Metal Complexes of Dithiolate Ligands: 5,6-Dihydro-1,4-dithiin-2,3-dithiolato (dddt(2-)), 5,7-Dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2-)), and 2-Thioxo-1,3-dithiole-4,5-dithiolato (dmit(2-)). Synthesis, Electrochemical Studies, Crystal and Electronic Structures, and Conducting Properties

New precursors to potentially conductive noninteger oxidation state (NIOS) compounds based on metal complexes [ML(2)](n)()(-) [M = Ni, Pd, Pt; L = 5,6-dihydro-1,4-dithiin-2,3-dithiolato (dddt(2)(-)), 5,7-dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2)(-)), and 2-thioxo-1,3-dithiole-4,5-dithiolato (dmit(2)(-)); n = 2, 1, 0] have been investigated. Complexes of the series (NR(4))[ML(2)] (R = Me, Et, Bu; L = dddt(2)(-), dtdt(2)(-)) have been isolated and characterized, and the crystal structure of (NBu(4))[Pt(dtdt)(2)] (1) has been determined {1 = C(24)H(44)NPtS(10), a = 12.064(2) ?, b = 17.201(3) ?, c = 16.878(2) ?, beta = 102.22(2) degrees, V = 3423(1) ?(3), monoclinic, P2(1)/n, Z = 4}. Oxidation of these complexes affords the corresponding neutral species [ML(2)](0). Another series of general formula (cation)(n)()[M(dmit)(2)] [cation = PPN(+), BTP(+), and (SMe(y)()Et(3)(-)(y)())(+) with y = 0, 1, 2, and 3, n = 2, 1, M = Ni, Pd] has also been studied. All of these (cation)(n)()[M(dmit)(2)] complexes have been isolated and characterized [with the exception of (cation)[Pd(dmit)(2)] for cation = (SMe(y)()Et(3)(-)(y)())(+)]. The crystal structures of (PPN)[Ni(dmit)(2)].(CH(3))(2)CO (2) and (SMeEt(2))[Ni(dmit)(2)] (3) have been determined {2 = C(45)H(36)NNiS(10)P(2)O, a = 12.310(2) ?, b = 13.328(3) ?, c = 15.850(3) ?, alpha = 108.19(3) degrees, beta = 96.64(2) degrees, gamma = 99.67(2) degrees, V = 2373(1) ?(3), triclinic, P&onemacr;, Z = 2; 3 = C(11)H(13)NiS(11), a = 7.171(9) ?, b = 17.802(3) ?, c = 16.251(3) ?, beta = 94.39(4) degrees, V = 2068(2) ?(3), monoclinic, P2(1)/n, Z = 4} NIOS salts derived from the preceding precursors were obtained by electrochemical oxidation. Electrochemical studies of the [M(dddt)(2)] complexes show that they may be used for the preparation of NIOS radical cation salts and [M(dddt)(2)][M'(dmit)(2)](x)() compounds, but not for the preparation of (cation)[M(dddt)(2)](z)() NIOS radical anion salts. The electrochemical oxidation of the [M(dtdt)(2)](-) complexes always yields the neutral [M(dtdt)(2)](0) species. The crystal structure of [Pt(dddt)(2)][Ni(dmit)(2)](2) (4) has been determined and is consistent with the low compaction powder conductivity (5 x 10(-)(5) S cm(-)(1) at room temperature) {4 = C(20)H(8)Ni(2)PtS(28), a = 20.336(4) ?, b = 7.189(2) ?, c = 14.181(2) ?, beta = 97.16(2) degrees, V = 2057(1) ?(3), monoclinic, C2/m, Z = 2}. The crystal structures of the semiconducting NIOS compounds (BTP)[Ni(dmit)(2)](3) (5) and (SMe(3))[Ni(dmit)(2)](2) (6) have been determined {5 = C(43)H(22)PNi(3)S(30), a = 11.927(2) ?, b = 24.919(2) ?, c = 11.829(3) ?, alpha = 93.11(1) degrees, beta = 110.22(1) degrees, gamma = 83.94(1) degrees, V = 3284(1) ?(3), triclinic, P&onemacr;, Z = 2; 6 = C(15)H(9)Ni(2)S(21), a = 7.882(1) ?, b = 11.603(2) ?, c = 17.731(2) ?, alpha = 77.44(1) degrees, beta = 94.39(1) degrees, gamma = 81.27(1) degrees, V = 1563(1) ?(3), triclinic, P&onemacr;, Z = 2}. The parent compound (SEt(3))[Ni(dmit)(2)](z) (unknown stoichiometry) is also a semiconductor with a single-crystal conductivity at room temperature of 10 S cm(-)(1). By contrast, the single-crystal conductivity at room temperature of (SMeEt(2))[Pd(dmit)(2)](2) (7) is rather high (100 S cm(-)(1)). 7 behaves as a pseudometal down to 150 K and undergoes an irreversible metal-insulator transition below this temperature. The crystal structure of 7 has been determined {7 = C(17)H(13)NPd(2)S(21), a = 7.804(4) ?, b = 36.171(18) ?, c = 6.284(2) ?, alpha = 91.68(4) degrees, beta = 112.08(4) degrees, gamma = 88.79(5) degrees, V = 1643(1) ?(3), triclinic, P&onemacr;, Z = 2}. The electronic structure of (SMeEt(2))[Pd(dmit)(2)](2) (7) and the possible origin of the metal-insulator transition at 150 K are discussed on the basis of tight-binding band structure calculations.     

