共查询到20条相似文献,搜索用时 265 毫秒
1.
A. M. Maharramov R. A. Alieva G. G. Nazarova F. N. Bakhmanova R. K. Askerov F. M. Chyragov 《Journal of Structural Chemistry》2016,57(4):819-821
A new complex of copper (II) with 3-(2-hydroxy-3-sulfo-5-nitrophenylazo)-pentadione-2,4 (HL) is synthesized and analyzed by single crystal XRD. The crystals are monoclinic: a = 7.7563(4) Å, b = 24.0157(12) Å, c = 24.6353(13) Å, β = 91.9490(10)°, V = 4586.2(4) Å3, space group P21/c, Z = 2, ρcalc = 1.713 g/cm3, R = 0.0695. The environment of the copper atom is formed by three oxygen atoms, the nitrogen atom of tetradentate ligand, and the oxygen atom of a water molecule. 相似文献
2.
V. F. Shul’gin Yu. V. Trush O. V. Konnik E. B. Rusanov V. Ya. Zub V. V. Minin 《Russian Journal of Inorganic Chemistry》2012,57(2):226-230
Binuclear copper(II) complexes with acyldihydrazones of benzenedicarboxylic acid and trifluoroacetylacetone have been synthesized and studied. The structure of the copper(II) complex with diacylhydrazone of 1,3-benzenedicarboxylic acid (H4L) of composition [Cu2L · 2LPy] has been studied by X-ray diffraction. The crystals are triclinic: a = 9.2298(4) Å, b = 11.8510(6) Å, c = 13.8314(7) Å, α = 90.780(3)°, β = 96.124(3)°, γ = 99.264(3)°, space group \(P\bar 1\), Z = 2. The number of symmetry-unrelated reflections with I > 2σ(I) 5941; R = 0.0357, R w = 0.0589. The complex contains two equivalent copper atoms at a distance of 9.56 Å from each other in the square-planar coordination environment. The high-temperature EPR spectra of the complexes show a signal of seven HFS lines indicating the coupling of unpaired electrons to two equivalent copper nuclei (g = 2.113?2.116, a Cu = 37.0?37.2 × 10?4 cm?1). 相似文献
3.
V. F. Shul’gin Yu. V. Trush O. V. Konnik E. B. Rusanov V. Ya. Zub V. V. Minin 《Russian Journal of Inorganic Chemistry》2011,56(5):707-712
The binuclear copper(II) complexes with acyldihydrazones formed by 1,4-cyclohexanedicarboxylic acid and salicylaldehyde or 2-hydroxyacetophenone were synthesized and studied. The structure of the complex with 1,4-cyclohexanedicarboxylic acid bis(salicylidene)hydrazone (H4L1) [Cu2L1(Py)2] was studied by X-ray diffraction. The crystals are triclinic: a = 8.1852(4) Å, b = 8.5157(5) Å, c = 11.6553(7) Å, α = 80.678(3)°, β = 70.041(4)°, γ = 74.803(3)°. Space group \(P\bar 1\), Z = 1. The number of symmetrically independent reflections with I > 2(σ(I)) is 2245, R = 0.0395; R w = 0.0917. The complex contains two equivalent copper atoms located at a 10.772 Å distance from each other. The coordination polyhedra have a square geometry and are involved in the intermolecular π/π-stacking. The EPR spectra of solutions of the binuclear complexes show an isotropic signal of seven HFS lines (g = 2.113–2.118, A Cu ≈ 38 G), indicating interaction between the unpaired electrons and the two equivalent copper nuclei. The possible exchange interaction channels were analyzed. 相似文献
4.
S. I. Dorovskikh K. V. Zherikova N. V. Kuratieva N. B. Morozova 《Journal of Structural Chemistry》2011,52(6):1120-1123
The structure of a nickel(II) complex with 2-amino-4-iminopentane is determined by X-ray crystallography at 150 K. Crystal data for C10H18N4Ni are: a = 10.9802(3)Å, b = 13.5780(4)Å, c = 8.0935(2)Å, β = 107.304(1)°, space group P21/c, V = 1152.04(5) Å3, Z = 4, d x = 1.459 g/cm3, R = 0.0283. The structure is molecular; the metal atom is coordinated by four nitrogen atoms of two β-diimine ligands. The Ni-N distances in Ni(NacNac)2 fall within 1.8571–1.8623 Å. The molecules in the crystal are joined by only van der Waals interactions. 相似文献
5.
