共查询到20条相似文献,搜索用时 171 毫秒
1.
The blue copper complex compounds [Cu(phen)2(C6H8O4)] · 4.5 H2O ( 1 ) and [(Cu2(phen)2Cl2)(C6H8O4)] · 4 H2O ( 2 ) were synthesized from CuCl2, 1,10‐phenanthroline (phen) and adipic acid in CH3OH/H2O solutions. [Cu(phen)2‐ (C6H8O4)] complexes and hydrogen bonded H2O molecules form the crystal structure of ( 1 ) (P1 (no. 2), a = 10.086(2) Å, b = 11.470(2) Å, c = 16.523(3) Å, α = 99.80(1)°, β = 115.13(1)°, γ = 115.13(1)°, V = 1617.5(5) Å3, Z = 2). The Cu atoms are square‐pyramidally coordinated by four N atoms of the phen ligands and one O atom of the adipate anion (d(Cu–O) = 1.989 Å, d(Cu–N) = 2.032–2.040 Å, axial d(Cu–N) = 2.235 Å). π‐π stacking interactions between phen ligands are responsible for the formation of supramolecular assemblies of [Cu(phen)2(C6H8O4)] complex molecules into 1 D chains along [111]. The crystal structure of ( 2 ) shows polymeric [(Cu2(phen)2Cl2)(C6H8O4)2/2] chains (P1 (no. 2), a = 7.013(1) Å, b = 10.376(1) Å, c = 11.372(3) Å, α = 73.64(1)°, β = 78.15(2)°, γ = 81.44(1)°, V = 773.5(2) Å3, Z = 1). The Cu atoms are fivefold coordinated by two Cl atoms, two N atoms of phen ligands and one O atom of the adipate anion, forming [CuCl2N2O] square pyramids with an axial Cl atom (d(Cu–O) = 1.958 Å, d(Cu–N) = 2.017–2.033 Å, d(Cu–Cl) = 2.281 Å; axial d(Cu–Cl) = 2.724 Å). Two square pyramids are condensed via the common Cl–Cl edge to centrosymmetric [Cu2Cl2N4O2] dimers, which are connected via the adipate anions to form the [(Cu2(phen)2Cl2)(C6H8O4)2/2] chains. The supramolecular 3 D network results from π‐π stacking interactions between the chains. H2O molecules are located in tunnels. 相似文献
2.
The blue copper complex [Cu2(H2O)2(phen)2(OH)2][Cu2(phen)2(OH)2(CO3)2] · 10 H2O, which was prepared by reaction of 1,10‐phenanthroline monohydrate, CuCl2 · 2 H2O and Na2CO3 in the presence of succinic acid in CH3OH/H2O at pH = 13.0, crystallized in the triclinic space group P1 (no. 2) with cell dimensions: a = 9.515(1) Å, b = 12.039(1) Å, c = 12.412(2) Å, α = 70.16(1)°, β = 85.45(1)°, γ = 81.85(1)°, V = 1323.2(2) Å3, Z = 1. The crystal structure consists of dinuclear [Cu2(H2O)2(phen)2(OH)2]2+ complex cations, dinuclear [Cu2(phen)2(OH)2(CO3)2]2– complex anions and hydrogen bonded H2O molecules. In both the centrosymmetric dinuclear cation and anion, the Cu atoms are coordinated by two N atoms of one phen ligand, three O atoms of two μ‐OH groups and respectively one H2O molecule or one CO32– anion to complete distorted [CuN2O3] square‐pyramids with the H2O molecule or the CO32– anion at the apical position (equatorial d(Cu–O) = 1.939–1.961 Å, d(Cu–N) = 2.026–2.051 Å and axial d(Cu–O) = 2.194, 2.252 Å). Two adjacent [CuN2O3] square pyramids are condensed via two μ‐OH groups. Through the interionic hydrogen bonds, the dinuclear cations and anions are linked into 1D chains with parallel phen ligands on both sides. Interdigitation of phen ligands of neighboring 1D chains generated 2D layers, between which the hydrogen bonded water molecules are sandwiched. 相似文献
3.