Synthesis and Characterization of Copper(II), Zinc(II), and Potassium Complexes of a Highly Fluorinated Bis(pyrazolyl)borate Ligand

Highly fluorinated, dihydridobis(3,5-bis(trifluoromethyl)pyrazolyl)borate ligand, [H(2)B(3,5-(CF(3))(2)Pz)(2)](-) has been synthesized and characterized as its potassium salt. The copper(II) and zinc(II) complexes, [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu and [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn, have been prepared by metathesis of [H(2)B(3,5-(CF(3))(2)Pz)(2)]K with Cu(OTf)(2) and Zn(OTf)(2), respectively. All the new metal adducts have been characterized by X-ray diffraction. The potassium salt is polymeric and shows several K.F interactions. The Cu center of [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu adopts a square planar geometry, whereas the Zn atom in [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn displays a tetrahedral coordination. Bis(pyrazolyl)borate ligands in the Zn adduct show a significantly distorted boat conformation. The nature and extent of this distortion is similar to that observed for the methylated analog, [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn. This ligand allows a comparison of electronic effects of bis(pyrazolyl)borate ligands with similar steric properties. Crystallographic data for [H(2)B(3,5-(CF(3))(2)Pz)(2)]K: triclinic, space group P&onemacr;, with a = 8.385(1) ?, b = 10.097(2) ?, c = 10.317(1) ?, alpha = 104.193(9) degrees, beta = 104.366(6) degrees, gamma = 91.733(9) degrees, V = 816.5(3) ?(3), and Z = 2. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Cu is monoclinic, space group C2/c with a = 25.632(3) ?, b = 9.197(1) ?, c = 17.342(2) ?, beta = 129.292(5) degrees, V = 3164.0(6) ?(3), and Z = 4. [H(2)B(3,5-(CF(3))(2)Pz)(2)](2)Zn is triclinic, space group P&onemacr;, with a = 9.104(1) ?, b = 9.278(1) ?, c = 18.700(2) ?, alpha = 83.560(6) degrees, beta = 88.200(10) degrees, gamma = 78.637(9) degrees, V = 1538.8(3) ?(3), and Z = 2. [H(2)B(3,5-(CH(3))(2)Pz)(2)](2)Zn is monoclinic, space group C2/c with a = 8.445(1) ?, b = 14.514(2) ?, c = 19.983(3) ?, beta = 90.831(8) degrees, V = 2449.1(6) ?(3), and Z = 4.     

Synthesis and Characterization of Six-Coordinate Nitrido Complexes of Vanadium(V), Chromium(V), and Manganese(V). Isolation of a Dinuclear, Mixed-Valent &mgr;-Nitrido Chromium(III)/Chromium(V) Species

Photolysis of a series of octahedral monoazido complexes of the type [LM(III)(didentate ligand)(N(3))](n)(+)X(n) of vanadium(III), chromium(III), and manganese(III) in the solid state or in solution yields quantitatively the corresponding six-coordinate nitrido complexes [LM(V)(didentate ligand)(N)](n)(+)X(n) and 1 equiv of dinitrogen. L represents the macrocycle 1,4,7-triazacyclononane or its N-methylated derivative (L'), the didentate ligands are pentane-2,4-dionate (acac), 2,2,6,6-tetramethylheptane-3,5-dionate (tacac), picolinate (pic), phenanthroline (phen), and oxalate (ox), and X(-) represents perchlorate or hexafluorophosphate. The following nitrido complexes were prepared: [LV(V)(N)(acac)](ClO(4)) (6), [LCr(V)(N)(acac)](ClO(4)) (13), [LCr(V)(N)(tacac)](ClO(4)) (14), [LCr(V)(N)(pic)](ClO(4)) (15), [LCr(V)(N)(phen)](ClO(4))(2) (16), [LCr(V)(N)(ox)] (19), [L'Mn(V)(N)(acac)]PF(6) (21). Photolysis of [LCr(III)(N(3))(ox)] (17) in the solid state produces the &mgr;-nitrido-bridged mixed-valent species [L(2)Cr(2)(ox)(2)(&mgr;-N)](N(3)) (18). The structures of the precursor complex [L'Mn(acac)(N(3))]BPh(4) (20), of 13, and of [L'Mn(V)(N)(acac)]BPh(4) (21) have been determined by X-ray crystallography. Complex 13 crystallizes in the orthorhombic space group Pnma, with cell constants a = 27.187(5) ?, b = 9.228(2) ?, c = 7.070(1) ?, V = 1773.7(6) ?(3), and Z = 4; complex 20 crystallizes in the triclinic space group P&onemacr; with a = 14.769(5) ?, b = 16.83(1) ?, c = 16.96(1) ?, alpha = 108.19(5) degrees, beta = 105.06(4) degrees, gamma = 99.78(4) degrees, V = 3719(2) ?(3), and Z = 4; and complex 21 crystallizes in the monoclinic space group P2(1)/n with a = 10.443(3) ?, b = 16.035(4) ?, c = 21.463(5) ?, beta = 95.76(1) degrees, V = 3575.9(14) ?(3), and Z = 4. The Cr(V)&tbd1;N and Mn(V)&tbd1;N distances are short at 1.575(9) and 1.518(4) ?, respectively, and indicate a metal-to-nitrogen triple bond.     

