共查询到20条相似文献,搜索用时 171 毫秒
1.
Sheet- and column-like cyanide bridged lanthanide-transition metal arrays were synthesized through metathesis reactions between anhydrous LnCl(3) (Ln = Eu, Yb) and A(2)[M(CN)(4)] (A = K(+), NH(4)(+); M = Ni, Pt) in a 1:2 molar ratio in DMF (DMF = N,N-dimethylformamide) solution. Single-crystal X-ray analysis revealed that complexes of formula [K(DMF)(7)Ln[M(CN)(4)](2)](infinity) (Ln = Eu, M = Ni, 1; Ln = Yb, M = Pt, 2) consist of infinite layers of neutral, puckered sheets that contain hexagonal rings of composition [(DMF)(10)Ln(2)[M(CN)(4)](3)](6) with interstitial (DMF)(4)K(2)[M(CN)(4)] units located between the layers. The sheet structure is generated through the repeating (DMF)(10)Ln(2)[M(CN)(4)](3) unit with trans cyanide ligands in [M(CN)(4)](2)(-) serving as bridges. The column-like complex [(NH(4))(DMF)(4)Yb[Pt(CN)(4)](2)](infinity), 3, is formed when NH(4)(+) replaces K(+). It consists of infinite, negatively charged, square, parallel columns bundled through N-H...NC hydrogen bonds between NH(4)(+) and terminal CN from the columns. Cis cyanide ligands in [Pt(CN)(4)](2)(-) units serve as bridges. Complex 3 is the first known example where Ln(III) centers are coordinated to four [M(CN)(4)](2)(-) units. Bicapped (square face) trigonal prismatic coordination geometries were observed for Ln(III) centers in 1 and 2. Square antiprismatic geometry for Yb(III) centers are observed in 3. Crystal data for 1: triclinic space group P1, a = 8.797(2) A, b = 15.621(3) A, c = 17.973(6) A, alpha = 105.48(2) degrees, beta = 98.60(2) degrees, gamma = 98.15(2) degrees, Z = 2. Crystal data for 2: triclinic space group P1, a = 8.825(1) A, b = 15.673(1) A, c = 17.946(1) A, alpha = 105.46(2) degrees, beta = 99.10(1) degrees, gamma = 98.59(1) degrees, Z = 2. Crystal data for 3: monoclinic space group P2(1)/c, a = 9.032(1) A, b = 29.062(1) A, c = 15.316(1) A, beta = 94.51(1) degrees, Z = 2. 相似文献
2.
By choosing a suitable metal center, ligand, and solvents, we have revealed several structural transformations involving a polymer precursor. infinity 1[Co(bpdc)(H2O)2].H2O (1) was prepared by reaction of Na2bpdc and Co(NO3)2 in aqueous solution. Immersing 1 in pyridine/water solutions of (2:1) and (8:1) ratios yielded a second one-dimensional structure infinity 1[Co(bpdc)(py)2(H2O)2].2py (2) and a two-dimensional structure infinity 2[Co(bpdc)(py)2].H2O (3), respectively. After heating 1 under N2 to remove all water within the structure, the compound Co(bpdc) (IR) was obtained. When IR was immersed in solutions of pyridine/water (5:4) and in pure pyridine (in air), a third one-dimensional structure of infinity 1[Co(bpdc)(py)2(H2O)2].2py.H2O (4) and 3, respectively, were obtained. Compounds 2-4 easily transformed to 1 when immersed in water. Crystal data for 1: monoclinic, space group C2/c with a = 6.950(1), b = 31.585(6), and c = 6.226(1) A, beta = 95.84(3) degrees, Z = 4. Crystal data for 2: triclinic, space group P1 with a = 9.646(2), b = 10.352(2), and c = 17.031(3) A, alpha = 79.02(3) degrees, beta = 86.88(3) degrees, gamma = 77.16(3) degrees, Z = 2. Crystal data for 3: triclinic, space group P1 with a = 9.137(2), b = 10.480(2), and c = 12.254(2) A, alpha = 102.10(3) degrees, beta = 100.80(3) degrees, gamma = 99.43(3) degrees, Z = 2. Crystal data for 4: orthorhombic, space group Pbcn with a = 13.468(3), b = 16.652 (3), and c = 14.977(3) A, Z = 4. 相似文献
3.