S. S. Qian X. L. Zhao L. H. Pang Z. L. You H. L. Zhu 《Russian Journal of Coordination Chemistry》2016,42(5):345-350
A new centrosymmetric mononuclear copper(II) complex [Cu(L)2](ClO4)2 (I) and a new centrosymmetric mononuclear nickel(II) complex [Ni(L)2(MeOH)2](ClO4)2 (II), where L is the zwitterionic ligand 2-bromo-4-chloro-6-[(2-methylammonioethylimino)methyl]phenolate, have been prepared from the Schiff base 2-bromo-4-chloro-6-[(2-methylaminoethylimino)methyl]phenol with copper perchlorate and nickel perchlorate, respectively. The complexes were characterized by elemental analysis, infrared spectra, and single-cyrstal X-ray diffraction (CIF files CCDC nos. 1408054 (I) and 1407973 (II)). Complex I crystallizes in the monoclinic space group P21/c with unit cell dimensions a = 7.7736(4), b = 21.608(1), c = 8.5194(4) Å, β = 93.907(2)°, V = 1427.7(1) Å3, Z = 2, R 1 = 0.0546, and wR 2 = 0.1531. Complex II crystallizes in the monoclinic space group P21/c with unit cell dimensions a = 21.324(3), b = 16.821(2), c = 9.425(1) Å, β = 90.114(2)°, V = 3380.5(7) Å3, Z = 4, R 1 = 0.0693, and wR 2 = 0.1627. The Cu atom in I is in square planar coordination, and the Ni atom in II is in octahedral coordination. 相似文献
6.
A copper(II) complex with 2-(diphenylacetyl)indanedione-1,3 (HL) was synthesized. CuL2·0.5C4H8O2 crystals prepared from chloroform + 1,4-dioxane are triclinic, space group P \(\bar 1\), a = 15.0206(9) Å, b = 16.0132(9) Å, c = 16.8323(10) Å, α = 109.6850(10)°, β = 96.4390(10)°, γ = 97.7120(10)°, Z = 4. A unit cell contains two crystallographically independent centrosymmetric dinuclear complexes of the same structure. Each copper(II) atom is coordinated by bidentate cis-oriented deprotonated ligands L at the corners of the square. Bridging 1,4-dioxane molecules make the CN of each metal atom five. 相似文献
7.
V. F. Shul’gin A. I. Obukh E. B. Rusanov V. Ya. Zub V. V. Minin 《Russian Journal of Inorganic Chemistry》2009,54(7):1076-1081
Copper(II) binuclear complexes with acyldihydrazones of saturated carboxylic acids and pyruvic acid in which the coordination polyhedra are connected by polymethylene chains of different length (1 to 5 units) were synthesized and studied by chemical and thermogravimetric analysis, IR spectroscopy, and EPR. The structure of binuclear copper(II) complex with succinic acid acyldihydrazone [Cu2L · 4Py] · 2Py was determined by X-ray diffraction. The crystals are monoclinic: a = 14.3795(6), b = 8.8736(4), c = 15.9147(7) Å, β = 101.062(3)°, space group P21/c, Z = 2. The number of independent reflections with I > 2σ(I) = 2804, R = 0.042, R w = 0.087. The copper atoms are spaced by a chain of seven σ bonds at 8.922 Å. The coordination polyhedron can be described as a tetragonal pyramid highly distorted toward a trigonal bipyramid. The EPR spectra of solutions of complexes based on malonic, succinic, glutaric, and adipinic acids exhibit a poorly resolved signal of seven HFS lines with a constant of (26.3–27.0) × 10?4 cm?1, which attests to the presence of weak exchange interactions between paramagnetic centers. An increase in the length of the polymethylene spaur suppresses exchange interactions, and the EPR spectrum of the complex based on pimelic acid acyldihydrazone shows a signal of four HFS lines with a constant of 43.8 × 10?4 cm?1 typical of monomeric copper(II) complexes. 相似文献
8.