Utility of Arylamido Ligands in Yttrium and Lanthanide Chemistry(1)

The reactivity of KNHAr reagents (Ar = C(6)H(5), C(6)H(3)Me(2)-2,6, C(6)H(3)(i)Pr(2)-2,6) with lanthanide and yttrium trichlorides has been investigated. With the larger metals Nd and Sm and the smaller 2,6-dimethyl-substituted ligand, the bimetallic dianionic complexes [K(THF)(6)](2)[Ln(&mgr;-NHC(6)H(3)Me(2)-2,6)(NHC(6)H(3)Me(2)-2,6)(3)](2) (Ln: Sm, 1a; Nd, 1b) are isolated as the potassium salts. Under the same reaction conditions YCl(3) forms a bimetallic anion which retains chloride: [K(DME)(2)(THF)(3)][Y(2)(&mgr;-NHC(6)H(3)Me(2)-2,6)(2)(&mgr;-Cl)(NHC(6)H(3)Me(2)-2,6)(4)(THF)(2)], 2. With the larger 2,6-diisopropyl ligands, neutral complexes are isolated in both solvated monometallic and unsolvated bimetallic forms. With Nd, a distorted octahedral trisolvate, Nd(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(3), 3, was obtained, whereas with Yb and Y the trigonal bipyramidal disolvates, Ln(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(2) (Ln: Yb, 4a; Y, 4b), were isolated. THF-free complexes of the NHC(6)H(3)(i)Pr(2)-2,6 ligand are available by reacting the amine NH(2)C(6)H(3)(i)Pr(2)-2,6 with Ln[N(SiMe(3))(2)](3) complexes. By this route, the dimers [Ln(&mgr;-NHC(6)H(3)(i)Pr(2)-2,6)(NHC(6)H(3)(i)Pr(2)-2,6)(2)](2) (Ln: Yb, 5a; Y, 5b) were isolated. The reaction of the unsubstituted arylamido salt KNHC(6)H(5) with NdCl(3) produced an insoluble material which was characterized as [Nd(NHC(6)H(5))(3)(KCl)(3)], 6. 6 reacted with Al(2)Me(6) in hexanes and produced a heteroleptic mixed-metal complex {[Me(2)Al(&mgr;-Me(2))](2)Nd(&mgr;(3)-NC(6)H(5))(&mgr;-Me)AlMe}(2), 7, and the trimeric aluminum arylamido complex [Me(2)Al(&mgr;-NHC(6)H(5))](3), 8. The solvent of crystallization and relevant crystallographic data for the compounds identified by X-ray analysis follow: 1a,THF, 156 K, P2(1)/n, a = 12.985(2) ?, b = 27.122(5) ?, c = 17.935(3) ?, beta = 100.19(1) degrees, V = 6216(1) ?(3), Z = 2, 6148 reflections (I > 3sigma(I)), R(F)() = 7.1%; 1b,THF, 156 K, P2(1)/n, a = 12.998(2) ?, b = 27.058(3) ?, c = 17.962(2) ?, beta = 99.74(1) degrees, V = 6225(1) ?(3), Z = 2; 2,DME/hexanes, P2(1)/n, a = 23.335(2) ?, b = 12.649(1) ?, c = 27.175(3) ?, beta = 96.36(1) degrees, V = 7971(1) ?(3), Z = 4, 2788 reflections (I > 3sigma(I)), R(F)() = 9.5%; 3, THF, P2(1), a = 12.898(1) ?, b = 16.945(1) ?, c = 13.290(1) ?, beta = 118.64(2) degrees, V = 2549.3(3) ?(3), Z = 2, 3414 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4a, hexanes, P2(1), a = 9.718(2) ?, b = 19.119(3) ?, c = 12.640(2) ?, beta = 112.08(1) degrees, V = 2176.3(6) ?(3), Z = 2, 2933 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4b, hexanes, 158 K, a = 9.729(2) ?, b = 19.095(5) ?, c = 12.744(1) ?, beta = 112.11(1) degrees, V = 2193.4(6) ?(3); 5b, hot toluene, 158 K, P2(1), a =19.218(9) ?, b = 9.375(3) ?, c = 19.820(5) ?, beta = 110.25(2) degrees, V = 3350(2)?(3), Z = 2, 1718 reflections (I > 2sigma (I)), R1 = 9.7%; 7, hexanes, 156 K, P&onemacr;, a = 9.618(3) ?, b = 12.738(4) ?, c = 9.608(3) ?, alpha = 99.32(1) degrees, beta = 108.87(1) degrees, gamma = 94.23(1) degrees, V = 1089.1(6) ?(3), Z = 2, 2976 reflections (I > 3sigma(I)), R(F)() = 3.9%; 8, hexanes, 156 K, Pcab, a = 23.510(5) ?, b = 25.462(5) ?, c = 8.668(2) ?, V = 5188(1) ?(3), Z = 8, 1386 reflections (I > 3sigma(I)), R(F)() = 5.7%.     

X-ray Crystallographic Study of the Ruthenium Blue Complexes [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2): Steric Interactions and the Ru-Ru "Bond Length"

X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions.     

Synthesis and structure of QD-6: a novel aluminoborate constructed from unprecedented [B@Al6O24] and polyborate clusters

A novel aluminoborate (NH(4))(6)[C(5)NH(12)](6)[Al(12)B(65)O(105)(OH)(33)]·(H(2)O)(15) (QD-6), has been synthesized under mild hydrothermal conditions and characterized by IR, elemental analysis, TGA, powder and single-crystal X-ray diffractions. This compound crystallizes in the rhombohedral space group R3 (No. 148) with the lattice constants a = 23.7421(2) ?, c = 24.7699(3) ?, V = 12091.9(2) ?(3), and Z = 3. QD-6 consists of two unprecedented aluminoborate clusters, [Al(6)B(34)O(54)(OH)(18)](6-) and [Al(6)B(31)O(51)(OH)(15)](6-), which are built from the same hexagon-like [B@Al(6)O(24)] clusters and [B(11)O(17)(OH)(6)] or [B(10)O(16)(OH)(5)] polyborates.     

