A Copper（Ⅱ）-cadmium（Ⅱ） Heterometallic Hexanuclear Complex：[Cd_4Cu_2（pdc）_4（H_2O）_（14）]（H_3pdc=3,5-Pyrazoledicarboxylic Acid）

The title complex 1,[Cd 4 Cu 2 (pdc) 4 (H 2 O) 14 ] (H 3 pdc=3,5-pyrazoledicarboxylic acid),has been solvothermally synthesized and structurally characterized by single-crystal X-ray diffraction.Complex 1 crystallizes in triclinic,space group P1 with a=0.67235(10),b=1.27935(18),c=1.28569(17) nm,α=112.633(2),β=102.971(3),γ=97.089(2)o,V=0.9673(2) nm 3,C 20 H 32 Cd 4 Cu 2 N 8 O 30,M r=1441.22,D c=2.474 g/cm 3,μ(MoKα)=3.356 mm 1,F(000)=698,S=1.003,Z=1,the final R=0.0471 and wR=0.0748 for I > 2σ(Ⅰ).In 1,two deprotonated 3,5-pyrazoledicarboxylic acids (pdc 3),one copper(Ⅱ) ion and one cadmium(Ⅱ) ion firstly form a pyrazole-bridged Cu II Cd II dinuclear unit,two of which related by an inversion center are connected by another two cadmium(Ⅱ) ions through chelating carboxylate groups to construct the copper(Ⅱ)-cadmium(Ⅱ) heterometallic hexanuclear complexes.Plenty of hydrogen bond interactions existing in the system further lead to a three-dimensional (3D) supramolecular framework.     

Crystal Structure of a Three-dimensional Coordination Polymer {[Ca_3(μ_5-OOCCH_2OCH_2COO)_3(H_2O)_4]·4H_2O}_n

A novel three-dimensional coordination polymer, {[Ca3(μ5-OOCCH2OCH2COO)3(H2O)4]- 4H2O}n, has been synthesized with oxydiacetate as bridge ligand and structurally determined by X-ray crystallography. The crystal belongs to monoclinic, space group C2/c with a = 17.805(2), b = 9.3923(12), c = 17.255(2) A, β = 107.838(5)°, V = 2746.8(6) A3, Mr = 660.58, C12H28Ca3O23, Dc = 1.597 g/cm3, μ = 0.695 mm-1, Z = 4, F(000) = 1376, GOOF = 1.027, R = 0.0303 and wR = 0.0660. In the complex there are two coordination modes for Ca(II) ions, one coordinated by three μ5-OOCCH2OCH2COO2- bridge ligands together with two H2O molecules, and the other by five μ-5-OOCCH2OCH2COO2 bridge ligands. In both coordination modes each Ca(II) ion assumes a distorted dipentapyramidal CaO7 geometry; whereas each oxydiacetate is coordinated with five Ca(II) ions and acts as a pentdentates bridge ligand.     

Synthesis and Crystal Structure of a Dinuclear Complex of Cu（II） with Tetra（3,5-diphenyl pyrazole）

A Cu(II) complex of tetra(3,5-diphenyl pyrazole) [Cu(C15H12N2)2Cl2]2 (1) was synthesized, and its structure was determined by single-crystal X-ray diffraction and further characterized by elemental analysis, NMR and IR. 1 belongs to the monoclinic system, space group P21/c with a = 13.3780(5), b = 15.1392(6), c = 15.5923(6) , β = 124.522(2)°, Z = 2 and V = 2601.86(17) 3. In 1, each Cu2+ ion is coordinated with two N atoms from two tetra(3,5-diphenyl pyrazole) ligands and three Cl- anions to give a distorted square-pyramidal geometry, which is further linked through edge-sharing bridging by Cl- anions to form a centrosymmetric dinuclear structure.     

