A novel open framework uranyl molybdate: synthesis and structure of (NH4)4[(UO2)5(MoO4)7](H2O)5

Single crystals of (NH(4))(4)[(UO(2))(5)(MoO(4))(7)](H(2)O)(5) have been synthesized hydrothermally using (NH(4))(6)Mo(7)O(24), (UO(2))(CH(3)COO)(2).2H(2)O, and H(2)O at 180 degrees C. The phase has been characterized by single-crystal X-ray diffraction using a merohedrally twinned single crystal: it is hexagonal, P6(1), a = 11.4067(5) A, c = 70.659(5) A, V = 7961.9(7) A(3), and Z = 6. The structure is based upon an open framework with composition [(UO(2))(5)(MoO(4))(7)](4-) that is composed of UO(7) pentagonal bipyramids that share vertexes with MoO(4) tetrahedra. The framework has large channels (effective pore size: 4.8 x 4.8 A(2)) parallel to the c axis and a system of smaller channels (effective pore size: 2.5 x 3.6 A(2)) parallel to [100], [110], [010], [110], [110], and [110]. The channels are occupied by NH(4)(+) cations and H(2)O molecules. The topological structure of the uranyl molybdate framework can be described either in terms of fundamental chains of UO(7) pentagonal bipyramids and MoO(4) tetrahedra or in terms of tubular building units parallel to the c axis.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

Expanding the crystal chemistry of actinyl peroxides: open sheets of uranyl polyhedra in Na5[(UO2)3(O2)4(OH)3](H2O)13

A uranyl peroxide, Na5[(UO2)3(O2)4(OH)3](H2O)13, with an open sheet of uranyl polyhedra has been synthesized under ambient conditions and structurally characterized. The structure (orthorombic, Cmca, a = 23.632(1) A, b = 15.886(1) A, c = 13.952(1) A, V = 5237.7 A(3), and Z = 8) consists of sheets composed of two symmetrically unique uranyl (UO2)2+ ions that are coordinated equatorially by two peroxide groups and two OH(-) groups, forming distorted uranyl hexagonal bipyramids of composition (UO2)(O2)2(OH)2(4-). The uranyl bipyramids are connected into sheets with openings with dimensions 13.7 A along [010] and 15.9 A along [100]. The shortest dimension of the cavity is 8.08 A. Sheets of two-dimensionally polymerized uranyl polyhedra are the most common structural type of inorganic uranyl phases; however, such an open topology has never been observed.     

Hydrothermal syntheses, structures, and properties of the new uranyl selenites Ag(2)(UO(2))(SeO(3))(2), M[(UO(2))(HSeO(3))(SeO(3))] (M = K, Rb, Cs, Tl), and Pb(UO(2))(SeO(3))(2)

The transition metal, alkali metal, and main group uranyl selenites, Ag(2)(UO(2))(SeO(3))(2) (1), K[(UO(2))(HSeO(3))(SeO(3))] (2), Rb[(UO(2))(HSeO(3))(SeO(3))] (3), Cs[(UO(2))(HSeO(3))(SeO(3))] (4), Tl[(UO(2))(HSeO(3))(SeO(3))] (5), and Pb(UO(2))(SeO(3))(2) (6), have been prepared from the hydrothermal reactions of AgNO(3), KCl, RbCl, CsCl, TlCl, or Pb(NO(3))(2) with UO(3) and SeO(2) at 180 degrees C for 3 d. The structures of 1-5 contain similar [(UO(2))(SeO(3))(2)](2-) sheets constructed from pentagonal bipyramidal UO(7) units that are joined by bridging SeO(3)(2-) anions. In 1, the selenite oxo ligands that are not utilized within the layers coordinate the Ag(+) cations to create a three-dimensional network structure. In 2-5, half of the selenite ligands are monoprotonated to yield a layer composition of [(UO(2))(HSeO(3))(SeO(3))](1-), and coordination of the K(+), Rb(+), Cs(+), and Tl(+) cations occurs through long ionic contacts. The structure of 6 contains a uranyl selenite layered substructure that differs substantially from those in 1-5 because the selenite anions adopt both bridging and chelating binding modes to the uranyl centers. Furthermore, the Pb(2+) cations form strong covalent bonds with these anions creating a three-dimensional framework. These cations occur as distorted square pyramidal PbO(5) units with stereochemically active lone pairs of electrons. These polyhedra align along the c-axis to create a polar structure. Second-harmonic generation (SHG) measurements revealed a response of 5x alpha-quartz for 6. The diffuse reflectance spectrum of 6 shows optical transitions at 330 and 440 nm. The trailing off of the 440 nm transition to longer wavelengths is responsible for the orange coloration of 6.     