Reactions of 1,10‐phenanthroline monohydrate, Na2C4H4O4 · 6 H2O and MnSO4 · H2O in CH3OH/H2O yielded a mixture of [Mn2(H2O)4(phen)2(C4H4O4)2] · 2 H2O ( 1 ) and [Mn(phen)2(H2O)2][Mn(phen)2(C4H4O4)](C4H4O4) · 7 H2O ( 2 ). The crystal structure of 1 (P1 (no. 2), a = 8.257(1) Å, b = 8.395(1) Å, c = 12.879(2) Å, α = 95.33(1)°, β = 104.56(1)°, γ = 106.76(1)°, V = 814.1(2) Å3, Z = 1) consists of the dinuclear [Mn2(H2O)4(phen)2(C4H4O4)2] molecules and hydrogen bonded H2O molecules. The centrosymmetric dinuclear molecules, in which the Mn atoms are octahedrally coordinated by two N atoms of one phen ligand and four O atoms from two H2O molecules and two bis‐monodentate succinato ligands, are assembled via π‐π stacking interactions into 2 D supramolecular layers parallel to (101) (d(Mn–O) = 2.123–2.265 Å, d(Mn–N) = 2.307 Å). The crystal structure of 2 (P1 (no. 2), a = 14.289(2) Å, b = 15.182(2) Å, c = 15.913(2) Å, α = 67.108(7)°, β = 87.27(1)°, γ = 68.216(8)°, V = 2934.2(7) Å3, Z = 2) is composed of the [Mn(phen)2(H2O)2]2+ cations, [Mn(phen)2(C4H4O4)] complex molecules, (C4H4O4)2– anions, and H2O molecules. The (C4H4O4)2– anions and H2O molecules form 3 D hydrogen bonded network and the cations and complex molecules in the tunnels along [001] and [011], respectively, are assembled via the π‐π stacking interactions into 1 D supramolecular chains. The Mn atoms are octahedrally coordinated by four N atoms of two bidentate chelating phen ligands and two water O atoms or two carboxyl O atoms (d(Mn–O) = 2.088–2.129 Å, d(Mn–N) = 2.277–2.355 Å). Interestingly, the succinato ligands in the complex molecules assume gauche conformation bidentately to chelate the Mn atoms into seven‐membered rings. 相似文献
4.
The blue tetranuclear CuII complexes {[Cu(bpy)(OH)]4Cl2}Cl2 · 6 H2O ( 1 ) and {[Cu(phen)(OH)]4(H2O)2}Cl4 · 4 H2O ( 2 ) were synthesized and characterized by single crystal X‐ray diffraction. ( 1 ): P 1 (no. 2), a = 9.240(1) Å, b = 10.366(2) Å, c = 12.973(2) Å, α = 85.76(1)°, β = 75.94(1)°, γ = 72.94(1)°, V = 1152.2(4) Å3, Z = 1; ( 2 ): P 1 (no. 2), a = 9.770(3) Å, b = 10.118(3) Å, c = 14.258(4) Å, α = 83.72(2)°, β = 70.31(1)°, γ = 70.63(1)°, V = 1252.0(9) Å3, Z = 1. The building units are centrosymmetric tetranuclear {[Cu(bpy)(OH)]4Cl2}2+ and {[Cu(phen)(OH)]4(H2O)2}4+ complex cations formed by condensation of four elongated square pyramids CuN2(OH)2Lap with the apical ligands Lap = Cl, H2O, OH. The resulting [Cu4(μ2‐OH)2(μ3‐OH)2] core has the shape of a zigzag band of three Cu2(OH)2 squares. The cations exhibit intramolecular and intermolecular π‐π stacking interactions and the latter form 2D layers with the non‐bonded Cl– anions and H2O molecules in between (bond lengths: Cu–N = 1.995–2.038 Å; Cu–O = 1.927–1.982 Å; Cu–Clap = 2.563; Cu–Oap(OH) = 2.334–2.369 Å; Cu–Oap(H2O) = 2.256 Å). The Cu…Cu distances of about 2.93 Å do not indicate direct interactions, but the strongly reduced magnetic moment of about 2.74 B.M. corresponds with only two unpaired electrons per formula unit of 1 (1.37 B.M./Cu) and obviously results from intramolecular spin couplings (χm(T‐θ) = 0.933 cm3 · mol–1 · K with θ = –0.7 K). 相似文献
5.