An Approach to Heterometallic Complexes with Selenolate and Tellurolate Ligands: Crystal Structures of cis-[Mn(CO)(4)(SePh)(2)](-), [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-), (CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3), and (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3)

Oxidative addition of diorganyl diselenides to the coordinatively unsaturated, low-valent transition-metal-carbonyl fragment [Mn(CO)(5)](-) produced cis-[Mn(CO)(4)(SeR)(2)](-). The complex cis-[PPN][Mn(CO)(4)(SePh)(2)] crystallized in triclinic space group P&onemacr; with a = 10.892(8) ?, b = 10.992(7) ?, c = 27.021(4) ?, alpha = 101.93(4) degrees, beta = 89.79(5) degrees, gamma = 116.94(5) degrees, V = 2807(3) ?(3), and Z = 2; final R = 0.085 and R(w) = 0.094. Thermolytic transformation of cis-[Mn(CO)(4)(SeMe)(2)](-) to [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-) was accomplished in high yield in THF at room temperature. Crystal data for [Na-18-crown-6-ether][(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)]: trigonal space group R&thremacr;, a = 13.533(3) ?, c = 32.292(8) ?, V = 5122(2) ?(3), Z = 6, R = 0.042, R(w) = 0.041. Oxidation of Co(2+) to Co(3+) by diphenyl diselenide in the presence of chelating metallo ligands cis-[Mn(CO)(4)(SePh)(2)](-) and cis-[Mn(CO)(4)(TePh)(2)](-), followed by a bezenselenolate ligand rearranging to bridge two metals and a labile carbonyl shift from Mn to Co, led directly to [(CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3)]. Crystal data: triclinic space group P&onemacr;, a = 11.712(3) ?, b = 12.197(3) ?, c = 15.754(3) ?, alpha = 83.56(2) degrees, beta = 76.13(2) degrees, gamma = 72.69(2) degrees, V = 2083.8(7) ?(3), Z = 2, R = 0.040, R(w) = 0.040. Addition of fac-[Fe(CO)(3)(SePh)(3)](-) to fac-[Mn(CO)(3)(CH(3)CN)(3)](+) resulted in formation of (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3). This neutral heterometallic complex crystallized in monoclinic space group P2(1)/n with a = 8.707(2) ?, b = 17.413(4) ?, c = 17.541(4) ?, beta = 99.72(2) degrees, V = 2621(1) ?(3), and Z = 4; final R = 0.033 and R(w) = 0.030.     

Syntheses of Cationic, Six-Coordinate Cadmium(II) Complexes Containing Tris(pyrazolyl)methane Ligands. Influence of Charge on Cadmium-113 NMR Chemical Shifts

Treating a thf (thf = tetrahydrofuran) suspension of Cd(acac)(2) (acac = acetylacetonate) with 2 equiv of HBF(4).Et(2)O results in the immediate formation of [Cd(2)(thf)(5)](BF(4))(4) (1). Crystallization of this complex from thf/CH(2)Cl(2) yields [Cd(thf)(4)](BF(4))(2) (2), a complex characterized in the solid state by X-ray crystallography. Crystal data: monoclinic, P2(1)/n, a = 7.784(2) ?, b = 10.408(2) ?, c = 14.632(7) ?, beta = 94.64(3) degrees, V = 1181.5(6) ?(3), Z = 2, R = 0.0484. The geometry about the cadmium is octahedral with a square planar arrangement of the thf ligands and a fluorine from each (BF(4))(-) occupying the remaining two octahedral sites. Reactions of [Cd(2)(thf)(5)](BF(4))(4) with either HC(3,5-Me(2)pz)(3) or HC(3-Phpz)(3) yield the dicationic, homoleptic compounds {[HC(3,5-Me(2)pz)(3)](2)Cd}(BF(4))(2) (3) and {[HC(3-Phpz)(3)](2)Cd}(BF(4))(2) (4) (pz = 1-pyrazolyl). The solid state structure of 3 has been determined by X-ray crystallography. Crystal data: rhombohedral, R&thremacr;, a = 12.236(8) ?, c = 22.69(3) ?, V = 2924(4) ?(3), Z = 3, R = 0.0548. The cadmium is bonded to the six nitrogen donor atoms in a trigonally distorted octahedral arrangement. Four monocationic, mixed ligand tris(pyrazolyl)methane-tris(pyrazolyl)borate complexes {[HC(3,5-Me(2)pz)(3)][HB(3,5-Me(2)pz)(3)]Cd}(BF(4)) (5), {[HC(3,5-Me(2)pz)(3)][HB(3-Phpz)(3)]Cd}(BF(4)) (6), {[HC(3-Phpz)(3)][HB(3,5-Me(2)pz)(3)]Cd}(BF(4)) (7), and {[HC(3-Phpz)(3)][HB(3-Phpz)(3)]Cd}(BF(4)) (8) are prepared by appropriate conproportionation reactions of 3or 4 with equimolar amounts of the appropriate homoleptic neutral tris(pyrazolyl)borate complexes [HB(3,5-Me(2)pz)(3)](2)Cd or [HB(3-Phpz)(3)](2)Cd. Solution (113)Cd NMR studies on complexes 3-8 demonstrate that the chemical shifts of the new cationic, tris(pyrazolyl)methane complexes are very similar to the neutral tris(pyrazolyl)borate complexes that contain similar substitution of the pyrazolyl rings.     

Synthesis, Structure, and Reactivity of [Zr(6)Cl(18)H(5)](2)(-), the First Paramagnetic Species of Its Class

Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4.     

