A Ferromagnetic Interaction between Cu(2+) Centers through a [CrO(4)](2-) Bridge: Crystal Structures and Magnetic Properties of [{Cu(acpa)}(2)(&mgr;-MO(4))] (M = Cr, Mo) (Hacpa = N-(1-Acetyl-2-propyridene)(2-pyridylmethyl)amine)

The reaction of [Cu(acpa)](+) with [MO(4)](2)(-) (Hacpa = N-(1-acetyl-2-propyridene)(2-pyridylmethyl)amine and M = Cr and Mo) in water-methanol or water-acetonitrile solution affords dinuclear copper(II) complexes with metalate bridges, [{Cu(acpa)}(2)(&mgr;-CrO(4))].4CH(3)OH.4H(2)O (1) and [{Cu(acpa)}(2)(&mgr;-MoO(4))].4H(2)O (2), respectively. The crystal structures and the magnetic properties have been studied. Complexes 1 and 2 are isomorphous and the structures are made up of discrete dimers in which two copper(II) ions are bridged by the [MO(4)](2)(-) anion. The coordination geometry about the copper(II) ions is square planar with a N(2)O chelate group from acpa and an oxygen atom from [MO(4)](2)(-). Magnetic susceptibility measurements for 1 revealed that a ferromagnetic interaction between copper(II) ions is propagated through the [CrO(4)](2)(-) bridge and the coupling constant (2J) was evaluated to be 14.6(1) cm(-)(1) (H = -2JS(1).S(2)). In 2, two copper(II) ions bridged by [MoO(4)](2)(-) anion are antiferromagnetically coupled with the 2J value of -5.1(4) cm(-)(1). The ferromagnetic interaction in 1 is explained by means of the orbital topology of frontier orbitals. Crystal data: 1, monoclinic, space group P2(1)/m, a = 8.349(2) ?, b = 17.616(3) ?, c = 10.473 ?, beta = 107.40(2) degrees, Z= 2; 2, monoclinic, space group P2(1)/m, a = 8.486(2) ?, b = 18.043(3) ?, c = 9.753(2) ?, beta = 95.82(2) degrees, Z = 2.     

Synthesis, Characterization, and Single-Crystal EPR Studies of Three Dinuclear Copper(II) Complexes and One Mixed-Valence Tetranuclear Copper(I)-Copper(II) Cluster with an Asymmetric Imidazole-Containing Tripodal Ligand with Copper(II)-Copper(II) Distances between 3.35 and 3.63 Å

The synthesis and characterization of three dinuclear copper(II) complexes and one mixed-valence tetranuclear cluster with the asymmetric imidazole-containing ligand bis(1,1'-imidazole-2-yl)(4-imidazole-4(5)-yl)-2-azabutane (biib) are described. X-ray crystallographic parameters for the copper complexes are as follows. [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4): triclinic, space group P&onemacr;, a = 10.178(1) ?, b = 9.4881(9) ?, c = 11.037(1) ?, alpha = 95.130(10) degrees, beta = 112.20(1) degrees, gamma = 92.142(9) degrees, and Z = 1. [Cu(2)(biib)(2)(NO(3))(2)](NO(3))(2)(H(2)O)(4): monoclinic, space group &Pmacr;2(1)/n, a = 9.207(6) ?, b = 17.0516(6) ?, c = 12.6107(7) ?, beta = 109.82(1) degrees, and Z = 2. [Cu(2)(biib)(2)(CuBr(3))(2)]: monoclinic, space group P2(1)/c, a = 11.583(2) ?, b = 11.864(2) ?, c = 16.070(2) ?, beta = 112.459(12) degrees, and Z = 2. The two Cu(II) ions in all four complexes are coordinated in a square-pyramidal geometry by three imidazole nitrogens and one amine nitrogen donor in the equatorial plane, and each copper ion is weakly coordinated at the axial position by respectively a tetrafluoroborate, a perchlorate, a nitrate, or a tribromocuprate(I) anion. By comparison of the structural data of the four complexes a relationship has been established between the donor strength of the anion and some structural features, like the Cu(II)-Cu(II) distance, of the dinuclear Cu(II)-Cu(II) unit in the four complexes. Single-crystal EPR spectra of [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4) were recorded at room temperature at X-band frequencies. The triplet spectra have been fit with nonparallel g and D tensors, whose principle values are as follows: g(xx)() = 2.022(8), g(yy)() = 2.060(7), g(zz)() = 2.211(8), D(x)()(')(x)()(') = -0.0182(9) cm(-)(1), D(y)()(')(y)()(') = -0.081(6) cm(-)(1), D(z)()(')(z)()(') = 0.0264(7) cm(-)(1). The compounds were further characterized and studied by ligand field and by frozen-solution and polycrystalline powder EPR spectroscopy. EPR spectra recorded at 77 K of frozen solutions of the perchlorate complex show that upon dilution in methanol the dinuclear complex reacts to form a mononuclear species.     