The reaction of CuCl2 · 2 H2O, 1,10‐phenanthroline (phen), suberic acid and Na2CO3 in a CH3CN–H2O solution yielded blue needle‐like crystals of [Cu2(phen)2(C8H12O4)2] · 3 H2O. The crystal structure (monoclinic, P21/n, a = 10.756(2) Å, b = 9.790(2) Å, c = 18.593(4) Å, β = 91.15(3)°, Z = 2, R = 0.043, wR2 = 0.1238) consists of suberato‐bridged [Cu2(phen)2(C8H12O4)4/2] layers and hydrogen bonded H2O molecules. The Cu atoms are coordinated by two N atoms from one bidentate chelating phen ligand and three carboxyl O atoms from different suberato ligands to form distorted [CuN2O3] square‐pyramids with one carboxyl O atom at the apical position (d(Cu–N) = 2.017(2), 2.043(3) Å, basal d(Cu–O) = 1.936(2), 1.951(2) Å and axial d(Cu–O) = 2.389(2) Å). Two [CuN2O3] square‐pyramids are condensed via a common O–O edge to a centrosymmetric [Cu2N4O4] dimer with the Cu…Cu distance of 3.406(1) Å indicating no interaction between Cu atoms. The resultant [Cu2N4O4] dimers are interlinked by the tridentate suberato ligands to form [Cu2(phen)2(C8H12O4)4/2] layers parallel to (101). These are assembled via π‐π stacking interactions into 3D network with H2O molecules in the tunnels extending in the [010] direction. 相似文献
6.
The title compound [La(phen)2(H2O)2(NO3)2](NO3) · 2(phen)(H2O) with phen = 1,10‐phenanthroline was prepared by the stoichiometric reaction of La(NO3)3 · 6 H2O and 1,10‐phenanthroline monohydrate in a CH3OH–H2O solution. The crystal structure (triclinic, P 1 (no. 2), a = 11.052(2), b = 13.420(2), c = 16.300(2) Å, α = 78.12(1)°, β = 88.77(1)°, γ = 83.03(1)°, Z = 2, R = 0.0488, wR2 = 0.1028) consists of [La(phen)2(H2O)2(NO3)2]2+ complex cations, NO3– anions, phen and H2O molecules. The La atom is 10‐fold coordinated by four N atoms of two bidentate chelating phen ligands and six O atoms of two H2O molecules and two bidentate chelating NO32– ligands with d(La–O) = 2.522–2.640 Å and d(La–N) = 2.689–2.738 Å. The intermolecular π‐π stacking interactions play an essential role in the formation of two different 2 D layers parallel to (001), which are formed by complex cations and uncoordinating phen molecules, respectively. The uncoordinated NO3– anions and H2O molecules are sandwiched between the cationic and phen layers. 相似文献
7.
The title compound [Cu2(phen)2(C9H14O4)2] · 6 H2O was prepared by the reaction of CuCl2 · 2 H2O, 1,10‐phenanthroline (phen), azelaic acid and Na2CO3 in a CH3OH/H2O solution. The crystal structure (monoclinic, C2/c (no. 15), a = 22.346(3), b = 11.862(1), c = 17.989(3) Å, β = 91.71(1)°, Z = 4, R = 0.0473, wR2 = 0.1344 for 4279 observed reflections) consists of centrosymmetric dinuclear [Cu2(phen)2(C9H14O4)2] complexes and hydrogen bonded H2O molecules. The Cu atom is square‐planar coordinated by the two N atoms of the chelating phen ligand and two O atoms of different bidentate bridging azelaate groups with d(Cu–N) = 2.053, 2.122(2) Å and d(Cu–O) = 1.948(2), 2.031(2) Å. Two azelaate anions bridge two common Cu atoms via the terminal O atoms (d(C–O) = 1.29(2) Å; d(C–C) = 1.550(4)–1.583(4) Å). Phen ligands of adjacent complexes cover each other at distances of about 3.62 Å, indicating π‐π stacking interaction, by which the complexes are linked to 1 D bands. 相似文献
8.