A Three-dimensional Porous Metal-organic Framework Based on Cyano Unit and 1,4-Bis（1,2,4-triazol-1-yl）butane（btb）：{[Cu_8（btb）_2（CN）_8].3H_2O}_n

The title coordination polymer 1,{[Cu8(btb)2(CN)8].3H2O}n(btb = 1,4-bis(1,2,4-triazol-1-yl)butane),has been hydrothermally synthesized and structurally characterized by single-crystal X-ray diffraction.Complex 1 crystallizes in monoclinic,space group C2/c with a = 1.2938(3),b = 1.9422(5),c = 0.9406(2) nm,β = 121.891(4)°,V = 2.0066(9) nm3,C24H30Cu8N20O3,Mr = 1155.00,Dc = 1.912 g/cm3,μ(MoKα) = 4.209 mm?1,F(000) = 1140,GOF = 1.184,Z = 2,the final R = 0.0634 and wR = 0.1503 for I > 2σ(I).In complex 1,one-dimensional CuCN zigzag chains are linked by triazolyl groups of btb ligands to form two-dimensional networks,which are further bridged by 1,4-butyl moieties of btb ligands to fabricate a three-dimensional order framework,in which one-dimensional ellipsoid-like channels are observed.     

A New 1D Cd(Ⅱ) Coordination Polymer Constructed by 2,2'-H_2biimidazole:[Cd(H_2biim)_2(SO_4)]_n·3nH_2O

A new 1D Cd(II) coordination polymer, [Cd(H2biim)2(SO4)]n·3n H2O(1, H2 biim = 2,2'-H2biimidazole), has been hydrothermally synthesized and characterized by single-crystal X-ray diffraction. It crystallizes in monoclinic, space group P21/c with a = 6.8405(14), b = 17.792(4), c = 14.987(3) A, β = 92.68(3), V = 1822.1(6) A3, Z = 4, C12H18 Cd N8O7S, Mr = 530.80, Dc = 1.935 g/cm3, F(000) = 1064, μ(Mo Ka) = 1.371 mm-1, R = 0.0280 and w R = 0.0617. In 1, adjacent Cd(II) atoms are bridged by sulfate anions in bidentate modes to yield a 1D chain. H2 biim ligands are located on both sides of the chain in chelating bidentate modes. Further, the H2 biim ligands from neighboring chains are paired through π-π interactions to generate a supramolecular layer, which is stabilized by the complicated N–H···O and O–H···O hydrogen bonds. In addition, thermal behavior and luminescent property of 1 have been investigated.     

Synthesis and Crystal Structure of[Cu（dppb）（NO_3）]_2（dppb=1,4-Bis（diphenylphosphino）butane）

The synthesis and molecular structure of a new dinuclear copper(Ⅰ) complex [Cu(dppb)(NO 3)] 2 are reported.The compound crystallizes in the monoclinic system,space group P2 1 /n with a=12.830(3),b=10.899(2),c=19.666 (4),β=104.69(3)°,V=2660.1(9)3,Z=4,D c=1.378 g/cm 3,F(000)=1144,the final R=0.0600 and wR=0.0668 for 2951 observed reflections with I > 2σ(Ⅰ).The complex contains a folded Cu 2 P 4 core structure,with two Cu(Ⅰ) atoms being bridged by a pair of dppb ligands to form a 14-membered Cu 2 P 4 C 8 zigzag ring.The ligand sphere of each metal center is completed by a nitrate anion in a chelating fashion.     

Synthesis and Crystal Structure of a Dinuclear Complex： Bis[aqua（phen）（4- aba）copper（Ⅱ）nitrate（4-abaH）dihydrate]

The title complex has been obtained by the reaction of copper nitrate tri-hydrate with 4-abaH (4-abaH=4-aminobenzonic acid) and phenanthroline in ethanol solution,and its structure was determined by X-ray crystallography with the following data: monoclinic,space group C2/c,Mr=1266.13,Cu2C52H54N10O20,a=25.884(5),b=10.205(2),c=20.849(4) ,β=106.34(3)°,Z=4,V=5284.7(18) 3,F(000)=2616,Dc=1.591 g/cm3,μ=0.896 mm-1,the final R=0.0441 and wR=0.1148 for 4200 observed reflections (I > 2σ(I)). In the molecule of the title complex,the asymmetric unit contains one half molecule. The Cu(Ⅱ) atom is five-coordinated by a terminal water molecule,a bidentate phenanthroline and two monodentate 4-aminobenzoate ligands forming a square pyramidal coordination environment. The two bridging 4-aminobenzoate ligands result in a dinuclear copper(Ⅱ) cluster with a short Cu–Cu distance (3.048 ) and a π-π stacking between the adjacent phenanthroline rings (2.96 ).     