Two-Dimensional (1)H NMR Studies on Octahedral Nickel(II) Complexes

The dinucleating ligand ethylene glycol-bis(beta-aminoethyl ether) N,N,N',N'-tetrakis[(2-(1-ethylbenzimidazoyl)] (EGTB-Et; 1) was used to synthesize the dinuclear Ni(II) tetraacetonitrile complex cation [Ni(2)(EGTB-Et)(CH(3)CN)(4)](2+) (2): triclinic space group P&onemacr; (a = 12.273(5) ?, b = 12.358(7) ?, c = 12.561(6) ?, alpha = 90.43(4) degrees, beta = 110.26(3) degrees, gamma = 99.21 (4) degrees, and Z = 1). The structure shows two identical octahedral Ni(II) centers each bound to two benzimidazole ring nitrogen atoms, one amine nitrogen atom, an ether oxygen atom, and two acetonitrile nitrogen atoms. The Ni(II) ions are tethered together by a diethyl ether linkage with a crystallographic center of inversion between the methylene carbons of this bridge. The Ni--Ni separation in 2 is 7.072 ?. The mononuclear Ni(II) complex cation [Ni(Bipy)(2)(OAc)](+) (3) (Bipy = bipyridine) was synthesized and crystallographically characterized: monoclinic space group P2(1)/c (a = 9.269(4) ?, b = 8.348(4) ?, c = 14.623(7) ?, and beta = 102.46(4) degrees, Z = 2). The Ni(II) ions in 3 adopts a distorted octahedral geometry and is bound to four bipyridine ring nitrogen atoms and two carboxylate oxygen atoms. The average Ni-N and Ni-O distances are 2.062 and 2.110 ?. The electronic absorption spectra of both 2 and 3 were recorded in acetonitrile solution and are consistent with octahedral coordination geometries about the Ni(II) ions with Racah parameters of 840 and 820 cm(-)(1), respectively. Both one- and two-dimensional (1)H NMR techniques were used to assign the observed hyperfine shifted (1)H NMR resonances of 2 and 3 in acetonitrile solution. Clear COSY cross signals are observed between the aromatic protons of both the benzimidazole and pyridine protons of 2 and 3, respectively. The use of 2D NMR methods to assign inequivalent aromatic protons rather than synthetic methods such as substitution or deuteration are discussed.     

Dinuclear Copper(II) Complexes Incorporating a New Septadentate Polyimidazole Ligand

The dinuclear copper(II) complexes [Cu(2)(tmihpn)(prz)](ClO(4))(2).2CH(3)CN (6) and [Cu(2)(tmihpn)(O(2)CCH(3))](ClO(4))(2).CH(3)CN (7) were prepared, where tmihpn is the deprotonated form of N,N,N',N'-tetrakis[(1-methylimidazol-2-yl)methyl]-1,3-diaminopropan-2-ol and prz is the pyrazolate anion. The crystal structures of 6 and 7 were determined and revealed that both complexes contain bridging alkoxide ligands as well as bridging pyrazolate and acetate ions, respectively. Crystal data: compound 6, triclinic, P&onemacr;, a = 18.089(2) ?, b = 22.948(3) ?, c = 9.597(2) ?, alpha = 93.37(2) degrees, beta = 94.49(2) degrees, gamma = 81.69(2) degrees, V = 3925.1 ?(3), Z = 4; compound 7, triclinic, P&onemacr;, a = 12.417(2) ?, b = 15.012(3) ?, c = 10.699(2) ?, alpha = 104.76(2) degrees, beta = 102.63(2) degrees, gamma = 99.44(2) degrees, V = 1830.1 ?(3), Z = 2. In compound 6, the coordination geometry around both copper centers resembles a distorted square pyramid, while the stereochemistry around the copper centers in 7 is best described as trigonal bipyramidal. Both complexes display well-resolved isotropically shifted (1)H NMR spectra. Selective substitution studies and integration data have been used to definitively assign several signals to specific ligand protons. Results from the solution (1)H NMR studies suggest that the basal and apical imidazole groups do not exchange rapidly on the NMR time scale and the solid state structures of the complexes are retained in solution. In addition, the magnetochemical characteristics of 6 and 7 were determined and provide evidence for "magnetic orbital switching". Antiferromagnetic coupling in 6 (J = -130 cm(-)(1)) is strong, while the copper centers in compound 7 are ferromagnetically coupled (J = +16.4 cm(-1)). Differences in the magnetic behavior of the two copper centers have been rationalized using the "ligand orbital complementary" concept. The ground state magnetic orbitals involved in spin coupling in 6 (d(x)()()2(-)(y)()()2) are different from those in 7 (d(z)()()2).     

Intermolecular Ferromagnetic and Antiferromagnetic Interactions in Halogen-Bridged Copper(I) Imino Nitroxides: Crystal Structures and Magnetic Properties of [Cu(I)(&mgr;-X)(imino nitroxide)](2) (X = I or Br)

Reaction of CuI or CuBr with some imino nitroxides in methanol gave the halogen bridged dinuclear Cu(I) complexes [Cu(&mgr;-I)(impy)](2) (1), [Cu(&mgr;-I)(immepy)](2) (2), [Cu(&mgr;-Br)(immepy)](2) (3), and [Cu(&mgr;-Br)(imph-NO(2))](2) (4), respectively (impy = 2-(2'-pyridyl)-4,4,5,5-tetramethyl-4,5-dihydro-1H-imidazolyl-1-oxyl, immepy = 2-(6'-methyl-2'-pyridyl)-4,4,5,5-tetramethyl-4,5-dihydro-1H-imidazolyl-1-oxyl, imph-NO(2) = 2-(4'-nitrophenyl)-4,4,5,5-tetramethyl-4,6-dihydro-1H-imidazolyl-1-oxyl). Crystal structures and magnetic properties have been studied. Complexes 1-4 have dimeric structures where two copper ions are doubly bridged by halide ions in a &mgr;(2) fashion. In 1-3, each copper ion is tetrahedral with a bidentate imino nitroxide and two halide ions, and the two copper ions are separated by 2.592(2), 2.6869(8), and 2.7357(6) ?, respectively. In 4, triangular coordination sites of the copper ions are completed with a nitrogen atom from the imino nitroxide and two bromide ions bridging the two copper ions with a separation of 3.074(2) ?. Ligand imino nitroxides in 1-4 form one-dimensional radical chains, and the chains are linked with halocuprate dimer units. Structural and magnetic susceptibility data support that radicals in 1 and 4 are ferromagnetically stacked, while radicals in 2 and 3 form an antiferromagnetic chain. The magnetic behaviors are discussed in connection with the stacking modes of the radicals and bridging conformations. Crystal data (Mo Kalpha, lambda = 0.71069 ?): 1, orthorhombic, space group P2(1)2(1)2(1), a = 17.807(2) ?, b = 8.595(2) ?, c = 19.336(6) ?, and Z = 4; 2, monoclinic, space group P2(1)/c, a = 9.941(2) ?, b = 18.482(2) ?, c = 8.337(2) ?, beta = 96.41(2) degrees, and Z = 2; 3, monoclinic, space group P2(1)/c, a = 9.964(6) ?, b = 18.167(4) ?, c = 8.009(7) ?, beta = 95.81(6) degrees, and Z = 2; 4, monoclinic, space group P2(1)/c, a = 11.991(7) ?, b = 17.998(8) ?, c = 7.215(6) ?, beta = 104.07(6) degrees, and Z = 2.     