[Cu(C12H8N2)(C4H4O4)(H2O)]2 · C4H6O4 was prepared by the reaction of succinic acid, CuCl2 · 2 H2O, 1,10‐phenanthroline (phen = C12H8N2), and Na2CO3 in a CH3OH–H2O solution. The crystal structure (triclinic, P 1 (no. 2), a = 7.493(1), b = 9.758(1), c = 13.517(1) Å; α = 68.89(1)°, β = 88.89(1)°, γ = 73.32(1)°, Z = 1, R = 0.0308, wR2 = 0.0799 for 3530 observed reflections (F ≥ 2σ(F ) out of 3946 unique reflections) consists of hydrogen bonded succinic acid molecules and succinato bridged 1 D zipperlike supramolecular [Cu(phen)(C4H4O4)2/2(H2O)]2 double chains based on 1 D π‐π stacking interactions between the chelating phen systems at distances of 3.71 Å and 3.79 Å. The Cu atoms are fivefold trigonal bipyramidally coordinated by two N atoms of the bidentate chelating phen ligand and three O atoms of one water molecule and two bidentate bridging succinate ligands. The water O atom and one phen N atom are at the apical positions (equatorial: d(Cu–O) = 1.945, 2.254(2) Å, d(Cu–N) = 2.034(2) Å; axial: d(Cu–O) = 1.971(2) Å, d(Cu–N) = 1.995 Å). 相似文献
9.
Syntheses of the sky blue complex compounds [Ni(H2O)3(phen)(C5H6O4)] · H2O ( 1 ) and [Ni(H2O)2(phen)(C5H6O4)] ( 2 ) were carried out by the reactions of 1,10‐phenanthroline monohydrate, glutaric acid, NiSO4 · 6 H2O and Na2CO3 in CH3OH/H2O at pH = 6.9 and 7.5, respectively. The crystal structure of 1 (P 1 (no. 2), a = 14.289 Å, b = 15.182 Å, c = 15.913 Å, α = 67.108°, β = 87.27°, γ = 68.216°, V = 2934.2 Å3, Z = 2) consists of hydrogen bonded [Ni(H2O)3‐ (phen)(C5H6O4)]2 dimers and H2O molecules. The Ni atoms are octahedrally coordinated by two N atoms of one phen ligand, three water O atoms and one carboxyl O atom from one monodentate glutarato ligand (d(Ni–N) = 2.086, 2.090 Å; d(Ni–O) = 2.064–2.079 Å). Through the π‐π stacking interactions and intermolecular hydrogen bonds, the dimers are assembled to form 2 D layers parallel to (0 1 1). The crystal structure of 2 (P21/n (no. 14), a = 7.574 Å, b = 11.938 Å, c = 18.817 Å, β = 98.48°, V = 1682.8 Å3, Z = 4) contains [Ni(H2O)2(phen)(C5H6O4)2/2] supramolecular chains extending along [010]. The Ni atoms are octahedrally coordinated by two N atoms of one phen ligand, two water O atoms and two carboxyl O atoms from different bis‐monodentate glutarato ligands with d(Ni–N) = 2.082, 2.105 Å and d(Ni–O) = 2.059–2.087 Å. The supramolecular chains are assembled into a 3 D network by π‐π stacking interactions and interchain hydrogen bonds. A TG/DTA of 2 shows two endothermic effects at 132 °C and 390 °C corresponding to the complete dehydration and the lost of phen. 相似文献
10.