Synthesis and Crystal Structure of a New Complex [Cu（C_（14）H_9O_3）_2（C_5H_5N）_2（C_2H_5OH）_2]

The title compound of Cu(C14H9O3)2(C5H5N)2(C2H5OH)2(1) was synthesized via the hy- drothermal reaction of CuCl2·2H2O and 9-hydroxy-fluorene-9-carboxylic acid(HHF) with pyridine, and characterized by elemental analysis and infrared spectra. The crystal belongs to triclinic, space group P1 with a = 8.8302(12), b = 10.1625(14), c = 12.2708(17), α = 86.207(2), β = 69.562(2), γ = 64.932(2)o, V = 930.3(2) 3, Z = 1, Mr = 764.30, Dc = 1.364 g/cm3, F(000) = 399, S = 1.059 and μ(MoKα) = 0.644 mm-1. The final R = 0.0459 and wR = 0.1274 for 3414 observed reflections with I 2σ(I). The copper atom is six-coordinated by two oxygen atoms from two different 9-hydroxy-fluorene-9-carboxylate ligands, two pyridine nitrogen atoms and two ethanol oxygen atoms, forming a distorted octahedral coordination geometry. The extensive O–H···O hydrogen bonding connects the molecules to form a one-dimensional chain structure. Between adjacent one-dimensional chains, a two-dimensional layered structure was formed by fluorene ring π-π packing interaction. Between the layers, a three-dimensional structure was formed through the π-π packing interaction of the pyridine ring. Moreover, the thermal stability and photoluminescent property of the complex has been investigated.     

Unprecedented Pseudo Water Tapes Stabilized by a One-dimensional Cu（Ⅱ） Coordination Polymer

A new compound,[Cu(mal)(tmdpy)(H2O)]·4H2O(1,H2mal = malonic acid,tmdpy = 4,4'-trimethylenedipyridine) has been synthesized by the hydrothermal synthesis and structurally characterized by X-ray crystallography. It crystallizes in triclinic,space group P1 with a = 9.1662(6),b = 10.6266(7),c = 11.3056(7) ,α = 84.6390(10),β = 72.1030(10),γ = 73.0420(10) o,V = 1002.37(11) 3,C16H26CuN2O9,Mr = 453.93,Z = 2,Dc = 1.504 g/cm3,μ = 1.140 mm-1,F(000) = 474,R = 0.0375 and wR = 0.0975 for 3187 observed reflections(I > 2σ(I)) . In the structure of 1,the tmdpy ligands link the [Cu(mal)(H2O) ] units into an infinite chain,and the water molecules and carboxylate oxygen donors(O(2) and O(4)) from the mal ligands cooperatively built an interesting hydrogen bonding network with unprecedented pseudo water tape substructures.     

Synthesis and Crystal Sturcture of a New Praseodymium（Ⅲ）polym煳x：[

A novel polymeric Pr2Cu3 complex of iminodiacetic acid (H2L1=NH{CH2COOH}2) [Pr2Cu3(L1)6]n , 1, has been synthesized and structurally characterized. The title complex Pr2Cu3O24N6C24H30 (Mr=1258.97) crystallized in trigonal space group Pc1 (No. 165) with a = 13.424(4), c=14.752(6)(); V=2303(1)()3; F(000)=1226; λ(MoKα)=35.2 cm-1; Dc=1.820 g.cm-3; Z=2. The final R and Rw are 0.072 and 0.081 respectively for 1412 reflections with I>3σ(I). In crystal 1, the Pr3+ ion is nine-coordinated by 6 O atoms from three bidentate chelating carboxylate groups and 3 O atoms from three anti-anti bridging carboxylic groups of six L1 ligands; the Cu2+ ion is six-coordinated by 4 O and 2 N atoms from two pentadentate L1 ligands. Each pair of Pr(Ⅲ) atoms is bridged by three L1 ligands, each of which also chelates with one copper(Ⅱ) ion, thus forming a Pr2Cu3 cluster unit. Such cluster units are cross-linked by flexible L1 ligands into a three-dimensional coordination framework.     