Synthesis, Structure, and Reactivities of [eta(2)-P(7)M(CO)(4)](3)(-), [eta(2)-HP(7)M(CO)(4)](2)(-), and [eta(2)-RP(7)M(CO)(4)](2)(-) Zintl Ion Complexes Where M = Mo, W

Ethylenediamine (en) solutions of [eta(4)-P(7)M(CO)(3)](3)(-) ions [M = W (1a), Mo (1b)] react under one atmosphere of CO to form microcrystalline yellow powders of [eta(2)-P(7)M(CO)(4)](3)(-) complexes [M = W (4a), Mo (4b)]. Compounds 4 are unstable, losing CO to re-form 1, but are highly nucleophilic and basic. They are protonated with methanol in en solvent giving [eta(2)-HP(7)M(CO)(4)](2)(-) ions (5) and are alkylated with R(4)N(+) salts in en solutions to give [eta(2)-RP(7)M(CO)(4)](2)(-) complexes (6) in good yields (R = alkyl). Compounds 5 and 6 can also be prepared by carbonylations of the [eta(4)-HP(7)M(CO)(3)](2)(-) (3) and [eta(4)-RP(7)M(CO)(3)](2)(-) (2) precursors, respectively. The carbonylations of 1-3 to form 4-6 require a change from eta(4)- to eta(2)-coordination of the P(7) cages in order to maintain 18-electron configurations at the metal centers. Comparative protonation/deprotonation studies show 4 to be more basic than 1. The compounds were characterized by IR and (1)H, (13)C, and (31)P NMR spectroscopic studies and microanalysis where appropriate. The [K(2,2,2-crypt)](+) salts of 5 were characterized by single crystal X-ray diffraction. For 5, the M-P bonds are very long (2.71(1) ?, average). The P(7)(3)(-) cages of 5 are not displaced by dppe. The P(7) cages in 4-6 have nortricyclane-like structures in contrast to the norbornadiene-type geometries observed for 1-3. (31)P NMR spectroscopic studies for 5-6 show C(1) symmetry in solution (seven inequivalent phosphorus nuclei), consistent with the structural studies for 5, and C(s)() symmetry for 4 (five phosphorus nuclei in a 2:2:1:1:1 ratio). Crystallographic data for [K(2,2,2-crypt)](2)[eta(2)-HP(7)W(CO)(4)].en: monoclinic, space group C2/c, a = 23.067(20) ?, b = 12.6931(13) ?, c = 21.433(2) ?, beta = 90.758(7) degrees, V = 6274.9(10) ?(3), Z = 4, R(F) = 0.0573, R(w)(F(2)) = 0.1409. For [K(2,2,2-crypt)](2)[eta(2)-HP(7)Mo(CO)(4)].en: monoclinic, space group C2/c, a = 22.848(2) ?, b = 12.528(2) ?, c = 21.460(2) ?, beta = 91.412(12) degrees, V = 6140.9(12) ?(3), Z = 4, R(F) = 0.0681, R(w)(F(2)) = 0.1399.     

Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

Metal-centered deltahedral Zintl ions: synthesis of [Ni@Sn9]4- by direct extraction from intermetallic precursors and of the vertex-fused dimer [{Ni@Sn8(μ-Ge)(1/2)}2]4-

Ni-centered deltahedral Sn(9) clusters with a charge of 4-, i.e., [Ni@Sn(9)](4-), were extracted in ethylenediamine in high yield directly from intermetallic precursors with the nominal composition "K(4)Sn(9)Ni(3)". The new endohedral clusters were crystallized and structurally characterized in K[K(18-crown-6)](3)[Ni@Sn(9)]·3benzene (1a, triclinic, P1?, a = 10.2754(5) ?, b = 19.5442(9) ?, and c = 20.5576(13) ?, α = 73.927(3)°, β = 79.838(4)°, and γ = 84.389(3)°, V = 3899.6(4) ?(3), Z = 2) and K[K(2,2,2-crypt)](3)[Ni@Sn(9)] (1b, triclinic, P1, a = 15.8028(8) ?, b = 16.21350(9) ?, and c = 20.1760(12) ?, α = 98.71040(10)°, β = 104.4690(10)°, and γ = 118.3890(10)°, V = 4181.5(4) ?(3), Z = 2). The alternative method of a post-synthetic insertion of a Ni atom in empty Sn(9) clusters by a reaction with Ni(cod)(2) predominantly produces the more-oxidized clusters with a charge of 3-, i.e., the recently reported [Ni@Sn(9)](3-). Nonetheless, using substoichiometric amounts of 18-crown-6 as a cation sequestering agent, we also have been able to isolate the 4- clusters as a minor phase from such reactions. They were structurally characterized in K[K(en)][K(18-crown-6)](2)[Ni@Sn(9)]·0.5en (2, monoclinic, P2(1)/n, a = 10.4153(5) ?, b = 25.6788(11) ?, and c = 20.6630(9) ?, β = 102.530(2)°, V = 5394.7(4) ?(3), Z = 2). The ability of the Ni-centered clusters to exist with both 3- and 4- charges parallels the same ability of the empty clusters and is very promising for similarly rich chemistry involving electron transfer and flexible "oxidation states". We also report the synthesis and characterization of the endohedral heteroatomic dimer [{Ni@Sn(8)(μ-Ge)(1/2)}(2)](4-) composed of two [Ni@(Sn(8)Ge)]-clusters fused at the Ge-vertex. The dimer was synthesized by reacting an ethylenediamine solution of a ternary precursor with the nominal composition "K(4)Ge(4.5)Sn(4.5)", which is known to produce heteroatomic Ge(9-x)Sn(x) clusters, with Ni(cod)(2). It is isostructural with the reported [{Ni@Sn(8)(μ-Sn)(1/2)}(2)](4-) and is structurally characterized in [K-(2,2,2-crypt)](4)[{Ni@Sn(8)(μ-Ge)(1/2)}(2)]·2en (3, monoclinic, C2/c, a = 30.636(2) ?, b = 16.5548(12) ?, and c = 28.872(2) ?, β = 121.2140(10)°, V = 12523.5(15) ?(3), Z = 4).     