The first selenite chloride hydrates, Co(HSeO3)Cl · 3 H2O and Cu(HSeO3)Cl · 2 H2O, have been prepared from solution and characterised by single‐crystal X‐ray diffraction. The cobalt phase adopts an unusual “one‐dimensional” structure built up from vertex‐sharing pyramidal [HSeO3]2–, and octahedral [CoO2(H2O)4]2– and [CoO2(H2O)2Cl2]4– units. Inter‐chain bonding is by way of hydrogen bonds or van der Waals' interactions. The atomic arrangement of the copper phase involves [HSeO3]2– pyramids and Jahn‐Teller distorted [CuCl2(H2O)4] and [CuO4Cl2]8– octahedra, sharing vertices by way of Cu–O–Se and Cu–Cl–Cu bonds. Crystal data: Co(HSeO3)Cl · 3 H2O, Mr = 276.40, triclinic, space group P 1 (No. 2), a = 7.1657(5) Å, b = 7.3714(5) Å, c = 7.7064(5) Å, α = 64.934(1)°, β = 68.894(1)°, γ = 71.795(1)°, V = 337.78(7) Å3, Z = 2, R(F) = 0.036, wR(F) = 0.049. Cu(HSeO3)Cl · 2 H2O, Mr = 263.00, orthorhombic, space group Pnma (No. 62), a = 9.1488(3) Å, b = 17.8351(7) Å, c = 7.2293(3) Å, V = 1179.6(2) Å3, Z = 8, R(F) = 0.021, wR(F) = 0.024. 相似文献
11.
Blue crystals of Cu2(phen)2(H2O)2(C5H6O4)2 were obtained from a CH3OH–H2O solution containing CuCl2, 1,10‐phenanthroline (phen), glutaric acid and Na2CO3. The crystal structure (monoclinic, P21/c (no. 14), a = 10.271(1), b = 10.595(1), c = 15.585(1) Å, β = 107.105(3)°, Z = 2, R = 0.0328, wR2 = 0.1027 for 3376 observed reflections (F ≥ 2σ(F ) out of 3728 unique reflections) is built up of dinuclear Cu2(phen)2(H2O)2(C5H6O4)2 complex molecules centered at inversion centers. The Cu atoms are square‐pyramidally coordinated by two nitrogen atoms of one bidentate chelating phen ligand and three oxygen atoms from two bridging glutarate anions and one axial water molecule (d(Cu–N) = 2.018(2), 2.024(2) Å; basal d(Cu–O) = 1.949(2), 1.956(2) Å; axial d(Cu–O) = 2.382(2) Å). Through the π‐π stacking interactions extending in a direction, the complex molecules are interlinked into 2 D layers parallel to the ac plane. The resultant 2 D layers are held together by hydrogen bonds between water molecules and uncoordinated carboxyl oxygen atoms. 相似文献
12.
Reactions of phenanthroline (phen) and Er(NO3)3 · 5 H2O or Lu(NO3)3 · H2O in CH3OH/H2O yield [Ln2(phen)4(H2O)4(OH)2](NO3)4(phen)2 with Ln = Er ( 1 ), Lu ( 2 ). Both isostructural complex compounds crystallize in the triclinic space group P 1 (no. 2) with the cell dimensions: a = 11.257(2) Å, b = 11.467(2) Å, c = 14.069(2) Å, α = 93.93(2)°, β = 98.18(1)°, γ = 108.14(1)°, V = 1696.0(6) Å3, Z = 1 for ( 1 ) and a = 11.251(1) Å, b = 11.476(1) Å, c = 14.019(1) Å, α = 93.83(1)°, β = 98.27(1)°, γ = 108.27(1)°, V = 1689.0(3) Å3, Z = 1 for ( 2 ). The crystal structures consist of the hydroxo bridged dinuclear [Ln2(phen)4(H2O)4(OH)2]4+ complex cations, hydrogen bonded NO3– anions and π‐π stacking (phen)2 dimers. The rare earth metal atoms are coordinated by four N atoms of two phen ligands and four O atoms of two H2O molecules and two μ‐OH groups to complete tetragonal antiprisms. Via two common μ‐OH groups, two neighboring tetragonal antiprisms are condensed to a centrosymmetric dinuclear [Ln2(phen)4(H2O)4(OH)2]4+ complex cation. Based on π‐π stacking interactions and hydrogen bonding, the complex cations and (phen)2 dimers form 2 D layers parallel to (1 0 1), between which the hydrogen bonded NO3– anions are sandwiched. The structures can be simplified into a distorted CsCl structure when {[Ln2(phen)4(H2O)4(OH)2](NO3)4} and (phen)2 are viewed as building units. 相似文献
13.