Excision of uranium oxide chains and ribbons in the novel one-dimensional uranyl iodates K(2)[(UO(2))3(IO(3))(4)O(2)] and Ba[(UO(2)2(IO(3))(2)O(2)](H(2)O)

The alkali metal and alkaline-earth metal uranyl iodates K(2)[(UO(2))(3)(IO(3))(4)O(2)] and Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) have been prepared from the hydrothermal reactions of KCl or BaCl(2) with UO(3) and I(2)O(5) at 425 and 180 degrees C, respectively. While K(2)[(UO(2))(3)(IO(3))(4)O(2)] can be synthesized under both mild and supercritical conditions, the yield increases from <5% to 73% as the temperature is raised from 180 to 425 degrees C. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), however, has only been isolated from reactions performed in the mild temperature regime. Thermal measurements (DSC) indicate that K(2)[(UO(2))(3)(IO(3))(4)O(2)] is more stable than Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) and that both compounds decompose through thermal disproportionation at 579 and 575 degrees C, respectively. The difference in the thermal behavior of these compounds provides a basis for the divergence of their preparation temperatures. The structure of K(2)[(UO(2))(3)(IO(3))(4)O(2)] is composed of [(UO(2))(3)(IO(3))(4)O(2)](2)(-) chains built from the edge-sharing UO(7) pentagonal bipyramids and UO(6) octahedra. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) consists of one-dimensional [(UO(2))(2)(IO(3))(2)O(2)](2)(-) ribbons formed from the edge sharing of distorted UO(7) pentagonal bipyramids. In both compounds the iodate groups occur in both bridging and monodentate binding modes and further serve to terminate the edges of the uranium oxide chains. The K(+) or Ba(2+) cations separate the chains or ribbons in these compounds forming bonds with terminal oxygen atoms from the iodate ligands. Crystallographic data: K(2)[(UO(2))(3)(IO(3))(4)O(2)], triclinic, space group P_1, a = 7.0372(5) A, b = 7.7727(5) A, c = 8.9851(6) A, alpha = 93.386(1) degrees, beta = 105.668(1) degrees, gamma = 91.339(1) degrees, Z = 1; Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), monoclinic, space group P2(1)/c, a = 8.062(4) A, b = 6.940(3) A, c = 21.67(1), beta= 98.05(1) degrees, Z = 4.     

Aqueous reactions of U(VI) at high chloride concentrations: syntheses and structures of new uranyl chloride polymers

The reactions of UO(3) with acidic aqueous chloride solutions resulted in the formation of two new polymeric U(VI) compounds. Single crystals of Cs(2)[(UO(2))(3)Cl(2)(IO(3))(OH)O(2)].2H(2)O (1) were formed under hydrothermal conditions with HIO(3) and CsCl, and Li(H(2)O)(2)[(UO(2))(2)Cl(3)(O)(H(2)O)] (2) was obtained from acidic LiCl solutions under ambient temperature and pressure. Both compounds contain pentagonal bipyramidal coordination of the uranyl dication, UO(2)(2+). The structure of 1 consists of infinite [(UO(2))(3)Cl(2)(IO(3))(mu(3)-OH)(mu(3)-O)(2)](2-) ribbons that run down the b axis that are formed from edge-sharing pentagonal bipyramidal [UO(6)Cl] and [UO(5)Cl(2)] units. The Cs(+) cations separate the chains from one another and form long ionic contacts with terminal oxygen atoms from iodate ligands, uranyl oxygen atoms, water molecules, and chloride anions. In 2, edge-sharing [UO(3)Cl(4)] and [UO(5)Cl(2)] units build up tetranuclear [(UO(2))(4)(mu-Cl)(6)(mu(3)-O)(2)(H(2)O)(2)](2-) anions that are bridged by chloride to form one-dimensional chains. These chains are connected in a complex network of hydrogen bonds and interactions of uranyl oxygen atoms with Li(+) cations. Crystal data: 1, orthorhombic, space group Pnma, a = 8.2762(4) A, b = 12.4809(6) A, c = 17.1297(8) A, Z = 4; 2, triclinic, space group P1, a = 8.110(1) A, b = 8.621(1) A, c = 8.740(1) A, Z = 2.     

