Synthesis, characterization, and structure-property relationships in two new polar oxides: Zn2(MoO4)(SeO3) and Zn2(MoO4)(TeO3)

Two new noncentrosymmetric (NCS) polar oxide materials, Zn(2)(MoO(4))(AO(3)) (A = Se(4+) or Te(4+)), have been synthesized by hydrothermal and solid-state techniques. Their crystal structures have been determined, and characterization of their functional properties (second-harmonic generation, piezoelectricity, and polarization) has been performed. The isostructural materials exhibit a three-dimensional network consisting of ZnO(4), ZnO(6), MoO(4), and AO(3) polyhedra that share edges and corners. Powder second-harmonic generation (SHG) measurements using 1064 nm radiation indicate the materials exhibit moderate SHG efficiencies of 100 × and 80 × α-SiO(2) for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Particle size vs SHG efficiency measurements indicate the materials are type 1 non-phase-matchable. Converse piezoelectric measurements resulted in d(33) values of ～14 and ～30 pm/V for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively, whereas pyroelectric measurements revealed coefficients of -0.31 and -0.64 μC/m(2) K at 55 °C for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Frequency-dependent polarization measurements confirmed that all of the materials are nonferroelectric; that is, the macroscopic polarization is not reversible, or "switchable". Infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were also performed. First-principles density functional theory (DFT) electronic structure calculations were also done. Crystal data: Zn(2)(MoO(4))(SeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.1809(4) ?, b = 8.3238(7) ?, c = 7.1541(6) ?, β = 99.413(1)°, V = 305.2(1) ?(3), Z = 2; Zn(2)(MoO(4))(TeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.178(4) ?, b = 8.409(6) ?, c = 7.241(5) ?, β = 99.351(8)°, V = 311.1(4) ?(3), Z = 2.     

Sulfates of the refractory metals: crystal structure and thermal behavior of Nb2O2(SO4)3, MoO2(SO4), WO(SO4)2, and two modifications of Re2O5(SO4)2

The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.     

Two new neptunyl(V) selenites: a novel cation-cation interaction framework in (NpO2)3(OH)(SeO3)(H2O)2 3H2O and a uranophane-type sheet in Na(NpO2)(SeO3)(H2O)

Dark green crystals of (NpO(2))(3)(OH)(SeO(3))(H(2)O)(2)·H(2)O (1) have been prepared by a hydrothermal reaction of neptunyl(V) and Na(2)SeO(4) in an aqueous solution at 150 °C, while green plates of Na(NpO(2))(SeO(3))(H(2)O) (2) have been synthesized by evaporation of a solution of neptunyl(V), H(2)SeO(4), and NaOH at room temperature. Both compounds have been characterized by single-crystal X-ray diffraction. The structure of compound contains three crystallographically unique Np atoms that are bonded to two O atoms to form a nearly linear O═Np═O NpO(2)(+) cation. Neighboring Np(5+) ions connect to each other through a bridging oxo ion from the neptunyl unit, a configuration known as cation-cation interactions (CCIs), to build a complex three-dimensional network. More specifically, each Np(1)O(2)(+), Np(2)O(2)(+), and Np(3)O(2)(+) cation is involved in three, five, and four CCIs with other units, respectively. The framework of neptunyl(V) pentagonal bipyramids is decorated by selenite trigonal pyramids with one-dimensional open channels where uncoordinated waters are trapped via hydrogen bonding interactions. Compound adopts uranophane-type [(NpO(2))(SeO(3))](-) layers, which are separated by Na(+) cations and water molecules. Within each layer, neptunyl(V) pentagonal bipyramids share equatorial edges with each other to form a single chain that is further connected by both monodentate and bidentate selenite trigonal pyramids. Crystallographic data: compound, monoclinic, P2(1)/c, Z = 4, a = 6.6363(8) ?, b = 15.440(2) ?, c = 11.583(1) ?, β = 103.549(1)°, V = 1153.8(2) ?(3), R(F) = 0.0387 for I > 2σ(I); compound (2), monoclinic, C2/m, Z = 4, a = 14.874(4) ?, b = 7.271(2) ?, c = 6.758(2) ?, β = 112.005(4)°, V = 677.7(3) ?(3), R(F) = 0.0477 for I > 2σ(I).     