Copper(II) Complexes of the Hexaaza Macrocyclic Ligand 3,6,9,16,19,22-Hexaaza-27,28-dioxatricyclo[22.2.1.1(11,14)]octacosa-1(26),11,13,24-tetraene and Their Interaction with Oxalate, Malonate, and Pyrophosphate Anions

The hexaaza macrocyclic ligand 3,6,9,16,19,22-hexaaza-27,28-dioxatricyclo[22.2.1.1(11,14)]octacosa-1(26),11,13,24-tetraene (BFBD), forms both mono- and dinuclear complexes, as well as several protonated and hydroxo chelates, with Cu(II) ions. These cationic species can bind inorganic and organic anions through coordination and hydrogen bonding. Stability constants of the mono- and dinuclear Cu(II) complexes of BFBD and their interaction with oxalate, malonate, and pyrophosphate anions have been measured potentiometrically. The nature of the bonding between the hosts and the guests is discussed. The crystal structures of two new dinuclear Cu(II) complexes, determined by X-ray crystallography, are also reported. [BFBDCu(2)(Cl)(3)]ClO(4).0.5H(2)O crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.267(2) ?, b = 12.155(6) ?, c = 18.461 0 ?, beta = 90.86(2) degrees, and Z = 4. Each Cu(II) ion is coordinated by three nitrogen atoms from the diethylenetriamine unit of the macrocyclic ligand and two chloride anions, forming a square pyramidal geometry. [BFBDCu(2)(Ox)](BF(4))(1.8)Cl(0.2) crystallizes in the triclinic system, space group P1, with a = 6.772(1) ?, b = 10.646(2) ?, c = 11.517(2) ?, alpha = 64.74(3) degrees, beta = 79.79(3) degrees, gamma = 81.94(3) degrees, and Z = 1. The environment of each copper is intermediate between square pyramidal and trigonal pyramidal. The oxalate anion bridges in a bis-bidentate fashion between two Cu(II) ions.     

Two New Antiferromagnetic Nickel(II) Complexes Bridged by Azido Ligands in the Cis Position. Effect of the Counteranion on the Crystal Structure and Magnetic Properties

Two new nickel(II) end-to-end azido-bridged compounds, cis-catena-[NiL(2)(&mgr;-N(3))](n)()(ClO(4))(n)().nH(2)O (1) and [Ni(2)L(4)(&mgr;-N(3))(2)](PF(6))(2) (2), were synthesized and characterized; L is 2-(aminoethyl)pyridine. The crystal structures of 1 and 2 were solved. Complex 1: monoclinic system, space group P2(1)/a, a = 8.637(2) ?, b = 18.9995(7) ?, c = 12.3093(7) ?, beta = 105.92(2) degrees, Z = 4. Complex 2: triclinic system, space group P&onemacr;, a = 9.139(7) ?, b = 10.124(3) ?, c = 12.024(2) ?, alpha = 70.407(14) degrees, beta = 84.19(2) degrees, gamma = 67.67(4) degrees, Z = 1. In the two complexes the nickel atom is situated in a similarly distorted octahedral environment. The two complexes are different; 1 is a one-dimensional helicoidal complex with the two L ligands and the two end-to-end azido bridges in a cis arrangement while complex 2 is a dinuclear system with two end-to-end azido bridges, indicating the extreme importance of the counteranion present (ClO(4)(-) for 1 and PF(6)(-) for 2). The magnetic properties of the two compounds were studied by susceptibility measurements vs temperature. The chi(M) vs T plot for 1 shows the shape for a weakly antiferromagnetically coupled nickel(II) one-dimensional complex without a maximum until 4 K. In contrast, for complex 2 the shape of the chi(M) vs T curve shows a maximum near 40 K, indicating medium antiferromagnetic coupling. From the spin Hamiltonian -J(ij)()S(i)()S(j)(), J values for 1 and 2 were less than -1 and -29.1 cm(-)(1), respectively. The magnetic behavior for 1 and 2 may be explained in terms of the overlap between magnetic orbitals, taking into account the torsion of the Ni(II) atoms and azido-bridging ligands in the two structures.     

A dinuclear copper(II) complex with adeninate bridge ligands and prominent DNA cleavage activity. Structural and spectroscopic characterization and magnetic properties

A new dinuclear copper(II) complex has been synthesized and structurally characterized: [Cu(mu-ade)(tolSO3)(phen)]2.2H2O (Hade = adenine, tolSO3- = toluenesulfonate anion). Its magnetic properties and electronic paramagnetic resonance (EPR) spectra have been studied in detail. The compound has two metal centers bridged by two adeninate NCN groups. The coordination geometry of the copper(II) ions in the dinuclear entity is distorted square pyramidal, with the four equatorial positions occupied by two phenanthroline N atoms and two N atoms from different adenine molecules. The axial position is occupied by one sulfonate O atom. Magnetic susceptibility data show antiferromagnetic behavior with an estimated exchange constant of -2J = 65 cm-1. The EPR spectrum has been obtained at both X- and Q-band frequencies; a study at different temperatures has been carried out at the latter. Above 20 K, the Q-band spectra are characteristic of S = 1 species with a small zero-field splitting parameter (D = 0.0970 cm-1). A detailed study of the DNA-complex interaction has been performed. The title complex efficiently cleaves the pUC18 plasmid in the presence of reducing agents. Both the kinetics and the mechanism of the cleavage reaction are examined and described herein.     