Synthesis, Structure, and Reactivity of Model Complexes of Copper Nitrite Reductase

The copper(I) and copper(II) complexes with the nitrogen donor ligands bis[(1-methylbenzimidazol-2-yl)methyl]amine (1-BB), bis[2-(1-methylbenzimidazol-2-yl)ethyl]amine (2-BB), N-acetyl-2-BB (AcBB), and tris[2-(1-methylbenzimidazol-2-yl)ethyl]nitromethane (TB) have been studied as models for copper nitrite reductase. The copper(II) complexes form adducts with nitrite and azide that have been isolated and characterized. The Cu(II)-(1-BB) and Cu(II)-AcBB complexes are basically four-coordinated with weak axial interaction by solvent or counterion molecules, whereas the Cu(II)-(2-BB) and Cu(II)-TB complexes prefer to assume five-coordinate structures. A series of solid state structures of Cu(II)-(1-BB) and -(2-BB) complexes have been determined. [Cu(1-BB)(DMSO-O)(2)](ClO(4))(2): triclinic, P&onemacr; (No. 2), a = 9.400(1) ?, b = 10.494(2) ?, c = 16.760(2) ?, alpha = 96.67(1) degrees, beta = 97.10(1) degrees, gamma = 108.45(1) degrees, V = 1534.8(5) ?(3), Z = 2, number of unique data [I >/= 3sigma(I)] = 4438, number of refined parameters = 388, R = 0.058. [Cu(1-BB)(DMSO-O)(2)](BF(4))(2): triclinic, P&onemacr; (No. 2), a = 9.304(5) ?, b = 10.428(4) ?, c = 16.834(8) ?, alpha = 96.85(3) degrees, beta = 97.25(3) degrees, gamma = 108.21(2) degrees, V = 1517(1) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3388, number of refined parameters = 397, R = 0.075. [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 7.533(2) ?, b = 8.936(1) ?, c = 19.168(2) ?, alpha = 97.66(1) degrees, beta = 98.62(1) degrees, gamma = 101.06(1) degrees, V = 1234.4(7) ?(3), Z = 2, number of unique data [I >/= 2sigma(I)] = 3426, number of refined parameters = 325, R = 0.081. [Cu(2-BB)(MeOH)(ClO(4))](ClO(4)): triclinic, P&onemacr; (No. 2), a = 8.493(3) ?, b = 10.846(7) ?, c = 14.484(5) ?, alpha = 93.71(4) degrees, beta = 103.13(3) degrees, gamma = 100.61(4) degrees, V = 1270(1) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2612, number of refined parameters = 352, R = 0.073. [Cu(2-BB)(N(3))](ClO(4)): monoclinic, P2(1)/n (No. 14), a = 12.024(3) ?, b = 12.588(5) ?, c = 15.408(2) ?, beta = 101,90(2) degrees, V = 2282(1) ?(3), Z = 4, number of unique data [I >/= 2sigma(I)] = 2620, number of refined parameters = 311, R = 0.075. [Cu(2-BB)(NO(2))](ClO(4))(MeCN): triclinic, P&onemacr; (No. 2), a = 7.402(2) ?, b = 12.500(1) ?, c = 14.660(2) ?, alpha = 68.14(1) degrees, beta = 88.02(2) degrees, gamma = 78.61(1) degrees, V = 1233.0(4) ?(3), Z = 2, number of unique data [I>/= 2sigma(I)] = 2088, number of refined parameters = 319, R = 0.070. In all the complexes the 1-BB or 2-BB ligands coordinate the Cu(II) cations through their three donor atoms. The complexes with 2-BB appear to be more flexible than those with 1-BB. The nitrito ligand is bidentate in [Cu(2-BB)(NO(2))](ClO(4))(MeCN) and essentially monodentate in [Cu(1-BB)(DMSO-O)(NO(2))](ClO(4)). The copper(I) complexes exhibit nitrite reductase activity and react rapidly with NO(2)(-) in the presence of stoichiometric amounts of acid to give NO and the corresponding copper(II) complexes. Under the same conditions the reactions between the copper(I) complexes and NO(+) yield the same amount of NO, indicating that protonation and dehydration of bound nitrite are faster than its reduction. The NO evolved from the solution was detected and quantitated as the [Fe(EDTA)(NO)] complex. The order of reactivity of the Cu(I) complexes in the nitrite reduction process is [Cu(2-BB)](+) > [Cu(1-BB)](+) > [Cu(TB)](+) > [Cu(AcBB)](+).     

Linear Trinuclear Pt.Mo-Mo Complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CR)(2)](2) (X = Cl, Br, I; R = CH(3), C(CH(3))(3); pyphos = 6-(Diphenylphosphino)-2-pyridonate) with an Axial Interaction between the Quadruply Bonded Mo(2) Moiety and the Platinum Atom

An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters.     