Further evidence for the tetraoxoiodate(V) anion,IO(4)(3-): hydrothermal syntheses and structures of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O and Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O

The hydrothermal reaction of MoO(3) with BaH(3)IO(6) at 180 degrees C for 3 days results in the formation of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O (1). Under similar conditions, the reaction of Ba(OH)(2) x 8H(2)O with MoO(3) and Ba(IO(4))(2) x 6H(2)O yields Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O (2). The structure of 1, determined by single-crystal X-ray diffraction, consists of corner- and edge-sharing distorted MoO(6) octahedra that create two-dimensional slabs. Contained within this molybdenum oxide framework are approximately C(2v) tetraoxoiodate(V) anions, IO(4)(3-), that are involved in bonding with five Mo(VI) centers. The two equatorial oxygen atoms of the IO(4)(3-) anion chelate a single Mo(VI) center, whereas the axial atoms are mu(3)-oxo groups and complete the octahedra of four MoO(6) units. The coordination of the tetraoxoiodate(V) anion to these five highly electropositive centers is probably responsible for stabilizing the substantial anionic charge of this anion. The Ba(2+) cations separate the layers from one another and form long ionic contacts with neighboring oxygen atoms and a water molecule. Compound 2 also contains distorted MoO(6) octahedra. However, these solely edge-share with octahedral hexaoxoiodate(VII), IO(6)(5-), anions to form zigzagging one-dimensional, (1)(infinity)[(MoO(2))(IO(6))](3-), chains that are polar. These chains are separated from one another by Ba(2+) cations that are coordinated by additional water molecules. Bond valence sums for the iodine atoms in 1 and 2 are 5.01 and 7.03, respectively. Crystallographic data: 1, monoclinic, space group C2/c, a = 13.584(1) A, b = 7.3977(7) A, c = 20.736(2) A, beta = 108.244(2) degrees, Z = 4; 2, orthorhombic, space group Fdd2, a = 13.356(7) A, b = 45.54(2) A, c = 4.867(3) A, Z = 8.     

U(VI) uranyl cation-cation interactions in framework germanates

The isomorphous compounds NH(4)[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (1), K[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (2), Li(3)O[(UO(6))(2)(UO(2))(9)(GeO(4))(GeO(3)(OH))] (3), and Ba[(UO(6))(2)(UO(2))(9)(GeO(4))(2)] (4) were synthesized by hydrothermal reaction at 220 °C. The structures were determined using single crystal X-ray diffraction and refined to R(1) = 0.0349 (1), 0.0232 (2), 0.0236 (3), 0.0267 (4). Each are trigonal, P(3)1c. 1: a = 10.2525(5), c = 17.3972(13), V = 1583.69(16) ?(3), Z = 2; 2: a = 10.226(4), c = 17.150(9), V = 1553.1(12) ?(3), Z = 2; 3: a = 10.2668(5), c = 17.0558(11), V = 1556.94(15) ?(3), Z = 2; 4: a = 10.2012(5), c = 17.1570(12), V = 1546.23(15) ?(3), Z = 2. There are three symmetrically independent U sites in each structure, two of which correspond to typical (UO(2))(2+) uranyl ions and the other of which is octahedrally coordinated by six O atoms. One of the uranyl ions donates a cation-cation interaction, and accepts a different cation-cation interaction. The linkages between the U-centered polyhedra result in a relatively dense three-dimensional framework. Ge and low-valence sites are located within cavities in the framework of U-polyhedra. Chemical, thermal, and spectroscopic characterizations are provided.     

Cation-cation interactions in Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 and Cs(UO2)9U3O16(OH)5

Two novel U6+ compounds, Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 (SrFm) and Cs(UO2)9U3O16(OH)5 (CsFm), have been synthesized by mild hydrothermal reactions. The structures of SrFm (orthorhombic, C2221, a = 11.668(1), b = 21.065 (3), c = 13.273 A, V = 3532.5(1) A3, Z = 2) and CsFm (trigonal, R3c, a = 11.395(2), c = 43.722(7) A, V = 4916.7(1) A3, Z = 6) are rare examples of uranyl compounds that contain cation-cation interactions where an O atom of one uranyl ion is directly linked to another uranyl ion. Both structures are complex frameworks. SrFm contains sheets of polyhedra that are linked through cation-cation interactions with uranyl ions located between the sheets. CsFm possesses an unusually complex framework of vertex- and edge-sharing U6+ polyhedra that incorporates cation-cation interactions.     