Synthesis and Crystal Structure of a Macrocycle [Cu(dadm)(mal)(H2O)]2·2H2O

The reaction of 4,4′-diaminodiphenylmethane (dadm), malonic acid (H2mal) and Cu(NO3)2 in aqueous solution results in a discrete binuclear Cu(II) macrocycle: [Cu(dadm)(mal)- (H2O)]2(2H2O. It crystallizes in monoclinic, space group P21/c with a = 15.231(3), b = 11.847(2), c = 9.801(2)A,Z= 106.75(3)o, V = 1693.5(6)A3, Z = 2, C32H40Cu2N4O12, Mr = 799.76, Dc = 1.568 g/cm3, λ(MoK() = 0.71073A, μ = 1.325 mm-1, F(000) = 828, the final R = 0.0531 and Wr = 0.1244 for 3421 observed reflections with I > 2σ(I). Each Cu(II) is coordinated by two oxygen atoms from a mal ligand, two nitrogen atoms from two dadm ligands and a water oxygen atom to form a triangle bipyramidal motif. The title compound possesses a distorted macrocycle enclosed by dadm with approximate dimensions of 8.3A× 5.9A.     

Synthesis and Crystal Structure of a Macrocycle [Cu(dadm)(mal)(H_2O)]_2·02H_2O

1 INTRODUCTION Recently the self-assembly through transition metal and N-containing organic ligands has appear- ed as a popular research field in supramolecular architecture. Among the N-donor organic ligands, the rigid ligands have been well investigat…     

Copper(I) complexes of tripodal tris(imidazolyl) ligands: potential mimics of the Cu(A) site of hydroxylase enzymes

Copper(I) complexes of tripodal tris(N-methyl-4,5-diphenyl-imidazolyl)methane ligands, N3CR (1a-c, R = OH, OMe, H), have been prepared as models for the Cu(A) site of copper hydroxylase enzymes. In the absence of additional donors, the ligands 1 react with [Cu(CH3CN)4]PF6 (2) to produce dinuclear complexes [(N3CR)2Cu2](PF6)2 (3) in which the tripodal ligands bridge two trigonal Cu centers; the structures of 3b and 3c are established by X-ray diffraction. Mononuclear adducts [(N3CR)CuL]Z are produced with L = acetonitrile (4), carbon monoxide (5), and t-BuNC (6, 7). The carbonyl complexes 5 are in dynamic equilibrium with the dimeric complexes 3, but 5c (R = H) can be isolated. The structures of the isocyanide derivatives depend critically on the tripod methane substituent, R. Thus, the X-ray structures of 6 (R = OMe) and 7 (R = H) show trigonal and tetrahedral geometries, respectively, with bi- or tridentate coordination of the tripod. A trinuclear complex [Cu3(N3COH)2(t-BuNC)2](PF6)3 (8) is formed from N3COH (1a) which features both three-coordinate and two-coordinate Cu atoms and bidentate tripod coordination. Reactions of dioxygen with dinuclear 3c or mononuclear [(N3CR)CuL]Z are sluggish, producing from the latter in acetone [(N3CH)CuII(L)(L')](PF6)2 (9, L = acetone, L' = H2O).     