The salts (Ph(4)E)[M(SOCPh)(3)] (M = Zn, Cd, or Hg; E = P or As) are produced by the reaction of Zn(NO(3))(2).6 H(2)O, Cd(NO(3))(2).4H(2)O or HgCl(2) with Et(3)NH(+)PhCOS(-) and (Ph(4)E)X (E = P, X = Br; E = As, X = Cl) in aqueous MeOH in the ratios M(II):PhCOS(-):Ph(4)E(+) = 1:>/=3:>/=1. The crystal structures of (Ph(4)P)[Zn(SOCPh)(3)] (1), (Ph(4)As)[Cd(SOCPh)(3)] (2) and (Ph(4)P)[Hg(SOCPh)(3)] (3) have been determined by single-crystal X-ray diffraction experiments. Crystal data for 1: triclinic; space group P&onemacr;; Z = 2; a = 10.819(2) ?, b = 13.219(3) ?, c = 15.951(3) ?; alpha = 101.75(2) degrees, beta = 97.92(1) degrees, gamma = 109.18(2) degrees. Crystal data for 2: triclinic; space group P&onemacr;; Z= 2; a = 10.741(2) ?, b = 13.168(2) ?, c = 15.809(2) ?; alpha = 101.00(1) degrees, beta = 97.65(1) degrees, gamma = 109.88(1) degrees. Crystal data for 3: monoclinic; space group P2(1)/n; Z = 4; a = 13.302(2) ?, b = 14.276(2) ?, c = 21.108(2) ?; beta = 90.92(1) degrees. The compounds 1 and 2 are isomorphous and isostructural. In the anions [M(SOCPh)(3)](-) the metal atoms have trigonal planar coordination by three sulfur atoms. The metal atoms are further more weakly coordinated intramolecularly to one (M = Hg) or two (M = Zn, Cd) thiobenzoate oxygen atom(s). Using the Bond Valence approach it is found that the contribution of M.O bonding to the total bonding is in the order Cd > Zn > Hg. The metal ((113)Cd, (199)Hg) NMR signals of [M(SOCPh)(3)](-) (M = Cd, Hg) are more shielded than those found for MS(3) kernels in thiolate complexes, a difference attributed to the M(.)O bonding in the thiobenzoate complexes. The (113)Cd resonance of [Cd(SOCPh)(3)](-) in dilute solution is in the region anticipated from dilution data for [Na(Cd{SOCPh}(3))(2)](-). 相似文献
4.
The synthesis and crystal structure of the three-dimensional coordination polymer of an angular dipyridyl ligand 2,5-bis(4-pyridyl)-1,3,4-oxadiazole (L) and Cu(ClO(4))(2), exhibiting the first Cu(II) diamondoid network with 2-fold interpenetration, ([Cu(L)(2)(H(2)O)(2)](ClO(4))(OH)(H(2)O)(2.5))(n) (1), together with the Cu(OAc)(2) complex of L, [Cu(L)(2)(OAc)(2)(H(2)O)](H(2)O)(2)(CH(3)OH) (2), with an unexpected mononuclear structure, are reported. Crystal data for 1: tetragonal, space group I4(1)/a, a = b = 13.477(3) A, c = 46.167(13) A, Z = 8. Crystal data for 2: triclinic, space group P(-)1, a = 7.847(2) A, b = 13.189(4) A, c = 15.948(5) A, alpha = 75.225(7) degrees, beta = 79.945(6) degrees, gamma = 77.540(5) degrees, Z = 2. The magnetic properties and anion effect are also discussed. 相似文献
5.
The compound [PPh(4)](3)[Cr(Te(4))(3)].DMF has been synthesized from the reaction of Cr(CO)(6) with a polytelluride solution in dimethylformamide at 100 degrees C. The compound has been characterized by (125)Te NMR and single-crystal X-ray diffraction techniques. The compound crystallizes in the triclinic space group P(-)1, with a = 12.991(3) A, b = 14.782(3) A, c = 24.628(5) A, alpha= 90.63(3)o, beta= 104.45(3)o, gamma= 106.49(3)o, and Z = 2 (T = 153 K). The [Cr(Te(4))(3)](3-) anion consists of a Cr(III) center chelated by three Te(4)(2-) ligands in a distorted octahedral environment. The anion has the Deltalambdalambdalambda (or Lambdadeltadeltadelta) conformation. 相似文献
6.