Synthesis, structure, and characterization of novel two- and three-dimensional vanadates: Ba2.5(VO2)3(SeO3)4.H2O and La(VO2)3(TeO6).3H2O

Two new vanadates, Ba(2.5)(VO2)3(SeO3)4.H2O and La(VO2)3(TeO6).3H2O, have been synthesized by hydrothermal methods using BaCO3, Ba(OH)2.H2O, La(NO3)3.6H2O, V2O5, TeO2, and H2SeO3 as reagents. The structures were determined by single-crystal X-ray diffraction. Ba(2.5)(VO2)3(SeO3)4.H2O exhibits a two-dimensional layered structure consisting of VO(5) square pyramids and SeO3 polyhedra, whereas La(VO2)3(TeO6).3H2O has a three-dimensional framework structure composed of VO(4) tetrahedra and TeO6 octahedra. Infrared and Raman spectroscopy, UV-vis diffuse reflectance spectroscopy, and thermogravimetric analysis are also presented. Crystal data: Ba(2.5)(VO2)3(SeO3)4.H2O, trigonal, space group P (No. 147) with a = b = 12.8279(15) A, c = 7.2631(9) A, V = 1035.1(2) A(3), and Z = 2; La(VO2)3(TeO6).3H2O, trigonal, space group R3c (No. 161) with a = b = 9.4577(16) A, c = 23.455(7) A, V = 1816.9(7) A3, and Z = 6.     

AVSeO(5) (A = Rb, Cs) and AV(3)Se(2)O(12) (A = K, Rb, Cs, NH(4)): Hydrothermal Synthesis in the V(2)O(5)-SeO(2)-AOH System and Crystal Structure of CsVSeO(5)

Hydrothermal reactions in the V(2)O(5)-SeO(2)-AOH systems (A = Na, K, Rb, Cs, NH(4)) were studied with various reagent mole ratios. Typical millimole ratios were V(2)O(5)/SeO(2)/AOH = 5 or 3/15/x in 10-mL aqueous solutions, where x was 5, 10, 15, and 20. The reactions with x = 5 for A = K, Rb, Cs, and NH(4) at 230 degrees C produced single-phase products of the general formula AV(3)Se(2)O(12) with the (NH(4))(VO)(3)(SeO(3))(2) structure type. The x = 15 reactions for A = Rb and Cs yielded AVSeO(5) phases with a new structure type. The crystal structure for CsVSeO(5) was determined with X-ray single-crystal diffraction techniques to be monoclinic (P2(1) (No. 4), a = 7.887(3) ?, b = 7.843(2) ?, c = 9.497(3) ?, beta = 92.13(3) degrees, Z = 4). The structure of this compound consists of interwoven helixes extended in all three directions. The spires are composed of alternating SeO(3) and VO(5) units sharing common-edge oxygens in all three directions. For A = K and NH(4), the reactions of this mole ratio did not produce any identifiable phases. Each of the compounds is characterized by powder X-ray diffraction, infrared spectroscopic, and thermogravimetric techniques. The dependency of the synthesis results on the reaction conditions is discussed and rationalized.     