Methanesulfonates of high-valent metals: syntheses and structural features of MoO2(CH3SO3)2, UO2(CH3SO3)2, ReO3(CH3SO3), VO(CH3SO3)2, and V2O3(CH3SO3)4 and their thermal decomposition under N2 and O2 atmosphere

Oxide methanesulfonates of Mo, U, Re, and V have been prepared by reaction of MoO(3), UO(2)(CH(3)COO)(2)·2H(2)O, Re(2)O(7)(H(2)O)(2), and V(2)O(5) with CH(3)SO(3)H or mixtures thereof with its anhydride. These compounds are the first examples of solvent-free oxide methanesulfonates of these elements. MoO(2)(CH(3)SO(3))(2) (Pbca, a=1487.05(4), b=752.55(2), c=1549.61(5) pm, V=1.73414(9) nm(3), Z=8) contains [MoO(2)] moieties connected by [CH(3)SO(3)] ions to form layers parallel to (100). UO(2)(CH(3)SO(3))(2) (P2(1)/c, a=1320.4(1), b=1014.41(6), c=1533.7(1) pm, β=112.80(1)°, V=1.8937(3) nm(3), Z=8) consists of linear UO(2)(2+) ions coordinated by five [CH(3)SO(3)] ions, forming a layer structure. VO(CH(3)SO(3))(2) (P2(1)/c, a=1136.5(1), b=869.87(7), c=915.5(1) pm, β=113.66(1)°, V=0.8290(2) nm(3), Z=4) contains [VO] units connected by methanesulfonate anions to form corrugated layers parallel to (100). In ReO(3)(CH(3)SO(3)) (P1, a=574.0(1), b=1279.6(3), c=1641.9(3) pm, α=102.08(2), β=96.11(2), γ=99.04(2)°, V=1.1523(4) nm(3), Z=8) a chain structure exhibiting infinite O-[ReO(2)]-O-[ReO(2)]-O chains is formed. Each [ReO(2)]-O-[ReO(2)] unit is coordinated by two bidentate [CH(3)SO(3)] ions. V(2)O(3)(CH(3)SO(3))(4) (I2/a, a=1645.2(3), b=583.1(1), c=1670.2(3) pm, β=102.58(3), V=1.5637(5) pm(3), Z=4) adopts a chain structure, too, but contains discrete [VO]-O-[VO] moieties, each coordinated by two bidentate [CH(3)SO(3)] ligands. Additional methanesulfonate ions connect the [V(2)O(3)] groups along [001]. Thermal decomposition of the compounds was monitored under N(2) and O(2) atmosphere by thermogravimetric/differential thermal analysis and XRD measurements. Under N(2) the decomposition proceeds with reduction of the metal leading to the oxides MoO(2), U(3)O(7), V(4)O(7), and VO(2); for MoO(2)(CH(3)SO(3))(2), a small amount of MoS(2) is formed. If the thermal decomposition is carried out in a atmosphere of O(2) the oxides MoO(3) and V(2)O(5) are formed.     

Hydrothermal synthesis and structure of a new one-dimensional, mixed-metal U(VI) iodate, Cs(2)[(UO(2))(CrO(4))(IO(3))(2)

The reaction of the molecular transition metal iodate, Cs[CrO(3)(IO(3))], with UO(3) under mild hydrothermal conditions provides access to a new low-dimensional, mixed-metal U(VI) compound, Cs(2)[(UO(2))(CrO(4))(IO(3))(2)] (1). The structure of 1 is quite unusual and consists of one-dimensional (1)(infinity)[(UO(2))(CrO(4))(IO(3))(2)](2-) ribbons separated by Cs(+) cations. These ribbons are formed from [UO(7)] pentagonal bipyramids that contain a uranyl core, [CrO(4)] tetrahedra, and both monodentate and bridging iodate anions. Crystallographic data: 1, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4 (T = 193 K).     