The reactions of 1,4-bis(phenylthio)butane (L) with Ag(I) salts in varied conditions (varying the solvents, metal-to-ligand ratios, and counteranions) lead to the formation of four new two-dimensional (2D) coordination polymers with different network structures: [Ag(2)L(3)(ClO(4))(2)](infinity) 1, [Ag(2)L(3)(ClO(4))(2) x CH(3)OH](infinity) 2, [[AgL(2)](ClO(4))](infinity) 3, and [AgLNO(3)](infinity) 4. All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 1: triclinic, P-1, a = 11.0253(9) A, b = 11.3455(9) A, c = 11.5231(9) A, alpha = 93.931(2) degrees, beta = 92.689(2) degrees, gamma = 112.9810(10) degrees, Z = 2. 2: triclinic, P-1, a = 11.9147(13) A, b = 16.1534(17) A, c = 16.2259(17) A, alpha = 74.977(2) degrees, beta = 69.030(2) degrees, gamma = 69.986(2) degrees, Z = 2. 3: triclinic, P-1, a = 12.1617(9) A, b = 12.5054(10) A, c = 13.1547(10) A, alpha = 64.3370(10) degrees, beta =85.938 (2) degrees, gamma = 69.3010(10) degrees, Z = 2. 4: monoclinic, P2(1)/c, a = 5.4032(17) A, b = 16.974(6) A, c = 19.489(6) A, beta = 94.234(6) degrees, Z = 4. In all four complexes, each Ag(I) center has a tetracoordination geometry, and the 2D networks consist of fused large macrometallacyclic ring systems. The "hexagonal" 42-membered rings, Ag(6)L(6), observed in 1 and 2 are nearly identical, which could be considered as unique examples of self-sustaining noninterpenetrated frameworks formed with flexible ligands. The repeating rectangular 28-membered macrometallacycle, Ag(4)L(4), is the basis for the network of 3, in which the perchlorate anions occupy the voids to prevent the ring from collapsing. In 4, columns of the fused rectangular 22-membered rings, Ag(4)L(2)(NO(3))(2), are cross-linked through the L ligands to form a unique 2D network consisting of two types of 22-membered repeating units. 相似文献
7.
2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4. 相似文献
8.
Fronczek FR Delord TJ Watkins SF Gueorguieva P Stanley GG Zizza AS Cornelius JB Mantz YA Musselman RL 《Inorganic chemistry》2003,42(22):7026-7036
Crystal structures of three Ni(CN)(4)(2)(-) salts all with eclipsed ligands and varying axial stacking arrangements are presented. The absorption spectra of all three salts show a slight red shift in the x,y-polarizations and a large red shift in their z-polarizations upon crystallization from solution. Semiempirical ZINDO calculations provide a good model of the solid state, even with only a three-molecule segment, allowing reproduction of the red-shifting and intensity increase upon crystallization found experimentally. The modified nickel beta(s,p) bonding parameter of -5 found appropriate for Ni coordination in our previous studies of single Ni(CN)(4)(2-) planes and a helically stacked Cs(2)[Ni(CN)(4)].H(2)O crystal was changed to -3 for the more parallel-stacked Ni(CN)(4)(2-) planes in this case, while beta(d) was retained at -41. Crystal data are as follows: Na(2)[Ni(CN)(4)].3H(2)O, triclinic space group P1, a = 7.2980(10) A, b = 8.8620(10) A, c = 15.132(2) A, alpha = 89.311(5) degrees, beta = 87.326(5) degrees, gamma = 83.772(6) degrees, V = 971.8(2) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.064; Sr[Ni(CN)(4)].5H(2)O, monoclinic space group C2/m, a = 10.356(2) A, b = 15.272(3) A, c = 7.1331(10) A, beta = 98.548(12) degrees, V = 1115.6(3) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.059; Rb(2)[Ni(CN)(4)].1.05H(2)O, triclinic space group P1, a = 8.6020(10) A, b = 9.6930(10) A, c = 12.006(2) A, alpha = 92.621(6) degrees, beta = 94.263(6) degrees, gamma = 111.795(10) degrees, V = 924.0(2) A(3), T = 100 K, Z = 4, R = 0.034, R(w) = 0.067. 相似文献
9.
Intermediates in the condensation process of [MS(4)](2)(-) (M = Mo, W) to polythiometalates, in the presence of alkyl halides, had not been reported prior to our communication of [PPh(4)][WS(3)(SEt)] (Boorman, P. M.; Wang, M.; Parvez, M. J. Chem. Soc., Chem. Commun. 