Reaction of MnSO4 · H2O, 2,2′‐bipyridine (bpy), suberic acid and Na2CO3 in CH3OH/H2O yielded a mixture of [Mn2(H2O)4(bpy)2(C8H12O4)2] · 2 H2O ( 1 ) and [Mn(H2O)2‐ (bpy)(C8H12O4)2/2] · H2O ( 2 ). In both complexes, the Mn atoms are octahedrally coordinated by two N atoms of one bpy ligand and four O atoms of two trans positioned H2O molecules and two suberato ligands (d(Mn–O) = 2.107–2.328 Å; d(Mn–N) = 2.250–2.330 Å). The bis‐monodentate suberato ligands bridge Mn atoms to form dinuclear [Mn2(H2O)4(bpy)2(C8H12O4)2] complex molecules in 1 and 1D [Mn(H2O)2(bpy)(C8H12O4)2/2] chains in 2 . Via the intermolecular hydrogen bondings and π‐π stacking interactions, the dinuclear molecules in 1 are assembled into 2D networks parallel to (100), between which the crystal H2O molecules are sandwiched. The polymeric chains in 2 are linked together by interchain hydrogen bonding and π‐π stacking interactions into 3D networks with the crystal H2O molecules located in tunnels along [010]. Crystal data for 1 : P21/c (no. 14), a = 10.092(1) Å, b = 11.916(2) Å, c = 17.296(2) Å, β = 93.41(1)° and Z = 2. Crystal data for 2 : P21/c (no. 14), a = 11.176(2) Å, b = 9.688(1) Å, c = 37.842(6) Å, β = 90.06(1)° and Z = 8. 相似文献
14.
Two mixed ligand ZnII complexes [Zn(phen)L2/2](H2L) ( 1 ) and [(phen)2Zn(μ‐L)Zn(phen)2]L � 11H2O ( 2 ) with H2L = suc‐cinic acid were prepared and crystallographically characterized. Complex 1 crystallizes in the monoclinic space group C2/c (no. 15) with a = 13.618(1) Å, b = 9.585(1) Å, c = 15.165(1) Å, β = 96.780(6)°, V = 1965.6(3)Å3, Z = 4 and complex 2 in the triclinic space group P 1¯ (no. 2) with a = 12.989(2)Å, b = 14.464(2)Å, c = 18.025(3)Å, α = 90.01(1)°, β = 109.69(1)°, γ = 112.32(1)°, V = 2917.4(8) Å3, Z = 2. 1 consists of succinic acid molecules and 1D zigzag [Zn(phen)(C4H4O4)2/2] polymeric chains, in which the tetrahedrally coordinated Zn atoms are bridged by bis ‐ monodentate succinato ligands. Succinic acid molecules play an important role in supramolecular assemblies of the polymeric chains into 2D layers as well as in the stacking of 2D layers. 2 is composed of [(phen)2Zn(μ‐L)Zn(phen)2]2+ complex cations, succinate anions and hydrogen bonded water molecules. Within the divalent cations, Zn atoms are octahedrally coordinated by four N atoms of two phen ligands and two O atoms of one bis‐chelating succinato ligand. Through the intermolecular π—π stacking interactions, the complex cations form positively charged 2D layers, between which the noncoordinating succinate anions and water molecules are sandwiched. 相似文献
15.