Imido Complexes Derived from the Reactions of Niobium and Tantalum Pentachlorides with Primary Amines: Relevance to the Chemical Vapor Deposition of Metal Nitride Films

Reactions of niobium and tantalum pentachlorides with tert-butylamine (>/=6 equiv) in benzene afford the dimeric imido complexes [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (90%) and [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (79%). The niobium complex exists as two isomers in solution, while the tantalum complex is composed of three major isomers and at least two minor isomers. Analogous treatments with isopropylamine (>/=7 equiv) give the monomeric complexes NbCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%) and TaCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%). The monomeric complexes are unaffected by treatment with excess isopropylamine, while the dimeric complexes are cleaved to the monomers MCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)(2) upon addition of excess tert-butylamine in chloroform solution. Treatment of niobium and tantalum pentachlorides with 2,6-diisopropylaniline affords insoluble precipitates of [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%) and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%), which react with 4-tert-butylpyridine to afford the soluble complexes [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (45%) and [4-t-C(4)H(9)C(5)H(4)NH](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (44%). Sublimation of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), MCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2), and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[MCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] leads to decomposition to give [MCl(3)(NR)(NH(2)R)](2) as sublimates (32-49%), leaving complexes of the proposed formulation MCl(NR)(2) as nonvolatile residues. By contrast, [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) sublimes without chemical reaction. Analysis of the organic products obtained from thermal decomposition of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) showed isobutylene and tert-butylamine in a 2.2:1 ratio. Mass spectra of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), and [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) showed the presence of dimeric imido complexes, monomeric imido complexes, and nitrido complexes, implying that such species are important gas phase species in CVD processes utilizing these molecular precursors. The crystal structures of [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))], [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2), [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2), and [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) were determined. [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] crystallizes in the space group P2(1)/c with a = 12.448(3) ?, b = 10.363(3) ?, c = 28.228(3) ?, beta = 94.92(1) degrees, V = 3628(5) ?(3), and Z = 4. [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) crystallizes in the space group P2(1)/c with a = 9.586(4) ?, b = 12.385(4) ?, c = 11.695(4) ?, beta = 112.89(2) degrees, V = 1279.0(6) ?(3), and Z = 2. [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.285(3) ?, b = 11.208(3) ?, c = 23.867(6) ?, beta = 97.53 degrees, V = 2727(1) ?(3), and Z = 2. [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.273(1) ?, b = 11.241(2) ?, c = 23.929(7) ?, beta = 97.69(2) degrees, V = 2695(2) ?(3), and Z = 2. These findings are discussed in the context of niobium and tantalum nitride film depositions from molecular precursors.     

Isolation of a Bismuth Chloride-Iron Carbonyl Adduct: Synthesis and Structural Characterization of [PhCH(2)NMe(3)](2)[Bi(2)Cl(4)(&mgr;-Cl)(2){&mgr;-Fe(CO)(4)}

The reaction of bismuth(III) chloride with [PhCH(2)NMe(3)](2)[Fe(CO)(4)] at a ratio of 2:1 in acetonitrile yields the iron carbonyl-bismuth chloride adduct [PhCH(2)NMe(3)](2)[Bi(2)Cl(4)(&mgr;-Cl)(2){&mgr;-Fe(CO)(4)}] cleanly in high yield. The complex consists of two BiCl(3) groups bridged by an [Fe(CO)(4)](2)(-) unit. Two chloride ligands are shared between the Bi atoms, producing square-pyramidal coordination at bismuth and octahedral coordination at the iron center. The production of this complex represents the synthesis of a stable adduct of a highly nucleophilic metal carbonyl anion with a strongly Lewis acidic main group halide. The compound C(24)H(32)N(2)O(4)Bi(2)Cl(6)Fe crystallizes in the orthorhombic space group Pba2 (No. 32) with cell parameters a = 14.624(3) ?, b = 17.010(3) ?, c = 7.1990(10) ?, V = 1790.8(5) ?(3), and Z = 2.     

Heteroleptic Lanthanide Complexes with Aryloxide Ligands. Synthesis and Structural Characterization of Divalent and Trivalent Samarium Aryloxide/Halide and Aryloxide/Cyclopentadienide Complexes

Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557.     

Magnetic Susceptibility Trends in Oxo-Bridged, Dinuclear Chromium(III) Complexes. Crystal Structure of [(tmpa)Cr(&mgr;-O)(&mgr;-CO(3))Cr(tmpa)](ClO(4))(2).2H(2)O

The synthesis and physical characterization of oxo-bridged [Cr(2)(tmpa)(2)(&mgr;-O)(X)](n)()(+) complexes (tmpa = tris(2-pyridylmethyl)amine) containing a variety of complementary ligands (X = CO(3)(2)(-), PhPO(4)(2)(-), HS(-)) are described, with the objective of understanding factors underlying variations in the antiferromagnetic coupling constant J. We also present the crystal structure of [(tmpa)Cr(&mgr;-O)(&mgr;-CO(3))Cr(tmpa)](ClO(4))(2).2H(2)O, for comparison with previous findings on [(tmpa)Cr(&mgr;-O)(&mgr;-CH(3)CO(2))Cr(tmpa)](ClO(4))(3). The carbonate-bridged complex crystallizes in the monoclinic space group P2(1)/c with a = 11.286(10) ?, b = 18.12(2) ?, c = 20.592(12) ?, beta = 95.99(5) degrees, and V = 4190 ?(3) and Z = 4. Asymmetric tmpa ligation pertains, with apical N atoms situated trans to bridging oxo and acido O atoms. Key structural parameters include Cr-O(b) bond lengths of 1.818(6) and 1.838(6) ?, Cr-OCO(2) distances of 1.924(7) and 1.934(7) ?, and a bridging bond angle of 128.3(3) degrees. Several attempts to prepare oxo, amido-bridged dimers were unsuccessful, but the nearlinear [Cr(tmpa)(N(CN)(2))](2)O(ClO(4))(2).3H(2)O complex was isolated from the reaction of dicyanamide ion with [Cr(tmpa)(OH)](2)(4+). In contrast to the behavior of analogous diiron(III) complexes, antiferromagnetic coupling constants of [Cr(2)(tmpa)(2)(&mgr;-O)(X)](n)()(+) dinuclear species are highly responsive to the X group. Considering the complexes with X = CO(3)(2)(-), PhPO(4)(2)(-), HS(-), SO(4)(2)(-), and RCO(2)(-) (10 R substituents), we find a reasonably linear, empirical relationship between J and oxo bridge basicity, as measured by pK(a) (Cr(OH)Cr) values in aqueous solution. While there is no theoretical basis for such a correlation between solid-state and solution-phase properties, this relationship demonstrates that CrOCr pi-bonding contributes significantly to antiferromagnetic exchange. Thus, J tends to become less negative with increasing &mgr;-O(2)(-) basicity, showing that greater availability of a bridging oxo group lone pair toward the proton, with decreasing CrOCr pi-interaction, reduces the singlet-triplet gap.     