K(VO)(SeO(3))(2)H: A New One-Dimensional Compound with Strong Hydrogen Bonding

The hydrothermal synthesis, X-ray single crystal structure, magnetic properties, and solid state NMR and infrared spectroscopic data of a new compound, K(VO)(SeO(3))(2)H, are described. K(VO)(SeO(3))(2)H crystallizes in the monoclinic space group P2(1)/m (No. 11), with a = 7.8659(7) ?, b = 10.4298(7) ?, c = 4.0872(7) ?, beta = 96.45(1) degrees, and Z = 4. The structure is described as parallel linear strands made of repeating [(VO)(SeO(3))(2)](2-) units. The chains are held together through hydrogen bondings between selenite oxygens, weak V=O.V=O bonds, and ionic bonds to the interchain K(+) ions. The hydrogen bonding in this compound shows many characteristics of the strong hydrogen bonding with a short O-O distance of 2.459(6) ?, a large down field shift of the proton NMR signal of 19 +/- 1 ppm, and a low O-H absorption frequency. However, the exact position of the hydrogen atom and, thus, the nature of the hydrogen bonding in this compound is unclear. Possible models for the hydrogen atom positions are discussed based on experimental and literature data. The magnetic susceptibility data show an antiferromagnetic coupling below 19 K. The curve can be explained with a 1-D Heisenberg model for S = (1)/(2) with J/k = 13.8 K and g = 1.97.     

Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

Synthesis and structural characterization of a new series of vanadoselenites, [Se(x)V(4-x)O(12-x)](4-x)- (x=1,2)

Two new vanadoselenites, [SeV(3)O(11)](3)(-) and [Se(2)V(2)O(10)](2)(-), were synthesized by reacting SeO(2) with VO(3)(-). Single-crystal X-ray structural analyses of [(n-C(4)H(9))(4)N](3)[SeV(3)O(11)].0.5H(2)O [orthorhombic, space group P2(1)2(1)2, a = 22.328(5) A, b = 44.099(9) A, c = 12.287(3) A, Z = 8] and [[(C(6)H(5))(3)P](2)N](2)[Se(2)V(2)O(10)] [monoclinic, space group P2(1)/n, a = 12.2931(3) A, b = 13.5101(3) A, c = 20.9793(5) A, beta = 106.307(1) degrees, Z = 2] revealed that both anions are composed of Se(x)()V(4)(-)(x)()O(4) rings. The (51)V, (77)Se, and (17)O NMR spectra established that both [SeV(3)O(11)](3)(-) and [Se(2)V(2)O(10)](2)(-) anions maintain this ring structure in solution.     

Syntheses and Properties of New Layered Alkali-Metal/Ammonium Vanadium(V) Methylphosphonates: M(VO(2))(3)(PO(3)CH(3))(2) (M = NH(4), K, Rb, Tl). Single-Crystal Structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2)

The hydrothermal syntheses of a family of new alkali-metal/ammonium vanadium(V) methylphosphonates, M(VO(2))(3)(PO(3)CH(3))(2) (M = K, NH(4), Rb, Tl), are described. The crystal structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) have been determined from single-crystal X-ray data. Crystal data: K(VO(2))(3)(PO(3)CH(3))(2), M(r) = 475.93, trigonal, R32 (No. 155), a = 7.139(3) ?, c = 19.109(5) ?, Z = 3; NH(4)(VO(2))(3)(PO(3)CH(3))(2), M(r) = 454.87, trigonal, R32 (No. 155), a = 7.150(3) ?, c = 19.459(5) ?, Z = 3. These isostructural, noncentrosymmetric phases are built up from hexagonal tungsten oxide (HTO) like sheets of vertex-sharing VO(6) octahedra, capped on both sides of the V/O sheets by PCH(3) entities (as [PO(3)CH(3)](2-) methylphosphonate groups). In both phases, the vanadium octahedra display a distinctive two short + two intermediate + two long V-O bond distance distribution within the VO(6) unit. Interlayer potassium or ammonium cations provide charge balance for the anionic (VO(2))(3)(PO(3)CH(3))(2) sheets. Powder X-ray, TGA, IR, and Raman data for these phases are reported and discussed. The structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) are compared and contrasted with related layered phases based on the HTO motif.     