Magnetostructural Correlations in Bis(&mgr;(2)-phenoxide)-Bridged Macrocyclic Dinuclear Copper(II) Complexes. Influence of Electron-Withdrawing Substituents on Exchange Coupling

Macrocyclic dicopper(II) complexes derived from 2,6-di(R)formylphenols and various linking diamines are surveyed and their magnetic and structural properties assessed. For those systems with "flat" dinuclear centers and no electronic perturbations associated with electron-withdrawing ligands or ligand groups, the complexes exhibit a "straight-line" relationship between exchange integral and phenoxide bridge angle. Within the angle range 98.8-104.7 degrees, 11 complexes are included with -2J in the range 689-902 cm(-)(1). When electron-withdrawing species are present, either as ligands or as groups bound to the macrocycle itself, considerable suppression of the antiferromagnetic exchange component is observed. Single-crystal X-ray diffraction studies are reported for three complexes. [Cu(2)(L1)(H(2)O)(2)]F(2)(CH(3)OH)(2) (1) crystallized in the triclinic system, space group P&onemacr;, with a = 8.1878(5) ?, b = 9.0346(7) ?, c = 10.4048(7) ?, alpha = 103.672(6) degrees, beta = 101.163(5) degrees, gamma = 104.017(5) degrees, and Z = 1. [Cu(2)(L2)Cl(2)] [Cu(2)(L2) (H(2)O)(2)]Cl(ClO(4)).5.5H(2)O (2) crystallized in the monoclinic system, space group P2(1)/n, with a = 14.4305(5) ?, b = 24.3149(8) ?, c = 18.6584(8) ?, beta = 111.282(3) degrees, and Z = 4. [Cu(2)(L3)(H(2)O)(2)](BF(4))(2) (3) crystallized in the triclinic system, space group P&onemacr;, with a = 8.6127(4) ?, b = 8.6321(7) ?, c = 10.8430(10) ?, a = 74.390(10) degrees, beta = 86.050(10) degrees, gamma = 76.350(10) degrees, and Z = 2. Square pyramidal copper ion stereochemistries are observed in all cases, with axially coordinated halogens or water molecules. Strong antiferromagnetic exchange is observed for all complexes (-2J = 784(8) cm(-)(1), Cu-O-Cu 103.65(10) degrees (1); -2J = 801(11) cm(-)(1), Cu-O-Cu 102.4(3), 107.5(3), 102.9(3), 106.1(3) degrees (2); -2J = 689(3) cm(-)(1), Cu-O-Cu 98.8(4) degrees (3)). The presence of electron-withdrawing CN groups on the periphery of the macrocyclic ligand leads to substantially reduced antiferromagnetic exchange.     

Rational Design of a Novel Intercalation System. Layer-Gap Control of Crystalline Coordination Polymers, {[Cu(CA)(H(2)O)(m)()](G)}(n)() (m = 2, G = 2,5-Dimethylpyrazine and Phenazine; m = 1, G = 1,2,3,4,6,7,8,9-Octahydrophenazine)

New copper(II) intercalation compounds, {[Cu(CA)(H(2)O)(2)](G)}(n)() (H(2)CA = chloranilic acid; G = 2,5-dimethylpyrazine (dmpyz) (1a and 1b) and phenazine (phz) (2)) have been synthesized and characterized. 1acrystallizes in the triclinic space group P&onemacr;, with a = 8.028(2) ?, b = 10.269(1) ?, c = 4.780(2) ?, alpha = 93.85(3) degrees, beta = 101.01(2) degrees, gamma = 90.04(3) degrees, and Z = 1. 1b crystallizes in the triclinic space group P&onemacr;, with a = 8.010(1) ?, b = 10.117(1) ?, c = 5.162(1) ?, alpha = 94.40(1) degrees, beta = 97.49(1) degrees, gamma = 112.64(1) degrees, and Z = 1. 2crystallizes in the triclinic space group P&onemacr;, with a = 8.071(1) ?, b = 11.266(1) ?, c = 4.991(1) ?, alpha = 97.80(1) degrees, beta = 99.58(1) degrees, gamma = 83.02(1) degrees, and Z = 1. For all the compounds, the crystal structures consist of one dimensional [Cu(CA)(H(2)O)(2)](m)() chains and uncoordinated guest molecules (G). Each copper atom for 1a, 1b, and 2 displays a six-coordinate geometry with the two bis-chelating CA(2)(-) anions and water molecules, providing an infinite, nearly coplanar linear chains running along the a-direction. Theses chains are linked by hydrogen bonds between the coordinated water and the oxygen atoms of CA(2)(-) on the adjacent chain, forming extended layers, which spread out along the ac-plane. The guest molecules are intercalated in between the {[Cu(CA)(H(2)O)(2)](k)()}(l)() layers, just like pillars, which are supported with N.H(2)O hydrogen bonding. The guest molecules are stacked each other with an interplanar distance of ca. 3.2 ? along the c-axis perpendicular to the [Cu(CA)(H(2)O)(2)](m)() chain. The EHMO band calculations of intercalated dmpyz and phz columns show an appreciable band dispersion of phz pi (b(2g) and b(3g)) and dmpyz pi (b(g)), indicative of the importance of planar pi structure for the formation of the intercalated structure. The distances of O-H---N (guest molecules) fall within the range 2.74-2.80 ?, insensitive to the guest, whereas the interlayer distances increase in the order 9.25 ? (1b), 10.24 ? (1a), and 11.03 ? (2). The degree in lengthening the distance correlates well with the size of a molecule, indicative of the stability of the 2-D sheet structure and the flexibility of the sheet packing. The magnetic susceptibilities were measured from 2 to 300 K and analyzed by a one-dimensional Heisenberg-exchange model to yield J = -1.83 cm(-)(1), g = 2.18 (1a), J = -0.39 cm(-)(1), g = 2.14 (1b), and J = -1.84 cm(-)(1), g = 2.18 (2). The absolute value of J is smaller than that value for [Cu(CA)](n)(), which has a planar ribbon structure suggesting that the magnetic orbital d(x)()()2(-)(y)()()2 is not parallel to the chloranilate plane. For comparison with phz another type of copper(II) coordination compound, {[Cu(CA)(H(2)O)](ohphz)}(n)() (ohphz = 1,2,3,4,6,7,8,9-octahydrophenazine (7)) has also been obtained. 7 crystallizes in the orthorhombic space group Cmcm with a = 7.601(2) ?, b = 13.884(2) ?, c = 17.676(4) ?, and Z = 4. Nonplanar ohphz molecules are in between [Cu(CA)(H(2)O)(2)](m)() chains with the N.H(2)O hydrogen bonding in a fashion parallel to the chain direction. The copper atom shows a five-coordinate square-pyramidal configuration with two CA and one water molecule, thus affording no hydrogen bonding links between chains, dissimilar to 1a, 1b, and 2. The magnetic susceptibilities yield J = -10.93 cm(-)(1) and g = 2.00, comparable to that of the four-coordinate [Cu(CA)](n)(). On this basis both hydrogen bonding and stack capability of a guest molecule is responsible for building the unique intercalated structure such as is seen in 1a, 1b, and 2.     