One-dimensional array of two- and three-center cation-cation bonds in the structure of Li4[(UO2)10O10(Mo2O8)

Dark-red crystals of the new compound Li(4)[(UO(2))(10)O10(Mo(2)O(8))] (1) have been obtained by high-temperature solid-state reactions. The structure of 1 (monoclinic, P2(1)/c, a = 7.9426(4) A, b = 19.9895(9) A, c = 10.0796(5) A, beta = 90.575(2) degrees, V = 1600.24(13) A(3), Z = 4) consists of a framework of U and Mo polyhedra with Li+ cations in the channels. The framework contains seven-polyhedra-wide uranium oxide tapes interlinked by dimers of edge-sharing [4 + 1]-distorted MoO(5) polyhedra. The U-O tapes are parallel to the a axis, and their planes are oriented parallel to (021) and (02) so that they are cross-linked within the framework. The core of the tapes consists of unprecedented one-dimensional arrays of cation-cation-bonded uranyl ions. The arrays are constructed from eight-membered cycles with uranyl ions linked through two- and three-center cation-cation interactions.     

Expanding the remarkable structural diversity of uranyl tellurites: hydrothermal preparation and structures of K[UO(2)Te(2)O(5)(OH)], Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O,beta-Tl(2)[UO(2)(TeO(3))(2)], and Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2)

The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4.     

Topological evolution in uranyl dicarboxylates: synthesis and structures of one-dimensional UO2(C6H8O4)(H2O)2 and three-dimensional UO2(C6H8O4)

Two novel uranyl adipates are reported as synthesized via hydrothermal treatment of uranium oxynitrate and adipic acid. One-dimensional UO(2)(C(6)H(8)O(4))(H(2)O)(2) (1) [a = 9.6306(6) A, c = 11.8125(10) A, tetragonal, P4(3)2(1)2 (No. 96), Z = 4] consists of chains of (UO(2))O(4)(H(2)O)(2) hexagonal bipyramids tethered through a linear adipic acid backbone. Three-dimensional UO(2)(C(6)H(8)O(4)) (2) [a = 5.5835(12) A, b = 8.791(2) A, c = 9.2976(17) A, alpha = 87.769(9) degrees, beta = 78.957(8) degrees, gamma = 81.365(11) degrees, triclinic, P1 (No. 2), Z = 2] is produced by decreasing the hydration level of the reaction conditions. This structure contains a previously unreported [(UO(2))(2)O(8)] building unit cross-linked into a neutral metal-organic framework topology with vacant channels.     

Synthesis of a uranyl persulfide complex and quantum chemical studies of formation and topologies of hypothetical uranyl persulfide cage clusters

The compound Na(4)[(UO(2))(S(2))(3)](CH(3)OH)(8) was synthesized at room temperature in an oxygen-free environment. It contains a rare example of the [(UO(2))(S(2))(3)](4-) complex in which a uranyl ion is coordinated by three bidentate persulfide groups. We examined the possible linkage of these units to form nanoscale cage clusters analogous to those formed from uranyl peroxide polyhedra. Quantum chemical calculations at the density functional and multiconfigurational wave function levels show that the uranyl-persulfide-uranyl, U-(S(2))-U, dihedral angles of model clusters are bent due to partial covalent interactions. We propose that this bent interaction will favor assembly of uranyl ions through persulfide bridges into curved structures, potentially similar to the family of nanoscale cage clusters built from uranyl peroxide polyhedra. However, the U-(S(2))-U dihedral angles predicted for several model structures may be too tight for them to self-assemble into cage clusters with fullerene topologies in the absence of other uranyl-ion bridges that adopt a flatter configuration. Assembly of species such as [(UO(2))(S(2))(SH)(4)](4-) or [(UO(2))(S(2))(C(2)O(4))(4)](4-) into fullerene topologies with ~60 vertices may be favored by use of large counterions.     

Synthesis, crystal structure and optical properties of [Ag(UO2)3(OAc)9][Zn(H2O)4(CH3CH2OH)2]: a novel compound containing closed-shell 3d10, 4d10 and 5d10 metal ions

[Ag(UO(2))(3) (OAc)(9)][Zn(H(2)O)(4)(CH(3)CH(2)OH)(2)] (, OAc = CH(3)COO(-)) crystallized from an ethanol solution and its structure was determined by IR spectroscopy, elemental analysis, (1)H NMR, (13)C NMR and X-ray crystallography; it is composed of [Zn(H(2)O)(4)(CH(3)CH(2)OH)(2)](2+) cations and [Ag(UO(2))(3)(OAc)(9)](2-) anions in which triuranyl [(UO(2))(OAc)(3)](3) clusters are linked by the Ag ion.     