Hydrothermal syntheses, crystal structures, and magnetic properties of inorganic-organic hybrid vanadium selenites with zero- to three-dimensional structures: (1,10-phenanthroline)(2)V(2)SeO(7), (2,2'-bipyridine)VSeO(4), (4,4'-bipyridine)V(2)Se(2)O(8), and (4,4'-bipyridine)(2)V(4)Se(3)O(15).H(2)O

A family of inorganic-organic hybrid vanadium selenites with zero-, one-, two-, and three-dimensional structures, (1,10-phen)(2)V(2)SeO(7), (2,2'-bipy)VSeO(4), (4,4'-bipy)V(2)Se(2)O(8), and (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O (where phen = phenanthroline and bipy = bipyridine), were hydrothermally synthesized and characterized by single-crystal X-ray diffraction. Different bidentate organodiamine ligands and reactant concentrations were used in the four reaction systems, which are responsible for the variety of structural dimensions of the compounds. (1,10-phen)(2)V(2)SeO(7) crystallizes in a monoclinic system with space group P2(1)/n and cell parameters a = 8.6509(3) A,( )b = 7.8379(2) A, c = 34.0998(13) A, beta = 91.503(2) degrees, and Z = 4. (2,2'-bipy)VSeO(4) crystallizes in a monoclinic system with space group C2/c and cell parameters a = 17.0895(12) A, b = 14.7707(10) A, c = 11.7657(8) A, beta = 131.354(3) degrees, and Z = 8. (4,4'-bipy)V(2)Se(2)O(8) crystallizes in a triclinic system with space group Ponemacr; and cell parameters a = 7.1810(10) A, b = 10.8937(13) A, c = 11.1811(15) A, alpha = 115.455(3) degrees, beta = 107.582(3) degrees, gamma = 91.957(4) degrees, and Z = 2. (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O crystallizes in a monoclinic system with space group Pc and cell parameters a = 7.9889(9) A, b = 7.8448 A, c = 23.048(3) A, beta = 99.389(4) degrees, and Z = 2. (1,10-phen)(2)V(2)SeO(7) has an isolated structure, (2,2'-bipy)VSeO(4) has a chain structure, (4,4'-bipy)V(2)Se(2)O(8) has a layered structure, and (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O has a framework structure. The chains are constructed from VO(4)N(2) octahedra and SeO(3) pyramids, laced by organic ligands (2,2'-bipy). The layers consist of vanadium selenite chains [(VO)(2)(SeO(3))(2)]( infinity ), linked by 4,4'-bipy molecules. The framework is composed of vanadium selenite sheets [V(4)Se(3)O(16)]( infinity ), pillared by 4,4'-bipy molecules. All of the compounds are thermally stable to 300 degrees C, and the magnetic susceptibilities confirm the existence of tetravalent V atoms in the antiferromagnetic (4,4'-bipy)V(2)Se(2)O(8) complex and mixed tetravalent and pentavalent V atoms in the paramagnetic complex (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O.     

Hydrothermal syntheses and crystal structures of complex-linked three-Dimensional coordination vanadium selenites: M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (M = Co,Ni)

Two inorganic-organic hybrid compounds with the formula M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (M = Co, Ni) were hydrothermally synthesized and characterized by single-crystal X-ray diffraction. Compounds Co(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (1) and Ni(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (2), which are structural analogues, crystallize in the triclinic space group Ponemacr; with crystal data a = 7.9665(3) A, b = 8.1974(3) A, c = 13.8096(4) A, alpha = 85.704(2) degrees, beta = 73.5180(10) degrees, gamma = 75.645(2) degrees, V = 837.76(5) A(3), and Z = 2 and a = 7.9489(19) A, b = 8.128(2) A, c = 13.709 A, alpha = 85.838(6) degrees, beta = 73.736(8) degrees, gamma = 75.594(9) degrees, V = 823.5(4) A(3), and Z = 2, respectively. [M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10)] (M = Co, Ni) have a three-dimensional structure and consist of two subunits, [(VO(2))(SeO(3))](-) infinite chains and [M(4,4'-bipy)(H(2)O)](2+) fragments. The [(VO(2))(SeO(3))](-) chains are composed of [V(2)Se(4)O(14)](4)(-) clusters linked by VO(4)N triangular bipyramids. The 4,4'-bipy molecule as a bifunctional organic ligand is directly linked to Co or Ni and V atoms, affording the three-dimensionality. The compounds were characterized by infrared spectroscopy and differential thermal and thermogravimetric analyses.     