The structure of the hexanuclear copper(II) β-diketonate complex with gfa (hexafluoroacetylacetone) and dpm (dipivalylmethanate) ligands was studied by low-temperature (T = 100 K) X-ray diffraction. Crystal data for Cu6(gfa)4(dpm)4(OH)4 [C64H84Cu6F24O20]: a = 28.2364(7) Å, b = 12.8072(3) Å, c = 24.7199(7) Å, β= 115.900(1)°, V = 8041.5(4) Å3, space group C2/m, Z = 4, d calc 1.661 g/cm3. The coordination polyhedra of the copper atoms — squares and octahedra — are formed by the oxygen atoms of the gfa and dpm ligands and groups. In all cases, the Cu-O distances vary from 1.89 Å to 2.13 Å. The complexes follow the sites of the rhombohedral sublattice with the parameters a c ≈ 14.4 Å and a c ≈ 61.5°. 相似文献
9.
N. B. Morozova P. A. Stabnikov I. A. Baidina P. P. Semyannikov S. V. Trubin I. K. Igumenov 《Journal of Structural Chemistry》2007,48(5):889-898
Copper(II) chelates with β-diimine derivatives of acetylacetone that have a general formula of Cu(R1C(NR2)CHC(NR2)R1)2, where R1, R2 are alkyl substituents, are synthesized. The complexes were identified using elemental analysis, melting point measurements, and high-temperature mass spectrometry data. Knudsen technique is employed to determine the vapor pressure temperature dependence, and standard thermodynamic parameters of sublimation ΔH T 0 and ΔS T 0 are derived. A single crystal X-ray diffraction study is carried out for copper(II) complexes of Cu(CH3-C(NCH3)-CH-C(NCH3)-CH3)2 (a = 10.363(1) Å, b = 11.978(1) Å, c = 12.653(1) Å, V = 1570.6(3) Å3, space group Pnc2, Z = 4, d calc = 1.328 g/cm3, R = 0.027), Cu(CH3-C(NC2H5)-CH-C(NC2H5)-CH3)2 (a = 11.782(4) Å, b = 13.951(8) Å, c = 25.591(8) Å, V = 4206(3) Å3, space group C2221, Z = 8, d calc = 1.169 g/cm3, R = 0.10), and also 2-(methylamino)-4-(methylimino)-pentene-2 CH3-(C=(NCH3))-CH=(C-(NHCH3))-CH3 (a = 12.129(2) Å, b = 12.034(2) Å, c = 5.692(1) Å, β = 107.05(3)°, V = 794.3(3) Å3, space group Cc, Z = 4, d calc = 1.055 g/cm3, R = 0.06). Van der Waals lattice energy E cryst is calculated for the cooper(II) complexes by the atom-atom potential technique. The calculated values are compared to experimental sublimation enthalpies Δ H T 0 . 相似文献
10.
K. É. Miminoshvili A. N. Sobolev É. B. Miminoshvili L. A. Beridze É. R. Kutelia 《Journal of Structural Chemistry》2005,46(3):560-565
X-ray structural analysis has been performed for two complex compounds: Cu(en)2(o-HB)2H2O (I) (a = 16.873(4) Å, b = 8.713(2) Å, c = 14.803(3) Å, β = 91.15(2)°, V = 2175.8(8) Å3, C2/c, Z = 4, R(F) = 0.0263, 1516 reflections with I > 3σ (I)) and [Cu(en)2(OH2)2]2+(o-AB?)2 (II) (a = 7.488(5) Å, b = 22.122(8) Å, c = 7.856(5) Å, β = 118.77(2)°, V = 1140.7(11) Å3, P21/n, Z = 2, R(F) = 0.0432, 1684 reflections with I > 3σ(I)) synthesized under identical conditions (en is ethylenediamine, o-HB is o-hydroxybenzoate, and o-AB is o-aminobenzoate). Although the compounds were assumed to have similar structures and the Cu-Lig bond lengths and the cis and trans angles are acceptable for an octahedral structure, the geometric parameters of o-HB suggest that the copper atom has a plane square environment. 相似文献
11.