Chiral, Three-Dimensional Supramolecular Compounds: Homo- and Bimetallic Oxalate- and 1,2-Dithiooxalate-Bridged Networks. A Structural and Photophysical Study

In analogy to the [M(II)(bpy)(3)](2+) cations, where M(II) is a divalent transition-metal and bpy is 2,2'-bipyridine, the tris-chelated [M(III)(bpy)(3)](3+) cations, where M(III) is Cr(III) or Co(III), induce the crystallization of chiral, anionic three-dimensional (3D) coordination polymers of oxalate-bridged (&mgr;-ox) metal complexes with stoichiometries [M(II)(2)(ox)(3)](n)()(2)(n)()(-) or [M(I)M(III)(ox)(3)](n)()(2)(n)()(-). The tripositive charge is partially compensated by inclusion of additional complex anions like ClO(4)(-), BF(4)(-), or PF(6)(-) which are encapsulated in cubic shaped cavities formed by the bipyridine ligands of the cations. Thus, an elaborate structure of cationic and anionic species within a polymeric anionic network is realized. The compounds isolated and structurally characterized include [Cr(III)(bpy)(3)][ClO(4)] [NaCr(III)(ox)(3)] (1), [Cr(III)(bpy)(3)][ClO(4)][Mn(II)(2)(ox)(3)] (2), [Cr(III)(bpy)(3)][BF(4)] [Mn(II)(2)(ox)(3)] (3), [Co(III)(bpy)(3)][PF(6)][NaCr(III)(ox)(3)] (4). Crystal data: 1, cubic, P2(1)3, a = 15.523(4) ?, Z = 4; 2, cubic, P4(1)32, a = 15.564(3) ?, Z = 4; 3, cubic, P4(1)32, a = 15.553(3) ?, Z = 4; 4, cubic, P2(1)3, a = 15.515(3) ?, Z = 4. Furthermore, it seemed likely that 1,2-dithiooxalate (dto) could act as an alternative to the oxalate bridging ligand, and as a result the compound [Ni(II)(phen)(3)][NaCo(III)(dto)(3)].C(3)H(6)O (5) has successfully been isolated and structurally characterized. Crystal data: 5, orthorhombic, P2(1)2(1)2(1), a = 16.238(4) ?, b = 16.225(4) ?, c = 18.371(5) ?, Z = 4. In addition, the photophysical properties of compound 1 have been investigated in detail. In single crystal absorption spectra of [Cr(III)(bpy)(3)][ClO(4)][NaCr(III)(ox)(3)] (1), the spin-flip transitions of both the [Cr(bpy)(3)](3+) and the [Cr(ox)(3)](3)(-) chromophores are observed and can be clearly distinguished. Irradiating into the spin-allowed (4)A(2) --> (4)T(2) absorption band of [Cr(ox)(3)](3)(-) results in intense luminescence from the (2)E state of [Cr(bpy)(3)](3+) as a result of rapid energy transfer processes.     

Iron-Semiquinone, Semiquinone-Semiquinone, and Iron-Iron Magnetic Exchange in Monomeric and Dimeric Ferric Complexes Containing the 3,6-Di-tert-butyl-1,2-semiquinonate Ligand

Fe(3,6-DBSQ)(3) has been prepared by reacting 3,6-di-tert-butyl-1,2-benzoquinone with Fe(CO)(5). The complex has been characterized structurally [orthorhombic, Pbca, a = 18.277(5) ?, b = 11.634(3) ?, c = 39.903(10) ?, V = 8485(4) ?(3), Z = 8, R = 0.063], electrochemically, and magnetically. Ligand-based redox couples are observed in electrochemical experiments that consist of reversible or quasireversible Cat/SQ steps at negative potentials and irreversible SQ/BQ oxidations at positive potentials. Magnetic measurements show temperature dependence that arises from antiferromagnetic exchange. Data have been fit to an expression that includes the effects of both Fe-SQ and SQ-SQ exchange with the result that J(SQ-SQ) is larger in magnitude than J(Fe-SQ). In methanol, the complex undergoes solvolysis to form [Fe(3,6-DBSQ)(2)(&mgr;-OMe)](2). Structural characterization [triclinic, P&onemacr;, a = 11.441(2) ?, b = 11.514(2) ?, c = 14.552(2) ?, alpha = 67.86(1) degrees, beta = 70.51(1) degrees, gamma = 72.79(1) degrees, V = 1641.8(5) ?(3), Z = 1, R = 0.048] has shown that the molecule is a centrosymmetric dimer with no close intermolecular contacts. The temperature dependence of magnetic measurements has been fit to a model consisting of two interacting S = (3)/(2) centers that arise from strong Fe-SQ exchange with J(Fe-Fe) = -22.4 cm(-1).