Linear Trinuclear Pt.Mo-Mo Complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CR)(2)](2) (X = Cl, Br, I; R = CH(3), C(CH(3))(3); pyphos = 6-(Diphenylphosphino)-2-pyridonate) with an Axial Interaction between the Quadruply Bonded Mo(2) Moiety and the Platinum Atom

An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters.     

X-ray Crystallographic Study of the Ruthenium Blue Complexes [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2): Steric Interactions and the Ru-Ru "Bond Length"

X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions.     

Chemistry in Molten Alkali Metal Polyselenophosphate Fluxes. Influence of Flux Composition on Dimensionality. Layers and Chains in APbPSe(4), A(4)Pb(PSe(4))(2) (A = Rb, Cs), and K(4)Eu(PSe(4))(2)

The reaction of Pb and Eu with a molten mixture of A(2)Se/P(2)Se(5)/Se produced the quaternary compounds APbPSe(4), A(4)Pb(PSe(4))(2) (A = Rb,Cs), and K(4)Eu(PSe(4))(2). The red crystals of APbPSe(4) are stable in air and water. The orange crystals of A(4)Pb(PSe(4))(2) and K(4)Eu(PSe(4))(2) disintegrate in water and over a long exposure to air. CsPbPSe(4) crystallizes in the orthorhombic space group Pnma (No. 62) with a = 18.607(4) ?, b = 7.096(4) ?, c = 6.612(4) ?, and Z = 4. Rb(4)Pb(PSe(4))(2) crystallizes in the orthorhombic space group Ibam (No. 72) with a = 19.134(9) ?, b = 9.369(3) ?, c = 10.488(3) ?, and Z = 4. The isomorphous K(4)Eu(PSe(4))(2) has a = 19.020(4) ?, b = 9.131(1) ?, c = 10.198(2) ?, and Z = 4. The APbPSe(4) have a layered structure with [PbPSe(4)](n)()(n)()(-) layers separated by A(+) ions. The coordination geometry around Pb is trigonal prismatic. The layers are composed of chains of edge sharing trigonal prisms running along the b-direction. [PSe(4)](3)(-) tetrahedra link these chains along the c-direction by sharing edges and corners with the trigonal prisms. A(4)M(PSe(4))(2) (M = Pb, Eu) has an one-dimensional structure in which [M(PSe(4))(2)](n)()(n)()(-) chains are separated by A(+) ions. The coordination geometry around M is a distorted dodecahedron. Two [PSe(4)](3)(-) ligands bridge two adjacent metal atoms, using three selenium atoms each, forming in this way a chain along the c-direction. The solid state optical absorption spectra of the compounds are reported. All compounds melt congruently in the 597-620 degrees C region.     

Heterobimetallic Clusters of Copper(I) with Trithiotungstate and Trithiomolybdate. Synthesis and Characterization of the Octanuclear Clusters [Et(4)N](4)[M(4)Cu(4)S(12)O(4)] (M = Mo, W) and the Dodecanuclear Clusters [M(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (M = Mo, W; TMEN = N,N,N',N'-Tetramethylethylenediamine)