1995, 999-1000). We now report the isolation of a range of related compounds, with 1 degrees, 2 degrees, and 3 degrees alkyl thiolate ligands, including one Mo example. [PPh(4)][WS(3)(SR)] (R = (i)Bu (1), (i)Pr (2), (t)Bu (3), benzyl (5), allyl (6)) and [PPh(4)][MoS(3)(S(t)Bu)] (4) have been isolated in fair to good yields from the reaction of [PPh(4)](2)[MS(4)] with the appropriate alkyl halide in acetonitrile and subjected to analysis by X-ray crystallography. Crystal data are as follows: for 1, triclinic space group P1 (No. 2), a = 11.0377(6) A, b = 11.1307(5) A, c = 13.6286(7) A, alpha = 82.941(1) degrees, beta = 84.877(1) degrees, gamma = 60.826(1) degrees, Z = 2; for 2, monoclinic space group P2(1)/c (No. 14), a = 9.499(6) A, b = 15.913(5) A, c = 18.582(6) A, beta = 99.29(4) degrees, Z = 4; for 3, monoclinic space group P2(1)/n (No. 14), a = 10.667(2) A, b = 17.578(2) A, c = 16.117(3) A, beta = 101.67(1) degrees, Z = 4; for 4, monoclinic space group P2(1)/n (No. 14), a = 10.558(3) A, b = 17.477(3) A, c = 15.954(3) A, beta = 101.18(2) degrees, Z = 4; for 5, monoclinic space group P2(1)/n (No. 14), a = 16.2111(9) A, b = 11.0080(6) A, c = 18.1339(10) A, beta = 111.722(1) degrees, Z = 4; for 6, triclinic space group P1 (No. 2), a = 9.4716(9) A, b = 10.4336(10) A, c = 14.4186(14) A, alpha = 100.183(2) degrees, beta = 90.457(2) degrees, gamma = 91.747(2) degrees, Z = 2. Structures 3 and 4 are isomorphous, and 1 exhibits disorder about the tertiary carbon. 6 has been shown to exhibit fluxionality in solution by variable-temperature (1)H NMR studies, and an allyl migration mechanism is implicated in this process. The kinetics for the reaction of [WS(4)](2)(-) and EtBr were measured and suggest an associative nucleophilic substitution (S(N)2) mechanism. The decomposition of the [WS(3)(SEt)](-) ion is shown to be second order with respect to this ion, suggesting the formation of a transient binuclear intermediate. M-S bond cleavage is the predominant step in decomposition of 1-6 to yield alkyl sulfides, alkyl thiols, and polythiometalates such as [PPh(4)](2)[M(3)S(9)]. In contrast, reactions of [PPh(4)](2)[WO(x)()S(4)(-)(x)()] (x = 1, 2) with (t)BuBr result in the additional decomposition product of isobutene, presumably by C-S bond cleavage and beta-hydrogen transfer. Interestingly, the reaction of [PPh(4)](2)[WOS(3)] with BzCl yields 5 as the only isolable W thiolate species. 相似文献
10.
Zhao L Xu Z Grove H Milway VA Dawe LN Abedin TS Thompson LK Kelly TL Harvey RG Miller DO Weeks L Shapter JG Pope KJ 《Inorganic chemistry》2004,43(13):3812-3824
A series of [3 x 3] Mn(II)(9), antiferromagnetically coupled, alkoxide-bridged, square grid complexes, derived from a group of "tritopic" dihydrazide ligands, is described. The outer ring of eight Mn(II) centers in the grids is isolated magnetically from the central Mn(II) ion, leading to an S = 0 ground state for the ring, and an S = 5/2 ground state overall in each case. Exchange in the Mn(II)(8) ring can be represented by a 1D chain exchange model. Rich electrochemistry displayed by these systems has led to the production of Mn(II)/Mn(III) mixed-oxidation-state grids by both electrochemical and chemical means. Structures are reported for [Mn(9)(2poap)(6)](C(2)N(3))(6).10H(2)O (1), [Mn(9)(2poap)(6)](2)[Mn(NCS)(4)(H(2)O)](2)(NCS)(8).10H(2)O (2), [Mn(9)(2poapz)(6)](NO(3))(6).14.5H(2)O (3), [Mn(9)(2popp)(6)](NO(3))(6).12H(2)O (4), [Mn(9)(2pomp)(6)](MnCl(4))(2)Cl(2).2CH(3)OH.7H(2)O (5), and [Mn(9)(Cl2poap)(6)](ClO(4))(9).7H(2)O (6). Compound 1 crystallized in the tetragonal system, space group P4(2)/n, with a = 21.568(1) A, c = 16.275(1) A, and Z = 2. Compound 2 crystallized in the triclinic system, space group P, with a = 25.043(1) A, b = 27.413(1) A, c = 27.538(2) A, alpha = 91.586(2) degrees, beta = 113.9200(9) degrees, gamma = 111.9470(8) degrees, and Z = 2. Compound 3 crystallized in the triclinic system, space group P, with a = 18.1578(12) A, b = 18.2887(12) A, c = 26.764(2) A, alpha = 105.7880(12) degrees, beta = 101.547(2) degrees, gamma = 91.1250(11) degrees, and Z = 2. Compound 4 crystallized in the tetragonal system, space group P4(1)2(1)2, with a = 20.279(1) A, c = 54.873(6) A, and Z = 4. Compound 5 crystallized in the tetragonal system, space group I, with a = 18.2700(2) A, c = 26.753(2) A, and Z = 2. Compound 6 crystallized in the triclinic system, space group P, with a = 19.044(2) A, b = 19.457(2) A, c = 23.978(3) A, alpha = 84.518(3) degrees, beta = 81.227(3) degrees, gamma = 60.954(2) degrees, and Z = 2. Preliminary surface studies on Au(111), with a Mn(II) grid complex derived from a sulfur-derivatized ligand, indicate monolayer coverage via gold-sulfur interactions, and the potential for information storage at high-density levels. 相似文献
11.