Ni(2)(ppepO)(C(6)H(5)COO)(2)(CH(3)COOH)]ClO(4).C(4)H(10)O: Synthesis and Characterization of an Asymmetric Dinuclear Nickel(II) Complex Showing Unusual Coordination Behavior with Relevance to the Active Site of Urease

The synthesis of the novel asymmetric ligand 1-[bis(2-pyridylmethyl)amino]-3-[2-(2-pyridyl)ethoxy]-2-hydroxypropane (ppepOH) is reported. The ligand is suitable to form asymmetric dinuclear complexes with various transition metal ions. As an example, the synthesis and X-ray structure analysis of the dinickel(II) complex [Ni(2)(ppepO)(C(6)H(5)COO)(2)(CH(3)COOH)]ClO(4).C(4)H(10)O are described. The complex crystallizes in the monoclinic space group P2(1)/n with the following unit cell parameters: a = 13.704(10) ?, b = 14.849(10) ?, c = 22.697(14) ?, beta = 96.80(5) degrees, Z = 4. The nickel(II) ions are bridged by the alkoxy donor of the ligand and two benzoate anions. The hexadentate ligand leaves a free coordination site at one of the nickel(II) ions, which is occupied by a monodentate coordinated acetic acid molecule. The coordination of the neutral acetic acid molecule is selectively stabilized by a strong intramolecular hydrogen bond of the acidic proton to the &mgr;-alkoxo bridge of the dinuclear complex. The asymmetric complex was prepared in order to mimic the substrate uptake in the dinuclear active site of ureases. The magnetic and spectroscopic properties of the complex were determined and related to those of the urease enzymes.     

Synthesis of a Heteroditopic Cryptand Capable of Imposing a Distorted Coordination Geometry onto Cu(II): Crystal Structures of the Cryptand (L), [Cu(L)(CN)](picrate), and [Cu(L)(NCS)](picrate) and Spectroscopic Studies of the Cu(II) Complexes

The synthesis of a new macrobicyclic cryptand (L) with heteroditopic receptor sites has been achieved in good yields by the [1 + 1] Schiff base condensation of tris(2-aminoethyl)amine (tren) with the tripodal trialdehyde, tris{[2-(3-(oxomethyl)phenyl)oxy]ethyl}amine at 5 degrees C temperature. The crystal structure of L (P2(1)/c, a = 10.756 (5) ?, b = 27.407(9) ?, c = 12.000(2) ?, beta = 116.22(3) degrees, Z = 4, R = 0.060, R(w) = 0.058) shows a pseudo-3-fold symmetry axis passing through the two bridgehead nitrogens. This symmetry is maintained in chloroform solution also, as indicated from its (1)H-NMR spectral data. The cryptand readily forms inclusion complexes with the Cu(II) ion at the tren end of the cavity. The tetracoordinated Cu(II) cryptate (1) thus formed with Cu(picrate)(2) exhibits a very small A(II) value (60 x 10(-)(4) cm(-)(1)) in its EPR spectrum and low-energy ligand field bands in its electronic spectrum in MeCN at room temperature. The bound Cu(II) ion readily accepts the anions CN(-), SCN(-), or N(3)(-), forming distorted trigonal bipyramidal complexes (2-4). The crystal structure of [Cu(L)(CN)](picrate) (2) (P2(1)/C, a = 13.099(1) ?, b = 11.847(8) ?, c = 25.844(7) ?, beta = 91.22(1) degrees, Z = 4, R = 0.056, R(w) = 0.054) has been determined. The equatorial coordination is provided by the three secondary amino N atoms of the tren unit in L, while the two axial positions are occupied by the bridgehead N of the tren unit and the C atom of the cyanide group. One of the equatorial Cu-N bond distances is 2.339(6) ?, which is longer than normal values. The crystal structure of [Cu(L)(NCS)](picrate) (3) (C2/c, a = 47.889(10) ?, b = 10.467(5) ?, c = 16.922(2) ?, beta = 93.90(2) degrees, Z = 8, R = 0.054, R(w) = 0.055) shows the coordination geometry around the Cu(II) ion to be very similar to that in the case of 2. The electronic spectral and EPR spectral data obtained on 2-4 are characteristic of trigonal bipyramidal Cu(II) complexes. The three meta-substituted benzene rings present in L makes the donor atom somewhat rigid in nature which enforces a distorted geometry around the Cu(II) ion.     