Yellow crystals of [Mn(H2O)2(bpy)(C4H4O4)] · H2O were obtained by the reaction of 2,2′‐bipyridine, succinic acid, MnSO4 · H2O and Na2CO3 in an aqueous methanol solution. The crystal structure (monoclinic, P21/c (no. 14), a = 8.294(1), b = 11.556(1), c = 17.064(1)Å, β = 95.181(6)°, Z = 4, R = 0.0349, wR2 = 0.0887) consists of 1D supramolecular helix chains [Mn(H2O)2(bpy)(C4H4O4)2/2] and hydrogen bonded H2O molecules. The Mn atoms are octahedrally coordinated by two N atoms of one bidentate chelating bpy ligand and four O atoms of two H2O molecules and two bis‐monodentate bridging succinato ligands with d(Mn–O) = 2.139–2.237Å and d(Mn–N) = 2.268, 2.281 Å. The helix chains are held together by π‐π stacking interactions and hydrogen bonds. 相似文献
16.
Reaction of CuCl2 · 2H2O, phenanthroline, maleic acid and NaOH in CH3OH/H2O (1:1 v/v) at pH = 7.0 yielded blue {[Cu(phen)]2(C4H2O4)2} · 4.5H2O, which crystallizes in the monoclinic space group C2/c (no. 15) with cell dimensions: a = 18.127(2)Å, b = 12.482(2)Å, c = 14.602(2)Å, β = 103.43(1)°, U = 3213.5(8)Å3, Z = 4. The crystal structure consists of the centrosymmetric dinuclear {[Cu(phen)]2(C4H2O4)2} complex molecules and hydrogen bonded H2O molecules. The Cu atoms are each square‐pyramidally coordinated by two N atoms of one phen ligand and three carboxyl O atoms of two maleato ligands with one carboxyl O atom at the apical position (d(Cu‐N) = 2.008, 2.012Å, equatorial d(Cu‐O) = 1.933, 1.969Å, axial d(Cu‐O) = 2.306Å). Two square‐pyramids are condensed via two apical carboxyl O atoms with a relatively larger Cu···Cu separation of 3.346(1)Å. The dinuclear complex molecules are assembled via the intermolecular π—π stacking interactions into 1D ribbons. Crossover of the resulting ribbons via interribbon π—π stacking interactions forms a 3D network with the tunnels occupied by H2O molecules. The title complex behaves paramagnetically between 5—300 K, following the Curie‐Weiss law χm(T—θ) = 0.435 cm3 · mol—1 · K with θ = 1.59 K. 相似文献
17.
Crystals of anionic Na[CuCl2(HOCH2C≡CCH2OH)]·2H2O π‐complex have been synthesized by interaction of 2‐butyne‐1,4‐diol with CuCl in a concentrated aqueous NaCl solution and characterized by X‐ray diffraction at 100 K. The crystals are triclinic: space group , a = 7.142(3), b = 7.703(3), c = 10.425(4) Å, α = 105.60(3), β = 99.49(3), γ = 110.43(3)°, V = 495.9(4) Å3, Z = 2, R = 0.0203 for 3496 reflections. The structure is built of discrete [CuCl2(HOCH2C≡CCH2OH)]? anionic stacks and polymeric cations among the stacks. The CuI atom adopts trigonal planar coordination of two Cl? anions and the C≡C bond of 2‐butyne‐1,4‐diol, Cu–(C≡C) distance is equal to 1.903(3) Å. Na+ cations environment is octahedral and consists of O and Cl atoms. The crystal packing is governed by strong hydrogen bonds of O–H···Cl and O–H···O types. 相似文献
18.