Supramolecular water dimer, (H(2)O)(2), is fundamentally important. During the course of our work on polyoxometalates, we have been able to identify the existence of hydrogen-bonded, near-linear water dimers in the "sinuous" channels of an inorganic framework material, Na(3)(n)(H(2)O)(6)(n)[Al(OH)(6)Mo(6)O(18)](n)() x 2nH(2)O, 1. The three-dimensional network structure of 1 in the solid state is assembled by the Anderson type of heteropolyanions as building blocks sharing sodium cations. Vibrational spectroscopy, X-ray powder diffraction technique, TG-DSC analyses, and single-crystal X-ray structure analysis have characterized this host-guest system, 1. Crystal data for 1: triclinic space group Ponemacr;, a = 12.0618 (3) A, b = 13.1570 (4) A, c = 14.1563 (4) A, alpha = 80.7850 (10) degrees, beta = 75.2660 (10) degrees, gamma = 68.9210 (10) degrees, and Z = 3. 相似文献
12.
The reaction of Mn and Cd in alkali metal polythioarsenate fluxes afforded four new compounds featuring molecular anions. K(8)[Mn(2)(AsS(4))(4)] (I) crystallizes in the monoclinic space group P2/n with a = 9.1818(8) A, b = 8.5867(8) A, c = 20.3802(19) A, and beta = 95.095(2) degrees. Rb(8)[Mn(2)(AsS(4))(4)] (II) and Cs(8)[Mn(2)(AsS(4))(4)] (III) both crystallize in the triclinic space group P1 with a = 9.079(3) A, b = 9.197(3) A, c = 11.219(4) A, alpha = 105.958(7) degrees, beta = 103.950(5) degrees, and gamma = 92.612(6) degrees for II and a = 9.420(5) A, b = 9.559(5) A, c = 11.496(7) A, alpha = 105.606(14) degrees, beta = 102.999(12) degrees, and gamma = 92.423(14) degrees for III. The discrete dimeric [Mn(2)(AsS(4))(4)](8-) clusters in these compounds are composed of two octahedral Mn(2+) ions bridged by two [AsS(4)](3-) units and chelated each by a [AsS(4)](3-) unit. Rb(8)[Cd(2)(AsS(4))(2)(AsS(5))(2)] (IV) crystallizes in P1 with a = 9.122(2) A, b = 9.285(2) A, c = 12.400(3) A, alpha = 111.700(6) degrees, beta = 108.744 degrees, and gamma = 90.163(5) degrees. Owing to the greater size of Cd compared to Mn, the Cd centers in this compound are bridged by [AsS(5)](3-) units. The [Cd(2)(AsS(4))(4)](8-) cluster is a minor component cocrystallized in the lattice. These compounds are yellow in color and soluble in water. 相似文献
13.
Oxidative addition of diorganyl diselenides to the coordinatively unsaturated, low-valent transition-metal-carbonyl fragment [Mn(CO)(5)](-) produced cis-[Mn(CO)(4)(SeR)(2)](-). The complex cis-[PPN][Mn(CO)(4)(SePh)(2)] crystallized in triclinic space group P&onemacr; with a = 10.892(8) ?, b = 10.992(7) ?, c = 27.021(4) ?, alpha = 101.93(4) degrees, beta = 89.79(5) degrees, gamma = 116.94(5) degrees, V = 2807(3) ?(3), and Z = 2; final R = 0.085 and R(w) = 0.094. Thermolytic transformation of cis-[Mn(CO)(4)(SeMe)(2)](-) to [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-) was accomplished in high yield in THF at room temperature. Crystal data for [Na-18-crown-6-ether][(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)]: trigonal space group R&thremacr;, a = 13.533(3) ?, c = 32.292(8) ?, V = 5122(2) ?(3), Z = 6, R = 0.042, R(w) = 0.041. Oxidation of Co(2+) to Co(3+) by diphenyl diselenide in the presence of chelating metallo ligands cis-[Mn(CO)(4)(SePh)(2)](-) and cis-[Mn(CO)(4)(TePh)(2)](-), followed by a bezenselenolate ligand rearranging to bridge two metals and a labile carbonyl shift from Mn to Co, led directly to [(CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3)]. Crystal data: triclinic space group P&onemacr;, a = 11.712(3) ?, b = 12.197(3) ?, c = 15.754(3) ?, alpha = 83.56(2) degrees, beta = 76.13(2) degrees, gamma = 72.69(2) degrees, V = 2083.8(7) ?(3), Z = 2, R = 0.040, R(w) = 0.040. Addition of fac-[Fe(CO)(3)(SePh)(3)](-) to fac-[Mn(CO)(3)(CH(3)CN)(3)](+) resulted in formation of (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3). This neutral heterometallic complex crystallized in monoclinic space group P2(1)/n with a = 8.707(2) ?, b = 17.413(4) ?, c = 17.541(4) ?, beta = 99.72(2) degrees, V = 2621(1) ?(3), and Z = 4; final R = 0.033 and R(w) = 0.030. 相似文献
14.