S. S. Batool S. R. Gilani M. N. Tahir A. Siddique W. T. A. Harrison 《Journal of Structural Chemistry》2016,57(6):1176-1181
A new mixed-ligand one-dimensional copper(II) coordination polymer [Cu(en)(sal)Cl] n where en = ethylenediamine(C2H8N2) and Hsal = 2-hydroxybenzoic acid (salicylic acid; C7H6O3) is synthesized and characterized by FTIR spectroscopy and single crystal X-ray diffraction. The structure contains Cu2+ ions in two different distorted octahedral coordination environments: an axially extended CuN4Cl2 moiety arising from a pair of bidentate en ligands and a CuO4Cl2 moiety arising from a pair of asymmetrically coordinated sal– anions. The chloride ions bridge the copper ions into a zigzag chain propagating in [001]. The structure is consolidated by N–H???O and N–H???Cl hydrogen bonds which generate a layered network. Crystal data: C9H13ClCuN2O3, M r = 296.20, monoclinic, P21/c, a = 13.9179(10) Å, b = 10.4900(8) Å, c = 8.5181(6) Å, β = 105.518(4)°, V = 1198.30(15) Å3, Z = 4, R(F) = 0.026, w R(F 2) = 0.068. 相似文献
12.
K. V. Zherikova N. B. Morozova N. V. Kuratieva I. A. Baidina I. K. Igumenov 《Journal of Structural Chemistry》2005,46(6):1039-1046
Two volatile hafnium(IV) complexes with acetylacetone and trifluoroacetylacetone (HL) have been prepared and their structures have been studied at ?30°C. Crystal data for C20H28HfO8: a = 21.5493(4) Å, b = 8.36720(10) Å, c = 13.9905(3) Å; β = 116.5550(10)°, space group C2/c, Z = 4, d calc = 1.692 g/cm3, R = 0.015. Crystal data for C20H16F12HfO8: a = 8.1039(12) Å, b = 11.4499(14) Å, c = 15.790(2) Å; α = 99.341(4)°, β = 103.175(4)°, γ = 108.185(4)°, space group P?1, Z = 2, d calc = 2.003 g/cm3, R = 0.074. Both structures are molecular and comprise isolated complex molecules HfL4. The hafnium atom is coordinated with eight oxygen atoms of four β-diketonate ligands, Hf-O distances varying from 2.153 Å to 2.191 Å. The molecules make van der Waals contacts in the structures. 相似文献
13.
A. A. Vakulka Ya. E. Filinchuk M. G. Mys’kiv 《Russian Journal of Coordination Chemistry》2007,33(11):809-814
Crystals of the π copper(I) cyanide complex with N,N′-diallyl thiocarbamide, 2CuCN · (C3H5NH)2CS (I), are synthesized from an aqueous-methanol solution of potassium nitroprusside, diallyl thiocarbamide on a copper electrode using the method of alternating-current electrochemical synthesis. The crystals are monoclinic: space group P21/n, a = 6.9440(5) Å, b = 13.760(1)) Å, c = 12.733(1) Å, β = 97.280(9)°, V = 1206.8(2) Å3, Z = 4, R = 0.0361, R w = 0.0362 for 2836 independent reflections with F ≥ 4σ(F). A unique polymeric structure is built due to the Cu(I)-(C=C) π bond and the bridging function of the thioamide S atom of the ligand molecule and one of the two independent cyano groups. 相似文献
14.
Y. G. Li X. W. Dong R. Ai X. L. Xu H. L. Zhu 《Russian Journal of Coordination Chemistry》2011,37(7):523-527
The crystal structures of cobalt(II) Schiff base complex (CoIIL2 · H2O) and Schiff base ligand 3,5-dichlorosalicylidene-2-chlorophenylmethylamine (HL) have been determined by single-crystal X-ray analysis. The geometry around cobalt in CoIIL2 · H2O is distorted tetrahedral. CoIIL2 · H2O crystallizes in the monoclinic system, in space group C2/c, with crystallographic parameters: a = 12.9143(16) Å, b = 8.8326(16) Å, c = 25.115(3) Å, β = 92.791(10)°, V = 2861.4(7) Å3, Z = 4, F(000) = 1420, and the final R indices (I > 2σ(I)) are R 1 = 0.0440, wR 2 = 0.1272. HL crystallizes in the monoclinic system, in space group P21/c, with crystallographic parameters: a = 11.9764(15), b = 8.2331(10), c = 14.2211(17) Å, β = 98.723(6)°, V = 1386.0(3) Å3, Z = 4, F(000) = 640, and the final R indices (I > 2σ(I)) are R 1 = 0.0397, wR 2 = 0.1018. 相似文献
15.