A windmill-shaped hexacopper(II) molecule built up by template core-controlled expansion of diaquatetrakis(mu2-adeninato-N3,N9)dicopper(II) with aqua(oxydiacetato)copper(II)

The windmill-shaped hexanuclear copper(II) cluster {(H(2)O)(2)Cu(2)(mu(3)-(Ade)(4)[Cu(oda)(H(2)O)](4)}.6H(2)O (1-o) has been synthesized in aqueous medium by in situ core-controlled expansion of the neutral building block Cu(2)(mu(2)-N3,N9-Ade)(4)(H(2)O)(2) (2) with Cu(oda)(H(2)O) (3-o) (Ade = adeninato(1-) and oda = oxydiacetato(2-) ligands). Crystal data for 2-b (2.5H(2)O): triclinic, space group P(-)1; a = 9.374(1), b = 9.440(1), c = 10.326(1) A; alpha = 78.72(1), beta = 76.77(1), gamma = 63.51(1) degrees ; final R(1) = 0.059; T = 100(2) K. Crystal data for 1-o: monoclinic, space group P2(1)/n; a = 15.203(2), b = 10.245(1), c = 19.094(2) A; beta = 101.61(1) degrees ; final R(1) = 0.049; T = 293(2) K. The X-shaped hexanuclear molecule consists of a central core (2) and four terminal arms (3-o) linked together by bridging mu(3)-N3,N7,N9-Ade ligands. There are three crystallographic independent metal atoms (two terminals, one central). All Cu(II) atoms exhibit a 4 + 1 coordination, of which one is an aqua apical ligand. The basal coordination sets complete the CuN(4) + O or CuO(3)N + O chromophores for the central or terminal metal atoms, respectively. Thermal stability and spectral and magnetic properties were also studied. Analogous compounds to 1-o with tridentate or tripodal tetradentate ligands L(2-), instead of oda, have also been synthesized.     

Syntheses and Crystal Structures of Two Novel 1-D Metal Complexes with Dicyanamide： [Zn（pheen）（dca）2]n and [Cu（quin）2（dca）2]n

1 INTRODUCTION Polymeric transition metal complexes with di-cyanamide have attracted considerable attention because of their interesting coordination and phy-sical properties in recent years[1]. The dicyanamide is a versatile ligand coordinated to metal…     

Synthesis and structures of polymeric Mn, Co, Cu, and Zn complexes of 3-diphenylamino-4-hydroxycyclobut-3-ene-1,2-dione (diphenylaminosquarate) and of the salt [Ni(H2O)6][(C6H5)2NC4O3]2.2H2O

Reaction of M(NO3)2.xH2O (M = Mn, Co, Ni, Cu, Zn) with 3-diphenylamino-4-hydroxycyclobut-3-ene-1,2-dione (diphenylaminosquarate) produces the neutral polymeric species (M[mu-(C6H5)2NC4O3]2[H2O]2)n [M = Mn (1), Cu (2)]; (M[mu-(C6H5)2NC4O3][(C6H5)2NC4O3][H2O]3)n [M = Co (3), Zn (4)]; and in the case of Ni, the salt [Ni(H2O)6][(C6H5)2NC4O3]2.2H2O (5). Complexes 1 and 2 are isomorphous and crystallize in the monoclinic space group P2(1)/c with, for 1, a = 13.138(1) A, b = 10.900(2) A, c = 9.269(2) A, beta = 96.07(1) degrees, and Z = 2. Complexes 3 and 4 are also isomorphous and crystallize in the space group P2(1)/c with, for 3, a = 13.211(1) A, b = 11.038(1) A, c = 18.748(1) A, beta = 97.75(1) degrees, and Z = 4. The nickel salt, 5, crystallizes in the triclinic space group P1 with a = 6.181(1) A, b = 9.417(1) A, c = 15.486(1) A, alpha = 101.37(1) degrees, beta = 95.51(1) degrees, gamma = 107.57(1) degrees, and Z = 1. In 1 and 2, the metal coordination is octahedral, comprising four mu-1,3-bridging diphenylaminosquarate ligands and two trans aqua ligands. In 3 and 4, the metal coordination is again octahedral, comprising two mu-1,3-bridging and one pendant diphenylaminosquarate ligands, the octahedron being completed by three aqua ligands in a meridional configuration. In 5, the hexaaquanickel(II) ion is linked by O-H...O hydrogen bonds to a pair of diphenylaminosquarate anions. These anion-cation units are linked via included water molecules to form hydrogen-bonded chains. The diphenylaminosquarate ligands in the polymeric complexes 1-4 display multiple-bond localization, a feature which is absent in 5. Complex 1 exhibits weak antiferromagnetic coupling, whereas 2 shows no significant magnetic interactions.     