Sulfates of the refractory metals: crystal structure and thermal behavior of Nb2O2(SO4)3, MoO2(SO4), WO(SO4)2, and two modifications of Re2O5(SO4)2

The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.     

Structure Determination of a Complex Tubular Uranyl Phenylphosphonate, (UO(2))(3)(HO(3)PC(6)H(5))(2)(O(3)PC(6)H(5))(2).H(2)O, from Conventional X-ray Powder Diffraction Data

The three-dimensional structure of a complex tubular uranyl phosphonate, (UO(2))(3)(HO(3)PC(6)H(5))(2)(O(3)PC(6)H(5))(2).H(2)O, was determined ab initio from laboratory X-ray powder diffraction data and refined by the Rietveld method. The crystals belong to the space group P2(1)2(1)2(1), with a = 17.1966(2) ?, b = 7.2125(2) ?, c = 27.8282(4) ?, and Z = 4. The structure consists of three independent uranium atoms, among which two are seven-coordinated and the third is eight-coordinated. These metal atoms are connected by four different phosphonate groups to form a one-dimensional channel structure along the b axis. The phenyl groups are arranged on the outer periphery of the channels, and their stacking forces keep the channels intact in the lattice. The determination of this structure which contains 50 non-hydrogen atoms in the asymmetric unit, from conventional X-ray powder data, represents significant progress in the application of powder techniques to structure solution of complex inorganic compounds, including organometallic compounds.     

(UO2)2[UO4(trz)2](OH)2: a U(VI) coordination intermediate between a tetraoxido core and a uranyl ion with cation-cation interactions

A uranyl triazole (UO(2))(2)[UO(4)(trz)(2)](OH)(2) (1) (trz = 1,2,4-triazole) was prepared using a mild solvothermal reaction of uranyl acetate with 1,2,4-triazole. Single-crystal X-ray diffraction analysis of 1 revealed it contains sheets of uranium-oxygen polyhedra and that one of the U(VI) cations is in an unusual coordination polyhedron that is intermediate between a tetraoxido core and a uranyl ion. This U(VI) cation also forms cation-cation interactions (CCIs). Infrared, Raman, and XPS spectra are provided, together with a thermogravimetric analysis that demonstrates breakdown of the compound above 300 °C. The UV-vis-NIR spectrum of 1 is compared to those of another compound that has a range of U(VI) coordination enviromments.     

A new oxoanion: [IO]3- containing I(V) with a stereochemically active lone-pair in the silver uranyl iodate tetraoxoiodate(V), Ag4(UO2)4(IO3)2(IO4)2O2

The hydrothermal reaction of elemental Ag, or water-soluble silver sources, with UO3 and I2O5 at 200 degrees C for 5 days yields Ag4(UO2)4(IO3)2(IO4)2O2 in the form of orange fibrous needles. Single-crystal X-ray diffraction studies on this compound reveal a highly complex network structure consisting of three interconnected low-dimensional substructures. The first of these substructures are ribbons of UO8 hexagonal bipyramids that edge-share to form one-dimensional chains. These units further edge-share with pentagonal bipyramidal UO7 units to create ribbons. The edges of the ribbons are partially terminated by tetraoxoiodate(V), [IO4]3-, anions. The uranium oxide ribbons are joined by bridging iodate ligands to yield two-dimensional undulating sheets. These sheets help to form, and are linked together by, one-dimensional chains of edge-sharing AgO7 capped octahedral units and ribbons formed by corner-sharing capped trigonal planar AgO4 polyhedra, AgO6 capped square pyramids, and AgO6 octahedra. The [IO4]3- anions in Ag4(UO2)4(IO3)2)(IO4)2O2 are tetraoxoiodate(V), not metaperiodate, and contain I(V) with a stereochemically active lone-pair. Bond valence sum calculations are consistent with this formulation. Differential scanning calorimetry measurements show distinctly different thermal behavior of Ag4(UO2)4(IO3)2(IO4)2O2 versus other uranyl iodate compounds with endotherms at 479 and 494 degrees C. Density functional theory (DFT) calculations demonstrate that the approximate C2v geometry of the [IO4]3- anion can be attributed to a second-order Jahn-Teller distortion. DFT optimized geometry for the [IO4]3- anion is in good agreement with those measured from single-crystal X-ray diffraction studies on Ag4(UO2)4(IO3)2(IO4)2O2.