Helical-chain copper(II) complexes and a cyclic tetranuclear copper(II) complex with single syn-anti carboxylate bridges and ferromagnetic exchange interactions

Tridentate Schiff-base carboxylate-containing ligands, derived from the condensation of 2-imidazolecarboxaldehyde with the amino acids beta-alanine (H2L1) and 2-aminobenzoic acid (H2L5) and the condensation of 2-pyridinecarboxaldehyde with beta-alanine (HL2), D,L-3-aminobutyric acid (HL3), and 4-aminobutyric acid (HL4), react with copper(II) perchlorate to give rise to the helical-chain complexes [[Cu(mu-HL1)(H2O)](ClO4)]n (1), [[Cu(mu-L2)(H2O)](ClO4).2H2O]n (2), and [[Cu(mu-L3)(H2O)](ClO4).2H2O]n (3), the tetranuclear complex [[Cu(mu-L4)(H2O)](ClO4)]4 (4), and the mononuclear complex [Cu(HL5)(H2O)](ClO4).1/2H2O (5). The reaction of copper(II) chloride with H2L1 leads not to a syn-anti carboxylate-bridged compound but to the chloride-bridged dinuclear complex [Cu(HL1)(mu-Cl)]2 (6). The structures of these complexes have been solved by X-ray crystallography. In complexes 1-4, roughly square-pyramidal copper(II) ions are sequentially bridged by syn-anti carboxylate groups. Copper(II) ions exhibit CuN2O3 coordination environments with the three donor atoms of the ligand and one oxygen atom belonging to the carboxylate group of an adjacent molecule occupying the basal positions and an oxygen atom (from a water molecule in the case of compounds 1-3 and from a perchlorate anion in 4) coordinated in the apical position. Therefore, carboxylate groups are mutually cis oriented and each syn-anti carboxylate group bridges two copper(II) ions in basal-basal positions with Cu...Cu distances ranging from 4.541 A for 4 to 5.186 A for 2. In complex 5, the water molecule occupies an equatorial position in the distorted octahedral environment of the copper(II) ion and the Cu-O carboxylate distances in axial positions are very large (>2.78 A). Therefore, this complex can be considered as mononuclear. Complex 6 exhibits a dinuclear parallel planar structure with Ci symmetry. Copper(II) ions display a square-pyramidal coordination geometry (tau = 0.06) for the N2OCl2 donor set, where the basal coordination sites are occupied by one of the bridging chlorine atoms and the three donor atoms of the tridentate ligand and the apical site is occupied by the remaining bridging chlorine atom. Magnetic susceptibility measurements indicate that complexes 1-4 exhibit weak ferromagnetic interactions whereas a weak antiferromagnetic coupling has been established for 6. The magnetic behavior can be satisfactorily explained on the basis of the structural data for these and related complexes.     

A novel bis tridentate bipyridine carboxamide ligand and its complexation to copper(II): synthesis, structure, and magnetism

A new bis tridentate ligand 2,2'-bipyridine-3,3'-[2-pyridinecarboxamide] H(2)L(1) which can bind transition metal ions has been synthesized via the condensation of 3,3'-diamino-2,2'-bipyridine together with 2-pyridine carbonyl chloride. Two copper(II) coordination compounds have been prepared and characterized: [Cu(2)(L(1))(hfac)(2)].3CH(3)CN.H(2)O (1) and [Cu(2)(L(1))Cl(2)].CH(3)CN (2). The single-crystal X-ray structures reveal that complex 1 crystallizes in the triclinic space group P1, with the unit cell parameters a = 12.7185(6) A, b = 17.3792(9) A, c = 19.4696(8) A, alpha = 110.827(2) degrees, beta = 99.890(3) degrees, gamma = 97.966(3) degrees, V = 3868.3(3) A3, Z = 4, R = 0.0321 and R(w) = 0.0826. Complex 2 crystallizes in the monoclinic space group P2(1)/n with the unit cell parameters a = 12.8622(12) A, b = 9.6100(10) A, c = 19.897(2) A, beta = 102.027(3) degrees, V = 2405.3(4) A(3), Z = 4, R = 0.0409 and R(w) = 0.1005. In both complexes the ligand is in the dianionic form and coordinates the divalent Cu(II) ions via one amido and two pyridine nitrogen donor atoms. In 1, the coordination geometry around both Cu(II) ions is best described as distorted trigonal bipyramidal where the remaining two coordination sites are satisfied by hexafluoroacetylacetonate counterions. In 2 both Cu(II )ions adopt a (4 + 1) distorted square pyramidal geometry. One copper forms a longer apical bond to an adjacent carbonyl oxygen atom, whereas the second copper is chelated to a neighboring Cu-Cl chloride ion to afford a mu-Cl-bridged dimerized [Cu(2)(L(1))Cl(2)](2) complex. The magnetic susceptibility data for 1 (2 -270 K), reveal the occurrence of weak antiferromagnetic interactions between the Cu(II) ions. In contrast, variable-temperature magnetic susceptibility measurements for 2 reveal more complex magnetic properties, with the presence of a weak antiferromagnetic exchange (J = -10.1 K) between the copper ions in each dinuclear copper complex and a stronger ferromagnetic exchange interaction (J = 32.9 K) between the Cu(II) ions of the Cu(mu-Cl)(2)Cu dimeric bridging units.     

Copper and Bismuth Complexes Containing Dipyridyl gem-Diolato Ligands: Bi(III)(2)[(2-Py)(2)CO(OH)](2)(O(2)CCF(3))(4)(THF)(2), Cu(II)[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), and Cu(II)(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), a Ferromagnetically Coupled Tetranuclear Copper(II) Chain

The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1.     