R. -P. Liu M. -Yu. Duan J. Li Z. -P. Su J. -H. Zhang F. -X. Zhang 《Journal of Structural Chemistry》2011,52(5):935-940
Two complexes [Zn(SALIMP)(CH3CO2)]2 (1) and [Cu(SALIMP)Cl] (2) are obtained by the reactions of zinc(II) and copper(II) salts with a tridentate Schiff base ligand 2-[[(2-pyridinylmethyl) imino]methyl]phenol (HSALIMP). Their structure is determined by single crystal X-ray diffraction. Data for complex 1: C30H28N4O6Zn2, CCDC number: 668213, M r = 671.3, monoclinic, C2/c, with a = 34.670(5) Å, b = 15.266(2) Å, c = 23.464(4) Å, β = 114.045(2)°, V = 11341(3) Å3, Z = 16, F(000) = 5504, GOOF(F 2) = 0.894, the final R = 0.0520 and wR = 0.1272 for 10515 observed reflections with I > 2σ(I); complex 2: C13H12N2OClCu, CCDC number: 668211, M r = 311.24, triclinic, P-1, with a = 7.4050(8) Å, b = 10.2369(11) Å, c = 16.2873(17) Å, α = 87.728(2)°, β = 87.818(2)°, γ = 78.279(2)°, V = 1207.4(2) Å3, Z = 4, F(000) = 632, GOOF(F 2) = 1.077, the final R = 0.0326 and wR = 0.0381 for 4209 observed reflections with I > 2σ(I). 相似文献
16.
P. A. Stabnikov G. I. Zharkova N. I. Alferova A. P. Zubareva E. A. Shusharina N. V. Pervukhina 《Journal of Structural Chemistry》2011,52(2):371-375
Single crystal X-ray diffraction is used to investigate two synthesized β-diketonate complexes of copper(II) with aminopyridine: Cu(4-NH2Py)(aa)2 (I) and Cu(4-NH2Py)(hfa)2 (II). The crystals of I and II have a monoclinic system; the unit cell parameters of I are: P21/n space group, a = 8.2921(3) Å, b = 14.7243(5) Å, c = 13.4970(4) Å, β = 102.426(1)°, V = 1609.32(9) Å3, Z = 4; for II: C2/c space group, a = 23.5704(5) Å, b = 11.4977(2) Å, c = 16.0285(3) Å, β = 109.265(1)°, V = 4100.6(1) Å3, Z = 8. The structures of I and II are molecular; they are composed of isolated molecules. The coordination polyhedron of the copper atom is formed by the O atoms of two acetylacetonate ligands (Cu-O 1.940(2)–2.171(2) I and the O atoms of two hexafluoroacetylacetonate ligands (Cu-O 1.940(2)–2.215(3) Å) in II. The molecules of 4-NH2Py are bonded to the copper atom via the nitrogen atom of the aromatic ring (Cu-N 2.008(2) Å in I and Cu-N 1.978(3) Å in II). Noncoordinated amino groups join the molecules of the complexes together by means of N-H…O hydrogen bonds. 相似文献
17.
V. F. Shul’gin O. V. Konnik R. I. Gurtovoi A. S. Bogomyakov V. Ya. Zub V. V. Minin 《Russian Journal of Inorganic Chemistry》2011,56(4):600-605
A trinuclear copper(II) complex of trimesic acid salicylidene hydrazone (H6L) having the composition [Cu3L · 4Py] · CH3OH was synthesized and characterized. By X-ray crystallography, the crystals are triclinic: a = 11.7940(4) Å, b = 13.7241(5) Å, c = 15.8993(6) Å, α = 107.4120(10)°, β = 94.2900(10)°, γ = 105.5650(10)°, space group \(P\bar 1\), Z = 2. The number of symmetrically unique reflections having I > 2σ(I) is 7636, R = 0.0465, and R w = 0.1198. The newly prepared complex contains, in its unit cell, two [Cu3L · 4Py] molecules which are linked to form a dimer on account of phenoxo bridges (the Cu-O bond length is 2.555 the Cu…Cu distance is 3.348 Separations between them are 9.414, 9.371, and 9.667 of temperature is satisfactorily fitted in terms of a triangular cluster model (?2J = 2.2 cm?1) with extra intermolecular interactions (zJ′ = 0.4 cm?1). EPR spectra of solutions at 360–380 K feature a poorly resolved HFS, whose modeling gives a satisfactory result with allowance for the interaction of unpaired electrons with three equivalent copper nuclei (g = 2.098; a Cu = 25.8 × 10?4 cm?1). 相似文献
18.