Synthetic methods for [Et(4)N](4)[W(4)Cu(4)S(12)O(4)] (1), [Et(4)N](4)[Mo(4)Cu(4)S(12)O(4)] (2), [W(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (3), and [Mo(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (4) are described. [Et(4)N](2)[MS(4)], [Et(4)N](2)[MS(2)O(2)], Cu(NO(3))(2).3H(2)O, and KBH(4) (or Et(4)NBH(4)) were used as starting materials for the synthesis of 1 and 2. Compounds 3 and 4 were produced by reaction of [Et(4)N](2)[WOS(3)], Cu(NO(3))(2).3H(2)O, and TMEN and by reaction of [Me(4)N](2)[MO(2)O(2)S(8)], Cu(NO(3))(2).3H(2)O, and TMEN, respectively. Crystal structures of compounds 1-4 were determined. Compounds 1 and 2 crystallized in the monoclinic space group C2/c with a = 14.264(5) ?, b = 32.833(8) ?, c = 14.480(3) ?, beta = 118.66(2) degrees, V = 5950.8(5) ?(3), and Z = 4 for 1 and a = 14.288(5) ?, b = 32.937(10) ?, c = 14.490(3) ?, beta = 118.75(2) degrees, V = 5978.4(7) ?(3), and Z = 4 for 2. Compounds 3 and 4 crystallized in the trigonal space group P3(2)21 with a = 13.836(6) ?, c = 29.81(1) ?, V = 4942(4) ?(3), and Z = 3 for 3 and a = 13.756(9) ?, c = 29.80(2) ?, V = 4885(6) ?(3), and Z = 3 for 4. The cluster cores have approximate C(2v) symmetry. The anions of 1 and 2 may be viewed as consisting of two butterfly-type [CuMOS(3)Cu] fragments bridged by two [MOS(3)](2-) groups. Eight metal atoms in the anions are arranged in an approximate square configuration, with a Cu(4)M(4)S(12) ring structure. Compounds 3 and 4 can be considered to consist of one [M(4)Cu(4)S(12)O(4)](4-) (the anions of 1 and 2) unit capped by Cu(TMEN)(+) groups on each M atom; the Cu(TMEN)(+) groups extend alternately up and down around the Cu(4)M(4) square. The electronic spectra of the compounds are dominated by the internal transitions of the [MOS(3)](2-) moiety. (95)Mo NMR spectral data are investigated and compared with those of other compounds.     

Syntheses and crystal structures of a series of alkaline earth vanadium selenites and tellurites

Six new novel alkaline-earth metal vanadium(V) or vanadium(IV) selenites and tellurites, namely, Sr(2)(VO)(3)(SeO(3))(5), Sr(V(2)O(5))(TeO(3)), Sr(2)(V(2)O(5))(2)(TeO(3))(2)(H(2)O), Ba(3)(VO(2))(2)(SeO(3))(4), Ba(2)(VO(3))Te(4)O(9)(OH), and Ba(2)V(2)O(5)(Te(2)O(6)), have been prepared and structurally characterized by single crystal X-ray diffraction analyses. These compounds exhibit six different anionic structures ranging from zero-dimensional (0D) cluster to three-dimensional (3D) network. Sr(2)(VO)(3)(SeO(3))(5) features a 3D anionic framework composed of VO(6) octahedra that are bridged by SeO(3) polyhedra. The oxidation state of the vanadium cation is +4 because of the partial reduction of V(2)O(5) by SeO(2) at high temperature. Ba(3)(VO(2))(2)(SeO(3))(4) features a 0D [(VO(2))(SeO(3))(2)](3-) anion. Sr(V(2)O(5))(TeO(3)) displays a unique 1D vanadium(V) tellurite chain composed of V(2)O(8) and V(2)O(7) units connected by tellurite groups, forming 4- and 10-MRs, whereas Sr(2)(V(2)O(5))(2)(TeO(3))(2)(H(2)O) exhibits a 2D layer consisting of [V(4)O(14)] tetramers interconnected by bridging TeO(3)(2-) anions with the Sr(2+) and water molecules located at the interlayer space. Ba(2)(VO(3))Te(4)O(9)(OH) exhibits a one-dimensional (1D) vanadium tellurite chain composed of a novel 1D [Te(4)O(9)(OH)](3-) chain further decorated by VO(4) tetrahedra. Ba(2)V(2)O(5)(Te(2)O(6)) also features a 1D vanadium(V) tellurites chain in which neighboring VO(4) tetrahedra are bridged by [Te(2)O(6)](4-) dimers. The existence of V(4+) ions in Sr(2)(VO)(3)(SeO(3))(5) is also confirmed by magnetic measurements. The results of optical diffuse-reflectance spectrum measurements and electronic structure calculations based on density functional theory (DFT) methods indicate that all six compounds are wide-band gap semiconductors.     