Synthesis, crystal structures and magnetic properties of tricyanomethanide-containing copper(II) complexes

The preparation, crystal structures and magnetic properties of the copper(II) complexes of formula [Cu(pyim)(tcm)(2)](n) (1), [Cu(bpy)(tcm)(2)](n) (2), [Cu(4)(bpz)(4)(tcm)(8)] (3), {[Cu(terpy)(tcm)].tcm}(n) (4) and {[Cu(2)(tppz)(tcm)(4)].3/2H(2)O}(n) (5) [pyim = 2-(2-pyridyl)imidazole, tcm = tricyanomethanide, bpy = 2,2'-bipyridine, bpz = 2,2'-bipyrazine, terpy = 2,2':6',2'-terpyridine and tppz = 2,3,5,6-tetrakis(2-pyridyl)pyrazine] are reported. Complexes, 1, 2 and 4 are uniform copper(II) chains with single- (1 and 4) and double-(2) micro-1,5-tcm bridges with values of the intrachain copper-copper separation of 7.489(1) (1), 7.520(1) and 7.758(1) (2) and 7.469(1) A (4). Each copper atom in 1, 2 and 4 is five-coordinate with bidentate pyim (1)/bpy (2) and tridentate terpy (4) ligands and nitrile-nitrogen atoms from bridging (1,2 and 4) and terminal (1) tcm groups building a distorted square pyramidal surrounding. The structure of 3 is made up of neutral centrosymmetric rectangles of (2,2'-bipyrazine)copper(II) units at the corners, the edges being built by single- and double-micro-1,5-tcm bridges with copper-copper separations of 7.969(1) and 7.270(1) A, respectively. Five- and six-coordinated copper atoms with distorted square pyramidal and elongated octahedral environments occur in . Compound 5 is a neutral copper(II) chain with regular alternating bis-tridentate tppz and double micro-1,5-tcm bridges, the intrachain copper-copper distances being 6.549(7) and 7.668(1) A, respectively. The two crystallographically independent copper atoms in 5 have an elongated octahedral geometry with three tppz nitrogen atoms and a nitrile-nitrogen atom from a bridging tcm group in the equatorial positions, and two nitrile nitrogen atoms from a terminal and a bridging tcm ligand occupying the axial sites. The investigation of the magnetic properies of 1-5 in the temperature range 1.9-295 K has shown the occurrence of weak ferro- [J = +0.11(1) cm(-1) (2)] and antiferromagnetic interactions [J = -0.093(1) (1), -0.083(1) (4), -0.04(1) and 1.21(1) cm(-1) (3)] across the micro-1,5-tcm bridges and intermediate antiferromagnetic coupling [-J = 37.4(1) cm(-1) (5)] through bis-tridentate tppz. The values of the magnetic interactions are analyzed through simple orbital symmetry considerations and compared with those previously reported for related systems.     

Dinuclear Nickel(II) Complexes as Models for the Active Site of Urease

Dinuclear nickel(II) complexes of the ligands 2,6-bis[bis((2-benzimidazolylmethyl)amino)methyl]-p-cresol (bbapOH), N,N,N',N'-tetrakis(2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane (tbpOH), N-methyl-N,N',N'-tris(2-benzimidazolylmethyl)-2-hydroxy-1,3-diaminopropane (m-tbpOH) and 1-[N,N-bis(2-benzimidazolylmethyl)amino]-3-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethoxy]-2-hydroxypropane (bpepOH) were prepared in order to model the active site of urease. The novel asymmetric structures of the dinuclear complexes were characterized by X-ray structure analysis. The complex [Ni(2)(bbapO)(ClO(4))(H(2)O)(MeOH)](ClO(4))(2).Et(2)O, 1, crystallizes in the monoclinic space group P2(1)/c, with a = 10.258(2) ?, b = 19.876(3) ?, c = 25.592(4) ?, and beta = 97.12(2) degrees. The nickel ions in 1 are bridged by the phenoxy donor of the ligand and a perchlorate anion. The complexes [Ni(2)(tbpO)(MeCOO)(H(2)O)](ClO(4))(2).H(2)O.Et(2)O, 2, [Ni(2)(m-tbpO)(PhCOO)(EtOH)(2)](ClO(4))(2).EtOH, 3, and [Ni(2)(bpepO)(MeCOO)(H(2)O)(2)](ClO(4))(2).H(2)O.Et(2)O.2EtOH, 4, also crystallize in the monoclinic crystal system with the following unit cell parameters: 2, C2/c, a = 35.360(13) ?, b = 10.958(3) ?, c = 24.821(10) ?, beta = 103.55(3) degrees; 3, Cc, a = 14.663(5) ?, b = 32.630(13) ?, c = 9.839(3) ?, beta = 92.49(2) degrees; 4, C2/c, a = 27.689(13) ?, b = 12.187(5) ?, c = 31.513(14) ?, beta = 115.01(3) degrees. The dinuclear centers of all these complexes are bridged by the alkoxy donor of the ligand and a carboxylate function. Compounds 2 and 3 have one of the nickel ions in a five-coordinated, trigonal bipyramidal coordination environment and thus show a high structural similarity to the dinuclear active site of urease from Klebsiella aerogenes. Furthermore, their magnetic and spectroscopic properties were determined and related to those of the urease enzymes. Activity toward hydrolysis of test substrates (4-nitrophenyl)urea, 4-nitroacetanilide, 4-nitrophenyl phosphate or bis(4-nitrophenyl) phosphate by the dinuclear complexes were examined by UV spectroscopic measurements.     

