polyhalogenated metal-organic-frameworks with sulfo analogues of terephthalic acid

We developed convenient synthetic routes for the preparation of para-benzene disulfonic acid (H(2)BDS) and its tetrachloro (H(2)BDSCl(4)) and tetrafluoro (H(2)BDSF(4)) derivatives. The reaction of these acids with zinc nitrate in DMF led to single crystals of [Zn(BDS)(DMF)(2)] (triclinic, P ?1[combining macron], Z=2, a=976.62(4), b=986.85(4), c=1014.40(4), α=69.106(2)°, β=68.746(2)°, γ=86.295(2)°, wR(2)=0.0627), [Zn(BDSCl(4))(DMF)(4)] (triclinic, P ?1[combining macron], Z=1, a=831.5(1), b=905.2(1), c=989.6(1), α=90.44(2)°, β=91.41 (2)°, γ=106.72(2)°, wR(2)=0.0635), and [Zn(BDSF(4))(DMF)(4)] (monoclinic, P2(1)/c, Z=2, a=889.01(3), b=968.91(3), c=1633.07(5) pm, β=106.524(2)°, wR(2)=0.0948). While [Zn(BDS)(DMF)(2)] exhibits a layer structure, the disulfonate linkers connect the zinc ions into chains in the crystal structures of [Zn(BDSCl(4))(DMF)(4)] and [Zn(BDSF(4))(DMF)(4)]. Thermoanalytical investigations revealed that desolvation of the compounds occurs in a temperature range between 100 and 200 °C. The solvent free sulfonates show remarkably high stabilities, [Zn(BDS)(DMF)(2)] is stable up to nearly 600 °C. The halogenated acids were also used to prepare copper salts from aqueous solutions and Cu(2)(OH)(2)(CO(3)) (malachite) as a copper source. The crystal structure of [Cu(H(2)O)(6)](BDSF(4)) (triclinic, P ?1[combining macron], Z=1, a=510.45(2), b=744.68(3), c=1077.77(4) pm, α=85.627 (2)°, β=77.449 (2)°, γ=76.015 (2)°) exhibits complex cations and uncoordinated sulfonate anions, while in [Cu(BDSCl(4))(H(2)O)(4)] (orthorhombic, Pnma, Z=4, a=721.27(2), b=2147.81(6), c=979.42(3) pm) the Cu(2+) ions are linked to infinite chains in the crystal structure. The most interesting structural feature of [Cu(BDSCl(4))(H(2)O)(4)] is the significant deviation from planarity of the disulfonate dianion. Theoretical investigations revealed that a boat conformation is favoured due to steric hindrance in cases where a syn coordination of the sulfonate groups occurs. The thermal behaviour of the copper compounds was also investigated by DTA/TG measurements and X-ray powder diffraction.     

Solvothermal synthesis, crystal growth, and structure determination of sodium and potassium guanidinate

Phase-pure NaCN(3)H(4) and KCN(3)H(4) were synthesized from molecular guanidine and elemental metal in liquid ammonia at room temperature and elevated pressure close to 10 atm. The crystal structures were determined at 100 K using single-crystal X-ray diffraction. Both compounds crystallize in the monoclinic system (P2(1)/c, No. 14) but are far from being isotypical. NaCN(3)H(4) (a = 7.9496(12) ?, b = 5.0328(8) ?, c = 9.3591(15) ?, β = 110.797(3)°, Z = 4) contains a tetrahedrally N-coordinated sodium cation while KCN(3)H(4) (a = 7.1200(9) ?, b = 6.9385(9) ?, c = 30.404(4) ?, β = 94.626(2)°, Z = 16) features a very large c axis and a rather complicated packing of irregularly N-coordinated potassium cations. In the crystal structures, the guanidinate anions resemble the motif known from RbCN(3)H(4), that is, with one elongated C-((amino))N single bond and two shorter C-((imino))N bonds (bond order = 1.5) although the orientation of one N-H bond differs in the guanidinate anion of NaCN(3)H(4). Both crystal structures and infrared spectroscopy evidence the presence of hydrogen-bridging bonds, and the vibrational properties were analyzed by ab initio phonon calculations.     

Expansion of antimonato polyoxovanadates with transition metal complexes: (Co(N3C5H15)2)2[{Co(N3C5H15)2}V15Sb6O42(H2O)]·5H2O and (Ni(N3C5H15)2)2[{Ni(N3C5H15)2}V15Sb6O42(H2O)]·8H2O

Two new polyoxovanadates (Co(N(3)C(5)H(15))(2))(2)[{Co(N(3)C(5)H(15))(2)}V(15)Sb(6)O(42)(H(2)O)]·5H(2)O (1) and (Ni(N(3)C(5)H(15))(2))(2)[{Ni(N(3)C(5)H(15))(2)}V(15)Sb(6)O(42)(H(2)O)]·8H(2)O (2) (N(3)C(5)H(15) = N-(2-aminoethyl)-1,3-propanediamine) were synthesized under solvothermal conditions and structurally characterized. In both structures the [V(15)Sb(6)O(42)(H(2)O)](6-) shell displays the main structural motif, which is strongly related to the {V(18)O(42)} archetype cluster. Both compounds crystallize in the triclinic space group P1 with a = 14.3438(4), b = 16.6471(6), c = 18.9186(6) ?, α = 87.291(3)°, β = 83.340(3)°, γ = 78.890(3)°, and V = 4401.4(2) ?(3) (1) and a = 14.5697(13), b = 15.8523(16), c = 20.2411(18) ?, α = 86.702(11)°, β = 84.957(11)°, γ = 76.941(11)°, and V = 4533.0(7) ?(3) (2). In the structure of 1 the [V(15)Sb(6)O(42)(H(2)O)](6-) cluster anion is bound to a [Co(N(3)C(5)H(15))(2)](2+) complex via a terminal oxygen atom. In the Co(2+)-centered complex, one of the amine ligands coordinates in tridentate mode and the second one in bidentate mode to form a strongly distorted CoN(5)O octahedron. Similarly, in compound 2 an analogous NiN(5)O complex is joined to the [V(15)Sb(6)O(42)(H(2)O)](6-) anion via the same attachment mode. A remarkable difference between the two compounds is the orientation of the noncoordinated propylamine group leading to intermolecular Sb···O contacts in 1 and to Sb···N interactions in 2. In the solid-state lattices of 1 and 2, two additional [M(N(3)C(5)H(15))(2)](2+) complexes act as countercations and are located between the [{M(N(3)C(5)H(15))(2)}V(15)Sb(6)O(42)(H(2)O)](4-) anions. Between the anions and cations strong N-H···O hydrogen bonds are observed. In both compounds the clusters are stacked along the b axis in an ABAB fashion with cations and water molecules occupying the space between the clusters. Magnetic characterization demonstrates that the Ni(2+) and Co(2+) cations do not significantly couple with the S = 1/2 vanadyl groups. The susceptibility data can be successfully reproduced assuming a distorted ligand field for the Co(2+) ions (1) and an O(h)-symmetric Ni(2+) ligand field (2).