Methanesulfonates of high-valent metals: syntheses and structural features of MoO2(CH3SO3)2, UO2(CH3SO3)2, ReO3(CH3SO3), VO(CH3SO3)2, and V2O3(CH3SO3)4 and their thermal decomposition under N2 and O2 atmosphere

Oxide methanesulfonates of Mo, U, Re, and V have been prepared by reaction of MoO(3), UO(2)(CH(3)COO)(2)·2H(2)O, Re(2)O(7)(H(2)O)(2), and V(2)O(5) with CH(3)SO(3)H or mixtures thereof with its anhydride. These compounds are the first examples of solvent-free oxide methanesulfonates of these elements. MoO(2)(CH(3)SO(3))(2) (Pbca, a=1487.05(4), b=752.55(2), c=1549.61(5) pm, V=1.73414(9) nm(3), Z=8) contains [MoO(2)] moieties connected by [CH(3)SO(3)] ions to form layers parallel to (100). UO(2)(CH(3)SO(3))(2) (P2(1)/c, a=1320.4(1), b=1014.41(6), c=1533.7(1) pm, β=112.80(1)°, V=1.8937(3) nm(3), Z=8) consists of linear UO(2)(2+) ions coordinated by five [CH(3)SO(3)] ions, forming a layer structure. VO(CH(3)SO(3))(2) (P2(1)/c, a=1136.5(1), b=869.87(7), c=915.5(1) pm, β=113.66(1)°, V=0.8290(2) nm(3), Z=4) contains [VO] units connected by methanesulfonate anions to form corrugated layers parallel to (100). In ReO(3)(CH(3)SO(3)) (P1, a=574.0(1), b=1279.6(3), c=1641.9(3) pm, α=102.08(2), β=96.11(2), γ=99.04(2)°, V=1.1523(4) nm(3), Z=8) a chain structure exhibiting infinite O-[ReO(2)]-O-[ReO(2)]-O chains is formed. Each [ReO(2)]-O-[ReO(2)] unit is coordinated by two bidentate [CH(3)SO(3)] ions. V(2)O(3)(CH(3)SO(3))(4) (I2/a, a=1645.2(3), b=583.1(1), c=1670.2(3) pm, β=102.58(3), V=1.5637(5) pm(3), Z=4) adopts a chain structure, too, but contains discrete [VO]-O-[VO] moieties, each coordinated by two bidentate [CH(3)SO(3)] ligands. Additional methanesulfonate ions connect the [V(2)O(3)] groups along [001]. Thermal decomposition of the compounds was monitored under N(2) and O(2) atmosphere by thermogravimetric/differential thermal analysis and XRD measurements. Under N(2) the decomposition proceeds with reduction of the metal leading to the oxides MoO(2), U(3)O(7), V(4)O(7), and VO(2); for MoO(2)(CH(3)SO(3))(2), a small amount of MoS(2) is formed. If the thermal decomposition is carried out in a atmosphere of O(2) the oxides MoO(3) and V(2)O(5) are formed.     