Ligand effects on the structures and magnetic properties of tricyanomethanide-containing copper(II) complexes

The preparation, crystal structure and magnetic properties of four heteroleptic copper(II) complexes with the tricyanomethanide (tcm(-)) and the heterocyclic nitrogen donors 3,6-bis(2-pyridyl)pyridazine (dppn), 2,5-bis(2-pyridyl)pyrazine (2,5-dpp), 2,3-bis(2-pyridyl)pyrazine (2,3-dpp) and 2,3-bis(2-pyridyl)quinoxaline (2,3-dpq) are reported, {[Cu(2)(dppn)(OH)(tcm)(2)] x tcm}(n) (1), {[Cu(2,5-dpp)(tcm)] x tcm}(n) (2), {[Cu(2)(2,3-dpp)(2)(tcm)(3)(H(2)O)(0.5)] x tcm x 0.5H(2)O}(n) (3) and [Cu(2,3-dpq)(tcm)(2)](n) (4). 1 has a ladder-like structure with single mu-1,5-tcm ligands forming the sides and a bis-bidentate dppn and a single mu-hydroxo providing the rung. Each copper atom in 1 exhibits a distorted square pyramidal CuN(4)O surrounding: the basal plane is built by the hydroxo-oxygen, a nitrile-nitrogen atom from a tcm group and one pyrazine and a pyridyl nitrogen atoms from the dppn whereas the apical position is filled by a nitrile-nitrogen atom from a symmetry-related tcm ligand. The structures of 2-4 consists of zig-zag (2 and 3)/linear (4) chains of copper(II) ions which are bridged by either bis-bidentate 2,5-dpp (2) and 2,3-dpp (3) molecules or single mu-1,5-tcm (4) groups. The copper atoms in 2 and 4 are five coordinated with distorted trigonal bipyramidal (2) and square pyramidal (4) CuN(5) surroundings. The axial positions in 2 are occupied by two pyridyl-nitrogen atoms from two 2,5-dpp ligands whereas the trigonal plane is built by a nitrile-nitrogen from a terminally bound tcm group and two pyrazine nitrogen atoms from two 2,5-dpp molecules. The basal plane in 4 is defined by a pyridyl and a pyrazine nitrogen atoms from the bidentate 2,3-dpq ligand and two nitrile nitrogen atoms from two tcm groups (one terminal and the other bridging) whereas the apical position is filled by a nitrile nitrogen from another tcm ligand. The crystallographically independent copper atoms in 3 [Cu(1) and Cu(2)] exhibit elongated octahedral geometries being defined by four nitrogen atoms from two 2,3-dpp groups [Cu(1) and Cu(2)] either two terminally bound tcm ligands [Cu(1)] or a water molecule and a monodentate tcm ligand [Cu(2)] in cis positions. Magnetic susceptibility measurements for 1-4 in the temperature range 1.9-295 K reveal the occurrence of strong [J ca.-1000 cm(-1) (1); H = -JS(A) x S(B)] and weak [J = -0.13 (2), -0.67 (3) and -0.18 cm(-1) (4); H = -J Sigma(I)S(i) x S(i+1)] antiferromagnetic interactions in agreement with the different nature of the exchange pathways involved, diazine and single mu-hydroxo (1) and the extended 2,5-dpp (2), 2,3-dpp (3) and single mu-1,5-tcm (4) bridges with copper-copper separations of 3.363(8) (1), 7.111(1) (2), 6.823(1) and 7.056(1) (3) and 7.446(1) A (4).     

Model for the Reduced Schiff Base Intermediate between Amino Acids and Pyridoxal: Copper(II) Complexes of N-(2-Hydroxybenzyl)amino Acids with Nonpolar Side Chains and the Crystal Structures of [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(phen)].H(2)O and [Cu(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)

Copper(II) complexes with reduced Schiff base ligands of amino acids possessing nonpolar side chains with salicylaldehyde have been synthesized. Ternary complexes with imidazole, 1,10-phenanthroline, and pyridine have been prepared and characterized for N-(2-hydroxybenzyl)-D,L-alanine. The crystal structures of [(N-(2-hydroxybenzyl)-D,L-alanine)(1,10-phenanthroline)Cu(II)] monohydrate ([Cu(SAla)phen].H(2)O) and [(N-(2-hydroxybenzyl)-D,L-alanine)(imidazole)Cu(II)] ([Cu(SAla)Him]), have been determined. [Cu(SAla)phen].H(2)O crystallized in space group P&onemacr;, with a = 8.718(2) ?, b = 10.886(3) ?, c = 11.693(2) ?, alpha = 71.32(2) degrees, beta = 85.27(2) degrees, gamma = 70.21(2) degrees, and Z = 2. The copper atom is five coordinate, with SAla acting as a tridentate ONO chelator through the carboxylato and phenolato oxygens and the amine nitrogen. The remaining donors are provided by the phen nitrogens. [Cu(SAla)Him] crystallized in space group P2(1)/n, with a = 10.353(1) ?, b = 6.714(1) ?, c = 18.769(2) ?, beta = 91.71(1) degrees, and Z = 4. The copper atom is four coordinate, with SAla acting as a tridentate ONO chelator with the neutral imidazole moiety coordinated through nitrogen. In both complexes the ligand has two chiral centers due to the coordination of the N. Molecular mechanics calculations show that unfavorable steric interactions would occur in the nonobserved R,R and S,S diastereomers. Compounds prepared have been characterized by a range of physicochemical techniques. The complexes may serve as stable models for the intermediates in enzymatic amino acid transformations.     

Synthesis and Crystal Structure of a Dinuclear Cu(II) Complex [Cu(C12H17N2O)(NCS)]2 with Tridentate Schiff Base Ligand N(Salicylidene)-3-dimethylaminopropylamine

1 INTRODUCTION Metal complexes with multidentate Schiff baseligands have been extensively studied because suchligands can bind with one, two or more metal centersinvolving various modes and allow successful synt-hesis of homo and/or heteronuclear metal complexeswith interesting stereochemistry. Researches into thecopper(II) complexes have been stimulated by,amongst other things, biological modeling applica-tions, catalysis, design of molecular ferromagnets andmaterial chemistry[1～4]. I…