Mbomekalle IM Keita B Nierlich M Kortz U Berthet P Nadjo L 《Inorganic chemistry》2003,42(17):5143-5152
The three novel, multi-nickel-substituted heteropolytungstates [Ni(6)As(3)W(24)O(94)(H(2)O)(2)](17)(-) (1), [Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)](11)(-) (2), and [Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)](17)(-) (3) have been synthesized and characterized by IR, elemental analysis, electrochemistry, and magnetic studies. Single-crystal X-ray analysis was carried out on Na(16.5)Ni(0.25)[Ni(6)As(3)W(24)O(94)(H(2)O)(2)].54H(2)O, which crystallizes in the triclinic system, space group P1, with a = 17.450(4) A, b = 17.476(4) A, c = 22.232(4) A, alpha = 85.73(3) degrees, beta = 89.74(3) degrees, gamma = 84.33(3) degrees, and Z = 2, Na(11)[Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)].30.5H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.228(2) A, b = 16.743(3) A, c = 23.342(5) A, alpha = 78.50(3) degrees, beta = 80.69(3) degrees, gamma = 78.66(3) degrees, and Z = 2, and Na(17)[Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)].50.5H(2)O, which crystallizes in the monoclinic system, space group P2(1)/c, with a = 17.540(4) A, b = 22.303(5) A, c = 35.067(7) A, beta = 95.87(3) A, and Z = 4. Polyanion 1 consists of two B-alpha-(Ni(3)AsW(9)O(40)) Keggin moieties linked via a unique AsW(6)O(16) fragment, leading to a banana-shaped structure with C(2)(v)() symmetry. The mixed-metal tungstophosphate 3 is isostructural with 1. Polyanion 2 consists of two lacunary B-alpha-[AsW(9)O(34)](9)(-) Keggin moieties linked via three nickel(II) centers and a sodium ion. Electrochemical studies show that 1-3 exhibit a unique and reproducible voltammetric pattern and that all three compounds are stable in a large pH range. An investigation of the magnetic properties of 1-3 indicates that the exchange interactions within the trimetal clusters are ferromagnetic. However, for 1 and 3 intra- and intermolecular interactions between different trinuclear clusters are also present. 相似文献
15.
The oxothio polyanions gamma-[SiW(10)M(2)S(2)O(38)](6)(-) (M = Mo(V), W(V)) were obtained through stereospecific addition of the dication [M(2)S(2)O(2)](2+) (M = Mo, W) to the divacant gamma-[SiW(10)O(36)](8)(-) anion in dimethylformamide. These compounds were isolated as crystals and are stable in usual organic solvents and in aqueous medium from pH = 1 to pH = 7. NEt(4)Cs(3)H(2)[SiW(10)Mo(2)S(2)O(38)].6H(2)O (a gamma-isomer derived from the alpha Keggin structure capped by the [Mo(2)S(2)O(2)](2+) fragment containing a metal-metal bond) crystallizes in the triclinic space group P&onemacr; with a = 12.050(3) ?, b = 12.695(2) ?, c = 20.111(4) ?, alpha = 74.35(2) degrees, beta = 86.83(2) degrees, gamma = 63.50(2) degrees, Z = 2. NEt(4)Cs(5)[SiW(12)S(2)O(38)].7H(2)O is isostructural and crystallizes in the triclinic space group P&onemacr; with a = 12.197(4) ?, b = 12.714(3) ?, c = 20.298(3) ?, alpha = 74.75(1) ?, beta = 86.48(2) degrees, gamma = 61.80(2) degrees, Z = 2. (183)W NMR spectra of Li(+) salts in aqueous solution agree with the solid state structures and reveal 100% purity for both anions. Polarographic, infrared and UV-vis data are also given. 相似文献
16.
Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4. 相似文献
17.