Preparation and Characterization of Halogen-Boron-Phosphorus Compounds. X-ray Crystal Structures of X(3)B.P(SiMe(3))(3) and [X(2)BP(SiMe(3))(2)](2) (X = Cl, Br)

The 1:1 mole ratio reactions of boron trihalides (BX(3)) with tris(trimethylsilyl)phosphine [P(SiMe(3))(3)] produced 1:1 Lewis acid/base adducts [X(3)B.P(SiMe(3))(3), X = Cl (1), Br (2), I (5)]. Analogous 1:1 mole ratio reactions of these boron trihalides with lithium bis(trimethylsilyl)phosphide [LiP(SiMe(3))(2)] produced dimeric boron-phosphorus ring compounds {[X(2)BP(SiMe(3))(2)](2), X = Br (3), Cl (4)}. X-ray crystallographic studies were successfully conducted on compounds 1-4. Compound 1 crystallized in the orthorhombic space group Pbca, with a = 13.420(3) ?, b = 17.044(5) ?, c = 21.731(7) ?, V = 4970.6(25) ?(3), and D(calc) = 1.229 g cm(-3) for Z = 8; the B-P bond length was 2.022(9) ?, Compound 2 crystallized in the orthorhombic space group Pbca, with a = 13.581(6) ?, b = 17.106(7) ?, c = 22.021(9) ?, V = 5116(4) ?(3), and D(calc) = 1.540 g cm(-3) for Z = 8; the B-P bond length was 2.00(2) ?. Compound 3 crystallized in the monoclinic space group P2(1)/n, with a = 9.063(5) ?, b = 16.391(8) ?, c = 9.331(4) ?, V = 1379.2(12) ?(3), and D(calc) = 1.676 g cm(-3) for Z = 2; the B-P bond length was 2.023(10) ?. Compound 4 crystallized in the monoclinic space group P2(1)/n, with a = 9.143(5) ?, b = 16.021(8) ?, c = 9.170(4) ?, V = 1342.2(11) ?(3), and D(calc) = 1.282 g cm(-3) for Z = 2; the B-P bond length was 2.025(3) ?. Thermal decomposition studies were performed on compounds 1-4, yielding colored powders with boron:phosphorus ratios greater than 1:1 and significant C and H contamination indicated by elemental analyses.     

Syntheses and Crystal Structures of Ruthenium Complexes of 1,4,8,11-Tetraazacyclotetradecane, Tris(2-aminoethyl)amine (tren), and Bis(2-aminoethyl)(iminomethyl)amine. A Microporous Layered Structure Consisting of {[K(tren)](2)[RuCl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[RuCl(6)]}(n)()(n)()(+)

The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam).     

"A" cation polarity control in ACuTe2O7 (A = Sr2+, Ba2+, or Pb2+)

The synthesis and characterization of ACuTe(2)O(7) (A = Sr(2+), Ba(2+), or Pb(2+)) have been carried out. Interestingly, SrCuTe(2)O(7) and PbCuTe(2)O(7) are centrosymmetric and isostructural, whereas BaCuTe(2)O(7) is noncentrosymmetric and polar. All of the materials contain [CuTe(2)O(7)](2-) layers stacked along the b-axis direction that are separated by the "A" cations. The layers are composed of corner-shared CuO(5), TeO(6), and TeO(4) polyhedra. The influence of the "A" cation on the polarity is described by bond valence concepts, including the bond strain index and global instability index. Infrared, UV-vis, thermogravimetric, differential thermal analysis, and magnetic measurements were performed on all three materials. For BaCuTe(2)O(7), second-harmonic generation (SHG), piezoelectric, and polarization measurements were performed. A moderate SHG efficiency of approximately 70 × α-SiO(2) was measured. In addition, we determined that BaCuTe(2)O(7) is not ferroelectric; that is, the macroscopic polarization is not reversible. For BaCuTe(2)O(7), a pyroelectric coefficient of -9.5 μC/m(2)·K at 90 °C and a piezoelectric charge coefficient of 49 pm/V were determined. Crystal data are the following: SrCuTe(2)O(7), orthorhombic, space group Pbcm (No. 57), a = 7.1464(7) ?, b = 15.0609(15) ?, c = 5.4380(5) ?, V = 585.30(10) ?(3), and Z = 4; PbCuTe(2)O(7), orthorhombic, space group Pbcm (No. 57), a = 7.2033(5) ?, b = 15.0468(10) ?, c = 5.4691(4) ?, V = 592.78(7) ?(3), and Z = 4.