Synthesis and Crystal Structure of {Cu2(pdc)2(4,4′-bipy)(H2O)·(3H2O}2

The title compound {Cu2(pdc)2(4,4′-bipy)(H2O)(3H2O}2 1 (H2pdc = pyridine-2,6- dicarboxylic acid, also known as dipicolinic acid; 4,4′-bipy = 4,4′-bipyridine) has been synthesized by the hydrothermal reaction and its structure was determined by single-crystal X-ray diffraction. The crystal is of triclinic, space group Pī with a = 7.2278(3), b = 10.6259(4), c = 17.7614(6)A, α= 79.5990(10), β = 83.6300(10), γ = 71.8280(10)o, V = 1272.60(8)A3, C48H44Cu4N8O24, Mr = 1371.07, Z = 1, Dc = 1.789 g/cm3, μ = 1.747 mm-1, F(000) = 696, R = 0.0397 and wR = 0.1137 for 3938 observed reflections (I > 2σ(I)). There are two kinds of Cu coordination environments, and each central copper(II) atom is five-coordinated in a distorted square-based pyramidal coordination geo- metry. Four copper(II) atoms are linked by four pdc and two 4,4′-bipy ligands to form an annular rectangle structure. Extensive hydrogen-bonding interactions involving carboxylate O atoms as well as coordinated and free water molecules lead to the formation of a three-dimensional network struc- ture.     

Novel acetate binding modes in [Na2Cu(CH3COO)4(H2O)].H2O

A new copper(II) acetate, [Na(2)Cu(CH(3)COO)(4)(H(2)O)].H(2)O (1), has been crystallized from an aqueous solution containing sodium acetate and copper(II) acetate monohydrate in a 4:1 ratio and the structure determined by X-ray crystallography. 1 crystallizes in the monoclinic space group P2(1)/c, with a = 16.638(3) A, b = 11.781(2) A, c = 15.668(3) A, beta = 90.11(3) degrees, V = 3071.0(11) A(3), and Z = 4. In the asymmetric unit, sodium ions bridge two crystallographically unique square planar [Cu(CH(3)COO)(4)](2-) units to their symmetry-generated neighbors to form corrugated 2D sheets of Na(2)Cu(CH(3)COO)(4), which are held together by H-bonding interactions involving the waters of crystallization. In contrast, the structures of known sodium copper acetates are better described as 3D frameworks. The metal centers are bridged by a number of acetates in novel coordination modes. The square planar Cu(II) geometry generated by oxygen atoms from four different acetates is an unexpected feature given the weak ligand field provided by the acetate ligands.     

Synthesis and Characterization of a One-dimensional Chain Polymer {[Cu(4-CPOA)(3-PyOH)2(H2O)2](H2O}n

A novel one-dimensional copper(II) coordination polymer of {[Cu(4-CPOA)(3- PyOH)2(H2O)2]·H2O}n (4-CPOA2- = 4-carboxyphenoxyacetate dianion, 3-PyOH = 3-hydroxypyri- dine) has been synthesized and characterized by elemental analyses, IR spectra and single-crystal X-ray diffraction. The complex C19H22N2O10Cu crystallizes in triclinic system, space group P-1with a = 7.672(2), b = 18.490(4), c = 13.271(3) (A), α = 72.81(3), β ＝ 84.64(3), γ = 87.28(3)°, V = 1026.3(4) (A)3, Z = 2, Mr = 501.94, Dc = 1.624 g/cm3, μ = 1.126 mm-1, F(000) = 518, the final R = 0.0580 and wR = 0.1310 for 3364 observed reflections with I > 2σ(I). Each Cu(II) ion is coordinated with two different carboxyl O atoms from two 4-carboxyphenoxyacetate groups, two N atoms from two 3-PyOH ligands and two water molecules, residing in a distorted octahedral environment. Adjacent Cu(II) atoms are linked by bi-monodentate 4-CPOA2- groups into an one-dimensional chain along the b axis. A three-dimensional supramolecular network is constructed by O-H…O hydrogen bonds.