Matthews CJ Thompson LK Parsons SR Xu Z Miller DO Heath SL 《Inorganic chemistry》2001,40(17):4448-4454
A series of trigonal bipyramidal pentanuclear complexes involving the alkoxo-diazine ligands poap and p3oap, containing the M(5)[mu-O](6) core is described, which form by a strict self-assembly process. [Co(5)(poap-H)(6)](ClO(4))(4).3H(2)O (1), [Mn(5)(poap-H)(6)](ClO(4))(4).3.5CH(3)OH.H(2)O (2), [Mn(5)(p3oap-H)(6)](ClO(4))(4).CH(3)CH(2)OH.3H(2)O (3), and [Zn(5)(poap-H)(6)](ClO(4))(4).2.5H(2)O (4) are homoleptic pentanuclear complexes, where there is an exact match between the coordination requirements of the five metal ions in the cluster, and the available coordination pockets in the polytopic ligand. [Zn(4)(poap)(poap-H)(3)(H(2)O)(4)] (NO(3))(5).1.5H(2)O (5) is a square [2 x 2] grid with a Zn(4)[mu-O](4) core, and appears to result from the presence of NO(3), which is thought to be a competing ligand in the self-assembly. X-ray structures are reported for 1, 4, and 5. 1 crystallized in the monoclinic system, space group P2(1)/n with a = 13.385(1) A, b = 25.797(2) A, c = 28.513(3) A, beta = 98.704(2) degrees, and Z = 4. 4 crystallized in the triclinic system, space group P1 with a = 13.0897(9) A, b = 18.889(1) A, c = 20.506(2) A, alpha = 87.116(1) degrees, beta = 74.280(2) degrees, gamma = 75.809(2) degrees, and Z = 2. 5 crystallized in the monoclinic system, space group P2(1)/n with a = 14.8222(7) A, b = 21.408(1) A, c = 21.6197(9) A, beta = 90.698(1) degrees, and Z = 4. Compounds 1-3 exhibit intramolecular antiferromagnetic coupling. 相似文献
18.
Kortz U Nellutla S Stowe AC Dalal NS Rauwald U Danquah W Ravot D 《Inorganic chemistry》2004,43(7):2308-2317
The novel dimeric germanotungstates [M(4)(H(2)O)(2)(GeW(9)O(34))(2)](12)(-) (M = Mn(2+), Cu(2+), Zn(2+), Cd(2+)) have been synthesized and characterized by IR spectroscopy, elemental analysis, magnetic measurements, and (183)W-NMR spectroscopy. X-ray single-crystal analyses were carried out on Na(12)[Mn(4)(H(2)O)(2)(GeW(9)O(34))(2)].38H(2)O (Na(12)()-1), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.0419(8) A, b = 17.8422(10) A, c = 21.1626(12) A, beta = 93.3120(10) degrees, and Z = 2; Na(11)Cs(2)[Cu(4)(H(2)O)(2)(GeW(9)O(34))(2)]Cl.31H(2)O (Na(11)()Cs-2) crystallizes in the triclinic system, space group P, with a = 12.2338(17) A, b = 12.3833(17) A, c = 15.449(2) A, alpha = 100.041(2) degrees, beta = 97.034(2) degrees, gamma = 101.153(2) degrees, and Z = 1; Na(12)[Zn(4)(H(2)O)(2)(GeW(9)O(34))(2)].32H(2)O (Na(12)()-3) crystallizes in the triclinic system, space group P, with a = 11.589(3) A, b = 12.811(3) A, c = 17.221(4) A, alpha = 97.828(6) degrees, beta = 106.169(6) degrees, gamma = 112.113(5) degrees, and Z = 1; Na(12)[Cd(4)(H(2)O)(2)(GeW(9)O(34))(2)].32.2H(2)O (Na(12)()-4) crystallizes also in the triclinic system, space group P, with a = 11.6923(17) A, b = 12.8464(18) A, c = 17.616(2) A, alpha = 98.149(3) degrees, beta = 105.677(3) degrees, gamma = 112.233(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[GeW(9)O(34)](10)(-) Keggin moieties linked via a rhomblike M(4)O(16) (M = Mn, Cu, Zn, Cd) group leading to a sandwich-type structure. (183)W-NMR studies of the diamagnetic Zn and Cd derivatives indicate that the solid-state polyoxoanion structures are preserved in solution. EPR measurements on Na(12)()-1 at frequencies up to 188 GHz and temperatures down to 4 K yield a single, exchange-narrowed peak, at g(iso) = 1.9949, typical of Mn systems, and an upper limit of |D| = 20.0 mT; its magnetization studies still await further theoretical treatment. Detailed EPR studies on Na(11)()Cs-2 over temperatures down to 2 K and variable frequencies yield g( parallel ) = 2.4303 and g( perpendicular ) = 2.0567 and A( parallel ) = 4.4 mT (delocalized over the Cu(4) framework), with |D| = 12.1 mT. Magnetization studies in addition yield the exchange parameters J(1) = -11 and J(2) = -82 cm(-)(1), in agreement with the EPR studies. 相似文献
19.