Two CoII complexes, Co(phen)(HL)2 ( 1 ) and [Co2(phen)2(H2O)4L2]·H2O ( 2 ) (H2L = HOOC‐(CH2)5‐COOH), were synthesized and structurally characterized on the basis of single crystal X‐ray diffraction data. In complex 1 the Co atoms are tetrahedrally coordinated by two N atoms of one phen ligand and two O atoms of different hydrogenpimelato ligands. Through π—π stacking interactions between carboxyl group and phen ligand, the complex molecules are assembled into 1D columnar chains, which are connected by intermolecular hydrogen bonds. Complex 2 consists of the centrosymmetric dinuclear [Co2(phen)2(H2O)4L2] molecules and hydrogen bonded H2O molecules. The Co atoms are each octahedrally surrounded by two N atoms of one phen ligand and four O atoms from two bis‐monodentate pimelato ligands and two H2O molecules at the trans positions. The results about thermal analyses, which were performed in flowing N2 atmosphere, on both complexes were discussed. Crystal data: ( 1 ) C2/c (no. 15), a = 13.491(1)Å, b = 9.828(1)Å, c = 19.392(2)Å, β = 100.648(1)°, U = 2526.9(4)Å3, Z = 4; ( 2 ) P1 (no. 2), a = 11.558(1)Å, b = 11.947(3)Å, c = 15.211(1)Å, α = 86.17(1)°, β = 75.55(1)°, γ = 69.95(1)°, U = 1910.3(3)Å3, Z = 2. 相似文献
19.
Reactions of a freshly prepared Zn(OH)2‐2x(CO3)x · yH2O precipitate, phenanthroline with azelaic and sebacic acid in CH3OH/H2O afforded [Zn(phen)(C9H15O4)2] ( 1 ) and [Zn2(phen)2(H2O)2(C10H16O4)2] · 3H2O ( 2 ), respectively. They were structurally characterized by X‐ray diffraction methods. Compound 1 consists of complex molecules [Zn(phen)(C9H15O4)2] in which the Zn atoms are tetrahedrally coordinated by two N atoms of one phen ligand and two O atoms of different monodentate hydrogen azelaato groups. Intermolecular C(alkyl)‐H···π interactions and the intermolecular C(aryl)‐H···O and O‐H···O hydrogen bonds are responsible for the supramolecular assembly of the [Zn(phen)(C9H15O4)2] complexes. Compound 2 is built up from crystal H2O molecules and the centrosymmetric binuclear [Zn2(phen)2(H2O)2(C10H16O4)2] complex, in which two [Zn(phen)(H2O)]2+ moieties are bridged by two sebacato ligands. Through the intermolecular C(alkyl)‐H···O hydrogen bonds and π‐π stacking interactions, the binuclear complex molecules are assembled into layers, between which the lattice H2O molecules are sandwiched. Crystal data: ( 1 ) C2/c (no. 15), a = 13.887(2), b = 9.790(2), c = 22.887(3)Å, β = 107.05(1)°, U = 2974.8(8)Å3, Z = 4; ( 2 ) P1¯ (no. 2), a = 8.414(1), b = 10.679(1), c = 14.076(2)Å, α = 106.52(1)°, β = 91.56(1)°, γ = 99.09(1)°, U = 1193.9(2)Å3, Z = 1. 相似文献
20.
The tris‐bidentate complex [Ni(C12H8N2)2(CO3)] was synthesized by the reaction of Na2CO3, 1,10‐phenanthroline (phen = C12H8N2) and NiSO4 · 6 H2O in the presence of succinic acid in a CH3OH–H2O solution. The compound crystallizes as heptahydrate. The crystal structure (monoclinic, P21/c (no. 14), a = 9.897(1), b = 26.384(2), c = 10.582(1) Å, β = 105.87(1)°, Z = 4, R = 0.0505, wR2 = 0.1029 for 3166 observed reflections (F ≥ 2σ(F ) out of 6100 unique reflections) consists of hydrogen bonded water molecules and [Ni(phen)2(CO3)] complex molecules. The Ni atoms are sixfold octahedrally coordinated by the four N atoms of two bidentate chelating phen ligands and by two O atoms of the bidentate chelating carbonate group with d(Ni–N) = 2.092–2.100 Å, d(Ni–O) = 2.051, 2.079 Å. The complex molecules are stacked into 2D corrugated layers parallel to (010) via two types of intermolecular π‐π stacking interactions. One occurs between two quinoline rings of neighboring phen ligands at the distance of 3.63 Å in [010] direction and the other results from 1D π‐π stacking interactions through partially covered phen rings at alternative distances of 3.26 Å and 3.33 Å in [001] direction. The water molecules are sandwiched between 2D layers. 相似文献