V. E. Bryndin A. I. Smolentsev P. A. Stabnikov I. K. Igumenov 《Journal of Structural Chemistry》2008,49(3):556-559
trans-Bis-(4-phenyliminopentan-2-onato)Cu(II) (5), which is a phenyl-substituted ketoimine, was synthesized, and an X-ray study was performed for this compound. Crystal data for CuN2O2C22H24: a = 11.4557(3) Å, b = 26.6845(9) Å, c = 14.2976(5) Å, β = 113.2270(10)°; space group P21/n, Z = 8, d calc = 1.363 g/cm3, R = 0.033. The structure is molecular and built of isolated trans complexes. The central copper atom is surrounded by four atoms (2O+2N) with the average distances Cu-O 1.904(3) Å and Cu-N 1.962(3) Å. The polyhedron around the copper atom is a distorted tetrahedron; the average values of the O-Cu-O and N-Cu-N trans bond angles are 147(2)° and 150(2)°, respectively. The average value of the O-Cu-N angles is 94(1)°. 相似文献
19.
V. F. Shul’gin A. I. Obukh E. B. Rusanov V. Ya. Zub V. V. Minin 《Russian Journal of Inorganic Chemistry》2009,54(8):1223-1229
The synthesis of copper(II) binuclear complexes with acyldihydrazones of saturated carboxylic acids and 4-formyl-5-hydroxy-3-methyl-1-phenylpyrazoles in which the coordination polyhedra are connected by polymethylene chains of different length (two to five units) is described. The complexes were studied by chemical and thermal analysis, IR spectroscopy, and EPR. The molecular and crystal structure of the copper(II) complex with glutaric acid and 1-(4′-chlorophenyl)-4-formyl-5-hydroxy-3-methylpyrazole acyldihydrazone (H4L) described as [Cu2L·2Py] · Py · 4H2O was determined by X-ray diffraction. The crystals are orthorhombic: a = 24.789(7) Å, b = 39.319(9) Å, c = 4.6336(14) Å, space group Pnma, Z = 4. The number of symmetrically unrelated reflections is 4716, R = 0.0606, R w = 0.1307. The central atoms are separated by a chain of eight σ bonds and are located at a distance of 8.939 Å. The copper coordination polyhedron is a square. A specific feature of the crystal structure is the stacking interaction involving chelate rings and the pyrazole ring, resulting in stacks of molecular complexes. The EPR spectrum of a solution of the complex based on the acyldihydrazone of succinic acid and 4-formyl-5-hydroxy-3-methyl-1-phenylpyrazole recorded at room temperature exhibits seven HFS lines with an intensity ratio of 1: 2: 3: 4: 3: 2: 1 and a constant of 33.3 G as a result of exchange coupling of the unpaired electrons to the two equivalent copper nuclei. An increase in the length of the polymethylene chain to 3–5 units or introduction of the para-chlorine atom into the benzene ring hampers the exchange interactions, and the EPR spectrum shows a signal of four HFS lines with a constant of 55–70 G typical of monomeric copper(II) complexes. 相似文献
20.
A. M. Magerramov G. V. Tsintsadze R. A. Alieva F. O. Mamedova F. S. Alieva F. N. Bakhmanova A. V. Kurbanov F. M. Chyragov 《Russian Journal of Coordination Chemistry》2016,42(5):351-354
The crystal structure of copper(II) complex with the HL ligand obtained from 3-[4-carboxyphenylazo] penta-2,4-dione and ethylenediamine (En) was determined by X-ray diffraction. The crystals are orthorhombic: a = 7.329(3), b = 15.393(5), c = 18.474(7) Å, V = 2084.1(12) Å3, space group P212121, Z = 4, ρ(calcd.) = 1.486 g/cm3, R = 0.0441. The copper atom is coordinated by four nitrogen atoms of two En ligands and by the chlorine atom in an axial position according to the extended square pyramid geometry (4 + 1) (CIF file CCDC no. 1436882). 相似文献