High-dimensional architectures from the self-assembly of lanthanide ions with benzenedicarboxylates and 1,10-phenanthroline 总被引:1,自引:0,他引:1
Six new coordination polymers, [Eu(1,2-BDC)(1,2-HBDC)(phen)(H(2)O)](n) (1), [Eu(2)(1,3-BDC)(3)(phen)(2)(H(2)O)(2)](n).4nH(2)O (2), [Eu(1,4-BDC)(3/2)(phen)(H(2)O)](n) (3), [Yb(2)(1,2-BDC)(3)(phen)(H(2)O)(2)](n).3.5nH(2)O (4), [Yb(2)(1,3-BDC)(3)(phen)(1/2)](n) (5), and [Yb(2)(1,4-BDC)(3)(phen)(2)(H(2)O)](n) (6), were synthesized by hydrothermal reactions of lanthanide chlorides with three isomers of benzenedicarboxylic acid (H(2)BDC) and 1,10-phenanthroline (phen), and characterized by single-crystal X-ray diffraction. 1 has a 2-D herringbone architecture with a Z-shaped cavity. 2 and 5 have different 3-D networks, but both are formed by 1,3-BDC anions bridging metal centers (Eu or Yb) via carboxylate groups. 3 and 6 possess similar layer structures which are further constructed to form 3-D networks by hydrogen bonds and/or pi-pi aromatic interactions. 4 comprises 1-D chains that are further interlinked via hydrogen bonds, resulting in a 3-D network. In the three europium complexes, all the europium ions are eight-coordinated, while the coordination numbers of the ytterbium ions in other three-coordination polymers range from six to eight. Crystal data: for 1, monoclinic, space group P2(1)/c, with a = 12.565(6) A, b = 16.005(8) A, c = 12.891(6) A, beta = 102.173(8) degrees, and Z = 4; for 2, monoclinic, space group P2(1)/c, with a = 20.979(4) A, b = 11.5989(19) A, c = 20.810(3) A, beta = 110.391(3) degrees, and Z = 4; for 3, triclinic, space group P1, with a = 10.331(5) A, b = 10.887(5) A, c = 11.404(5) A, alpha = 107.660(7) degrees, beta = 91.787(7) degrees, gamma = 112.946(6) degrees, and Z = 2; for 4, triclinic, space group P1, with a = 11.517(5) A, b = 13.339(5) A, c = 13.595(6) A, alpha = 87.888(7) degrees, beta = 67.759(6) degrees, gamma = 68.070(6) degrees, and Z = 2; for 5, orthorhombic, space group C222(1), with a = 8.174(2) A, b = 24.497(7) A, c = 29.161(8) A, and Z = 8; for 6, triclinic, space group P1, with a = 10.349(3) A, b = 11.052(3) A, c = 19.431(6) A, alpha = 105.464(4) degrees, beta = 91.300(5) degrees, gamma = 93.655(5) degrees, and Z = 2. The magnetic properties of 1 and 4 were investigated. The photophysical properties of 1 were also studied. 相似文献
20.
Three novel polyoxometalate derivatives decorated by transition metal complexes have been hydrothermally synthesized. Compound 1 consists of [PMo(VI)(6)Mo(V)(2)V(IV)(8)O(44)[Co (2,2'-bipy)(2)(H(2)O)](4)](3+) polyoxocations and [PMo(VI)(4-)Mo(V)(4)V(IV)(8)O(44)[Co(2,2'-bipy)(2)(H(2)O)](2)](3-) polyoxoanions, which are both built on mixed-metal tetracapped [PMo(8)V(8)O(44)] subunits covalently bonded to four or two [Co(2,2'-bpy)(2)(H(2)O)](2+) clusters via terminal oxo groups of the capping V atoms. Compound 2 is built on [PMo(VI)(8)V(IV)(6)O(42)[Cu(I)(phen)](2)](5-) clusters constructed from mixed-metal bicapped [PMo(VI)(8)V(IV)(6)O(42)](7-) subunits covalently bonded to two [Cu(phen)](+) fragments in the similar way to 1. The structure of 3 is composed of [PMo(VI)(9)Mo(V)(3)O(40)](6-) units capped by two divalent Ni atoms via four bridging oxo groups. The crystal data for these are the following: C(120)H(126)Co(6)Mo(16)N(24)O(103)P(2)V(16) (1), triclinic P1, a = 15.6727(2) A, b = 17.3155(3) A, c = 19.5445(2) A, alpha = 86.1520(1) degrees, beta = 81.2010(1) degrees, gamma = 63.5970(1) degrees, Z = 1; C(120)H(85)Cu(6-)Mo(8)N(20)O(44)PV(6) (2), triclinic P1, a = 14.565(4) A, b = 15.899(3) A, c = 16.246(4) A, alpha = 116.289(2) degrees, beta = 103.084(2) degrees, gamma = 94.796(2) degrees, Z = 1; C(60)H(40)Mo(12)N(10)Ni(3)O(40)P (3), monoclinic P2(1)/c, a = 14.804(3) A, b = 22.137(4) A, c = 25.162(5) A, alpha = 90 degrees, beta = 98.59(3) degrees, gamma = 90 degrees, Z = 4. 相似文献